/*!
 * matter-js 0.18.0 by @liabru
 * http://brm.io/matter-js/
 * License MIT
 * 
 * The MIT License (MIT)
 * 
 * Copyright (c) Liam Brummitt and contributors.
 * 
 * Permission is hereby granted, free of charge, to any person obtaining a copy
 * of this software and associated documentation files (the "Software"), to deal
 * in the Software without restriction, including without limitation the rights
 * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
 * copies of the Software, and to permit persons to whom the Software is
 * furnished to do so, subject to the following conditions:
 * 
 * The above copyright notice and this permission notice shall be included in
 * all copies or substantial portions of the Software.
 * 
 * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
 * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
 * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
 * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
 * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
 * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
 * THE SOFTWARE.
 */
(function webpackUniversalModuleDefinition(root, factory) {
	if(typeof exports === 'object' && typeof module === 'object')
		module.exports = factory();
	else if(typeof define === 'function' && define.amd)
		define("Matter", [], factory);
	else if(typeof exports === 'object')
		exports["Matter"] = factory();
	else
		root["Matter"] = factory();
})(this, function() {
return /******/ (function(modules) { // webpackBootstrap
/******/ 	// The module cache
/******/ 	var installedModules = {};
/******/
/******/ 	// The require function
/******/ 	function __webpack_require__(moduleId) {
/******/
/******/ 		// Check if module is in cache
/******/ 		if(installedModules[moduleId]) {
/******/ 			return installedModules[moduleId].exports;
/******/ 		}
/******/ 		// Create a new module (and put it into the cache)
/******/ 		var module = installedModules[moduleId] = {
/******/ 			i: moduleId,
/******/ 			l: false,
/******/ 			exports: {}
/******/ 		};
/******/
/******/ 		// Execute the module function
/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/
/******/ 		// Flag the module as loaded
/******/ 		module.l = true;
/******/
/******/ 		// Return the exports of the module
/******/ 		return module.exports;
/******/ 	}
/******/
/******/
/******/ 	// expose the modules object (__webpack_modules__)
/******/ 	__webpack_require__.m = modules;
/******/
/******/ 	// expose the module cache
/******/ 	__webpack_require__.c = installedModules;
/******/
/******/ 	// define getter function for harmony exports
/******/ 	__webpack_require__.d = function(exports, name, getter) {
/******/ 		if(!__webpack_require__.o(exports, name)) {
/******/ 			Object.defineProperty(exports, name, { enumerable: true, get: getter });
/******/ 		}
/******/ 	};
/******/
/******/ 	// define __esModule on exports
/******/ 	__webpack_require__.r = function(exports) {
/******/ 		if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
/******/ 			Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
/******/ 		}
/******/ 		Object.defineProperty(exports, '__esModule', { value: true });
/******/ 	};
/******/
/******/ 	// create a fake namespace object
/******/ 	// mode & 1: value is a module id, require it
/******/ 	// mode & 2: merge all properties of value into the ns
/******/ 	// mode & 4: return value when already ns object
/******/ 	// mode & 8|1: behave like require
/******/ 	__webpack_require__.t = function(value, mode) {
/******/ 		if(mode & 1) value = __webpack_require__(value);
/******/ 		if(mode & 8) return value;
/******/ 		if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;
/******/ 		var ns = Object.create(null);
/******/ 		__webpack_require__.r(ns);
/******/ 		Object.defineProperty(ns, 'default', { enumerable: true, value: value });
/******/ 		if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));
/******/ 		return ns;
/******/ 	};
/******/
/******/ 	// getDefaultExport function for compatibility with non-harmony modules
/******/ 	__webpack_require__.n = function(module) {
/******/ 		var getter = module && module.__esModule ?
/******/ 			function getDefault() { return module['default']; } :
/******/ 			function getModuleExports() { return module; };
/******/ 		__webpack_require__.d(getter, 'a', getter);
/******/ 		return getter;
/******/ 	};
/******/
/******/ 	// Object.prototype.hasOwnProperty.call
/******/ 	__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
/******/
/******/ 	// __webpack_public_path__
/******/ 	__webpack_require__.p = "";
/******/
/******/
/******/ 	// Load entry module and return exports
/******/ 	return __webpack_require__(__webpack_require__.s = 21);
/******/ })
/************************************************************************/
/******/ ([
/* 0 */
/***/ (function(module, exports) {

/**
* The `Matter.Common` module contains utility functions that are common to all modules.
*
* @class Common
*/

var Common = {};

module.exports = Common;

(function() {

    Common._nextId = 0;
    Common._seed = 0;
    Common._nowStartTime = +(new Date());
    Common._warnedOnce = {};
    Common._decomp = null;
    
    /**
     * Extends the object in the first argument using the object in the second argument.
     * @method extend
     * @param {} obj
     * @param {boolean} deep
     * @return {} obj extended
     */
    Common.extend = function(obj, deep) {
        var argsStart,
            args,
            deepClone;

        if (typeof deep === 'boolean') {
            argsStart = 2;
            deepClone = deep;
        } else {
            argsStart = 1;
            deepClone = true;
        }

        for (var i = argsStart; i < arguments.length; i++) {
            var source = arguments[i];

            if (source) {
                for (var prop in source) {
                    if (deepClone && source[prop] && source[prop].constructor === Object) {
                        if (!obj[prop] || obj[prop].constructor === Object) {
                            obj[prop] = obj[prop] || {};
                            Common.extend(obj[prop], deepClone, source[prop]);
                        } else {
                            obj[prop] = source[prop];
                        }
                    } else {
                        obj[prop] = source[prop];
                    }
                }
            }
        }
        
        return obj;
    };

    /**
     * Creates a new clone of the object, if deep is true references will also be cloned.
     * @method clone
     * @param {} obj
     * @param {bool} deep
     * @return {} obj cloned
     */
    Common.clone = function(obj, deep) {
        return Common.extend({}, deep, obj);
    };

    /**
     * Returns the list of keys for the given object.
     * @method keys
     * @param {} obj
     * @return {string[]} keys
     */
    Common.keys = function(obj) {
        if (Object.keys)
            return Object.keys(obj);

        // avoid hasOwnProperty for performance
        var keys = [];
        for (var key in obj)
            keys.push(key);
        return keys;
    };

    /**
     * Returns the list of values for the given object.
     * @method values
     * @param {} obj
     * @return {array} Array of the objects property values
     */
    Common.values = function(obj) {
        var values = [];
        
        if (Object.keys) {
            var keys = Object.keys(obj);
            for (var i = 0; i < keys.length; i++) {
                values.push(obj[keys[i]]);
            }
            return values;
        }
        
        // avoid hasOwnProperty for performance
        for (var key in obj)
            values.push(obj[key]);
        return values;
    };

    /**
     * Gets a value from `base` relative to the `path` string.
     * @method get
     * @param {} obj The base object
     * @param {string} path The path relative to `base`, e.g. 'Foo.Bar.baz'
     * @param {number} [begin] Path slice begin
     * @param {number} [end] Path slice end
     * @return {} The object at the given path
     */
    Common.get = function(obj, path, begin, end) {
        path = path.split('.').slice(begin, end);

        for (var i = 0; i < path.length; i += 1) {
            obj = obj[path[i]];
        }

        return obj;
    };

    /**
     * Sets a value on `base` relative to the given `path` string.
     * @method set
     * @param {} obj The base object
     * @param {string} path The path relative to `base`, e.g. 'Foo.Bar.baz'
     * @param {} val The value to set
     * @param {number} [begin] Path slice begin
     * @param {number} [end] Path slice end
     * @return {} Pass through `val` for chaining
     */
    Common.set = function(obj, path, val, begin, end) {
        var parts = path.split('.').slice(begin, end);
        Common.get(obj, path, 0, -1)[parts[parts.length - 1]] = val;
        return val;
    };

    /**
     * Shuffles the given array in-place.
     * The function uses a seeded random generator.
     * @method shuffle
     * @param {array} array
     * @return {array} array shuffled randomly
     */
    Common.shuffle = function(array) {
        for (var i = array.length - 1; i > 0; i--) {
            var j = Math.floor(Common.random() * (i + 1));
            var temp = array[i];
            array[i] = array[j];
            array[j] = temp;
        }
        return array;
    };

    /**
     * Randomly chooses a value from a list with equal probability.
     * The function uses a seeded random generator.
     * @method choose
     * @param {array} choices
     * @return {object} A random choice object from the array
     */
    Common.choose = function(choices) {
        return choices[Math.floor(Common.random() * choices.length)];
    };

    /**
     * Returns true if the object is a HTMLElement, otherwise false.
     * @method isElement
     * @param {object} obj
     * @return {boolean} True if the object is a HTMLElement, otherwise false
     */
    Common.isElement = function(obj) {
        if (typeof HTMLElement !== 'undefined') {
            return obj instanceof HTMLElement;
        }

        return !!(obj && obj.nodeType && obj.nodeName);
    };

    /**
     * Returns true if the object is an array.
     * @method isArray
     * @param {object} obj
     * @return {boolean} True if the object is an array, otherwise false
     */
    Common.isArray = function(obj) {
        return Object.prototype.toString.call(obj) === '[object Array]';
    };

    /**
     * Returns true if the object is a function.
     * @method isFunction
     * @param {object} obj
     * @return {boolean} True if the object is a function, otherwise false
     */
    Common.isFunction = function(obj) {
        return typeof obj === "function";
    };

    /**
     * Returns true if the object is a plain object.
     * @method isPlainObject
     * @param {object} obj
     * @return {boolean} True if the object is a plain object, otherwise false
     */
    Common.isPlainObject = function(obj) {
        return typeof obj === 'object' && obj.constructor === Object;
    };

    /**
     * Returns true if the object is a string.
     * @method isString
     * @param {object} obj
     * @return {boolean} True if the object is a string, otherwise false
     */
    Common.isString = function(obj) {
        return toString.call(obj) === '[object String]';
    };
    
    /**
     * Returns the given value clamped between a minimum and maximum value.
     * @method clamp
     * @param {number} value
     * @param {number} min
     * @param {number} max
     * @return {number} The value clamped between min and max inclusive
     */
    Common.clamp = function(value, min, max) {
        if (value < min)
            return min;
        if (value > max)
            return max;
        return value;
    };
    
    /**
     * Returns the sign of the given value.
     * @method sign
     * @param {number} value
     * @return {number} -1 if negative, +1 if 0 or positive
     */
    Common.sign = function(value) {
        return value < 0 ? -1 : 1;
    };
    
    /**
     * Returns the current timestamp since the time origin (e.g. from page load).
     * The result is in milliseconds and will use high-resolution timing if available.
     * @method now
     * @return {number} the current timestamp in milliseconds
     */
    Common.now = function() {
        if (typeof window !== 'undefined' && window.performance) {
            if (window.performance.now) {
                return window.performance.now();
            } else if (window.performance.webkitNow) {
                return window.performance.webkitNow();
            }
        }

        if (Date.now) {
            return Date.now();
        }

        return (new Date()) - Common._nowStartTime;
    };
    
    /**
     * Returns a random value between a minimum and a maximum value inclusive.
     * The function uses a seeded random generator.
     * @method random
     * @param {number} min
     * @param {number} max
     * @return {number} A random number between min and max inclusive
     */
    Common.random = function(min, max) {
        min = (typeof min !== "undefined") ? min : 0;
        max = (typeof max !== "undefined") ? max : 1;
        return min + _seededRandom() * (max - min);
    };

    var _seededRandom = function() {
        // https://en.wikipedia.org/wiki/Linear_congruential_generator
        Common._seed = (Common._seed * 9301 + 49297) % 233280;
        return Common._seed / 233280;
    };

    /**
     * Converts a CSS hex colour string into an integer.
     * @method colorToNumber
     * @param {string} colorString
     * @return {number} An integer representing the CSS hex string
     */
    Common.colorToNumber = function(colorString) {
        colorString = colorString.replace('#','');

        if (colorString.length == 3) {
            colorString = colorString.charAt(0) + colorString.charAt(0)
                        + colorString.charAt(1) + colorString.charAt(1)
                        + colorString.charAt(2) + colorString.charAt(2);
        }

        return parseInt(colorString, 16);
    };

    /**
     * The console logging level to use, where each level includes all levels above and excludes the levels below.
     * The default level is 'debug' which shows all console messages.  
     *
     * Possible level values are:
     * - 0 = None
     * - 1 = Debug
     * - 2 = Info
     * - 3 = Warn
     * - 4 = Error
     * @property Common.logLevel
     * @type {Number}
     * @default 1
     */
    Common.logLevel = 1;

    /**
     * Shows a `console.log` message only if the current `Common.logLevel` allows it.
     * The message will be prefixed with 'matter-js' to make it easily identifiable.
     * @method log
     * @param ...objs {} The objects to log.
     */
    Common.log = function() {
        if (console && Common.logLevel > 0 && Common.logLevel <= 3) {
            console.log.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments)));
        }
    };

    /**
     * Shows a `console.info` message only if the current `Common.logLevel` allows it.
     * The message will be prefixed with 'matter-js' to make it easily identifiable.
     * @method info
     * @param ...objs {} The objects to log.
     */
    Common.info = function() {
        if (console && Common.logLevel > 0 && Common.logLevel <= 2) {
            console.info.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments)));
        }
    };

    /**
     * Shows a `console.warn` message only if the current `Common.logLevel` allows it.
     * The message will be prefixed with 'matter-js' to make it easily identifiable.
     * @method warn
     * @param ...objs {} The objects to log.
     */
    Common.warn = function() {
        if (console && Common.logLevel > 0 && Common.logLevel <= 3) {
            console.warn.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments)));
        }
    };

    /**
     * Uses `Common.warn` to log the given message one time only.
     * @method warnOnce
     * @param ...objs {} The objects to log.
     */
    Common.warnOnce = function() {
        var message = Array.prototype.slice.call(arguments).join(' ');

        if (!Common._warnedOnce[message]) {
            Common.warn(message);
            Common._warnedOnce[message] = true;
        }
    };

    /**
     * Shows a deprecated console warning when the function on the given object is called.
     * The target function will be replaced with a new function that first shows the warning
     * and then calls the original function.
     * @method deprecated
     * @param {object} obj The object or module
     * @param {string} name The property name of the function on obj
     * @param {string} warning The one-time message to show if the function is called
     */
    Common.deprecated = function(obj, prop, warning) {
        obj[prop] = Common.chain(function() {
            Common.warnOnce('🔅 deprecated 🔅', warning);
        }, obj[prop]);
    };

    /**
     * Returns the next unique sequential ID.
     * @method nextId
     * @return {Number} Unique sequential ID
     */
    Common.nextId = function() {
        return Common._nextId++;
    };

    /**
     * A cross browser compatible indexOf implementation.
     * @method indexOf
     * @param {array} haystack
     * @param {object} needle
     * @return {number} The position of needle in haystack, otherwise -1.
     */
    Common.indexOf = function(haystack, needle) {
        if (haystack.indexOf)
            return haystack.indexOf(needle);

        for (var i = 0; i < haystack.length; i++) {
            if (haystack[i] === needle)
                return i;
        }

        return -1;
    };

    /**
     * A cross browser compatible array map implementation.
     * @method map
     * @param {array} list
     * @param {function} func
     * @return {array} Values from list transformed by func.
     */
    Common.map = function(list, func) {
        if (list.map) {
            return list.map(func);
        }

        var mapped = [];

        for (var i = 0; i < list.length; i += 1) {
            mapped.push(func(list[i]));
        }

        return mapped;
    };

    /**
     * Takes a directed graph and returns the partially ordered set of vertices in topological order.
     * Circular dependencies are allowed.
     * @method topologicalSort
     * @param {object} graph
     * @return {array} Partially ordered set of vertices in topological order.
     */
    Common.topologicalSort = function(graph) {
        // https://github.com/mgechev/javascript-algorithms
        // Copyright (c) Minko Gechev (MIT license)
        // Modifications: tidy formatting and naming
        var result = [],
            visited = [],
            temp = [];

        for (var node in graph) {
            if (!visited[node] && !temp[node]) {
                Common._topologicalSort(node, visited, temp, graph, result);
            }
        }

        return result;
    };

    Common._topologicalSort = function(node, visited, temp, graph, result) {
        var neighbors = graph[node] || [];
        temp[node] = true;

        for (var i = 0; i < neighbors.length; i += 1) {
            var neighbor = neighbors[i];

            if (temp[neighbor]) {
                // skip circular dependencies
                continue;
            }

            if (!visited[neighbor]) {
                Common._topologicalSort(neighbor, visited, temp, graph, result);
            }
        }

        temp[node] = false;
        visited[node] = true;

        result.push(node);
    };

    /**
     * Takes _n_ functions as arguments and returns a new function that calls them in order.
     * The arguments applied when calling the new function will also be applied to every function passed.
     * The value of `this` refers to the last value returned in the chain that was not `undefined`.
     * Therefore if a passed function does not return a value, the previously returned value is maintained.
     * After all passed functions have been called the new function returns the last returned value (if any).
     * If any of the passed functions are a chain, then the chain will be flattened.
     * @method chain
     * @param ...funcs {function} The functions to chain.
     * @return {function} A new function that calls the passed functions in order.
     */
    Common.chain = function() {
        var funcs = [];

        for (var i = 0; i < arguments.length; i += 1) {
            var func = arguments[i];

            if (func._chained) {
                // flatten already chained functions
                funcs.push.apply(funcs, func._chained);
            } else {
                funcs.push(func);
            }
        }

        var chain = function() {
            // https://github.com/GoogleChrome/devtools-docs/issues/53#issuecomment-51941358
            var lastResult,
                args = new Array(arguments.length);

            for (var i = 0, l = arguments.length; i < l; i++) {
                args[i] = arguments[i];
            }

            for (i = 0; i < funcs.length; i += 1) {
                var result = funcs[i].apply(lastResult, args);

                if (typeof result !== 'undefined') {
                    lastResult = result;
                }
            }

            return lastResult;
        };

        chain._chained = funcs;

        return chain;
    };

    /**
     * Chains a function to excute before the original function on the given `path` relative to `base`.
     * See also docs for `Common.chain`.
     * @method chainPathBefore
     * @param {} base The base object
     * @param {string} path The path relative to `base`
     * @param {function} func The function to chain before the original
     * @return {function} The chained function that replaced the original
     */
    Common.chainPathBefore = function(base, path, func) {
        return Common.set(base, path, Common.chain(
            func,
            Common.get(base, path)
        ));
    };

    /**
     * Chains a function to excute after the original function on the given `path` relative to `base`.
     * See also docs for `Common.chain`.
     * @method chainPathAfter
     * @param {} base The base object
     * @param {string} path The path relative to `base`
     * @param {function} func The function to chain after the original
     * @return {function} The chained function that replaced the original
     */
    Common.chainPathAfter = function(base, path, func) {
        return Common.set(base, path, Common.chain(
            Common.get(base, path),
            func
        ));
    };

    /**
     * Provide the [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module to enable
     * concave vertex decomposition support when using `Bodies.fromVertices` e.g. `Common.setDecomp(require('poly-decomp'))`.
     * @method setDecomp
     * @param {} decomp The [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module.
     */
    Common.setDecomp = function(decomp) {
        Common._decomp = decomp;
    };

    /**
     * Returns the [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module provided through `Common.setDecomp`,
     * otherwise returns the global `decomp` if set.
     * @method getDecomp
     * @return {} The [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module if provided.
     */
    Common.getDecomp = function() {
        // get user provided decomp if set
        var decomp = Common._decomp;

        try {
            // otherwise from window global
            if (!decomp && typeof window !== 'undefined') {
                decomp = window.decomp;
            }
    
            // otherwise from node global
            if (!decomp && typeof global !== 'undefined') {
                decomp = global.decomp;
            }
        } catch (e) {
            // decomp not available
            decomp = null;
        }

        return decomp;
    };
})();


/***/ }),
/* 1 */
/***/ (function(module, exports) {

/**
* The `Matter.Bounds` module contains methods for creating and manipulating axis-aligned bounding boxes (AABB).
*
* @class Bounds
*/

var Bounds = {};

module.exports = Bounds;

(function() {

    /**
     * Creates a new axis-aligned bounding box (AABB) for the given vertices.
     * @method create
     * @param {vertices} vertices
     * @return {bounds} A new bounds object
     */
    Bounds.create = function(vertices) {
        var bounds = { 
            min: { x: 0, y: 0 }, 
            max: { x: 0, y: 0 }
        };

        if (vertices)
            Bounds.update(bounds, vertices);
        
        return bounds;
    };

    /**
     * Updates bounds using the given vertices and extends the bounds given a velocity.
     * @method update
     * @param {bounds} bounds
     * @param {vertices} vertices
     * @param {vector} velocity
     */
    Bounds.update = function(bounds, vertices, velocity) {
        bounds.min.x = Infinity;
        bounds.max.x = -Infinity;
        bounds.min.y = Infinity;
        bounds.max.y = -Infinity;

        for (var i = 0; i < vertices.length; i++) {
            var vertex = vertices[i];
            if (vertex.x > bounds.max.x) bounds.max.x = vertex.x;
            if (vertex.x < bounds.min.x) bounds.min.x = vertex.x;
            if (vertex.y > bounds.max.y) bounds.max.y = vertex.y;
            if (vertex.y < bounds.min.y) bounds.min.y = vertex.y;
        }
        
        if (velocity) {
            if (velocity.x > 0) {
                bounds.max.x += velocity.x;
            } else {
                bounds.min.x += velocity.x;
            }
            
            if (velocity.y > 0) {
                bounds.max.y += velocity.y;
            } else {
                bounds.min.y += velocity.y;
            }
        }
    };

    /**
     * Returns true if the bounds contains the given point.
     * @method contains
     * @param {bounds} bounds
     * @param {vector} point
     * @return {boolean} True if the bounds contain the point, otherwise false
     */
    Bounds.contains = function(bounds, point) {
        return point.x >= bounds.min.x && point.x <= bounds.max.x 
               && point.y >= bounds.min.y && point.y <= bounds.max.y;
    };

    /**
     * Returns true if the two bounds intersect.
     * @method overlaps
     * @param {bounds} boundsA
     * @param {bounds} boundsB
     * @return {boolean} True if the bounds overlap, otherwise false
     */
    Bounds.overlaps = function(boundsA, boundsB) {
        return (boundsA.min.x <= boundsB.max.x && boundsA.max.x >= boundsB.min.x
                && boundsA.max.y >= boundsB.min.y && boundsA.min.y <= boundsB.max.y);
    };

    /**
     * Translates the bounds by the given vector.
     * @method translate
     * @param {bounds} bounds
     * @param {vector} vector
     */
    Bounds.translate = function(bounds, vector) {
        bounds.min.x += vector.x;
        bounds.max.x += vector.x;
        bounds.min.y += vector.y;
        bounds.max.y += vector.y;
    };

    /**
     * Shifts the bounds to the given position.
     * @method shift
     * @param {bounds} bounds
     * @param {vector} position
     */
    Bounds.shift = function(bounds, position) {
        var deltaX = bounds.max.x - bounds.min.x,
            deltaY = bounds.max.y - bounds.min.y;
            
        bounds.min.x = position.x;
        bounds.max.x = position.x + deltaX;
        bounds.min.y = position.y;
        bounds.max.y = position.y + deltaY;
    };
    
})();


/***/ }),
/* 2 */
/***/ (function(module, exports) {

/**
* The `Matter.Vector` module contains methods for creating and manipulating vectors.
* Vectors are the basis of all the geometry related operations in the engine.
* A `Matter.Vector` object is of the form `{ x: 0, y: 0 }`.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Vector
*/

// TODO: consider params for reusing vector objects

var Vector = {};

module.exports = Vector;

(function() {

    /**
     * Creates a new vector.
     * @method create
     * @param {number} x
     * @param {number} y
     * @return {vector} A new vector
     */
    Vector.create = function(x, y) {
        return { x: x || 0, y: y || 0 };
    };

    /**
     * Returns a new vector with `x` and `y` copied from the given `vector`.
     * @method clone
     * @param {vector} vector
     * @return {vector} A new cloned vector
     */
    Vector.clone = function(vector) {
        return { x: vector.x, y: vector.y };
    };

    /**
     * Returns the magnitude (length) of a vector.
     * @method magnitude
     * @param {vector} vector
     * @return {number} The magnitude of the vector
     */
    Vector.magnitude = function(vector) {
        return Math.sqrt((vector.x * vector.x) + (vector.y * vector.y));
    };

    /**
     * Returns the magnitude (length) of a vector (therefore saving a `sqrt` operation).
     * @method magnitudeSquared
     * @param {vector} vector
     * @return {number} The squared magnitude of the vector
     */
    Vector.magnitudeSquared = function(vector) {
        return (vector.x * vector.x) + (vector.y * vector.y);
    };

    /**
     * Rotates the vector about (0, 0) by specified angle.
     * @method rotate
     * @param {vector} vector
     * @param {number} angle
     * @param {vector} [output]
     * @return {vector} The vector rotated about (0, 0)
     */
    Vector.rotate = function(vector, angle, output) {
        var cos = Math.cos(angle), sin = Math.sin(angle);
        if (!output) output = {};
        var x = vector.x * cos - vector.y * sin;
        output.y = vector.x * sin + vector.y * cos;
        output.x = x;
        return output;
    };

    /**
     * Rotates the vector about a specified point by specified angle.
     * @method rotateAbout
     * @param {vector} vector
     * @param {number} angle
     * @param {vector} point
     * @param {vector} [output]
     * @return {vector} A new vector rotated about the point
     */
    Vector.rotateAbout = function(vector, angle, point, output) {
        var cos = Math.cos(angle), sin = Math.sin(angle);
        if (!output) output = {};
        var x = point.x + ((vector.x - point.x) * cos - (vector.y - point.y) * sin);
        output.y = point.y + ((vector.x - point.x) * sin + (vector.y - point.y) * cos);
        output.x = x;
        return output;
    };

    /**
     * Normalises a vector (such that its magnitude is `1`).
     * @method normalise
     * @param {vector} vector
     * @return {vector} A new vector normalised
     */
    Vector.normalise = function(vector) {
        var magnitude = Vector.magnitude(vector);
        if (magnitude === 0)
            return { x: 0, y: 0 };
        return { x: vector.x / magnitude, y: vector.y / magnitude };
    };

    /**
     * Returns the dot-product of two vectors.
     * @method dot
     * @param {vector} vectorA
     * @param {vector} vectorB
     * @return {number} The dot product of the two vectors
     */
    Vector.dot = function(vectorA, vectorB) {
        return (vectorA.x * vectorB.x) + (vectorA.y * vectorB.y);
    };

    /**
     * Returns the cross-product of two vectors.
     * @method cross
     * @param {vector} vectorA
     * @param {vector} vectorB
     * @return {number} The cross product of the two vectors
     */
    Vector.cross = function(vectorA, vectorB) {
        return (vectorA.x * vectorB.y) - (vectorA.y * vectorB.x);
    };

    /**
     * Returns the cross-product of three vectors.
     * @method cross3
     * @param {vector} vectorA
     * @param {vector} vectorB
     * @param {vector} vectorC
     * @return {number} The cross product of the three vectors
     */
    Vector.cross3 = function(vectorA, vectorB, vectorC) {
        return (vectorB.x - vectorA.x) * (vectorC.y - vectorA.y) - (vectorB.y - vectorA.y) * (vectorC.x - vectorA.x);
    };

    /**
     * Adds the two vectors.
     * @method add
     * @param {vector} vectorA
     * @param {vector} vectorB
     * @param {vector} [output]
     * @return {vector} A new vector of vectorA and vectorB added
     */
    Vector.add = function(vectorA, vectorB, output) {
        if (!output) output = {};
        output.x = vectorA.x + vectorB.x;
        output.y = vectorA.y + vectorB.y;
        return output;
    };

    /**
     * Subtracts the two vectors.
     * @method sub
     * @param {vector} vectorA
     * @param {vector} vectorB
     * @param {vector} [output]
     * @return {vector} A new vector of vectorA and vectorB subtracted
     */
    Vector.sub = function(vectorA, vectorB, output) {
        if (!output) output = {};
        output.x = vectorA.x - vectorB.x;
        output.y = vectorA.y - vectorB.y;
        return output;
    };

    /**
     * Multiplies a vector and a scalar.
     * @method mult
     * @param {vector} vector
     * @param {number} scalar
     * @return {vector} A new vector multiplied by scalar
     */
    Vector.mult = function(vector, scalar) {
        return { x: vector.x * scalar, y: vector.y * scalar };
    };

    /**
     * Divides a vector and a scalar.
     * @method div
     * @param {vector} vector
     * @param {number} scalar
     * @return {vector} A new vector divided by scalar
     */
    Vector.div = function(vector, scalar) {
        return { x: vector.x / scalar, y: vector.y / scalar };
    };

    /**
     * Returns the perpendicular vector. Set `negate` to true for the perpendicular in the opposite direction.
     * @method perp
     * @param {vector} vector
     * @param {bool} [negate=false]
     * @return {vector} The perpendicular vector
     */
    Vector.perp = function(vector, negate) {
        negate = negate === true ? -1 : 1;
        return { x: negate * -vector.y, y: negate * vector.x };
    };

    /**
     * Negates both components of a vector such that it points in the opposite direction.
     * @method neg
     * @param {vector} vector
     * @return {vector} The negated vector
     */
    Vector.neg = function(vector) {
        return { x: -vector.x, y: -vector.y };
    };

    /**
     * Returns the angle between the vector `vectorB - vectorA` and the x-axis in radians.
     * @method angle
     * @param {vector} vectorA
     * @param {vector} vectorB
     * @return {number} The angle in radians
     */
    Vector.angle = function(vectorA, vectorB) {
        return Math.atan2(vectorB.y - vectorA.y, vectorB.x - vectorA.x);
    };

    /**
     * Temporary vector pool (not thread-safe).
     * @property _temp
     * @type {vector[]}
     * @private
     */
    Vector._temp = [
        Vector.create(), Vector.create(), 
        Vector.create(), Vector.create(), 
        Vector.create(), Vector.create()
    ];

})();

/***/ }),
/* 3 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Vertices` module contains methods for creating and manipulating sets of vertices.
* A set of vertices is an array of `Matter.Vector` with additional indexing properties inserted by `Vertices.create`.
* A `Matter.Body` maintains a set of vertices to represent the shape of the object (its convex hull).
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Vertices
*/

var Vertices = {};

module.exports = Vertices;

var Vector = __webpack_require__(2);
var Common = __webpack_require__(0);

(function() {

    /**
     * Creates a new set of `Matter.Body` compatible vertices.
     * The `points` argument accepts an array of `Matter.Vector` points orientated around the origin `(0, 0)`, for example:
     *
     *     [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }]
     *
     * The `Vertices.create` method returns a new array of vertices, which are similar to Matter.Vector objects,
     * but with some additional references required for efficient collision detection routines.
     *
     * Vertices must be specified in clockwise order.
     *
     * Note that the `body` argument is not optional, a `Matter.Body` reference must be provided.
     *
     * @method create
     * @param {vector[]} points
     * @param {body} body
     */
    Vertices.create = function(points, body) {
        var vertices = [];

        for (var i = 0; i < points.length; i++) {
            var point = points[i],
                vertex = {
                    x: point.x,
                    y: point.y,
                    index: i,
                    body: body,
                    isInternal: false
                };

            vertices.push(vertex);
        }

        return vertices;
    };

    /**
     * Parses a string containing ordered x y pairs separated by spaces (and optionally commas), 
     * into a `Matter.Vertices` object for the given `Matter.Body`.
     * For parsing SVG paths, see `Svg.pathToVertices`.
     * @method fromPath
     * @param {string} path
     * @param {body} body
     * @return {vertices} vertices
     */
    Vertices.fromPath = function(path, body) {
        var pathPattern = /L?\s*([-\d.e]+)[\s,]*([-\d.e]+)*/ig,
            points = [];

        path.replace(pathPattern, function(match, x, y) {
            points.push({ x: parseFloat(x), y: parseFloat(y) });
        });

        return Vertices.create(points, body);
    };

    /**
     * Returns the centre (centroid) of the set of vertices.
     * @method centre
     * @param {vertices} vertices
     * @return {vector} The centre point
     */
    Vertices.centre = function(vertices) {
        var area = Vertices.area(vertices, true),
            centre = { x: 0, y: 0 },
            cross,
            temp,
            j;

        for (var i = 0; i < vertices.length; i++) {
            j = (i + 1) % vertices.length;
            cross = Vector.cross(vertices[i], vertices[j]);
            temp = Vector.mult(Vector.add(vertices[i], vertices[j]), cross);
            centre = Vector.add(centre, temp);
        }

        return Vector.div(centre, 6 * area);
    };

    /**
     * Returns the average (mean) of the set of vertices.
     * @method mean
     * @param {vertices} vertices
     * @return {vector} The average point
     */
    Vertices.mean = function(vertices) {
        var average = { x: 0, y: 0 };

        for (var i = 0; i < vertices.length; i++) {
            average.x += vertices[i].x;
            average.y += vertices[i].y;
        }

        return Vector.div(average, vertices.length);
    };

    /**
     * Returns the area of the set of vertices.
     * @method area
     * @param {vertices} vertices
     * @param {bool} signed
     * @return {number} The area
     */
    Vertices.area = function(vertices, signed) {
        var area = 0,
            j = vertices.length - 1;

        for (var i = 0; i < vertices.length; i++) {
            area += (vertices[j].x - vertices[i].x) * (vertices[j].y + vertices[i].y);
            j = i;
        }

        if (signed)
            return area / 2;

        return Math.abs(area) / 2;
    };

    /**
     * Returns the moment of inertia (second moment of area) of the set of vertices given the total mass.
     * @method inertia
     * @param {vertices} vertices
     * @param {number} mass
     * @return {number} The polygon's moment of inertia
     */
    Vertices.inertia = function(vertices, mass) {
        var numerator = 0,
            denominator = 0,
            v = vertices,
            cross,
            j;

        // find the polygon's moment of inertia, using second moment of area
        // from equations at http://www.physicsforums.com/showthread.php?t=25293
        for (var n = 0; n < v.length; n++) {
            j = (n + 1) % v.length;
            cross = Math.abs(Vector.cross(v[j], v[n]));
            numerator += cross * (Vector.dot(v[j], v[j]) + Vector.dot(v[j], v[n]) + Vector.dot(v[n], v[n]));
            denominator += cross;
        }

        return (mass / 6) * (numerator / denominator);
    };

    /**
     * Translates the set of vertices in-place.
     * @method translate
     * @param {vertices} vertices
     * @param {vector} vector
     * @param {number} scalar
     */
    Vertices.translate = function(vertices, vector, scalar) {
        scalar = typeof scalar !== 'undefined' ? scalar : 1;

        var verticesLength = vertices.length,
            translateX = vector.x * scalar,
            translateY = vector.y * scalar,
            i;
        
        for (i = 0; i < verticesLength; i++) {
            vertices[i].x += translateX;
            vertices[i].y += translateY;
        }

        return vertices;
    };

    /**
     * Rotates the set of vertices in-place.
     * @method rotate
     * @param {vertices} vertices
     * @param {number} angle
     * @param {vector} point
     */
    Vertices.rotate = function(vertices, angle, point) {
        if (angle === 0)
            return;

        var cos = Math.cos(angle),
            sin = Math.sin(angle),
            pointX = point.x,
            pointY = point.y,
            verticesLength = vertices.length,
            vertex,
            dx,
            dy,
            i;

        for (i = 0; i < verticesLength; i++) {
            vertex = vertices[i];
            dx = vertex.x - pointX;
            dy = vertex.y - pointY;
            vertex.x = pointX + (dx * cos - dy * sin);
            vertex.y = pointY + (dx * sin + dy * cos);
        }

        return vertices;
    };

    /**
     * Returns `true` if the `point` is inside the set of `vertices`.
     * @method contains
     * @param {vertices} vertices
     * @param {vector} point
     * @return {boolean} True if the vertices contains point, otherwise false
     */
    Vertices.contains = function(vertices, point) {
        var pointX = point.x,
            pointY = point.y,
            verticesLength = vertices.length,
            vertex = vertices[verticesLength - 1],
            nextVertex;

        for (var i = 0; i < verticesLength; i++) {
            nextVertex = vertices[i];

            if ((pointX - vertex.x) * (nextVertex.y - vertex.y) 
                + (pointY - vertex.y) * (vertex.x - nextVertex.x) > 0) {
                return false;
            }

            vertex = nextVertex;
        }

        return true;
    };

    /**
     * Scales the vertices from a point (default is centre) in-place.
     * @method scale
     * @param {vertices} vertices
     * @param {number} scaleX
     * @param {number} scaleY
     * @param {vector} point
     */
    Vertices.scale = function(vertices, scaleX, scaleY, point) {
        if (scaleX === 1 && scaleY === 1)
            return vertices;

        point = point || Vertices.centre(vertices);

        var vertex,
            delta;

        for (var i = 0; i < vertices.length; i++) {
            vertex = vertices[i];
            delta = Vector.sub(vertex, point);
            vertices[i].x = point.x + delta.x * scaleX;
            vertices[i].y = point.y + delta.y * scaleY;
        }

        return vertices;
    };

    /**
     * Chamfers a set of vertices by giving them rounded corners, returns a new set of vertices.
     * The radius parameter is a single number or an array to specify the radius for each vertex.
     * @method chamfer
     * @param {vertices} vertices
     * @param {number[]} radius
     * @param {number} quality
     * @param {number} qualityMin
     * @param {number} qualityMax
     */
    Vertices.chamfer = function(vertices, radius, quality, qualityMin, qualityMax) {
        if (typeof radius === 'number') {
            radius = [radius];
        } else {
            radius = radius || [8];
        }

        // quality defaults to -1, which is auto
        quality = (typeof quality !== 'undefined') ? quality : -1;
        qualityMin = qualityMin || 2;
        qualityMax = qualityMax || 14;

        var newVertices = [];

        for (var i = 0; i < vertices.length; i++) {
            var prevVertex = vertices[i - 1 >= 0 ? i - 1 : vertices.length - 1],
                vertex = vertices[i],
                nextVertex = vertices[(i + 1) % vertices.length],
                currentRadius = radius[i < radius.length ? i : radius.length - 1];

            if (currentRadius === 0) {
                newVertices.push(vertex);
                continue;
            }

            var prevNormal = Vector.normalise({ 
                x: vertex.y - prevVertex.y, 
                y: prevVertex.x - vertex.x
            });

            var nextNormal = Vector.normalise({ 
                x: nextVertex.y - vertex.y, 
                y: vertex.x - nextVertex.x
            });

            var diagonalRadius = Math.sqrt(2 * Math.pow(currentRadius, 2)),
                radiusVector = Vector.mult(Common.clone(prevNormal), currentRadius),
                midNormal = Vector.normalise(Vector.mult(Vector.add(prevNormal, nextNormal), 0.5)),
                scaledVertex = Vector.sub(vertex, Vector.mult(midNormal, diagonalRadius));

            var precision = quality;

            if (quality === -1) {
                // automatically decide precision
                precision = Math.pow(currentRadius, 0.32) * 1.75;
            }

            precision = Common.clamp(precision, qualityMin, qualityMax);

            // use an even value for precision, more likely to reduce axes by using symmetry
            if (precision % 2 === 1)
                precision += 1;

            var alpha = Math.acos(Vector.dot(prevNormal, nextNormal)),
                theta = alpha / precision;

            for (var j = 0; j < precision; j++) {
                newVertices.push(Vector.add(Vector.rotate(radiusVector, theta * j), scaledVertex));
            }
        }

        return newVertices;
    };

    /**
     * Sorts the input vertices into clockwise order in place.
     * @method clockwiseSort
     * @param {vertices} vertices
     * @return {vertices} vertices
     */
    Vertices.clockwiseSort = function(vertices) {
        var centre = Vertices.mean(vertices);

        vertices.sort(function(vertexA, vertexB) {
            return Vector.angle(centre, vertexA) - Vector.angle(centre, vertexB);
        });

        return vertices;
    };

    /**
     * Returns true if the vertices form a convex shape (vertices must be in clockwise order).
     * @method isConvex
     * @param {vertices} vertices
     * @return {bool} `true` if the `vertices` are convex, `false` if not (or `null` if not computable).
     */
    Vertices.isConvex = function(vertices) {
        // http://paulbourke.net/geometry/polygonmesh/
        // Copyright (c) Paul Bourke (use permitted)

        var flag = 0,
            n = vertices.length,
            i,
            j,
            k,
            z;

        if (n < 3)
            return null;

        for (i = 0; i < n; i++) {
            j = (i + 1) % n;
            k = (i + 2) % n;
            z = (vertices[j].x - vertices[i].x) * (vertices[k].y - vertices[j].y);
            z -= (vertices[j].y - vertices[i].y) * (vertices[k].x - vertices[j].x);

            if (z < 0) {
                flag |= 1;
            } else if (z > 0) {
                flag |= 2;
            }

            if (flag === 3) {
                return false;
            }
        }

        if (flag !== 0){
            return true;
        } else {
            return null;
        }
    };

    /**
     * Returns the convex hull of the input vertices as a new array of points.
     * @method hull
     * @param {vertices} vertices
     * @return [vertex] vertices
     */
    Vertices.hull = function(vertices) {
        // http://geomalgorithms.com/a10-_hull-1.html

        var upper = [],
            lower = [], 
            vertex,
            i;

        // sort vertices on x-axis (y-axis for ties)
        vertices = vertices.slice(0);
        vertices.sort(function(vertexA, vertexB) {
            var dx = vertexA.x - vertexB.x;
            return dx !== 0 ? dx : vertexA.y - vertexB.y;
        });

        // build lower hull
        for (i = 0; i < vertices.length; i += 1) {
            vertex = vertices[i];

            while (lower.length >= 2 
                   && Vector.cross3(lower[lower.length - 2], lower[lower.length - 1], vertex) <= 0) {
                lower.pop();
            }

            lower.push(vertex);
        }

        // build upper hull
        for (i = vertices.length - 1; i >= 0; i -= 1) {
            vertex = vertices[i];

            while (upper.length >= 2 
                   && Vector.cross3(upper[upper.length - 2], upper[upper.length - 1], vertex) <= 0) {
                upper.pop();
            }

            upper.push(vertex);
        }

        // concatenation of the lower and upper hulls gives the convex hull
        // omit last points because they are repeated at the beginning of the other list
        upper.pop();
        lower.pop();

        return upper.concat(lower);
    };

})();


/***/ }),
/* 4 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Events` module contains methods to fire and listen to events on other objects.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Events
*/

var Events = {};

module.exports = Events;

var Common = __webpack_require__(0);

(function() {

    /**
     * Subscribes a callback function to the given object's `eventName`.
     * @method on
     * @param {} object
     * @param {string} eventNames
     * @param {function} callback
     */
    Events.on = function(object, eventNames, callback) {
        var names = eventNames.split(' '),
            name;

        for (var i = 0; i < names.length; i++) {
            name = names[i];
            object.events = object.events || {};
            object.events[name] = object.events[name] || [];
            object.events[name].push(callback);
        }

        return callback;
    };

    /**
     * Removes the given event callback. If no callback, clears all callbacks in `eventNames`. If no `eventNames`, clears all events.
     * @method off
     * @param {} object
     * @param {string} eventNames
     * @param {function} callback
     */
    Events.off = function(object, eventNames, callback) {
        if (!eventNames) {
            object.events = {};
            return;
        }

        // handle Events.off(object, callback)
        if (typeof eventNames === 'function') {
            callback = eventNames;
            eventNames = Common.keys(object.events).join(' ');
        }

        var names = eventNames.split(' ');

        for (var i = 0; i < names.length; i++) {
            var callbacks = object.events[names[i]],
                newCallbacks = [];

            if (callback && callbacks) {
                for (var j = 0; j < callbacks.length; j++) {
                    if (callbacks[j] !== callback)
                        newCallbacks.push(callbacks[j]);
                }
            }

            object.events[names[i]] = newCallbacks;
        }
    };

    /**
     * Fires all the callbacks subscribed to the given object's `eventName`, in the order they subscribed, if any.
     * @method trigger
     * @param {} object
     * @param {string} eventNames
     * @param {} event
     */
    Events.trigger = function(object, eventNames, event) {
        var names,
            name,
            callbacks,
            eventClone;

        var events = object.events;
        
        if (events && Common.keys(events).length > 0) {
            if (!event)
                event = {};

            names = eventNames.split(' ');

            for (var i = 0; i < names.length; i++) {
                name = names[i];
                callbacks = events[name];

                if (callbacks) {
                    eventClone = Common.clone(event, false);
                    eventClone.name = name;
                    eventClone.source = object;

                    for (var j = 0; j < callbacks.length; j++) {
                        callbacks[j].apply(object, [eventClone]);
                    }
                }
            }
        }
    };

})();


/***/ }),
/* 5 */
/***/ (function(module, exports, __webpack_require__) {

/**
* A composite is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite` objects.
*
* They are a container that can represent complex objects made of multiple parts, even if they are not physically connected.
* A composite could contain anything from a single body all the way up to a whole world.
* 
* When making any changes to composites, use the included functions rather than changing their properties directly.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Composite
*/

var Composite = {};

module.exports = Composite;

var Events = __webpack_require__(4);
var Common = __webpack_require__(0);
var Bounds = __webpack_require__(1);
var Body = __webpack_require__(6);

(function() {

    /**
     * Creates a new composite. The options parameter is an object that specifies any properties you wish to override the defaults.
     * See the properites section below for detailed information on what you can pass via the `options` object.
     * @method create
     * @param {} [options]
     * @return {composite} A new composite
     */
    Composite.create = function(options) {
        return Common.extend({ 
            id: Common.nextId(),
            type: 'composite',
            parent: null,
            isModified: false,
            bodies: [], 
            constraints: [], 
            composites: [],
            label: 'Composite',
            plugin: {},
            cache: {
                allBodies: null,
                allConstraints: null,
                allComposites: null
            }
        }, options);
    };

    /**
     * Sets the composite's `isModified` flag. 
     * If `updateParents` is true, all parents will be set (default: false).
     * If `updateChildren` is true, all children will be set (default: false).
     * @private
     * @method setModified
     * @param {composite} composite
     * @param {boolean} isModified
     * @param {boolean} [updateParents=false]
     * @param {boolean} [updateChildren=false]
     */
    Composite.setModified = function(composite, isModified, updateParents, updateChildren) {
        composite.isModified = isModified;

        if (isModified && composite.cache) {
            composite.cache.allBodies = null;
            composite.cache.allConstraints = null;
            composite.cache.allComposites = null;
        }

        if (updateParents && composite.parent) {
            Composite.setModified(composite.parent, isModified, updateParents, updateChildren);
        }

        if (updateChildren) {
            for (var i = 0; i < composite.composites.length; i++) {
                var childComposite = composite.composites[i];
                Composite.setModified(childComposite, isModified, updateParents, updateChildren);
            }
        }
    };

    /**
     * Generic single or multi-add function. Adds a single or an array of body(s), constraint(s) or composite(s) to the given composite.
     * Triggers `beforeAdd` and `afterAdd` events on the `composite`.
     * @method add
     * @param {composite} composite
     * @param {object|array} object A single or an array of body(s), constraint(s) or composite(s)
     * @return {composite} The original composite with the objects added
     */
    Composite.add = function(composite, object) {
        var objects = [].concat(object);

        Events.trigger(composite, 'beforeAdd', { object: object });

        for (var i = 0; i < objects.length; i++) {
            var obj = objects[i];

            switch (obj.type) {

            case 'body':
                // skip adding compound parts
                if (obj.parent !== obj) {
                    Common.warn('Composite.add: skipped adding a compound body part (you must add its parent instead)');
                    break;
                }

                Composite.addBody(composite, obj);
                break;
            case 'constraint':
                Composite.addConstraint(composite, obj);
                break;
            case 'composite':
                Composite.addComposite(composite, obj);
                break;
            case 'mouseConstraint':
                Composite.addConstraint(composite, obj.constraint);
                break;

            }
        }

        Events.trigger(composite, 'afterAdd', { object: object });

        return composite;
    };

    /**
     * Generic remove function. Removes one or many body(s), constraint(s) or a composite(s) to the given composite.
     * Optionally searching its children recursively.
     * Triggers `beforeRemove` and `afterRemove` events on the `composite`.
     * @method remove
     * @param {composite} composite
     * @param {object|array} object
     * @param {boolean} [deep=false]
     * @return {composite} The original composite with the objects removed
     */
    Composite.remove = function(composite, object, deep) {
        var objects = [].concat(object);

        Events.trigger(composite, 'beforeRemove', { object: object });

        for (var i = 0; i < objects.length; i++) {
            var obj = objects[i];

            switch (obj.type) {

            case 'body':
                Composite.removeBody(composite, obj, deep);
                break;
            case 'constraint':
                Composite.removeConstraint(composite, obj, deep);
                break;
            case 'composite':
                Composite.removeComposite(composite, obj, deep);
                break;
            case 'mouseConstraint':
                Composite.removeConstraint(composite, obj.constraint);
                break;

            }
        }

        Events.trigger(composite, 'afterRemove', { object: object });

        return composite;
    };

    /**
     * Adds a composite to the given composite.
     * @private
     * @method addComposite
     * @param {composite} compositeA
     * @param {composite} compositeB
     * @return {composite} The original compositeA with the objects from compositeB added
     */
    Composite.addComposite = function(compositeA, compositeB) {
        compositeA.composites.push(compositeB);
        compositeB.parent = compositeA;
        Composite.setModified(compositeA, true, true, false);
        return compositeA;
    };

    /**
     * Removes a composite from the given composite, and optionally searching its children recursively.
     * @private
     * @method removeComposite
     * @param {composite} compositeA
     * @param {composite} compositeB
     * @param {boolean} [deep=false]
     * @return {composite} The original compositeA with the composite removed
     */
    Composite.removeComposite = function(compositeA, compositeB, deep) {
        var position = Common.indexOf(compositeA.composites, compositeB);
        if (position !== -1) {
            Composite.removeCompositeAt(compositeA, position);
        }

        if (deep) {
            for (var i = 0; i < compositeA.composites.length; i++){
                Composite.removeComposite(compositeA.composites[i], compositeB, true);
            }
        }

        return compositeA;
    };

    /**
     * Removes a composite from the given composite.
     * @private
     * @method removeCompositeAt
     * @param {composite} composite
     * @param {number} position
     * @return {composite} The original composite with the composite removed
     */
    Composite.removeCompositeAt = function(composite, position) {
        composite.composites.splice(position, 1);
        Composite.setModified(composite, true, true, false);
        return composite;
    };

    /**
     * Adds a body to the given composite.
     * @private
     * @method addBody
     * @param {composite} composite
     * @param {body} body
     * @return {composite} The original composite with the body added
     */
    Composite.addBody = function(composite, body) {
        composite.bodies.push(body);
        Composite.setModified(composite, true, true, false);
        return composite;
    };

    /**
     * Removes a body from the given composite, and optionally searching its children recursively.
     * @private
     * @method removeBody
     * @param {composite} composite
     * @param {body} body
     * @param {boolean} [deep=false]
     * @return {composite} The original composite with the body removed
     */
    Composite.removeBody = function(composite, body, deep) {
        var position = Common.indexOf(composite.bodies, body);
        if (position !== -1) {
            Composite.removeBodyAt(composite, position);
        }

        if (deep) {
            for (var i = 0; i < composite.composites.length; i++){
                Composite.removeBody(composite.composites[i], body, true);
            }
        }

        return composite;
    };

    /**
     * Removes a body from the given composite.
     * @private
     * @method removeBodyAt
     * @param {composite} composite
     * @param {number} position
     * @return {composite} The original composite with the body removed
     */
    Composite.removeBodyAt = function(composite, position) {
        composite.bodies.splice(position, 1);
        Composite.setModified(composite, true, true, false);
        return composite;
    };

    /**
     * Adds a constraint to the given composite.
     * @private
     * @method addConstraint
     * @param {composite} composite
     * @param {constraint} constraint
     * @return {composite} The original composite with the constraint added
     */
    Composite.addConstraint = function(composite, constraint) {
        composite.constraints.push(constraint);
        Composite.setModified(composite, true, true, false);
        return composite;
    };

    /**
     * Removes a constraint from the given composite, and optionally searching its children recursively.
     * @private
     * @method removeConstraint
     * @param {composite} composite
     * @param {constraint} constraint
     * @param {boolean} [deep=false]
     * @return {composite} The original composite with the constraint removed
     */
    Composite.removeConstraint = function(composite, constraint, deep) {
        var position = Common.indexOf(composite.constraints, constraint);
        if (position !== -1) {
            Composite.removeConstraintAt(composite, position);
        }

        if (deep) {
            for (var i = 0; i < composite.composites.length; i++){
                Composite.removeConstraint(composite.composites[i], constraint, true);
            }
        }

        return composite;
    };

    /**
     * Removes a body from the given composite.
     * @private
     * @method removeConstraintAt
     * @param {composite} composite
     * @param {number} position
     * @return {composite} The original composite with the constraint removed
     */
    Composite.removeConstraintAt = function(composite, position) {
        composite.constraints.splice(position, 1);
        Composite.setModified(composite, true, true, false);
        return composite;
    };

    /**
     * Removes all bodies, constraints and composites from the given composite.
     * Optionally clearing its children recursively.
     * @method clear
     * @param {composite} composite
     * @param {boolean} keepStatic
     * @param {boolean} [deep=false]
     */
    Composite.clear = function(composite, keepStatic, deep) {
        if (deep) {
            for (var i = 0; i < composite.composites.length; i++){
                Composite.clear(composite.composites[i], keepStatic, true);
            }
        }
        
        if (keepStatic) {
            composite.bodies = composite.bodies.filter(function(body) { return body.isStatic; });
        } else {
            composite.bodies.length = 0;
        }

        composite.constraints.length = 0;
        composite.composites.length = 0;

        Composite.setModified(composite, true, true, false);

        return composite;
    };

    /**
     * Returns all bodies in the given composite, including all bodies in its children, recursively.
     * @method allBodies
     * @param {composite} composite
     * @return {body[]} All the bodies
     */
    Composite.allBodies = function(composite) {
        if (composite.cache && composite.cache.allBodies) {
            return composite.cache.allBodies;
        }

        var bodies = [].concat(composite.bodies);

        for (var i = 0; i < composite.composites.length; i++)
            bodies = bodies.concat(Composite.allBodies(composite.composites[i]));

        if (composite.cache) {
            composite.cache.allBodies = bodies;
        }

        return bodies;
    };

    /**
     * Returns all constraints in the given composite, including all constraints in its children, recursively.
     * @method allConstraints
     * @param {composite} composite
     * @return {constraint[]} All the constraints
     */
    Composite.allConstraints = function(composite) {
        if (composite.cache && composite.cache.allConstraints) {
            return composite.cache.allConstraints;
        }

        var constraints = [].concat(composite.constraints);

        for (var i = 0; i < composite.composites.length; i++)
            constraints = constraints.concat(Composite.allConstraints(composite.composites[i]));

        if (composite.cache) {
            composite.cache.allConstraints = constraints;
        }

        return constraints;
    };

    /**
     * Returns all composites in the given composite, including all composites in its children, recursively.
     * @method allComposites
     * @param {composite} composite
     * @return {composite[]} All the composites
     */
    Composite.allComposites = function(composite) {
        if (composite.cache && composite.cache.allComposites) {
            return composite.cache.allComposites;
        }

        var composites = [].concat(composite.composites);

        for (var i = 0; i < composite.composites.length; i++)
            composites = composites.concat(Composite.allComposites(composite.composites[i]));

        if (composite.cache) {
            composite.cache.allComposites = composites;
        }

        return composites;
    };

    /**
     * Searches the composite recursively for an object matching the type and id supplied, null if not found.
     * @method get
     * @param {composite} composite
     * @param {number} id
     * @param {string} type
     * @return {object} The requested object, if found
     */
    Composite.get = function(composite, id, type) {
        var objects,
            object;

        switch (type) {
        case 'body':
            objects = Composite.allBodies(composite);
            break;
        case 'constraint':
            objects = Composite.allConstraints(composite);
            break;
        case 'composite':
            objects = Composite.allComposites(composite).concat(composite);
            break;
        }

        if (!objects)
            return null;

        object = objects.filter(function(object) { 
            return object.id.toString() === id.toString(); 
        });

        return object.length === 0 ? null : object[0];
    };

    /**
     * Moves the given object(s) from compositeA to compositeB (equal to a remove followed by an add).
     * @method move
     * @param {compositeA} compositeA
     * @param {object[]} objects
     * @param {compositeB} compositeB
     * @return {composite} Returns compositeA
     */
    Composite.move = function(compositeA, objects, compositeB) {
        Composite.remove(compositeA, objects);
        Composite.add(compositeB, objects);
        return compositeA;
    };

    /**
     * Assigns new ids for all objects in the composite, recursively.
     * @method rebase
     * @param {composite} composite
     * @return {composite} Returns composite
     */
    Composite.rebase = function(composite) {
        var objects = Composite.allBodies(composite)
            .concat(Composite.allConstraints(composite))
            .concat(Composite.allComposites(composite));

        for (var i = 0; i < objects.length; i++) {
            objects[i].id = Common.nextId();
        }

        return composite;
    };

    /**
     * Translates all children in the composite by a given vector relative to their current positions, 
     * without imparting any velocity.
     * @method translate
     * @param {composite} composite
     * @param {vector} translation
     * @param {bool} [recursive=true]
     */
    Composite.translate = function(composite, translation, recursive) {
        var bodies = recursive ? Composite.allBodies(composite) : composite.bodies;

        for (var i = 0; i < bodies.length; i++) {
            Body.translate(bodies[i], translation);
        }

        return composite;
    };

    /**
     * Rotates all children in the composite by a given angle about the given point, without imparting any angular velocity.
     * @method rotate
     * @param {composite} composite
     * @param {number} rotation
     * @param {vector} point
     * @param {bool} [recursive=true]
     */
    Composite.rotate = function(composite, rotation, point, recursive) {
        var cos = Math.cos(rotation),
            sin = Math.sin(rotation),
            bodies = recursive ? Composite.allBodies(composite) : composite.bodies;

        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i],
                dx = body.position.x - point.x,
                dy = body.position.y - point.y;
                
            Body.setPosition(body, {
                x: point.x + (dx * cos - dy * sin),
                y: point.y + (dx * sin + dy * cos)
            });

            Body.rotate(body, rotation);
        }

        return composite;
    };

    /**
     * Scales all children in the composite, including updating physical properties (mass, area, axes, inertia), from a world-space point.
     * @method scale
     * @param {composite} composite
     * @param {number} scaleX
     * @param {number} scaleY
     * @param {vector} point
     * @param {bool} [recursive=true]
     */
    Composite.scale = function(composite, scaleX, scaleY, point, recursive) {
        var bodies = recursive ? Composite.allBodies(composite) : composite.bodies;

        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i],
                dx = body.position.x - point.x,
                dy = body.position.y - point.y;
                
            Body.setPosition(body, {
                x: point.x + dx * scaleX,
                y: point.y + dy * scaleY
            });

            Body.scale(body, scaleX, scaleY);
        }

        return composite;
    };

    /**
     * Returns the union of the bounds of all of the composite's bodies.
     * @method bounds
     * @param {composite} composite The composite.
     * @returns {bounds} The composite bounds.
     */
    Composite.bounds = function(composite) {
        var bodies = Composite.allBodies(composite),
            vertices = [];

        for (var i = 0; i < bodies.length; i += 1) {
            var body = bodies[i];
            vertices.push(body.bounds.min, body.bounds.max);
        }

        return Bounds.create(vertices);
    };

    /*
    *
    *  Events Documentation
    *
    */

    /**
    * Fired when a call to `Composite.add` is made, before objects have been added.
    *
    * @event beforeAdd
    * @param {} event An event object
    * @param {} event.object The object(s) to be added (may be a single body, constraint, composite or a mixed array of these)
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when a call to `Composite.add` is made, after objects have been added.
    *
    * @event afterAdd
    * @param {} event An event object
    * @param {} event.object The object(s) that have been added (may be a single body, constraint, composite or a mixed array of these)
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when a call to `Composite.remove` is made, before objects have been removed.
    *
    * @event beforeRemove
    * @param {} event An event object
    * @param {} event.object The object(s) to be removed (may be a single body, constraint, composite or a mixed array of these)
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when a call to `Composite.remove` is made, after objects have been removed.
    *
    * @event afterRemove
    * @param {} event An event object
    * @param {} event.object The object(s) that have been removed (may be a single body, constraint, composite or a mixed array of these)
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`.
     *
     * @property id
     * @type number
     */

    /**
     * A `String` denoting the type of object.
     *
     * @property type
     * @type string
     * @default "composite"
     * @readOnly
     */

    /**
     * An arbitrary `String` name to help the user identify and manage composites.
     *
     * @property label
     * @type string
     * @default "Composite"
     */

    /**
     * A flag that specifies whether the composite has been modified during the current step.
     * This is automatically managed when bodies, constraints or composites are added or removed.
     *
     * @property isModified
     * @type boolean
     * @default false
     */

    /**
     * The `Composite` that is the parent of this composite. It is automatically managed by the `Matter.Composite` methods.
     *
     * @property parent
     * @type composite
     * @default null
     */

    /**
     * An array of `Body` that are _direct_ children of this composite.
     * To add or remove bodies you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property.
     * If you wish to recursively find all descendants, you should use the `Composite.allBodies` method.
     *
     * @property bodies
     * @type body[]
     * @default []
     */

    /**
     * An array of `Constraint` that are _direct_ children of this composite.
     * To add or remove constraints you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property.
     * If you wish to recursively find all descendants, you should use the `Composite.allConstraints` method.
     *
     * @property constraints
     * @type constraint[]
     * @default []
     */

    /**
     * An array of `Composite` that are _direct_ children of this composite.
     * To add or remove composites you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property.
     * If you wish to recursively find all descendants, you should use the `Composite.allComposites` method.
     *
     * @property composites
     * @type composite[]
     * @default []
     */

    /**
     * An object reserved for storing plugin-specific properties.
     *
     * @property plugin
     * @type {}
     */

    /**
     * An object used for storing cached results for performance reasons.
     * This is used internally only and is automatically managed.
     *
     * @private
     * @property cache
     * @type {}
     */

})();


/***/ }),
/* 6 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Body` module contains methods for creating and manipulating body models.
* A `Matter.Body` is a rigid body that can be simulated by a `Matter.Engine`.
* Factories for commonly used body configurations (such as rectangles, circles and other polygons) can be found in the module `Matter.Bodies`.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).

* @class Body
*/

var Body = {};

module.exports = Body;

var Vertices = __webpack_require__(3);
var Vector = __webpack_require__(2);
var Sleeping = __webpack_require__(7);
var Render = __webpack_require__(16);
var Common = __webpack_require__(0);
var Bounds = __webpack_require__(1);
var Axes = __webpack_require__(11);

(function() {

    Body._inertiaScale = 4;
    Body._nextCollidingGroupId = 1;
    Body._nextNonCollidingGroupId = -1;
    Body._nextCategory = 0x0001;

    /**
     * Creates a new rigid body model. The options parameter is an object that specifies any properties you wish to override the defaults.
     * All properties have default values, and many are pre-calculated automatically based on other properties.
     * Vertices must be specified in clockwise order.
     * See the properties section below for detailed information on what you can pass via the `options` object.
     * @method create
     * @param {} options
     * @return {body} body
     */
    Body.create = function(options) {
        var defaults = {
            id: Common.nextId(),
            type: 'body',
            label: 'Body',
            parts: [],
            plugin: {},
            angle: 0,
            vertices: Vertices.fromPath('L 0 0 L 40 0 L 40 40 L 0 40'),
            position: { x: 0, y: 0 },
            force: { x: 0, y: 0 },
            torque: 0,
            positionImpulse: { x: 0, y: 0 },
            constraintImpulse: { x: 0, y: 0, angle: 0 },
            totalContacts: 0,
            speed: 0,
            angularSpeed: 0,
            velocity: { x: 0, y: 0 },
            angularVelocity: 0,
            isSensor: false,
            isStatic: false,
            isSleeping: false,
            motion: 0,
            sleepThreshold: 60,
            density: 0.001,
            restitution: 0,
            friction: 0.1,
            frictionStatic: 0.5,
            frictionAir: 0.01,
            collisionFilter: {
                category: 0x0001,
                mask: 0xFFFFFFFF,
                group: 0
            },
            slop: 0.05,
            timeScale: 1,
            render: {
                visible: true,
                opacity: 1,
                strokeStyle: null,
                fillStyle: null,
                lineWidth: null,
                sprite: {
                    xScale: 1,
                    yScale: 1,
                    xOffset: 0,
                    yOffset: 0
                }
            },
            events: null,
            bounds: null,
            chamfer: null,
            circleRadius: 0,
            positionPrev: null,
            anglePrev: 0,
            parent: null,
            axes: null,
            area: 0,
            mass: 0,
            inertia: 0,
            _original: null
        };

        var body = Common.extend(defaults, options);

        _initProperties(body, options);

        return body;
    };

    /**
     * Returns the next unique group index for which bodies will collide.
     * If `isNonColliding` is `true`, returns the next unique group index for which bodies will _not_ collide.
     * See `body.collisionFilter` for more information.
     * @method nextGroup
     * @param {bool} [isNonColliding=false]
     * @return {Number} Unique group index
     */
    Body.nextGroup = function(isNonColliding) {
        if (isNonColliding)
            return Body._nextNonCollidingGroupId--;

        return Body._nextCollidingGroupId++;
    };

    /**
     * Returns the next unique category bitfield (starting after the initial default category `0x0001`).
     * There are 32 available. See `body.collisionFilter` for more information.
     * @method nextCategory
     * @return {Number} Unique category bitfield
     */
    Body.nextCategory = function() {
        Body._nextCategory = Body._nextCategory << 1;
        return Body._nextCategory;
    };

    /**
     * Initialises body properties.
     * @method _initProperties
     * @private
     * @param {body} body
     * @param {} [options]
     */
    var _initProperties = function(body, options) {
        options = options || {};

        // init required properties (order is important)
        Body.set(body, {
            bounds: body.bounds || Bounds.create(body.vertices),
            positionPrev: body.positionPrev || Vector.clone(body.position),
            anglePrev: body.anglePrev || body.angle,
            vertices: body.vertices,
            parts: body.parts || [body],
            isStatic: body.isStatic,
            isSleeping: body.isSleeping,
            parent: body.parent || body
        });

        Vertices.rotate(body.vertices, body.angle, body.position);
        Axes.rotate(body.axes, body.angle);
        Bounds.update(body.bounds, body.vertices, body.velocity);

        // allow options to override the automatically calculated properties
        Body.set(body, {
            axes: options.axes || body.axes,
            area: options.area || body.area,
            mass: options.mass || body.mass,
            inertia: options.inertia || body.inertia
        });

        // render properties
        var defaultFillStyle = (body.isStatic ? '#14151f' : Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1'])),
            defaultStrokeStyle = body.isStatic ? '#555' : '#ccc',
            defaultLineWidth = body.isStatic && body.render.fillStyle === null ? 1 : 0;
        body.render.fillStyle = body.render.fillStyle || defaultFillStyle;
        body.render.strokeStyle = body.render.strokeStyle || defaultStrokeStyle;
        body.render.lineWidth = body.render.lineWidth || defaultLineWidth;
        body.render.sprite.xOffset += -(body.bounds.min.x - body.position.x) / (body.bounds.max.x - body.bounds.min.x);
        body.render.sprite.yOffset += -(body.bounds.min.y - body.position.y) / (body.bounds.max.y - body.bounds.min.y);
    };

    /**
     * Given a property and a value (or map of), sets the property(s) on the body, using the appropriate setter functions if they exist.
     * Prefer to use the actual setter functions in performance critical situations.
     * @method set
     * @param {body} body
     * @param {} settings A property name (or map of properties and values) to set on the body.
     * @param {} value The value to set if `settings` is a single property name.
     */
    Body.set = function(body, settings, value) {
        var property;

        if (typeof settings === 'string') {
            property = settings;
            settings = {};
            settings[property] = value;
        }

        for (property in settings) {
            if (!Object.prototype.hasOwnProperty.call(settings, property))
                continue;

            value = settings[property];
            switch (property) {

            case 'isStatic':
                Body.setStatic(body, value);
                break;
            case 'isSleeping':
                Sleeping.set(body, value);
                break;
            case 'mass':
                Body.setMass(body, value);
                break;
            case 'density':
                Body.setDensity(body, value);
                break;
            case 'inertia':
                Body.setInertia(body, value);
                break;
            case 'vertices':
                Body.setVertices(body, value);
                break;
            case 'position':
                Body.setPosition(body, value);
                break;
            case 'angle':
                Body.setAngle(body, value);
                break;
            case 'velocity':
                Body.setVelocity(body, value);
                break;
            case 'angularVelocity':
                Body.setAngularVelocity(body, value);
                break;
            case 'parts':
                Body.setParts(body, value);
                break;
            case 'centre':
                Body.setCentre(body, value);
                break;
            default:
                body[property] = value;

            }
        }
    };

    /**
     * Sets the body as static, including isStatic flag and setting mass and inertia to Infinity.
     * @method setStatic
     * @param {body} body
     * @param {bool} isStatic
     */
    Body.setStatic = function(body, isStatic) {
        for (var i = 0; i < body.parts.length; i++) {
            var part = body.parts[i];
            part.isStatic = isStatic;

            if (isStatic) {
                part._original = {
                    restitution: part.restitution,
                    friction: part.friction,
                    mass: part.mass,
                    inertia: part.inertia,
                    density: part.density,
                    inverseMass: part.inverseMass,
                    inverseInertia: part.inverseInertia
                };

                part.restitution = 0;
                part.friction = 1;
                part.mass = part.inertia = part.density = Infinity;
                part.inverseMass = part.inverseInertia = 0;

                part.positionPrev.x = part.position.x;
                part.positionPrev.y = part.position.y;
                part.anglePrev = part.angle;
                part.angularVelocity = 0;
                part.speed = 0;
                part.angularSpeed = 0;
                part.motion = 0;
            } else if (part._original) {
                part.restitution = part._original.restitution;
                part.friction = part._original.friction;
                part.mass = part._original.mass;
                part.inertia = part._original.inertia;
                part.density = part._original.density;
                part.inverseMass = part._original.inverseMass;
                part.inverseInertia = part._original.inverseInertia;

                part._original = null;
            }
        }
    };

    /**
     * Sets the mass of the body. Inverse mass, density and inertia are automatically updated to reflect the change.
     * @method setMass
     * @param {body} body
     * @param {number} mass
     */
    Body.setMass = function(body, mass) {
        var moment = body.inertia / (body.mass / 6);
        body.inertia = moment * (mass / 6);
        body.inverseInertia = 1 / body.inertia;

        body.mass = mass;
        body.inverseMass = 1 / body.mass;
        body.density = body.mass / body.area;
    };

    /**
     * Sets the density of the body. Mass and inertia are automatically updated to reflect the change.
     * @method setDensity
     * @param {body} body
     * @param {number} density
     */
    Body.setDensity = function(body, density) {
        Body.setMass(body, density * body.area);
        body.density = density;
    };

    /**
     * Sets the moment of inertia (i.e. second moment of area) of the body. 
     * Inverse inertia is automatically updated to reflect the change. Mass is not changed.
     * @method setInertia
     * @param {body} body
     * @param {number} inertia
     */
    Body.setInertia = function(body, inertia) {
        body.inertia = inertia;
        body.inverseInertia = 1 / body.inertia;
    };

    /**
     * Sets the body's vertices and updates body properties accordingly, including inertia, area and mass (with respect to `body.density`).
     * Vertices will be automatically transformed to be orientated around their centre of mass as the origin.
     * They are then automatically translated to world space based on `body.position`.
     *
     * The `vertices` argument should be passed as an array of `Matter.Vector` points (or a `Matter.Vertices` array).
     * Vertices must form a convex hull, concave hulls are not supported.
     *
     * @method setVertices
     * @param {body} body
     * @param {vector[]} vertices
     */
    Body.setVertices = function(body, vertices) {
        // change vertices
        if (vertices[0].body === body) {
            body.vertices = vertices;
        } else {
            body.vertices = Vertices.create(vertices, body);
        }

        // update properties
        body.axes = Axes.fromVertices(body.vertices);
        body.area = Vertices.area(body.vertices);
        Body.setMass(body, body.density * body.area);

        // orient vertices around the centre of mass at origin (0, 0)
        var centre = Vertices.centre(body.vertices);
        Vertices.translate(body.vertices, centre, -1);

        // update inertia while vertices are at origin (0, 0)
        Body.setInertia(body, Body._inertiaScale * Vertices.inertia(body.vertices, body.mass));

        // update geometry
        Vertices.translate(body.vertices, body.position);
        Bounds.update(body.bounds, body.vertices, body.velocity);
    };

    /**
     * Sets the parts of the `body` and updates mass, inertia and centroid.
     * Each part will have its parent set to `body`.
     * By default the convex hull will be automatically computed and set on `body`, unless `autoHull` is set to `false.`
     * Note that this method will ensure that the first part in `body.parts` will always be the `body`.
     * @method setParts
     * @param {body} body
     * @param [body] parts
     * @param {bool} [autoHull=true]
     */
    Body.setParts = function(body, parts, autoHull) {
        var i;

        // add all the parts, ensuring that the first part is always the parent body
        parts = parts.slice(0);
        body.parts.length = 0;
        body.parts.push(body);
        body.parent = body;

        for (i = 0; i < parts.length; i++) {
            var part = parts[i];
            if (part !== body) {
                part.parent = body;
                body.parts.push(part);
            }
        }

        if (body.parts.length === 1)
            return;

        autoHull = typeof autoHull !== 'undefined' ? autoHull : true;

        // find the convex hull of all parts to set on the parent body
        if (autoHull) {
            var vertices = [];
            for (i = 0; i < parts.length; i++) {
                vertices = vertices.concat(parts[i].vertices);
            }

            Vertices.clockwiseSort(vertices);

            var hull = Vertices.hull(vertices),
                hullCentre = Vertices.centre(hull);

            Body.setVertices(body, hull);
            Vertices.translate(body.vertices, hullCentre);
        }

        // sum the properties of all compound parts of the parent body
        var total = Body._totalProperties(body);

        body.area = total.area;
        body.parent = body;
        body.position.x = total.centre.x;
        body.position.y = total.centre.y;
        body.positionPrev.x = total.centre.x;
        body.positionPrev.y = total.centre.y;

        Body.setMass(body, total.mass);
        Body.setInertia(body, total.inertia);
        Body.setPosition(body, total.centre);
    };

    /**
     * Set the centre of mass of the body. 
     * The `centre` is a vector in world-space unless `relative` is set, in which case it is a translation.
     * The centre of mass is the point the body rotates about and can be used to simulate non-uniform density.
     * This is equal to moving `body.position` but not the `body.vertices`.
     * Invalid if the `centre` falls outside the body's convex hull.
     * @method setCentre
     * @param {body} body
     * @param {vector} centre
     * @param {bool} relative
     */
    Body.setCentre = function(body, centre, relative) {
        if (!relative) {
            body.positionPrev.x = centre.x - (body.position.x - body.positionPrev.x);
            body.positionPrev.y = centre.y - (body.position.y - body.positionPrev.y);
            body.position.x = centre.x;
            body.position.y = centre.y;
        } else {
            body.positionPrev.x += centre.x;
            body.positionPrev.y += centre.y;
            body.position.x += centre.x;
            body.position.y += centre.y;
        }
    };

    /**
     * Sets the position of the body instantly. Velocity, angle, force etc. are unchanged.
     * @method setPosition
     * @param {body} body
     * @param {vector} position
     */
    Body.setPosition = function(body, position) {
        var delta = Vector.sub(position, body.position);
        body.positionPrev.x += delta.x;
        body.positionPrev.y += delta.y;

        for (var i = 0; i < body.parts.length; i++) {
            var part = body.parts[i];
            part.position.x += delta.x;
            part.position.y += delta.y;
            Vertices.translate(part.vertices, delta);
            Bounds.update(part.bounds, part.vertices, body.velocity);
        }
    };

    /**
     * Sets the angle of the body instantly. Angular velocity, position, force etc. are unchanged.
     * @method setAngle
     * @param {body} body
     * @param {number} angle
     */
    Body.setAngle = function(body, angle) {
        var delta = angle - body.angle;
        body.anglePrev += delta;

        for (var i = 0; i < body.parts.length; i++) {
            var part = body.parts[i];
            part.angle += delta;
            Vertices.rotate(part.vertices, delta, body.position);
            Axes.rotate(part.axes, delta);
            Bounds.update(part.bounds, part.vertices, body.velocity);
            if (i > 0) {
                Vector.rotateAbout(part.position, delta, body.position, part.position);
            }
        }
    };

    /**
     * Sets the linear velocity of the body instantly. Position, angle, force etc. are unchanged. See also `Body.applyForce`.
     * @method setVelocity
     * @param {body} body
     * @param {vector} velocity
     */
    Body.setVelocity = function(body, velocity) {
        body.positionPrev.x = body.position.x - velocity.x;
        body.positionPrev.y = body.position.y - velocity.y;
        body.velocity.x = velocity.x;
        body.velocity.y = velocity.y;
        body.speed = Vector.magnitude(body.velocity);
    };

    /**
     * Sets the angular velocity of the body instantly. Position, angle, force etc. are unchanged. See also `Body.applyForce`.
     * @method setAngularVelocity
     * @param {body} body
     * @param {number} velocity
     */
    Body.setAngularVelocity = function(body, velocity) {
        body.anglePrev = body.angle - velocity;
        body.angularVelocity = velocity;
        body.angularSpeed = Math.abs(body.angularVelocity);
    };

    /**
     * Moves a body by a given vector relative to its current position, without imparting any velocity.
     * @method translate
     * @param {body} body
     * @param {vector} translation
     */
    Body.translate = function(body, translation) {
        Body.setPosition(body, Vector.add(body.position, translation));
    };

    /**
     * Rotates a body by a given angle relative to its current angle, without imparting any angular velocity.
     * @method rotate
     * @param {body} body
     * @param {number} rotation
     * @param {vector} [point]
     */
    Body.rotate = function(body, rotation, point) {
        if (!point) {
            Body.setAngle(body, body.angle + rotation);
        } else {
            var cos = Math.cos(rotation),
                sin = Math.sin(rotation),
                dx = body.position.x - point.x,
                dy = body.position.y - point.y;
                
            Body.setPosition(body, {
                x: point.x + (dx * cos - dy * sin),
                y: point.y + (dx * sin + dy * cos)
            });

            Body.setAngle(body, body.angle + rotation);
        }
    };

    /**
     * Scales the body, including updating physical properties (mass, area, axes, inertia), from a world-space point (default is body centre).
     * @method scale
     * @param {body} body
     * @param {number} scaleX
     * @param {number} scaleY
     * @param {vector} [point]
     */
    Body.scale = function(body, scaleX, scaleY, point) {
        var totalArea = 0,
            totalInertia = 0;

        point = point || body.position;

        for (var i = 0; i < body.parts.length; i++) {
            var part = body.parts[i];

            // scale vertices
            Vertices.scale(part.vertices, scaleX, scaleY, point);

            // update properties
            part.axes = Axes.fromVertices(part.vertices);
            part.area = Vertices.area(part.vertices);
            Body.setMass(part, body.density * part.area);

            // update inertia (requires vertices to be at origin)
            Vertices.translate(part.vertices, { x: -part.position.x, y: -part.position.y });
            Body.setInertia(part, Body._inertiaScale * Vertices.inertia(part.vertices, part.mass));
            Vertices.translate(part.vertices, { x: part.position.x, y: part.position.y });

            if (i > 0) {
                totalArea += part.area;
                totalInertia += part.inertia;
            }

            // scale position
            part.position.x = point.x + (part.position.x - point.x) * scaleX;
            part.position.y = point.y + (part.position.y - point.y) * scaleY;

            // update bounds
            Bounds.update(part.bounds, part.vertices, body.velocity);
        }

        // handle parent body
        if (body.parts.length > 1) {
            body.area = totalArea;

            if (!body.isStatic) {
                Body.setMass(body, body.density * totalArea);
                Body.setInertia(body, totalInertia);
            }
        }

        // handle circles
        if (body.circleRadius) { 
            if (scaleX === scaleY) {
                body.circleRadius *= scaleX;
            } else {
                // body is no longer a circle
                body.circleRadius = null;
            }
        }
    };

    /**
     * Performs a simulation step for the given `body`, including updating position and angle using Verlet integration.
     * @method update
     * @param {body} body
     * @param {number} deltaTime
     * @param {number} timeScale
     * @param {number} correction
     */
    Body.update = function(body, deltaTime, timeScale, correction) {
        var deltaTimeSquared = Math.pow(deltaTime * timeScale * body.timeScale, 2);

        // from the previous step
        var frictionAir = 1 - body.frictionAir * timeScale * body.timeScale,
            velocityPrevX = body.position.x - body.positionPrev.x,
            velocityPrevY = body.position.y - body.positionPrev.y;

        // update velocity with Verlet integration
        body.velocity.x = (velocityPrevX * frictionAir * correction) + (body.force.x / body.mass) * deltaTimeSquared;
        body.velocity.y = (velocityPrevY * frictionAir * correction) + (body.force.y / body.mass) * deltaTimeSquared;

        body.positionPrev.x = body.position.x;
        body.positionPrev.y = body.position.y;
        body.position.x += body.velocity.x;
        body.position.y += body.velocity.y;

        // update angular velocity with Verlet integration
        body.angularVelocity = ((body.angle - body.anglePrev) * frictionAir * correction) + (body.torque / body.inertia) * deltaTimeSquared;
        body.anglePrev = body.angle;
        body.angle += body.angularVelocity;

        // track speed and acceleration
        body.speed = Vector.magnitude(body.velocity);
        body.angularSpeed = Math.abs(body.angularVelocity);

        // transform the body geometry
        for (var i = 0; i < body.parts.length; i++) {
            var part = body.parts[i];

            Vertices.translate(part.vertices, body.velocity);
            
            if (i > 0) {
                part.position.x += body.velocity.x;
                part.position.y += body.velocity.y;
            }

            if (body.angularVelocity !== 0) {
                Vertices.rotate(part.vertices, body.angularVelocity, body.position);
                Axes.rotate(part.axes, body.angularVelocity);
                if (i > 0) {
                    Vector.rotateAbout(part.position, body.angularVelocity, body.position, part.position);
                }
            }

            Bounds.update(part.bounds, part.vertices, body.velocity);
        }
    };

    /**
     * Applies a force to a body from a given world-space position, including resulting torque.
     * @method applyForce
     * @param {body} body
     * @param {vector} position
     * @param {vector} force
     */
    Body.applyForce = function(body, position, force) {
        body.force.x += force.x;
        body.force.y += force.y;
        var offset = { x: position.x - body.position.x, y: position.y - body.position.y };
        body.torque += offset.x * force.y - offset.y * force.x;
    };

    /**
     * Returns the sums of the properties of all compound parts of the parent body.
     * @method _totalProperties
     * @private
     * @param {body} body
     * @return {}
     */
    Body._totalProperties = function(body) {
        // from equations at:
        // https://ecourses.ou.edu/cgi-bin/ebook.cgi?doc=&topic=st&chap_sec=07.2&page=theory
        // http://output.to/sideway/default.asp?qno=121100087

        var properties = {
            mass: 0,
            area: 0,
            inertia: 0,
            centre: { x: 0, y: 0 }
        };

        // sum the properties of all compound parts of the parent body
        for (var i = body.parts.length === 1 ? 0 : 1; i < body.parts.length; i++) {
            var part = body.parts[i],
                mass = part.mass !== Infinity ? part.mass : 1;

            properties.mass += mass;
            properties.area += part.area;
            properties.inertia += part.inertia;
            properties.centre = Vector.add(properties.centre, Vector.mult(part.position, mass));
        }

        properties.centre = Vector.div(properties.centre, properties.mass);

        return properties;
    };

    /*
    *
    *  Events Documentation
    *
    */

    /**
    * Fired when a body starts sleeping (where `this` is the body).
    *
    * @event sleepStart
    * @this {body} The body that has started sleeping
    * @param {} event An event object
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when a body ends sleeping (where `this` is the body).
    *
    * @event sleepEnd
    * @this {body} The body that has ended sleeping
    * @param {} event An event object
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * An integer `Number` uniquely identifying number generated in `Body.create` by `Common.nextId`.
     *
     * @property id
     * @type number
     */

    /**
     * A `String` denoting the type of object.
     *
     * @property type
     * @type string
     * @default "body"
     * @readOnly
     */

    /**
     * An arbitrary `String` name to help the user identify and manage bodies.
     *
     * @property label
     * @type string
     * @default "Body"
     */

    /**
     * An array of bodies that make up this body. 
     * The first body in the array must always be a self reference to the current body instance.
     * All bodies in the `parts` array together form a single rigid compound body.
     * Parts are allowed to overlap, have gaps or holes or even form concave bodies.
     * Parts themselves should never be added to a `World`, only the parent body should be.
     * Use `Body.setParts` when setting parts to ensure correct updates of all properties.
     *
     * @property parts
     * @type body[]
     */

    /**
     * An object reserved for storing plugin-specific properties.
     *
     * @property plugin
     * @type {}
     */

    /**
     * A self reference if the body is _not_ a part of another body.
     * Otherwise this is a reference to the body that this is a part of.
     * See `body.parts`.
     *
     * @property parent
     * @type body
     */

    /**
     * A `Number` specifying the angle of the body, in radians.
     *
     * @property angle
     * @type number
     * @default 0
     */

    /**
     * An array of `Vector` objects that specify the convex hull of the rigid body.
     * These should be provided about the origin `(0, 0)`. E.g.
     *
     *     [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }]
     *
     * When passed via `Body.create`, the vertices are translated relative to `body.position` (i.e. world-space, and constantly updated by `Body.update` during simulation).
     * The `Vector` objects are also augmented with additional properties required for efficient collision detection. 
     *
     * Other properties such as `inertia` and `bounds` are automatically calculated from the passed vertices (unless provided via `options`).
     * Concave hulls are not currently supported. The module `Matter.Vertices` contains useful methods for working with vertices.
     *
     * @property vertices
     * @type vector[]
     */

    /**
     * A `Vector` that specifies the current world-space position of the body.
     *
     * @property position
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * A `Vector` that specifies the force to apply in the current step. It is zeroed after every `Body.update`. See also `Body.applyForce`.
     *
     * @property force
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * A `Number` that specifies the torque (turning force) to apply in the current step. It is zeroed after every `Body.update`.
     *
     * @property torque
     * @type number
     * @default 0
     */

    /**
     * A `Number` that _measures_ the current speed of the body after the last `Body.update`. It is read-only and always positive (it's the magnitude of `body.velocity`).
     *
     * @readOnly
     * @property speed
     * @type number
     * @default 0
     */

    /**
     * A `Number` that _measures_ the current angular speed of the body after the last `Body.update`. It is read-only and always positive (it's the magnitude of `body.angularVelocity`).
     *
     * @readOnly
     * @property angularSpeed
     * @type number
     * @default 0
     */

    /**
     * A `Vector` that _measures_ the current velocity of the body after the last `Body.update`. It is read-only. 
     * If you need to modify a body's velocity directly, you should either apply a force or simply change the body's `position` (as the engine uses position-Verlet integration).
     *
     * @readOnly
     * @property velocity
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * A `Number` that _measures_ the current angular velocity of the body after the last `Body.update`. It is read-only. 
     * If you need to modify a body's angular velocity directly, you should apply a torque or simply change the body's `angle` (as the engine uses position-Verlet integration).
     *
     * @readOnly
     * @property angularVelocity
     * @type number
     * @default 0
     */

    /**
     * A flag that indicates whether a body is considered static. A static body can never change position or angle and is completely fixed.
     * If you need to set a body as static after its creation, you should use `Body.setStatic` as this requires more than just setting this flag.
     *
     * @property isStatic
     * @type boolean
     * @default false
     */

    /**
     * A flag that indicates whether a body is a sensor. Sensor triggers collision events, but doesn't react with colliding body physically.
     *
     * @property isSensor
     * @type boolean
     * @default false
     */

    /**
     * A flag that indicates whether the body is considered sleeping. A sleeping body acts similar to a static body, except it is only temporary and can be awoken.
     * If you need to set a body as sleeping, you should use `Sleeping.set` as this requires more than just setting this flag.
     *
     * @property isSleeping
     * @type boolean
     * @default false
     */

    /**
     * A `Number` that _measures_ the amount of movement a body currently has (a combination of `speed` and `angularSpeed`). It is read-only and always positive.
     * It is used and updated by the `Matter.Sleeping` module during simulation to decide if a body has come to rest.
     *
     * @readOnly
     * @property motion
     * @type number
     * @default 0
     */

    /**
     * A `Number` that defines the number of updates in which this body must have near-zero velocity before it is set as sleeping by the `Matter.Sleeping` module (if sleeping is enabled by the engine).
     *
     * @property sleepThreshold
     * @type number
     * @default 60
     */

    /**
     * A `Number` that defines the density of the body, that is its mass per unit area.
     * If you pass the density via `Body.create` the `mass` property is automatically calculated for you based on the size (area) of the object.
     * This is generally preferable to simply setting mass and allows for more intuitive definition of materials (e.g. rock has a higher density than wood).
     *
     * @property density
     * @type number
     * @default 0.001
     */

    /**
     * A `Number` that defines the mass of the body, although it may be more appropriate to specify the `density` property instead.
     * If you modify this value, you must also modify the `body.inverseMass` property (`1 / mass`).
     *
     * @property mass
     * @type number
     */

    /**
     * A `Number` that defines the inverse mass of the body (`1 / mass`).
     * If you modify this value, you must also modify the `body.mass` property.
     *
     * @property inverseMass
     * @type number
     */

    /**
     * A `Number` that defines the moment of inertia (i.e. second moment of area) of the body.
     * It is automatically calculated from the given convex hull (`vertices` array) and density in `Body.create`.
     * If you modify this value, you must also modify the `body.inverseInertia` property (`1 / inertia`).
     *
     * @property inertia
     * @type number
     */

    /**
     * A `Number` that defines the inverse moment of inertia of the body (`1 / inertia`).
     * If you modify this value, you must also modify the `body.inertia` property.
     *
     * @property inverseInertia
     * @type number
     */

    /**
     * A `Number` that defines the restitution (elasticity) of the body. The value is always positive and is in the range `(0, 1)`.
     * A value of `0` means collisions may be perfectly inelastic and no bouncing may occur. 
     * A value of `0.8` means the body may bounce back with approximately 80% of its kinetic energy.
     * Note that collision response is based on _pairs_ of bodies, and that `restitution` values are _combined_ with the following formula:
     *
     *     Math.max(bodyA.restitution, bodyB.restitution)
     *
     * @property restitution
     * @type number
     * @default 0
     */

    /**
     * A `Number` that defines the friction of the body. The value is always positive and is in the range `(0, 1)`.
     * A value of `0` means that the body may slide indefinitely.
     * A value of `1` means the body may come to a stop almost instantly after a force is applied.
     *
     * The effects of the value may be non-linear. 
     * High values may be unstable depending on the body.
     * The engine uses a Coulomb friction model including static and kinetic friction.
     * Note that collision response is based on _pairs_ of bodies, and that `friction` values are _combined_ with the following formula:
     *
     *     Math.min(bodyA.friction, bodyB.friction)
     *
     * @property friction
     * @type number
     * @default 0.1
     */

    /**
     * A `Number` that defines the static friction of the body (in the Coulomb friction model). 
     * A value of `0` means the body will never 'stick' when it is nearly stationary and only dynamic `friction` is used.
     * The higher the value (e.g. `10`), the more force it will take to initially get the body moving when nearly stationary.
     * This value is multiplied with the `friction` property to make it easier to change `friction` and maintain an appropriate amount of static friction.
     *
     * @property frictionStatic
     * @type number
     * @default 0.5
     */

    /**
     * A `Number` that defines the air friction of the body (air resistance). 
     * A value of `0` means the body will never slow as it moves through space.
     * The higher the value, the faster a body slows when moving through space.
     * The effects of the value are non-linear. 
     *
     * @property frictionAir
     * @type number
     * @default 0.01
     */

    /**
     * An `Object` that specifies the collision filtering properties of this body.
     *
     * Collisions between two bodies will obey the following rules:
     * - If the two bodies have the same non-zero value of `collisionFilter.group`,
     *   they will always collide if the value is positive, and they will never collide
     *   if the value is negative.
     * - If the two bodies have different values of `collisionFilter.group` or if one
     *   (or both) of the bodies has a value of 0, then the category/mask rules apply as follows:
     *
     * Each body belongs to a collision category, given by `collisionFilter.category`. This
     * value is used as a bit field and the category should have only one bit set, meaning that
     * the value of this property is a power of two in the range [1, 2^31]. Thus, there are 32
     * different collision categories available.
     *
     * Each body also defines a collision bitmask, given by `collisionFilter.mask` which specifies
     * the categories it collides with (the value is the bitwise AND value of all these categories).
     *
     * Using the category/mask rules, two bodies `A` and `B` collide if each includes the other's
     * category in its mask, i.e. `(categoryA & maskB) !== 0` and `(categoryB & maskA) !== 0`
     * are both true.
     *
     * @property collisionFilter
     * @type object
     */

    /**
     * An Integer `Number`, that specifies the collision group this body belongs to.
     * See `body.collisionFilter` for more information.
     *
     * @property collisionFilter.group
     * @type object
     * @default 0
     */

    /**
     * A bit field that specifies the collision category this body belongs to.
     * The category value should have only one bit set, for example `0x0001`.
     * This means there are up to 32 unique collision categories available.
     * See `body.collisionFilter` for more information.
     *
     * @property collisionFilter.category
     * @type object
     * @default 1
     */

    /**
     * A bit mask that specifies the collision categories this body may collide with.
     * See `body.collisionFilter` for more information.
     *
     * @property collisionFilter.mask
     * @type object
     * @default -1
     */

    /**
     * A `Number` that specifies a tolerance on how far a body is allowed to 'sink' or rotate into other bodies.
     * Avoid changing this value unless you understand the purpose of `slop` in physics engines.
     * The default should generally suffice, although very large bodies may require larger values for stable stacking.
     *
     * @property slop
     * @type number
     * @default 0.05
     */

    /**
     * A `Number` that allows per-body time scaling, e.g. a force-field where bodies inside are in slow-motion, while others are at full speed.
     *
     * @property timeScale
     * @type number
     * @default 1
     */

    /**
     * An `Object` that defines the rendering properties to be consumed by the module `Matter.Render`.
     *
     * @property render
     * @type object
     */

    /**
     * A flag that indicates if the body should be rendered.
     *
     * @property render.visible
     * @type boolean
     * @default true
     */

    /**
     * Sets the opacity to use when rendering.
     *
     * @property render.opacity
     * @type number
     * @default 1
    */

    /**
     * An `Object` that defines the sprite properties to use when rendering, if any.
     *
     * @property render.sprite
     * @type object
     */

    /**
     * An `String` that defines the path to the image to use as the sprite texture, if any.
     *
     * @property render.sprite.texture
     * @type string
     */
     
    /**
     * A `Number` that defines the scaling in the x-axis for the sprite, if any.
     *
     * @property render.sprite.xScale
     * @type number
     * @default 1
     */

    /**
     * A `Number` that defines the scaling in the y-axis for the sprite, if any.
     *
     * @property render.sprite.yScale
     * @type number
     * @default 1
     */

    /**
      * A `Number` that defines the offset in the x-axis for the sprite (normalised by texture width).
      *
      * @property render.sprite.xOffset
      * @type number
      * @default 0
      */

    /**
      * A `Number` that defines the offset in the y-axis for the sprite (normalised by texture height).
      *
      * @property render.sprite.yOffset
      * @type number
      * @default 0
      */

    /**
     * A `Number` that defines the line width to use when rendering the body outline (if a sprite is not defined).
     * A value of `0` means no outline will be rendered.
     *
     * @property render.lineWidth
     * @type number
     * @default 0
     */

    /**
     * A `String` that defines the fill style to use when rendering the body (if a sprite is not defined).
     * It is the same as when using a canvas, so it accepts CSS style property values.
     *
     * @property render.fillStyle
     * @type string
     * @default a random colour
     */

    /**
     * A `String` that defines the stroke style to use when rendering the body outline (if a sprite is not defined).
     * It is the same as when using a canvas, so it accepts CSS style property values.
     *
     * @property render.strokeStyle
     * @type string
     * @default a random colour
     */

    /**
     * An array of unique axis vectors (edge normals) used for collision detection.
     * These are automatically calculated from the given convex hull (`vertices` array) in `Body.create`.
     * They are constantly updated by `Body.update` during the simulation.
     *
     * @property axes
     * @type vector[]
     */
     
    /**
     * A `Number` that _measures_ the area of the body's convex hull, calculated at creation by `Body.create`.
     *
     * @property area
     * @type string
     * @default 
     */

    /**
     * A `Bounds` object that defines the AABB region for the body.
     * It is automatically calculated from the given convex hull (`vertices` array) in `Body.create` and constantly updated by `Body.update` during simulation.
     *
     * @property bounds
     * @type bounds
     */

})();


/***/ }),
/* 7 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Sleeping` module contains methods to manage the sleeping state of bodies.
*
* @class Sleeping
*/

var Sleeping = {};

module.exports = Sleeping;

var Events = __webpack_require__(4);

(function() {

    Sleeping._motionWakeThreshold = 0.18;
    Sleeping._motionSleepThreshold = 0.08;
    Sleeping._minBias = 0.9;

    /**
     * Puts bodies to sleep or wakes them up depending on their motion.
     * @method update
     * @param {body[]} bodies
     * @param {number} timeScale
     */
    Sleeping.update = function(bodies, timeScale) {
        var timeFactor = timeScale * timeScale * timeScale;

        // update bodies sleeping status
        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i],
                motion = body.speed * body.speed + body.angularSpeed * body.angularSpeed;

            // wake up bodies if they have a force applied
            if (body.force.x !== 0 || body.force.y !== 0) {
                Sleeping.set(body, false);
                continue;
            }

            var minMotion = Math.min(body.motion, motion),
                maxMotion = Math.max(body.motion, motion);
        
            // biased average motion estimation between frames
            body.motion = Sleeping._minBias * minMotion + (1 - Sleeping._minBias) * maxMotion;
            
            if (body.sleepThreshold > 0 && body.motion < Sleeping._motionSleepThreshold * timeFactor) {
                body.sleepCounter += 1;
                
                if (body.sleepCounter >= body.sleepThreshold)
                    Sleeping.set(body, true);
            } else if (body.sleepCounter > 0) {
                body.sleepCounter -= 1;
            }
        }
    };

    /**
     * Given a set of colliding pairs, wakes the sleeping bodies involved.
     * @method afterCollisions
     * @param {pair[]} pairs
     * @param {number} timeScale
     */
    Sleeping.afterCollisions = function(pairs, timeScale) {
        var timeFactor = timeScale * timeScale * timeScale;

        // wake up bodies involved in collisions
        for (var i = 0; i < pairs.length; i++) {
            var pair = pairs[i];
            
            // don't wake inactive pairs
            if (!pair.isActive)
                continue;

            var collision = pair.collision,
                bodyA = collision.bodyA.parent, 
                bodyB = collision.bodyB.parent;
        
            // don't wake if at least one body is static
            if ((bodyA.isSleeping && bodyB.isSleeping) || bodyA.isStatic || bodyB.isStatic)
                continue;
        
            if (bodyA.isSleeping || bodyB.isSleeping) {
                var sleepingBody = (bodyA.isSleeping && !bodyA.isStatic) ? bodyA : bodyB,
                    movingBody = sleepingBody === bodyA ? bodyB : bodyA;

                if (!sleepingBody.isStatic && movingBody.motion > Sleeping._motionWakeThreshold * timeFactor) {
                    Sleeping.set(sleepingBody, false);
                }
            }
        }
    };
  
    /**
     * Set a body as sleeping or awake.
     * @method set
     * @param {body} body
     * @param {boolean} isSleeping
     */
    Sleeping.set = function(body, isSleeping) {
        var wasSleeping = body.isSleeping;

        if (isSleeping) {
            body.isSleeping = true;
            body.sleepCounter = body.sleepThreshold;

            body.positionImpulse.x = 0;
            body.positionImpulse.y = 0;

            body.positionPrev.x = body.position.x;
            body.positionPrev.y = body.position.y;

            body.anglePrev = body.angle;
            body.speed = 0;
            body.angularSpeed = 0;
            body.motion = 0;

            if (!wasSleeping) {
                Events.trigger(body, 'sleepStart');
            }
        } else {
            body.isSleeping = false;
            body.sleepCounter = 0;

            if (wasSleeping) {
                Events.trigger(body, 'sleepEnd');
            }
        }
    };

})();


/***/ }),
/* 8 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Collision` module contains methods for detecting collisions between a given pair of bodies.
*
* For efficient detection between a list of bodies, see `Matter.Detector` and `Matter.Query`.
*
* See `Matter.Engine` for collision events.
*
* @class Collision
*/

var Collision = {};

module.exports = Collision;

var Vertices = __webpack_require__(3);
var Pair = __webpack_require__(9);

(function() {
    var _supports = [];

    var _overlapAB = {
        overlap: 0,
        axis: null
    };

    var _overlapBA = {
        overlap: 0,
        axis: null
    };

    /**
     * Creates a new collision record.
     * @method create
     * @param {body} bodyA The first body part represented by the collision record
     * @param {body} bodyB The second body part represented by the collision record
     * @return {collision} A new collision record
     */
    Collision.create = function(bodyA, bodyB) {
        return { 
            pair: null,
            collided: false,
            bodyA: bodyA,
            bodyB: bodyB,
            parentA: bodyA.parent,
            parentB: bodyB.parent,
            depth: 0,
            normal: { x: 0, y: 0 },
            tangent: { x: 0, y: 0 },
            penetration: { x: 0, y: 0 },
            supports: []
        };
    };

    /**
     * Detect collision between two bodies.
     * @method collides
     * @param {body} bodyA
     * @param {body} bodyB
     * @param {pairs} [pairs] Optionally reuse collision records from existing pairs.
     * @return {collision|null} A collision record if detected, otherwise null
     */
    Collision.collides = function(bodyA, bodyB, pairs) {
        Collision._overlapAxes(_overlapAB, bodyA.vertices, bodyB.vertices, bodyA.axes);

        if (_overlapAB.overlap <= 0) {
            return null;
        }

        Collision._overlapAxes(_overlapBA, bodyB.vertices, bodyA.vertices, bodyB.axes);

        if (_overlapBA.overlap <= 0) {
            return null;
        }

        // reuse collision records for gc efficiency
        var pair = pairs && pairs.table[Pair.id(bodyA, bodyB)],
            collision;

        if (!pair) {
            collision = Collision.create(bodyA, bodyB);
            collision.collided = true;
            collision.bodyA = bodyA.id < bodyB.id ? bodyA : bodyB;
            collision.bodyB = bodyA.id < bodyB.id ? bodyB : bodyA;
            collision.parentA = collision.bodyA.parent;
            collision.parentB = collision.bodyB.parent;
        } else {
            collision = pair.collision;
        }

        bodyA = collision.bodyA;
        bodyB = collision.bodyB;

        var minOverlap;

        if (_overlapAB.overlap < _overlapBA.overlap) {
            minOverlap = _overlapAB;
        } else {
            minOverlap = _overlapBA;
        }

        var normal = collision.normal,
            supports = collision.supports,
            minAxis = minOverlap.axis,
            minAxisX = minAxis.x,
            minAxisY = minAxis.y;

        // ensure normal is facing away from bodyA
        if (minAxisX * (bodyB.position.x - bodyA.position.x) + minAxisY * (bodyB.position.y - bodyA.position.y) < 0) {
            normal.x = minAxisX;
            normal.y = minAxisY;
        } else {
            normal.x = -minAxisX;
            normal.y = -minAxisY;
        }
        
        collision.tangent.x = -normal.y;
        collision.tangent.y = normal.x;

        collision.depth = minOverlap.overlap;

        collision.penetration.x = normal.x * collision.depth;
        collision.penetration.y = normal.y * collision.depth;

        // find support points, there is always either exactly one or two
        var supportsB = Collision._findSupports(bodyA, bodyB, normal, 1),
            supportCount = 0;

        // find the supports from bodyB that are inside bodyA
        if (Vertices.contains(bodyA.vertices, supportsB[0])) {
            supports[supportCount++] = supportsB[0];
        }

        if (Vertices.contains(bodyA.vertices, supportsB[1])) {
            supports[supportCount++] = supportsB[1];
        }

        // find the supports from bodyA that are inside bodyB
        if (supportCount < 2) {
            var supportsA = Collision._findSupports(bodyB, bodyA, normal, -1);

            if (Vertices.contains(bodyB.vertices, supportsA[0])) {
                supports[supportCount++] = supportsA[0];
            }

            if (supportCount < 2 && Vertices.contains(bodyB.vertices, supportsA[1])) {
                supports[supportCount++] = supportsA[1];
            }
        }

        // account for the edge case of overlapping but no vertex containment
        if (supportCount === 0) {
            supports[supportCount++] = supportsB[0];
        }

        // update supports array size
        supports.length = supportCount;

        return collision;
    };

    /**
     * Find the overlap between two sets of vertices.
     * @method _overlapAxes
     * @private
     * @param {object} result
     * @param {vertices} verticesA
     * @param {vertices} verticesB
     * @param {axes} axes
     */
    Collision._overlapAxes = function(result, verticesA, verticesB, axes) {
        var verticesALength = verticesA.length,
            verticesBLength = verticesB.length,
            verticesAX = verticesA[0].x,
            verticesAY = verticesA[0].y,
            verticesBX = verticesB[0].x,
            verticesBY = verticesB[0].y,
            axesLength = axes.length,
            overlapMin = Number.MAX_VALUE,
            overlapAxisNumber = 0,
            overlap,
            overlapAB,
            overlapBA,
            dot,
            i,
            j;

        for (i = 0; i < axesLength; i++) {
            var axis = axes[i],
                axisX = axis.x,
                axisY = axis.y,
                minA = verticesAX * axisX + verticesAY * axisY,
                minB = verticesBX * axisX + verticesBY * axisY,
                maxA = minA,
                maxB = minB;
            
            for (j = 1; j < verticesALength; j += 1) {
                dot = verticesA[j].x * axisX + verticesA[j].y * axisY;

                if (dot > maxA) { 
                    maxA = dot;
                } else if (dot < minA) { 
                    minA = dot;
                }
            }

            for (j = 1; j < verticesBLength; j += 1) {
                dot = verticesB[j].x * axisX + verticesB[j].y * axisY;

                if (dot > maxB) { 
                    maxB = dot;
                } else if (dot < minB) { 
                    minB = dot;
                }
            }

            overlapAB = maxA - minB;
            overlapBA = maxB - minA;
            overlap = overlapAB < overlapBA ? overlapAB : overlapBA;

            if (overlap < overlapMin) {
                overlapMin = overlap;
                overlapAxisNumber = i;

                if (overlap <= 0) {
                    // can not be intersecting
                    break;
                }
            } 
        }

        result.axis = axes[overlapAxisNumber];
        result.overlap = overlapMin;
    };

    /**
     * Projects vertices on an axis and returns an interval.
     * @method _projectToAxis
     * @private
     * @param {} projection
     * @param {} vertices
     * @param {} axis
     */
    Collision._projectToAxis = function(projection, vertices, axis) {
        var min = vertices[0].x * axis.x + vertices[0].y * axis.y,
            max = min;

        for (var i = 1; i < vertices.length; i += 1) {
            var dot = vertices[i].x * axis.x + vertices[i].y * axis.y;

            if (dot > max) { 
                max = dot; 
            } else if (dot < min) { 
                min = dot; 
            }
        }

        projection.min = min;
        projection.max = max;
    };

    /**
     * Finds supporting vertices given two bodies along a given direction using hill-climbing.
     * @method _findSupports
     * @private
     * @param {body} bodyA
     * @param {body} bodyB
     * @param {vector} normal
     * @param {number} direction
     * @return [vector]
     */
    Collision._findSupports = function(bodyA, bodyB, normal, direction) {
        var vertices = bodyB.vertices,
            verticesLength = vertices.length,
            bodyAPositionX = bodyA.position.x,
            bodyAPositionY = bodyA.position.y,
            normalX = normal.x * direction,
            normalY = normal.y * direction,
            nearestDistance = Number.MAX_VALUE,
            vertexA,
            vertexB,
            vertexC,
            distance,
            j;

        // find deepest vertex relative to the axis
        for (j = 0; j < verticesLength; j += 1) {
            vertexB = vertices[j];
            distance = normalX * (bodyAPositionX - vertexB.x) + normalY * (bodyAPositionY - vertexB.y);

            // convex hill-climbing
            if (distance < nearestDistance) {
                nearestDistance = distance;
                vertexA = vertexB;
            }
        }

        // measure next vertex
        vertexC = vertices[(verticesLength + vertexA.index - 1) % verticesLength];
        nearestDistance = normalX * (bodyAPositionX - vertexC.x) + normalY * (bodyAPositionY - vertexC.y);

        // compare with previous vertex
        vertexB = vertices[(vertexA.index + 1) % verticesLength];
        if (normalX * (bodyAPositionX - vertexB.x) + normalY * (bodyAPositionY - vertexB.y) < nearestDistance) {
            _supports[0] = vertexA;
            _supports[1] = vertexB;

            return _supports;
        }

        _supports[0] = vertexA;
        _supports[1] = vertexC;

        return _supports;
    };

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * A reference to the pair using this collision record, if there is one.
     *
     * @property pair
     * @type {pair|null}
     * @default null
     */

    /**
     * A flag that indicates if the bodies were colliding when the collision was last updated.
     * 
     * @property collided
     * @type boolean
     * @default false
     */

    /**
     * The first body part represented by the collision (see also `collision.parentA`).
     * 
     * @property bodyA
     * @type body
     */

    /**
     * The second body part represented by the collision (see also `collision.parentB`).
     * 
     * @property bodyB
     * @type body
     */

    /**
     * The first body represented by the collision (i.e. `collision.bodyA.parent`).
     * 
     * @property parentA
     * @type body
     */

    /**
     * The second body represented by the collision (i.e. `collision.bodyB.parent`).
     * 
     * @property parentB
     * @type body
     */

    /**
     * A `Number` that represents the minimum separating distance between the bodies along the collision normal.
     *
     * @readOnly
     * @property depth
     * @type number
     * @default 0
     */

    /**
     * A normalised `Vector` that represents the direction between the bodies that provides the minimum separating distance.
     *
     * @property normal
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * A normalised `Vector` that is the tangent direction to the collision normal.
     *
     * @property tangent
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * A `Vector` that represents the direction and depth of the collision.
     *
     * @property penetration
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * An array of body vertices that represent the support points in the collision.
     * These are the deepest vertices (along the collision normal) of each body that are contained by the other body's vertices.
     *
     * @property supports
     * @type vector[]
     * @default []
     */

})();


/***/ }),
/* 9 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Pair` module contains methods for creating and manipulating collision pairs.
*
* @class Pair
*/

var Pair = {};

module.exports = Pair;

var Contact = __webpack_require__(17);

(function() {
    
    /**
     * Creates a pair.
     * @method create
     * @param {collision} collision
     * @param {number} timestamp
     * @return {pair} A new pair
     */
    Pair.create = function(collision, timestamp) {
        var bodyA = collision.bodyA,
            bodyB = collision.bodyB;

        var pair = {
            id: Pair.id(bodyA, bodyB),
            bodyA: bodyA,
            bodyB: bodyB,
            collision: collision,
            contacts: [],
            activeContacts: [],
            separation: 0,
            isActive: true,
            confirmedActive: true,
            isSensor: bodyA.isSensor || bodyB.isSensor,
            timeCreated: timestamp,
            timeUpdated: timestamp,
            inverseMass: 0,
            friction: 0,
            frictionStatic: 0,
            restitution: 0,
            slop: 0
        };

        Pair.update(pair, collision, timestamp);

        return pair;
    };

    /**
     * Updates a pair given a collision.
     * @method update
     * @param {pair} pair
     * @param {collision} collision
     * @param {number} timestamp
     */
    Pair.update = function(pair, collision, timestamp) {
        var contacts = pair.contacts,
            supports = collision.supports,
            activeContacts = pair.activeContacts,
            parentA = collision.parentA,
            parentB = collision.parentB,
            parentAVerticesLength = parentA.vertices.length;
        
        pair.isActive = true;
        pair.timeUpdated = timestamp;
        pair.collision = collision;
        pair.separation = collision.depth;
        pair.inverseMass = parentA.inverseMass + parentB.inverseMass;
        pair.friction = parentA.friction < parentB.friction ? parentA.friction : parentB.friction;
        pair.frictionStatic = parentA.frictionStatic > parentB.frictionStatic ? parentA.frictionStatic : parentB.frictionStatic;
        pair.restitution = parentA.restitution > parentB.restitution ? parentA.restitution : parentB.restitution;
        pair.slop = parentA.slop > parentB.slop ? parentA.slop : parentB.slop;

        collision.pair = pair;
        activeContacts.length = 0;
        
        for (var i = 0; i < supports.length; i++) {
            var support = supports[i],
                contactId = support.body === parentA ? support.index : parentAVerticesLength + support.index,
                contact = contacts[contactId];

            if (contact) {
                activeContacts.push(contact);
            } else {
                activeContacts.push(contacts[contactId] = Contact.create(support));
            }
        }
    };
    
    /**
     * Set a pair as active or inactive.
     * @method setActive
     * @param {pair} pair
     * @param {bool} isActive
     * @param {number} timestamp
     */
    Pair.setActive = function(pair, isActive, timestamp) {
        if (isActive) {
            pair.isActive = true;
            pair.timeUpdated = timestamp;
        } else {
            pair.isActive = false;
            pair.activeContacts.length = 0;
        }
    };

    /**
     * Get the id for the given pair.
     * @method id
     * @param {body} bodyA
     * @param {body} bodyB
     * @return {string} Unique pairId
     */
    Pair.id = function(bodyA, bodyB) {
        if (bodyA.id < bodyB.id) {
            return 'A' + bodyA.id + 'B' + bodyB.id;
        } else {
            return 'A' + bodyB.id + 'B' + bodyA.id;
        }
    };

})();


/***/ }),
/* 10 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Constraint` module contains methods for creating and manipulating constraints.
* Constraints are used for specifying that a fixed distance must be maintained between two bodies (or a body and a fixed world-space position).
* The stiffness of constraints can be modified to create springs or elastic.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Constraint
*/

var Constraint = {};

module.exports = Constraint;

var Vertices = __webpack_require__(3);
var Vector = __webpack_require__(2);
var Sleeping = __webpack_require__(7);
var Bounds = __webpack_require__(1);
var Axes = __webpack_require__(11);
var Common = __webpack_require__(0);

(function() {

    Constraint._warming = 0.4;
    Constraint._torqueDampen = 1;
    Constraint._minLength = 0.000001;

    /**
     * Creates a new constraint.
     * All properties have default values, and many are pre-calculated automatically based on other properties.
     * To simulate a revolute constraint (or pin joint) set `length: 0` and a high `stiffness` value (e.g. `0.7` or above).
     * If the constraint is unstable, try lowering the `stiffness` value and / or increasing `engine.constraintIterations`.
     * For compound bodies, constraints must be applied to the parent body (not one of its parts).
     * See the properties section below for detailed information on what you can pass via the `options` object.
     * @method create
     * @param {} options
     * @return {constraint} constraint
     */
    Constraint.create = function(options) {
        var constraint = options;

        // if bodies defined but no points, use body centre
        if (constraint.bodyA && !constraint.pointA)
            constraint.pointA = { x: 0, y: 0 };
        if (constraint.bodyB && !constraint.pointB)
            constraint.pointB = { x: 0, y: 0 };

        // calculate static length using initial world space points
        var initialPointA = constraint.bodyA ? Vector.add(constraint.bodyA.position, constraint.pointA) : constraint.pointA,
            initialPointB = constraint.bodyB ? Vector.add(constraint.bodyB.position, constraint.pointB) : constraint.pointB,
            length = Vector.magnitude(Vector.sub(initialPointA, initialPointB));
    
        constraint.length = typeof constraint.length !== 'undefined' ? constraint.length : length;

        // option defaults
        constraint.id = constraint.id || Common.nextId();
        constraint.label = constraint.label || 'Constraint';
        constraint.type = 'constraint';
        constraint.stiffness = constraint.stiffness || (constraint.length > 0 ? 1 : 0.7);
        constraint.damping = constraint.damping || 0;
        constraint.angularStiffness = constraint.angularStiffness || 0;
        constraint.angleA = constraint.bodyA ? constraint.bodyA.angle : constraint.angleA;
        constraint.angleB = constraint.bodyB ? constraint.bodyB.angle : constraint.angleB;
        constraint.plugin = {};

        // render
        var render = {
            visible: true,
            lineWidth: 2,
            strokeStyle: '#ffffff',
            type: 'line',
            anchors: true
        };

        if (constraint.length === 0 && constraint.stiffness > 0.1) {
            render.type = 'pin';
            render.anchors = false;
        } else if (constraint.stiffness < 0.9) {
            render.type = 'spring';
        }

        constraint.render = Common.extend(render, constraint.render);

        return constraint;
    };

    /**
     * Prepares for solving by constraint warming.
     * @private
     * @method preSolveAll
     * @param {body[]} bodies
     */
    Constraint.preSolveAll = function(bodies) {
        for (var i = 0; i < bodies.length; i += 1) {
            var body = bodies[i],
                impulse = body.constraintImpulse;

            if (body.isStatic || (impulse.x === 0 && impulse.y === 0 && impulse.angle === 0)) {
                continue;
            }

            body.position.x += impulse.x;
            body.position.y += impulse.y;
            body.angle += impulse.angle;
        }
    };

    /**
     * Solves all constraints in a list of collisions.
     * @private
     * @method solveAll
     * @param {constraint[]} constraints
     * @param {number} timeScale
     */
    Constraint.solveAll = function(constraints, timeScale) {
        // Solve fixed constraints first.
        for (var i = 0; i < constraints.length; i += 1) {
            var constraint = constraints[i],
                fixedA = !constraint.bodyA || (constraint.bodyA && constraint.bodyA.isStatic),
                fixedB = !constraint.bodyB || (constraint.bodyB && constraint.bodyB.isStatic);

            if (fixedA || fixedB) {
                Constraint.solve(constraints[i], timeScale);
            }
        }

        // Solve free constraints last.
        for (i = 0; i < constraints.length; i += 1) {
            constraint = constraints[i];
            fixedA = !constraint.bodyA || (constraint.bodyA && constraint.bodyA.isStatic);
            fixedB = !constraint.bodyB || (constraint.bodyB && constraint.bodyB.isStatic);

            if (!fixedA && !fixedB) {
                Constraint.solve(constraints[i], timeScale);
            }
        }
    };

    /**
     * Solves a distance constraint with Gauss-Siedel method.
     * @private
     * @method solve
     * @param {constraint} constraint
     * @param {number} timeScale
     */
    Constraint.solve = function(constraint, timeScale) {
        var bodyA = constraint.bodyA,
            bodyB = constraint.bodyB,
            pointA = constraint.pointA,
            pointB = constraint.pointB;

        if (!bodyA && !bodyB)
            return;

        // update reference angle
        if (bodyA && !bodyA.isStatic) {
            Vector.rotate(pointA, bodyA.angle - constraint.angleA, pointA);
            constraint.angleA = bodyA.angle;
        }
        
        // update reference angle
        if (bodyB && !bodyB.isStatic) {
            Vector.rotate(pointB, bodyB.angle - constraint.angleB, pointB);
            constraint.angleB = bodyB.angle;
        }

        var pointAWorld = pointA,
            pointBWorld = pointB;

        if (bodyA) pointAWorld = Vector.add(bodyA.position, pointA);
        if (bodyB) pointBWorld = Vector.add(bodyB.position, pointB);

        if (!pointAWorld || !pointBWorld)
            return;

        var delta = Vector.sub(pointAWorld, pointBWorld),
            currentLength = Vector.magnitude(delta);

        // prevent singularity
        if (currentLength < Constraint._minLength) {
            currentLength = Constraint._minLength;
        }

        // solve distance constraint with Gauss-Siedel method
        var difference = (currentLength - constraint.length) / currentLength,
            stiffness = constraint.stiffness < 1 ? constraint.stiffness * timeScale : constraint.stiffness,
            force = Vector.mult(delta, difference * stiffness),
            massTotal = (bodyA ? bodyA.inverseMass : 0) + (bodyB ? bodyB.inverseMass : 0),
            inertiaTotal = (bodyA ? bodyA.inverseInertia : 0) + (bodyB ? bodyB.inverseInertia : 0),
            resistanceTotal = massTotal + inertiaTotal,
            torque,
            share,
            normal,
            normalVelocity,
            relativeVelocity;

        if (constraint.damping) {
            var zero = Vector.create();
            normal = Vector.div(delta, currentLength);

            relativeVelocity = Vector.sub(
                bodyB && Vector.sub(bodyB.position, bodyB.positionPrev) || zero,
                bodyA && Vector.sub(bodyA.position, bodyA.positionPrev) || zero
            );

            normalVelocity = Vector.dot(normal, relativeVelocity);
        }

        if (bodyA && !bodyA.isStatic) {
            share = bodyA.inverseMass / massTotal;

            // keep track of applied impulses for post solving
            bodyA.constraintImpulse.x -= force.x * share;
            bodyA.constraintImpulse.y -= force.y * share;

            // apply forces
            bodyA.position.x -= force.x * share;
            bodyA.position.y -= force.y * share;

            // apply damping
            if (constraint.damping) {
                bodyA.positionPrev.x -= constraint.damping * normal.x * normalVelocity * share;
                bodyA.positionPrev.y -= constraint.damping * normal.y * normalVelocity * share;
            }

            // apply torque
            torque = (Vector.cross(pointA, force) / resistanceTotal) * Constraint._torqueDampen * bodyA.inverseInertia * (1 - constraint.angularStiffness);
            bodyA.constraintImpulse.angle -= torque;
            bodyA.angle -= torque;
        }

        if (bodyB && !bodyB.isStatic) {
            share = bodyB.inverseMass / massTotal;

            // keep track of applied impulses for post solving
            bodyB.constraintImpulse.x += force.x * share;
            bodyB.constraintImpulse.y += force.y * share;
            
            // apply forces
            bodyB.position.x += force.x * share;
            bodyB.position.y += force.y * share;

            // apply damping
            if (constraint.damping) {
                bodyB.positionPrev.x += constraint.damping * normal.x * normalVelocity * share;
                bodyB.positionPrev.y += constraint.damping * normal.y * normalVelocity * share;
            }

            // apply torque
            torque = (Vector.cross(pointB, force) / resistanceTotal) * Constraint._torqueDampen * bodyB.inverseInertia * (1 - constraint.angularStiffness);
            bodyB.constraintImpulse.angle += torque;
            bodyB.angle += torque;
        }

    };

    /**
     * Performs body updates required after solving constraints.
     * @private
     * @method postSolveAll
     * @param {body[]} bodies
     */
    Constraint.postSolveAll = function(bodies) {
        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i],
                impulse = body.constraintImpulse;

            if (body.isStatic || (impulse.x === 0 && impulse.y === 0 && impulse.angle === 0)) {
                continue;
            }

            Sleeping.set(body, false);

            // update geometry and reset
            for (var j = 0; j < body.parts.length; j++) {
                var part = body.parts[j];
                
                Vertices.translate(part.vertices, impulse);

                if (j > 0) {
                    part.position.x += impulse.x;
                    part.position.y += impulse.y;
                }

                if (impulse.angle !== 0) {
                    Vertices.rotate(part.vertices, impulse.angle, body.position);
                    Axes.rotate(part.axes, impulse.angle);
                    if (j > 0) {
                        Vector.rotateAbout(part.position, impulse.angle, body.position, part.position);
                    }
                }

                Bounds.update(part.bounds, part.vertices, body.velocity);
            }

            // dampen the cached impulse for warming next step
            impulse.angle *= Constraint._warming;
            impulse.x *= Constraint._warming;
            impulse.y *= Constraint._warming;
        }
    };

    /**
     * Returns the world-space position of `constraint.pointA`, accounting for `constraint.bodyA`.
     * @method pointAWorld
     * @param {constraint} constraint
     * @returns {vector} the world-space position
     */
    Constraint.pointAWorld = function(constraint) {
        return {
            x: (constraint.bodyA ? constraint.bodyA.position.x : 0) + constraint.pointA.x,
            y: (constraint.bodyA ? constraint.bodyA.position.y : 0) + constraint.pointA.y
        };
    };

    /**
     * Returns the world-space position of `constraint.pointB`, accounting for `constraint.bodyB`.
     * @method pointBWorld
     * @param {constraint} constraint
     * @returns {vector} the world-space position
     */
    Constraint.pointBWorld = function(constraint) {
        return {
            x: (constraint.bodyB ? constraint.bodyB.position.x : 0) + constraint.pointB.x,
            y: (constraint.bodyB ? constraint.bodyB.position.y : 0) + constraint.pointB.y
        };
    };

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`.
     *
     * @property id
     * @type number
     */

    /**
     * A `String` denoting the type of object.
     *
     * @property type
     * @type string
     * @default "constraint"
     * @readOnly
     */

    /**
     * An arbitrary `String` name to help the user identify and manage bodies.
     *
     * @property label
     * @type string
     * @default "Constraint"
     */

    /**
     * An `Object` that defines the rendering properties to be consumed by the module `Matter.Render`.
     *
     * @property render
     * @type object
     */

    /**
     * A flag that indicates if the constraint should be rendered.
     *
     * @property render.visible
     * @type boolean
     * @default true
     */

    /**
     * A `Number` that defines the line width to use when rendering the constraint outline.
     * A value of `0` means no outline will be rendered.
     *
     * @property render.lineWidth
     * @type number
     * @default 2
     */

    /**
     * A `String` that defines the stroke style to use when rendering the constraint outline.
     * It is the same as when using a canvas, so it accepts CSS style property values.
     *
     * @property render.strokeStyle
     * @type string
     * @default a random colour
     */

    /**
     * A `String` that defines the constraint rendering type. 
     * The possible values are 'line', 'pin', 'spring'.
     * An appropriate render type will be automatically chosen unless one is given in options.
     *
     * @property render.type
     * @type string
     * @default 'line'
     */

    /**
     * A `Boolean` that defines if the constraint's anchor points should be rendered.
     *
     * @property render.anchors
     * @type boolean
     * @default true
     */

    /**
     * The first possible `Body` that this constraint is attached to.
     *
     * @property bodyA
     * @type body
     * @default null
     */

    /**
     * The second possible `Body` that this constraint is attached to.
     *
     * @property bodyB
     * @type body
     * @default null
     */

    /**
     * A `Vector` that specifies the offset of the constraint from center of the `constraint.bodyA` if defined, otherwise a world-space position.
     *
     * @property pointA
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * A `Vector` that specifies the offset of the constraint from center of the `constraint.bodyB` if defined, otherwise a world-space position.
     *
     * @property pointB
     * @type vector
     * @default { x: 0, y: 0 }
     */

    /**
     * A `Number` that specifies the stiffness of the constraint, i.e. the rate at which it returns to its resting `constraint.length`.
     * A value of `1` means the constraint should be very stiff.
     * A value of `0.2` means the constraint acts like a soft spring.
     *
     * @property stiffness
     * @type number
     * @default 1
     */

    /**
     * A `Number` that specifies the damping of the constraint, 
     * i.e. the amount of resistance applied to each body based on their velocities to limit the amount of oscillation.
     * Damping will only be apparent when the constraint also has a very low `stiffness`.
     * A value of `0.1` means the constraint will apply heavy damping, resulting in little to no oscillation.
     * A value of `0` means the constraint will apply no damping.
     *
     * @property damping
     * @type number
     * @default 0
     */

    /**
     * A `Number` that specifies the target resting length of the constraint. 
     * It is calculated automatically in `Constraint.create` from initial positions of the `constraint.bodyA` and `constraint.bodyB`.
     *
     * @property length
     * @type number
     */

    /**
     * An object reserved for storing plugin-specific properties.
     *
     * @property plugin
     * @type {}
     */

})();


/***/ }),
/* 11 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Axes` module contains methods for creating and manipulating sets of axes.
*
* @class Axes
*/

var Axes = {};

module.exports = Axes;

var Vector = __webpack_require__(2);
var Common = __webpack_require__(0);

(function() {

    /**
     * Creates a new set of axes from the given vertices.
     * @method fromVertices
     * @param {vertices} vertices
     * @return {axes} A new axes from the given vertices
     */
    Axes.fromVertices = function(vertices) {
        var axes = {};

        // find the unique axes, using edge normal gradients
        for (var i = 0; i < vertices.length; i++) {
            var j = (i + 1) % vertices.length, 
                normal = Vector.normalise({ 
                    x: vertices[j].y - vertices[i].y, 
                    y: vertices[i].x - vertices[j].x
                }),
                gradient = (normal.y === 0) ? Infinity : (normal.x / normal.y);
            
            // limit precision
            gradient = gradient.toFixed(3).toString();
            axes[gradient] = normal;
        }

        return Common.values(axes);
    };

    /**
     * Rotates a set of axes by the given angle.
     * @method rotate
     * @param {axes} axes
     * @param {number} angle
     */
    Axes.rotate = function(axes, angle) {
        if (angle === 0)
            return;
        
        var cos = Math.cos(angle),
            sin = Math.sin(angle);

        for (var i = 0; i < axes.length; i++) {
            var axis = axes[i],
                xx;
            xx = axis.x * cos - axis.y * sin;
            axis.y = axis.x * sin + axis.y * cos;
            axis.x = xx;
        }
    };

})();


/***/ }),
/* 12 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Bodies` module contains factory methods for creating rigid body models 
* with commonly used body configurations (such as rectangles, circles and other polygons).
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Bodies
*/

// TODO: true circle bodies

var Bodies = {};

module.exports = Bodies;

var Vertices = __webpack_require__(3);
var Common = __webpack_require__(0);
var Body = __webpack_require__(6);
var Bounds = __webpack_require__(1);
var Vector = __webpack_require__(2);

(function() {

    /**
     * Creates a new rigid body model with a rectangle hull. 
     * The options parameter is an object that specifies any properties you wish to override the defaults.
     * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object.
     * @method rectangle
     * @param {number} x
     * @param {number} y
     * @param {number} width
     * @param {number} height
     * @param {object} [options]
     * @return {body} A new rectangle body
     */
    Bodies.rectangle = function(x, y, width, height, options) {
        options = options || {};

        var rectangle = { 
            label: 'Rectangle Body',
            position: { x: x, y: y },
            vertices: Vertices.fromPath('L 0 0 L ' + width + ' 0 L ' + width + ' ' + height + ' L 0 ' + height)
        };

        if (options.chamfer) {
            var chamfer = options.chamfer;
            rectangle.vertices = Vertices.chamfer(rectangle.vertices, chamfer.radius, 
                chamfer.quality, chamfer.qualityMin, chamfer.qualityMax);
            delete options.chamfer;
        }

        return Body.create(Common.extend({}, rectangle, options));
    };
    
    /**
     * Creates a new rigid body model with a trapezoid hull. 
     * The options parameter is an object that specifies any properties you wish to override the defaults.
     * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object.
     * @method trapezoid
     * @param {number} x
     * @param {number} y
     * @param {number} width
     * @param {number} height
     * @param {number} slope
     * @param {object} [options]
     * @return {body} A new trapezoid body
     */
    Bodies.trapezoid = function(x, y, width, height, slope, options) {
        options = options || {};

        slope *= 0.5;
        var roof = (1 - (slope * 2)) * width;
        
        var x1 = width * slope,
            x2 = x1 + roof,
            x3 = x2 + x1,
            verticesPath;

        if (slope < 0.5) {
            verticesPath = 'L 0 0 L ' + x1 + ' ' + (-height) + ' L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0';
        } else {
            verticesPath = 'L 0 0 L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0';
        }

        var trapezoid = { 
            label: 'Trapezoid Body',
            position: { x: x, y: y },
            vertices: Vertices.fromPath(verticesPath)
        };

        if (options.chamfer) {
            var chamfer = options.chamfer;
            trapezoid.vertices = Vertices.chamfer(trapezoid.vertices, chamfer.radius, 
                chamfer.quality, chamfer.qualityMin, chamfer.qualityMax);
            delete options.chamfer;
        }

        return Body.create(Common.extend({}, trapezoid, options));
    };

    /**
     * Creates a new rigid body model with a circle hull. 
     * The options parameter is an object that specifies any properties you wish to override the defaults.
     * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object.
     * @method circle
     * @param {number} x
     * @param {number} y
     * @param {number} radius
     * @param {object} [options]
     * @param {number} [maxSides]
     * @return {body} A new circle body
     */
    Bodies.circle = function(x, y, radius, options, maxSides) {
        options = options || {};

        var circle = {
            label: 'Circle Body',
            circleRadius: radius
        };
        
        // approximate circles with polygons until true circles implemented in SAT
        maxSides = maxSides || 25;
        var sides = Math.ceil(Math.max(10, Math.min(maxSides, radius)));

        // optimisation: always use even number of sides (half the number of unique axes)
        if (sides % 2 === 1)
            sides += 1;

        return Bodies.polygon(x, y, sides, radius, Common.extend({}, circle, options));
    };

    /**
     * Creates a new rigid body model with a regular polygon hull with the given number of sides. 
     * The options parameter is an object that specifies any properties you wish to override the defaults.
     * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object.
     * @method polygon
     * @param {number} x
     * @param {number} y
     * @param {number} sides
     * @param {number} radius
     * @param {object} [options]
     * @return {body} A new regular polygon body
     */
    Bodies.polygon = function(x, y, sides, radius, options) {
        options = options || {};

        if (sides < 3)
            return Bodies.circle(x, y, radius, options);

        var theta = 2 * Math.PI / sides,
            path = '',
            offset = theta * 0.5;

        for (var i = 0; i < sides; i += 1) {
            var angle = offset + (i * theta),
                xx = Math.cos(angle) * radius,
                yy = Math.sin(angle) * radius;

            path += 'L ' + xx.toFixed(3) + ' ' + yy.toFixed(3) + ' ';
        }

        var polygon = { 
            label: 'Polygon Body',
            position: { x: x, y: y },
            vertices: Vertices.fromPath(path)
        };

        if (options.chamfer) {
            var chamfer = options.chamfer;
            polygon.vertices = Vertices.chamfer(polygon.vertices, chamfer.radius, 
                chamfer.quality, chamfer.qualityMin, chamfer.qualityMax);
            delete options.chamfer;
        }

        return Body.create(Common.extend({}, polygon, options));
    };

    /**
     * Utility to create a compound body based on set(s) of vertices.
     * 
     * _Note:_ To optionally enable automatic concave vertices decomposition the [poly-decomp](https://github.com/schteppe/poly-decomp.js) 
     * package must be first installed and provided see `Common.setDecomp`, otherwise the convex hull of each vertex set will be used.
     * 
     * The resulting vertices are reorientated about their centre of mass,
     * and offset such that `body.position` corresponds to this point.
     * 
     * The resulting offset may be found if needed by subtracting `body.bounds` from the original input bounds.
     * To later move the centre of mass see `Body.setCentre`.
     * 
     * Note that automatic conconcave decomposition results are not always optimal. 
     * For best results, simplify the input vertices as much as possible first.
     * By default this function applies some addtional simplification to help.
     * 
     * Some outputs may also require further manual processing afterwards to be robust.
     * In particular some parts may need to be overlapped to avoid collision gaps.
     * Thin parts and sharp points should be avoided or removed where possible.
     *
     * The options parameter object specifies any `Matter.Body` properties you wish to override the defaults.
     * 
     * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object.
     * @method fromVertices
     * @param {number} x
     * @param {number} y
     * @param {array} vertexSets One or more arrays of vertex points e.g. `[[{ x: 0, y: 0 }...], ...]`.
     * @param {object} [options] The body options.
     * @param {bool} [flagInternal=false] Optionally marks internal edges with `isInternal`.
     * @param {number} [removeCollinear=0.01] Threshold when simplifying vertices along the same edge.
     * @param {number} [minimumArea=10] Threshold when removing small parts.
     * @param {number} [removeDuplicatePoints=0.01] Threshold when simplifying nearby vertices.
     * @return {body}
     */
    Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea, removeDuplicatePoints) {
        var decomp = Common.getDecomp(),
            canDecomp,
            body,
            parts,
            isConvex,
            isConcave,
            vertices,
            i,
            j,
            k,
            v,
            z;

        // check decomp is as expected
        canDecomp = Boolean(decomp && decomp.quickDecomp);

        options = options || {};
        parts = [];

        flagInternal = typeof flagInternal !== 'undefined' ? flagInternal : false;
        removeCollinear = typeof removeCollinear !== 'undefined' ? removeCollinear : 0.01;
        minimumArea = typeof minimumArea !== 'undefined' ? minimumArea : 10;
        removeDuplicatePoints = typeof removeDuplicatePoints !== 'undefined' ? removeDuplicatePoints : 0.01;

        // ensure vertexSets is an array of arrays
        if (!Common.isArray(vertexSets[0])) {
            vertexSets = [vertexSets];
        }

        for (v = 0; v < vertexSets.length; v += 1) {
            vertices = vertexSets[v];
            isConvex = Vertices.isConvex(vertices);
            isConcave = !isConvex;

            if (isConcave && !canDecomp) {
                Common.warnOnce(
                    'Bodies.fromVertices: Install the \'poly-decomp\' library and use Common.setDecomp or provide \'decomp\' as a global to decompose concave vertices.'
                );
            }

            if (isConvex || !canDecomp) {
                if (isConvex) {
                    vertices = Vertices.clockwiseSort(vertices);
                } else {
                    // fallback to convex hull when decomposition is not possible
                    vertices = Vertices.hull(vertices);
                }

                parts.push({
                    position: { x: x, y: y },
                    vertices: vertices
                });
            } else {
                // initialise a decomposition
                var concave = vertices.map(function(vertex) {
                    return [vertex.x, vertex.y];
                });

                // vertices are concave and simple, we can decompose into parts
                decomp.makeCCW(concave);
                if (removeCollinear !== false)
                    decomp.removeCollinearPoints(concave, removeCollinear);
                if (removeDuplicatePoints !== false && decomp.removeDuplicatePoints)
                    decomp.removeDuplicatePoints(concave, removeDuplicatePoints);

                // use the quick decomposition algorithm (Bayazit)
                var decomposed = decomp.quickDecomp(concave);

                // for each decomposed chunk
                for (i = 0; i < decomposed.length; i++) {
                    var chunk = decomposed[i];

                    // convert vertices into the correct structure
                    var chunkVertices = chunk.map(function(vertices) {
                        return {
                            x: vertices[0],
                            y: vertices[1]
                        };
                    });

                    // skip small chunks
                    if (minimumArea > 0 && Vertices.area(chunkVertices) < minimumArea)
                        continue;

                    // create a compound part
                    parts.push({
                        position: Vertices.centre(chunkVertices),
                        vertices: chunkVertices
                    });
                }
            }
        }

        // create body parts
        for (i = 0; i < parts.length; i++) {
            parts[i] = Body.create(Common.extend(parts[i], options));
        }

        // flag internal edges (coincident part edges)
        if (flagInternal) {
            var coincident_max_dist = 5;

            for (i = 0; i < parts.length; i++) {
                var partA = parts[i];

                for (j = i + 1; j < parts.length; j++) {
                    var partB = parts[j];

                    if (Bounds.overlaps(partA.bounds, partB.bounds)) {
                        var pav = partA.vertices,
                            pbv = partB.vertices;

                        // iterate vertices of both parts
                        for (k = 0; k < partA.vertices.length; k++) {
                            for (z = 0; z < partB.vertices.length; z++) {
                                // find distances between the vertices
                                var da = Vector.magnitudeSquared(Vector.sub(pav[(k + 1) % pav.length], pbv[z])),
                                    db = Vector.magnitudeSquared(Vector.sub(pav[k], pbv[(z + 1) % pbv.length]));

                                // if both vertices are very close, consider the edge concident (internal)
                                if (da < coincident_max_dist && db < coincident_max_dist) {
                                    pav[k].isInternal = true;
                                    pbv[z].isInternal = true;
                                }
                            }
                        }

                    }
                }
            }
        }

        if (parts.length > 1) {
            // create the parent body to be returned, that contains generated compound parts
            body = Body.create(Common.extend({ parts: parts.slice(0) }, options));

            // offset such that body.position is at the centre off mass
            Body.setPosition(body, { x: x, y: y });

            return body;
        } else {
            return parts[0];
        }
    };

})();


/***/ }),
/* 13 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Mouse` module contains methods for creating and manipulating mouse inputs.
*
* @class Mouse
*/

var Mouse = {};

module.exports = Mouse;

var Common = __webpack_require__(0);

(function() {

    /**
     * Creates a mouse input.
     * @method create
     * @param {HTMLElement} element
     * @return {mouse} A new mouse
     */
    Mouse.create = function(element) {
        var mouse = {};

        if (!element) {
            Common.log('Mouse.create: element was undefined, defaulting to document.body', 'warn');
        }
        
        mouse.element = element || document.body;
        mouse.absolute = { x: 0, y: 0 };
        mouse.position = { x: 0, y: 0 };
        mouse.mousedownPosition = { x: 0, y: 0 };
        mouse.mouseupPosition = { x: 0, y: 0 };
        mouse.offset = { x: 0, y: 0 };
        mouse.scale = { x: 1, y: 1 };
        mouse.wheelDelta = 0;
        mouse.button = -1;
        mouse.pixelRatio = parseInt(mouse.element.getAttribute('data-pixel-ratio'), 10) || 1;

        mouse.sourceEvents = {
            mousemove: null,
            mousedown: null,
            mouseup: null,
            mousewheel: null
        };
        
        mouse.mousemove = function(event) { 
            var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio),
                touches = event.changedTouches;

            if (touches) {
                mouse.button = 0;
                event.preventDefault();
            }

            mouse.absolute.x = position.x;
            mouse.absolute.y = position.y;
            mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x;
            mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y;
            mouse.sourceEvents.mousemove = event;
        };
        
        mouse.mousedown = function(event) {
            var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio),
                touches = event.changedTouches;

            if (touches) {
                mouse.button = 0;
                event.preventDefault();
            } else {
                mouse.button = event.button;
            }

            mouse.absolute.x = position.x;
            mouse.absolute.y = position.y;
            mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x;
            mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y;
            mouse.mousedownPosition.x = mouse.position.x;
            mouse.mousedownPosition.y = mouse.position.y;
            mouse.sourceEvents.mousedown = event;
        };
        
        mouse.mouseup = function(event) {
            var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio),
                touches = event.changedTouches;

            if (touches) {
                event.preventDefault();
            }
            
            mouse.button = -1;
            mouse.absolute.x = position.x;
            mouse.absolute.y = position.y;
            mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x;
            mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y;
            mouse.mouseupPosition.x = mouse.position.x;
            mouse.mouseupPosition.y = mouse.position.y;
            mouse.sourceEvents.mouseup = event;
        };

        mouse.mousewheel = function(event) {
            mouse.wheelDelta = Math.max(-1, Math.min(1, event.wheelDelta || -event.detail));
            event.preventDefault();
        };

        Mouse.setElement(mouse, mouse.element);

        return mouse;
    };

    /**
     * Sets the element the mouse is bound to (and relative to).
     * @method setElement
     * @param {mouse} mouse
     * @param {HTMLElement} element
     */
    Mouse.setElement = function(mouse, element) {
        mouse.element = element;

        element.addEventListener('mousemove', mouse.mousemove);
        element.addEventListener('mousedown', mouse.mousedown);
        element.addEventListener('mouseup', mouse.mouseup);
        
        element.addEventListener('mousewheel', mouse.mousewheel);
        element.addEventListener('DOMMouseScroll', mouse.mousewheel);

        element.addEventListener('touchmove', mouse.mousemove);
        element.addEventListener('touchstart', mouse.mousedown);
        element.addEventListener('touchend', mouse.mouseup);
    };

    /**
     * Clears all captured source events.
     * @method clearSourceEvents
     * @param {mouse} mouse
     */
    Mouse.clearSourceEvents = function(mouse) {
        mouse.sourceEvents.mousemove = null;
        mouse.sourceEvents.mousedown = null;
        mouse.sourceEvents.mouseup = null;
        mouse.sourceEvents.mousewheel = null;
        mouse.wheelDelta = 0;
    };

    /**
     * Sets the mouse position offset.
     * @method setOffset
     * @param {mouse} mouse
     * @param {vector} offset
     */
    Mouse.setOffset = function(mouse, offset) {
        mouse.offset.x = offset.x;
        mouse.offset.y = offset.y;
        mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x;
        mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y;
    };

    /**
     * Sets the mouse position scale.
     * @method setScale
     * @param {mouse} mouse
     * @param {vector} scale
     */
    Mouse.setScale = function(mouse, scale) {
        mouse.scale.x = scale.x;
        mouse.scale.y = scale.y;
        mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x;
        mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y;
    };
    
    /**
     * Gets the mouse position relative to an element given a screen pixel ratio.
     * @method _getRelativeMousePosition
     * @private
     * @param {} event
     * @param {} element
     * @param {number} pixelRatio
     * @return {}
     */
    Mouse._getRelativeMousePosition = function(event, element, pixelRatio) {
        var elementBounds = element.getBoundingClientRect(),
            rootNode = (document.documentElement || document.body.parentNode || document.body),
            scrollX = (window.pageXOffset !== undefined) ? window.pageXOffset : rootNode.scrollLeft,
            scrollY = (window.pageYOffset !== undefined) ? window.pageYOffset : rootNode.scrollTop,
            touches = event.changedTouches,
            x, y;
        
        if (touches) {
            x = touches[0].pageX - elementBounds.left - scrollX;
            y = touches[0].pageY - elementBounds.top - scrollY;
        } else {
            x = event.pageX - elementBounds.left - scrollX;
            y = event.pageY - elementBounds.top - scrollY;
        }

        return { 
            x: x / (element.clientWidth / (element.width || element.clientWidth) * pixelRatio),
            y: y / (element.clientHeight / (element.height || element.clientHeight) * pixelRatio)
        };
    };

})();


/***/ }),
/* 14 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Detector` module contains methods for efficiently detecting collisions between a list of bodies using a broadphase algorithm.
*
* @class Detector
*/

var Detector = {};

module.exports = Detector;

var Common = __webpack_require__(0);
var Collision = __webpack_require__(8);

(function() {

    /**
     * Creates a new collision detector.
     * @method create
     * @param {} options
     * @return {detector} A new collision detector
     */
    Detector.create = function(options) {
        var defaults = {
            bodies: [],
            pairs: null
        };

        return Common.extend(defaults, options);
    };

    /**
     * Sets the list of bodies in the detector.
     * @method setBodies
     * @param {detector} detector
     * @param {body[]} bodies
     */
    Detector.setBodies = function(detector, bodies) {
        detector.bodies = bodies.slice(0);
    };

    /**
     * Clears the detector including its list of bodies.
     * @method clear
     * @param {detector} detector
     */
    Detector.clear = function(detector) {
        detector.bodies = [];
    };

    /**
     * Efficiently finds all collisions among all the bodies in `detector.bodies` using a broadphase algorithm.
     * 
     * _Note:_ The specific ordering of collisions returned is not guaranteed between releases and may change for performance reasons.
     * If a specific ordering is required then apply a sort to the resulting array.
     * @method collisions
     * @param {detector} detector
     * @return {collision[]} collisions
     */
    Detector.collisions = function(detector) {
        var collisions = [],
            pairs = detector.pairs,
            bodies = detector.bodies,
            bodiesLength = bodies.length,
            canCollide = Detector.canCollide,
            collides = Collision.collides,
            i,
            j;

        bodies.sort(Detector._compareBoundsX);

        for (i = 0; i < bodiesLength; i++) {
            var bodyA = bodies[i],
                boundsA = bodyA.bounds,
                boundXMax = bodyA.bounds.max.x,
                boundYMax = bodyA.bounds.max.y,
                boundYMin = bodyA.bounds.min.y,
                bodyAStatic = bodyA.isStatic || bodyA.isSleeping,
                partsALength = bodyA.parts.length,
                partsASingle = partsALength === 1;

            for (j = i + 1; j < bodiesLength; j++) {
                var bodyB = bodies[j],
                    boundsB = bodyB.bounds;

                if (boundsB.min.x > boundXMax) {
                    break;
                }

                if (boundYMax < boundsB.min.y || boundYMin > boundsB.max.y) {
                    continue;
                }

                if (bodyAStatic && (bodyB.isStatic || bodyB.isSleeping)) {
                    continue;
                }

                if (!canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) {
                    continue;
                }

                var partsBLength = bodyB.parts.length;

                if (partsASingle && partsBLength === 1) {
                    var collision = collides(bodyA, bodyB, pairs);

                    if (collision) {
                        collisions.push(collision);
                    }
                } else {
                    var partsAStart = partsALength > 1 ? 1 : 0,
                        partsBStart = partsBLength > 1 ? 1 : 0;
                    
                    for (var k = partsAStart; k < partsALength; k++) {
                        var partA = bodyA.parts[k],
                            boundsA = partA.bounds;

                        for (var z = partsBStart; z < partsBLength; z++) {
                            var partB = bodyB.parts[z],
                                boundsB = partB.bounds;

                            if (boundsA.min.x > boundsB.max.x || boundsA.max.x < boundsB.min.x
                                || boundsA.max.y < boundsB.min.y || boundsA.min.y > boundsB.max.y) {
                                continue;
                            }

                            var collision = collides(partA, partB, pairs);

                            if (collision) {
                                collisions.push(collision);
                            }
                        }
                    }
                }
            }
        }

        return collisions;
    };

    /**
     * Returns `true` if both supplied collision filters will allow a collision to occur.
     * See `body.collisionFilter` for more information.
     * @method canCollide
     * @param {} filterA
     * @param {} filterB
     * @return {bool} `true` if collision can occur
     */
    Detector.canCollide = function(filterA, filterB) {
        if (filterA.group === filterB.group && filterA.group !== 0)
            return filterA.group > 0;

        return (filterA.mask & filterB.category) !== 0 && (filterB.mask & filterA.category) !== 0;
    };

    /**
     * The comparison function used in the broadphase algorithm.
     * Returns the signed delta of the bodies bounds on the x-axis.
     * @private
     * @method _sortCompare
     * @param {body} bodyA
     * @param {body} bodyB
     * @return {number} The signed delta used for sorting
     */
    Detector._compareBoundsX = function(bodyA, bodyB) {
        return bodyA.bounds.min.x - bodyB.bounds.min.x;
    };

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * The array of `Matter.Body` between which the detector finds collisions.
     * 
     * _Note:_ The order of bodies in this array _is not fixed_ and will be continually managed by the detector.
     * @property bodies
     * @type body[]
     * @default []
     */

    /**
     * Optional. A `Matter.Pairs` object from which previous collision objects may be reused. Intended for internal `Matter.Engine` usage.
     * @property pairs
     * @type {pairs|null}
     * @default null
     */

})();


/***/ }),
/* 15 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Plugin` module contains functions for registering and installing plugins on modules.
*
* @class Plugin
*/

var Plugin = {};

module.exports = Plugin;

var Common = __webpack_require__(0);

(function() {

    Plugin._registry = {};

    /**
     * Registers a plugin object so it can be resolved later by name.
     * @method register
     * @param plugin {} The plugin to register.
     * @return {object} The plugin.
     */
    Plugin.register = function(plugin) {
        if (!Plugin.isPlugin(plugin)) {
            Common.warn('Plugin.register:', Plugin.toString(plugin), 'does not implement all required fields.');
        }

        if (plugin.name in Plugin._registry) {
            var registered = Plugin._registry[plugin.name],
                pluginVersion = Plugin.versionParse(plugin.version).number,
                registeredVersion = Plugin.versionParse(registered.version).number;

            if (pluginVersion > registeredVersion) {
                Common.warn('Plugin.register:', Plugin.toString(registered), 'was upgraded to', Plugin.toString(plugin));
                Plugin._registry[plugin.name] = plugin;
            } else if (pluginVersion < registeredVersion) {
                Common.warn('Plugin.register:', Plugin.toString(registered), 'can not be downgraded to', Plugin.toString(plugin));
            } else if (plugin !== registered) {
                Common.warn('Plugin.register:', Plugin.toString(plugin), 'is already registered to different plugin object');
            }
        } else {
            Plugin._registry[plugin.name] = plugin;
        }

        return plugin;
    };

    /**
     * Resolves a dependency to a plugin object from the registry if it exists. 
     * The `dependency` may contain a version, but only the name matters when resolving.
     * @method resolve
     * @param dependency {string} The dependency.
     * @return {object} The plugin if resolved, otherwise `undefined`.
     */
    Plugin.resolve = function(dependency) {
        return Plugin._registry[Plugin.dependencyParse(dependency).name];
    };

    /**
     * Returns a pretty printed plugin name and version.
     * @method toString
     * @param plugin {} The plugin.
     * @return {string} Pretty printed plugin name and version.
     */
    Plugin.toString = function(plugin) {
        return typeof plugin === 'string' ? plugin : (plugin.name || 'anonymous') + '@' + (plugin.version || plugin.range || '0.0.0');
    };

    /**
     * Returns `true` if the object meets the minimum standard to be considered a plugin.
     * This means it must define the following properties:
     * - `name`
     * - `version`
     * - `install`
     * @method isPlugin
     * @param obj {} The obj to test.
     * @return {boolean} `true` if the object can be considered a plugin otherwise `false`.
     */
    Plugin.isPlugin = function(obj) {
        return obj && obj.name && obj.version && obj.install;
    };

    /**
     * Returns `true` if a plugin with the given `name` been installed on `module`.
     * @method isUsed
     * @param module {} The module.
     * @param name {string} The plugin name.
     * @return {boolean} `true` if a plugin with the given `name` been installed on `module`, otherwise `false`.
     */
    Plugin.isUsed = function(module, name) {
        return module.used.indexOf(name) > -1;
    };

    /**
     * Returns `true` if `plugin.for` is applicable to `module` by comparing against `module.name` and `module.version`.
     * If `plugin.for` is not specified then it is assumed to be applicable.
     * The value of `plugin.for` is a string of the format `'module-name'` or `'module-name@version'`.
     * @method isFor
     * @param plugin {} The plugin.
     * @param module {} The module.
     * @return {boolean} `true` if `plugin.for` is applicable to `module`, otherwise `false`.
     */
    Plugin.isFor = function(plugin, module) {
        var parsed = plugin.for && Plugin.dependencyParse(plugin.for);
        return !plugin.for || (module.name === parsed.name && Plugin.versionSatisfies(module.version, parsed.range));
    };

    /**
     * Installs the plugins by calling `plugin.install` on each plugin specified in `plugins` if passed, otherwise `module.uses`.
     * For installing plugins on `Matter` see the convenience function `Matter.use`.
     * Plugins may be specified either by their name or a reference to the plugin object.
     * Plugins themselves may specify further dependencies, but each plugin is installed only once.
     * Order is important, a topological sort is performed to find the best resulting order of installation.
     * This sorting attempts to satisfy every dependency's requested ordering, but may not be exact in all cases.
     * This function logs the resulting status of each dependency in the console, along with any warnings.
     * - A green tick ✅ indicates a dependency was resolved and installed.
     * - An orange diamond 🔶 indicates a dependency was resolved but a warning was thrown for it or one if its dependencies.
     * - A red cross ❌ indicates a dependency could not be resolved.
     * Avoid calling this function multiple times on the same module unless you intend to manually control installation order.
     * @method use
     * @param module {} The module install plugins on.
     * @param [plugins=module.uses] {} The plugins to install on module (optional, defaults to `module.uses`).
     */
    Plugin.use = function(module, plugins) {
        module.uses = (module.uses || []).concat(plugins || []);

        if (module.uses.length === 0) {
            Common.warn('Plugin.use:', Plugin.toString(module), 'does not specify any dependencies to install.');
            return;
        }

        var dependencies = Plugin.dependencies(module),
            sortedDependencies = Common.topologicalSort(dependencies),
            status = [];

        for (var i = 0; i < sortedDependencies.length; i += 1) {
            if (sortedDependencies[i] === module.name) {
                continue;
            }

            var plugin = Plugin.resolve(sortedDependencies[i]);

            if (!plugin) {
                status.push('❌ ' + sortedDependencies[i]);
                continue;
            }

            if (Plugin.isUsed(module, plugin.name)) {
                continue;
            }

            if (!Plugin.isFor(plugin, module)) {
                Common.warn('Plugin.use:', Plugin.toString(plugin), 'is for', plugin.for, 'but installed on', Plugin.toString(module) + '.');
                plugin._warned = true;
            }

            if (plugin.install) {
                plugin.install(module);
            } else {
                Common.warn('Plugin.use:', Plugin.toString(plugin), 'does not specify an install function.');
                plugin._warned = true;
            }

            if (plugin._warned) {
                status.push('🔶 ' + Plugin.toString(plugin));
                delete plugin._warned;
            } else {
                status.push('✅ ' + Plugin.toString(plugin));
            }

            module.used.push(plugin.name);
        }

        if (status.length > 0) {
            Common.info(status.join('  '));
        }
    };

    /**
     * Recursively finds all of a module's dependencies and returns a flat dependency graph.
     * @method dependencies
     * @param module {} The module.
     * @return {object} A dependency graph.
     */
    Plugin.dependencies = function(module, tracked) {
        var parsedBase = Plugin.dependencyParse(module),
            name = parsedBase.name;

        tracked = tracked || {};

        if (name in tracked) {
            return;
        }

        module = Plugin.resolve(module) || module;

        tracked[name] = Common.map(module.uses || [], function(dependency) {
            if (Plugin.isPlugin(dependency)) {
                Plugin.register(dependency);
            }

            var parsed = Plugin.dependencyParse(dependency),
                resolved = Plugin.resolve(dependency);

            if (resolved && !Plugin.versionSatisfies(resolved.version, parsed.range)) {
                Common.warn(
                    'Plugin.dependencies:', Plugin.toString(resolved), 'does not satisfy',
                    Plugin.toString(parsed), 'used by', Plugin.toString(parsedBase) + '.'
                );

                resolved._warned = true;
                module._warned = true;
            } else if (!resolved) {
                Common.warn(
                    'Plugin.dependencies:', Plugin.toString(dependency), 'used by',
                    Plugin.toString(parsedBase), 'could not be resolved.'
                );

                module._warned = true;
            }

            return parsed.name;
        });

        for (var i = 0; i < tracked[name].length; i += 1) {
            Plugin.dependencies(tracked[name][i], tracked);
        }

        return tracked;
    };

    /**
     * Parses a dependency string into its components.
     * The `dependency` is a string of the format `'module-name'` or `'module-name@version'`.
     * See documentation for `Plugin.versionParse` for a description of the format.
     * This function can also handle dependencies that are already resolved (e.g. a module object).
     * @method dependencyParse
     * @param dependency {string} The dependency of the format `'module-name'` or `'module-name@version'`.
     * @return {object} The dependency parsed into its components.
     */
    Plugin.dependencyParse = function(dependency) {
        if (Common.isString(dependency)) {
            var pattern = /^[\w-]+(@(\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-+]+)?))?$/;

            if (!pattern.test(dependency)) {
                Common.warn('Plugin.dependencyParse:', dependency, 'is not a valid dependency string.');
            }

            return {
                name: dependency.split('@')[0],
                range: dependency.split('@')[1] || '*'
            };
        }

        return {
            name: dependency.name,
            range: dependency.range || dependency.version
        };
    };

    /**
     * Parses a version string into its components.  
     * Versions are strictly of the format `x.y.z` (as in [semver](http://semver.org/)).
     * Versions may optionally have a prerelease tag in the format `x.y.z-alpha`.
     * Ranges are a strict subset of [npm ranges](https://docs.npmjs.com/misc/semver#advanced-range-syntax).
     * Only the following range types are supported:
     * - Tilde ranges e.g. `~1.2.3`
     * - Caret ranges e.g. `^1.2.3`
     * - Greater than ranges e.g. `>1.2.3`
     * - Greater than or equal ranges e.g. `>=1.2.3`
     * - Exact version e.g. `1.2.3`
     * - Any version `*`
     * @method versionParse
     * @param range {string} The version string.
     * @return {object} The version range parsed into its components.
     */
    Plugin.versionParse = function(range) {
        var pattern = /^(\*)|(\^|~|>=|>)?\s*((\d+)\.(\d+)\.(\d+))(-[0-9A-Za-z-+]+)?$/;

        if (!pattern.test(range)) {
            Common.warn('Plugin.versionParse:', range, 'is not a valid version or range.');
        }

        var parts = pattern.exec(range);
        var major = Number(parts[4]);
        var minor = Number(parts[5]);
        var patch = Number(parts[6]);

        return {
            isRange: Boolean(parts[1] || parts[2]),
            version: parts[3],
            range: range,
            operator: parts[1] || parts[2] || '',
            major: major,
            minor: minor,
            patch: patch,
            parts: [major, minor, patch],
            prerelease: parts[7],
            number: major * 1e8 + minor * 1e4 + patch
        };
    };

    /**
     * Returns `true` if `version` satisfies the given `range`.
     * See documentation for `Plugin.versionParse` for a description of the format.
     * If a version or range is not specified, then any version (`*`) is assumed to satisfy.
     * @method versionSatisfies
     * @param version {string} The version string.
     * @param range {string} The range string.
     * @return {boolean} `true` if `version` satisfies `range`, otherwise `false`.
     */
    Plugin.versionSatisfies = function(version, range) {
        range = range || '*';

        var r = Plugin.versionParse(range),
            v = Plugin.versionParse(version);

        if (r.isRange) {
            if (r.operator === '*' || version === '*') {
                return true;
            }

            if (r.operator === '>') {
                return v.number > r.number;
            }

            if (r.operator === '>=') {
                return v.number >= r.number;
            }

            if (r.operator === '~') {
                return v.major === r.major && v.minor === r.minor && v.patch >= r.patch;
            }

            if (r.operator === '^') {
                if (r.major > 0) {
                    return v.major === r.major && v.number >= r.number;
                }

                if (r.minor > 0) {
                    return v.minor === r.minor && v.patch >= r.patch;
                }

                return v.patch === r.patch;
            }
        }

        return version === range || version === '*';
    };

})();


/***/ }),
/* 16 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Render` module is a simple canvas based renderer for visualising instances of `Matter.Engine`.
* It is intended for development and debugging purposes, but may also be suitable for simple games.
* It includes a number of drawing options including wireframe, vector with support for sprites and viewports.
*
* @class Render
*/

var Render = {};

module.exports = Render;

var Common = __webpack_require__(0);
var Composite = __webpack_require__(5);
var Bounds = __webpack_require__(1);
var Events = __webpack_require__(4);
var Vector = __webpack_require__(2);
var Mouse = __webpack_require__(13);

(function() {

    var _requestAnimationFrame,
        _cancelAnimationFrame;

    if (typeof window !== 'undefined') {
        _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame
                                      || window.mozRequestAnimationFrame || window.msRequestAnimationFrame
                                      || function(callback){ window.setTimeout(function() { callback(Common.now()); }, 1000 / 60); };

        _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame
                                      || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame;
    }

    Render._goodFps = 30;
    Render._goodDelta = 1000 / 60;

    /**
     * Creates a new renderer. The options parameter is an object that specifies any properties you wish to override the defaults.
     * All properties have default values, and many are pre-calculated automatically based on other properties.
     * See the properties section below for detailed information on what you can pass via the `options` object.
     * @method create
     * @param {object} [options]
     * @return {render} A new renderer
     */
    Render.create = function(options) {
        var defaults = {
            controller: Render,
            engine: null,
            element: null,
            canvas: null,
            mouse: null,
            frameRequestId: null,
            timing: {
                historySize: 60,
                delta: 0,
                deltaHistory: [],
                lastTime: 0,
                lastTimestamp: 0,
                lastElapsed: 0,
                timestampElapsed: 0,
                timestampElapsedHistory: [],
                engineDeltaHistory: [],
                engineElapsedHistory: [],
                elapsedHistory: []
            },
            options: {
                width: 800,
                height: 600,
                pixelRatio: 1,
                background: '#14151f',
                wireframeBackground: '#14151f',
                hasBounds: !!options.bounds,
                enabled: true,
                wireframes: true,
                showSleeping: true,
                showDebug: false,
                showStats: false,
                showPerformance: false,
                showBounds: false,
                showVelocity: false,
                showCollisions: false,
                showSeparations: false,
                showAxes: false,
                showPositions: false,
                showAngleIndicator: false,
                showIds: false,
                showVertexNumbers: false,
                showConvexHulls: false,
                showInternalEdges: false,
                showMousePosition: false
            }
        };

        var render = Common.extend(defaults, options);

        if (render.canvas) {
            render.canvas.width = render.options.width || render.canvas.width;
            render.canvas.height = render.options.height || render.canvas.height;
        }

        render.mouse = options.mouse;
        render.engine = options.engine;
        render.canvas = render.canvas || _createCanvas(render.options.width, render.options.height);
        render.context = render.canvas.getContext('2d');
        render.textures = {};

        render.bounds = render.bounds || {
            min: {
                x: 0,
                y: 0
            },
            max: {
                x: render.canvas.width,
                y: render.canvas.height
            }
        };

        // for temporary back compatibility only
        render.options.showBroadphase = false;

        if (render.options.pixelRatio !== 1) {
            Render.setPixelRatio(render, render.options.pixelRatio);
        }

        if (Common.isElement(render.element)) {
            render.element.appendChild(render.canvas);
        } else if (!render.canvas.parentNode) {
            Common.log('Render.create: options.element was undefined, render.canvas was created but not appended', 'warn');
        }

        return render;
    };

    /**
     * Continuously updates the render canvas on the `requestAnimationFrame` event.
     * @method run
     * @param {render} render
     */
    Render.run = function(render) {
        (function loop(time){
            render.frameRequestId = _requestAnimationFrame(loop);
            
            _updateTiming(render, time);

            Render.world(render, time);

            if (render.options.showStats || render.options.showDebug) {
                Render.stats(render, render.context, time);
            }

            if (render.options.showPerformance || render.options.showDebug) {
                Render.performance(render, render.context, time);
            }
        })();
    };

    /**
     * Ends execution of `Render.run` on the given `render`, by canceling the animation frame request event loop.
     * @method stop
     * @param {render} render
     */
    Render.stop = function(render) {
        _cancelAnimationFrame(render.frameRequestId);
    };

    /**
     * Sets the pixel ratio of the renderer and updates the canvas.
     * To automatically detect the correct ratio, pass the string `'auto'` for `pixelRatio`.
     * @method setPixelRatio
     * @param {render} render
     * @param {number} pixelRatio
     */
    Render.setPixelRatio = function(render, pixelRatio) {
        var options = render.options,
            canvas = render.canvas;

        if (pixelRatio === 'auto') {
            pixelRatio = _getPixelRatio(canvas);
        }

        options.pixelRatio = pixelRatio;
        canvas.setAttribute('data-pixel-ratio', pixelRatio);
        canvas.width = options.width * pixelRatio;
        canvas.height = options.height * pixelRatio;
        canvas.style.width = options.width + 'px';
        canvas.style.height = options.height + 'px';
    };

    /**
     * Positions and sizes the viewport around the given object bounds.
     * Objects must have at least one of the following properties:
     * - `object.bounds`
     * - `object.position`
     * - `object.min` and `object.max`
     * - `object.x` and `object.y`
     * @method lookAt
     * @param {render} render
     * @param {object[]} objects
     * @param {vector} [padding]
     * @param {bool} [center=true]
     */
    Render.lookAt = function(render, objects, padding, center) {
        center = typeof center !== 'undefined' ? center : true;
        objects = Common.isArray(objects) ? objects : [objects];
        padding = padding || {
            x: 0,
            y: 0
        };

        // find bounds of all objects
        var bounds = {
            min: { x: Infinity, y: Infinity },
            max: { x: -Infinity, y: -Infinity }
        };

        for (var i = 0; i < objects.length; i += 1) {
            var object = objects[i],
                min = object.bounds ? object.bounds.min : (object.min || object.position || object),
                max = object.bounds ? object.bounds.max : (object.max || object.position || object);

            if (min && max) {
                if (min.x < bounds.min.x)
                    bounds.min.x = min.x;

                if (max.x > bounds.max.x)
                    bounds.max.x = max.x;

                if (min.y < bounds.min.y)
                    bounds.min.y = min.y;

                if (max.y > bounds.max.y)
                    bounds.max.y = max.y;
            }
        }

        // find ratios
        var width = (bounds.max.x - bounds.min.x) + 2 * padding.x,
            height = (bounds.max.y - bounds.min.y) + 2 * padding.y,
            viewHeight = render.canvas.height,
            viewWidth = render.canvas.width,
            outerRatio = viewWidth / viewHeight,
            innerRatio = width / height,
            scaleX = 1,
            scaleY = 1;

        // find scale factor
        if (innerRatio > outerRatio) {
            scaleY = innerRatio / outerRatio;
        } else {
            scaleX = outerRatio / innerRatio;
        }

        // enable bounds
        render.options.hasBounds = true;

        // position and size
        render.bounds.min.x = bounds.min.x;
        render.bounds.max.x = bounds.min.x + width * scaleX;
        render.bounds.min.y = bounds.min.y;
        render.bounds.max.y = bounds.min.y + height * scaleY;

        // center
        if (center) {
            render.bounds.min.x += width * 0.5 - (width * scaleX) * 0.5;
            render.bounds.max.x += width * 0.5 - (width * scaleX) * 0.5;
            render.bounds.min.y += height * 0.5 - (height * scaleY) * 0.5;
            render.bounds.max.y += height * 0.5 - (height * scaleY) * 0.5;
        }

        // padding
        render.bounds.min.x -= padding.x;
        render.bounds.max.x -= padding.x;
        render.bounds.min.y -= padding.y;
        render.bounds.max.y -= padding.y;

        // update mouse
        if (render.mouse) {
            Mouse.setScale(render.mouse, {
                x: (render.bounds.max.x - render.bounds.min.x) / render.canvas.width,
                y: (render.bounds.max.y - render.bounds.min.y) / render.canvas.height
            });

            Mouse.setOffset(render.mouse, render.bounds.min);
        }
    };

    /**
     * Applies viewport transforms based on `render.bounds` to a render context.
     * @method startViewTransform
     * @param {render} render
     */
    Render.startViewTransform = function(render) {
        var boundsWidth = render.bounds.max.x - render.bounds.min.x,
            boundsHeight = render.bounds.max.y - render.bounds.min.y,
            boundsScaleX = boundsWidth / render.options.width,
            boundsScaleY = boundsHeight / render.options.height;

        render.context.setTransform(
            render.options.pixelRatio / boundsScaleX, 0, 0, 
            render.options.pixelRatio / boundsScaleY, 0, 0
        );
        
        render.context.translate(-render.bounds.min.x, -render.bounds.min.y);
    };

    /**
     * Resets all transforms on the render context.
     * @method endViewTransform
     * @param {render} render
     */
    Render.endViewTransform = function(render) {
        render.context.setTransform(render.options.pixelRatio, 0, 0, render.options.pixelRatio, 0, 0);
    };

    /**
     * Renders the given `engine`'s `Matter.World` object.
     * This is the entry point for all rendering and should be called every time the scene changes.
     * @method world
     * @param {render} render
     */
    Render.world = function(render, time) {
        var startTime = Common.now(),
            engine = render.engine,
            world = engine.world,
            canvas = render.canvas,
            context = render.context,
            options = render.options,
            timing = render.timing;

        var allBodies = Composite.allBodies(world),
            allConstraints = Composite.allConstraints(world),
            background = options.wireframes ? options.wireframeBackground : options.background,
            bodies = [],
            constraints = [],
            i;

        var event = {
            timestamp: engine.timing.timestamp
        };

        Events.trigger(render, 'beforeRender', event);

        // apply background if it has changed
        if (render.currentBackground !== background)
            _applyBackground(render, background);

        // clear the canvas with a transparent fill, to allow the canvas background to show
        context.globalCompositeOperation = 'source-in';
        context.fillStyle = "transparent";
        context.fillRect(0, 0, canvas.width, canvas.height);
        context.globalCompositeOperation = 'source-over';

        // handle bounds
        if (options.hasBounds) {
            // filter out bodies that are not in view
            for (i = 0; i < allBodies.length; i++) {
                var body = allBodies[i];
                if (Bounds.overlaps(body.bounds, render.bounds))
                    bodies.push(body);
            }

            // filter out constraints that are not in view
            for (i = 0; i < allConstraints.length; i++) {
                var constraint = allConstraints[i],
                    bodyA = constraint.bodyA,
                    bodyB = constraint.bodyB,
                    pointAWorld = constraint.pointA,
                    pointBWorld = constraint.pointB;

                if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA);
                if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB);

                if (!pointAWorld || !pointBWorld)
                    continue;

                if (Bounds.contains(render.bounds, pointAWorld) || Bounds.contains(render.bounds, pointBWorld))
                    constraints.push(constraint);
            }

            // transform the view
            Render.startViewTransform(render);

            // update mouse
            if (render.mouse) {
                Mouse.setScale(render.mouse, {
                    x: (render.bounds.max.x - render.bounds.min.x) / render.options.width,
                    y: (render.bounds.max.y - render.bounds.min.y) / render.options.height
                });

                Mouse.setOffset(render.mouse, render.bounds.min);
            }
        } else {
            constraints = allConstraints;
            bodies = allBodies;

            if (render.options.pixelRatio !== 1) {
                render.context.setTransform(render.options.pixelRatio, 0, 0, render.options.pixelRatio, 0, 0);
            }
        }

        if (!options.wireframes || (engine.enableSleeping && options.showSleeping)) {
            // fully featured rendering of bodies
            Render.bodies(render, bodies, context);
        } else {
            if (options.showConvexHulls)
                Render.bodyConvexHulls(render, bodies, context);

            // optimised method for wireframes only
            Render.bodyWireframes(render, bodies, context);
        }

        if (options.showBounds)
            Render.bodyBounds(render, bodies, context);

        if (options.showAxes || options.showAngleIndicator)
            Render.bodyAxes(render, bodies, context);

        if (options.showPositions)
            Render.bodyPositions(render, bodies, context);

        if (options.showVelocity)
            Render.bodyVelocity(render, bodies, context);

        if (options.showIds)
            Render.bodyIds(render, bodies, context);

        if (options.showSeparations)
            Render.separations(render, engine.pairs.list, context);

        if (options.showCollisions)
            Render.collisions(render, engine.pairs.list, context);

        if (options.showVertexNumbers)
            Render.vertexNumbers(render, bodies, context);

        if (options.showMousePosition)
            Render.mousePosition(render, render.mouse, context);

        Render.constraints(constraints, context);

        if (options.hasBounds) {
            // revert view transforms
            Render.endViewTransform(render);
        }

        Events.trigger(render, 'afterRender', event);

        // log the time elapsed computing this update
        timing.lastElapsed = Common.now() - startTime;
    };

    /**
     * Renders statistics about the engine and world useful for debugging.
     * @private
     * @method stats
     * @param {render} render
     * @param {RenderingContext} context
     * @param {Number} time
     */
    Render.stats = function(render, context, time) {
        var engine = render.engine,
            world = engine.world,
            bodies = Composite.allBodies(world),
            parts = 0,
            width = 55,
            height = 44,
            x = 0,
            y = 0;
        
        // count parts
        for (var i = 0; i < bodies.length; i += 1) {
            parts += bodies[i].parts.length;
        }

        // sections
        var sections = {
            'Part': parts,
            'Body': bodies.length,
            'Cons': Composite.allConstraints(world).length,
            'Comp': Composite.allComposites(world).length,
            'Pair': engine.pairs.list.length
        };

        // background
        context.fillStyle = '#0e0f19';
        context.fillRect(x, y, width * 5.5, height);

        context.font = '12px Arial';
        context.textBaseline = 'top';
        context.textAlign = 'right';

        // sections
        for (var key in sections) {
            var section = sections[key];
            // label
            context.fillStyle = '#aaa';
            context.fillText(key, x + width, y + 8);

            // value
            context.fillStyle = '#eee';
            context.fillText(section, x + width, y + 26);

            x += width;
        }
    };

    /**
     * Renders engine and render performance information.
     * @private
     * @method performance
     * @param {render} render
     * @param {RenderingContext} context
     */
    Render.performance = function(render, context) {
        var engine = render.engine,
            timing = render.timing,
            deltaHistory = timing.deltaHistory,
            elapsedHistory = timing.elapsedHistory,
            timestampElapsedHistory = timing.timestampElapsedHistory,
            engineDeltaHistory = timing.engineDeltaHistory,
            engineElapsedHistory = timing.engineElapsedHistory,
            lastEngineDelta = engine.timing.lastDelta;
        
        var deltaMean = _mean(deltaHistory),
            elapsedMean = _mean(elapsedHistory),
            engineDeltaMean = _mean(engineDeltaHistory),
            engineElapsedMean = _mean(engineElapsedHistory),
            timestampElapsedMean = _mean(timestampElapsedHistory),
            rateMean = (timestampElapsedMean / deltaMean) || 0,
            fps = (1000 / deltaMean) || 0;

        var graphHeight = 4,
            gap = 12,
            width = 60,
            height = 34,
            x = 10,
            y = 69;

        // background
        context.fillStyle = '#0e0f19';
        context.fillRect(0, 50, gap * 4 + width * 5 + 22, height);

        // show FPS
        Render.status(
            context, x, y, width, graphHeight, deltaHistory.length, 
            Math.round(fps) + ' fps', 
            fps / Render._goodFps,
            function(i) { return (deltaHistory[i] / deltaMean) - 1; }
        );

        // show engine delta
        Render.status(
            context, x + gap + width, y, width, graphHeight, engineDeltaHistory.length,
            lastEngineDelta.toFixed(2) + ' dt', 
            Render._goodDelta / lastEngineDelta,
            function(i) { return (engineDeltaHistory[i] / engineDeltaMean) - 1; }
        );

        // show engine update time
        Render.status(
            context, x + (gap + width) * 2, y, width, graphHeight, engineElapsedHistory.length,
            engineElapsedMean.toFixed(2) + ' ut', 
            1 - (engineElapsedMean / Render._goodFps),
            function(i) { return (engineElapsedHistory[i] / engineElapsedMean) - 1; }
        );

        // show render time
        Render.status(
            context, x + (gap + width) * 3, y, width, graphHeight, elapsedHistory.length,
            elapsedMean.toFixed(2) + ' rt', 
            1 - (elapsedMean / Render._goodFps),
            function(i) { return (elapsedHistory[i] / elapsedMean) - 1; }
        );

        // show effective speed
        Render.status(
            context, x + (gap + width) * 4, y, width, graphHeight, timestampElapsedHistory.length, 
            rateMean.toFixed(2) + ' x', 
            rateMean * rateMean * rateMean,
            function(i) { return (((timestampElapsedHistory[i] / deltaHistory[i]) / rateMean) || 0) - 1; }
        );
    };

    /**
     * Renders a label, indicator and a chart.
     * @private
     * @method status
     * @param {RenderingContext} context
     * @param {number} x
     * @param {number} y
     * @param {number} width
     * @param {number} height
     * @param {number} count
     * @param {string} label
     * @param {string} indicator
     * @param {function} plotY
     */
    Render.status = function(context, x, y, width, height, count, label, indicator, plotY) {
        // background
        context.strokeStyle = '#888';
        context.fillStyle = '#444';
        context.lineWidth = 1;
        context.fillRect(x, y + 7, width, 1);

        // chart
        context.beginPath();
        context.moveTo(x, y + 7 - height * Common.clamp(0.4 * plotY(0), -2, 2));
        for (var i = 0; i < width; i += 1) {
            context.lineTo(x + i, y + 7 - (i < count ? height * Common.clamp(0.4 * plotY(i), -2, 2) : 0));
        }
        context.stroke();

        // indicator
        context.fillStyle = 'hsl(' + Common.clamp(25 + 95 * indicator, 0, 120) + ',100%,60%)';
        context.fillRect(x, y - 7, 4, 4);

        // label
        context.font = '12px Arial';
        context.textBaseline = 'middle';
        context.textAlign = 'right';
        context.fillStyle = '#eee';
        context.fillText(label, x + width, y - 5);
    };

    /**
     * Description
     * @private
     * @method constraints
     * @param {constraint[]} constraints
     * @param {RenderingContext} context
     */
    Render.constraints = function(constraints, context) {
        var c = context;

        for (var i = 0; i < constraints.length; i++) {
            var constraint = constraints[i];

            if (!constraint.render.visible || !constraint.pointA || !constraint.pointB)
                continue;

            var bodyA = constraint.bodyA,
                bodyB = constraint.bodyB,
                start,
                end;

            if (bodyA) {
                start = Vector.add(bodyA.position, constraint.pointA);
            } else {
                start = constraint.pointA;
            }

            if (constraint.render.type === 'pin') {
                c.beginPath();
                c.arc(start.x, start.y, 3, 0, 2 * Math.PI);
                c.closePath();
            } else {
                if (bodyB) {
                    end = Vector.add(bodyB.position, constraint.pointB);
                } else {
                    end = constraint.pointB;
                }

                c.beginPath();
                c.moveTo(start.x, start.y);

                if (constraint.render.type === 'spring') {
                    var delta = Vector.sub(end, start),
                        normal = Vector.perp(Vector.normalise(delta)),
                        coils = Math.ceil(Common.clamp(constraint.length / 5, 12, 20)),
                        offset;

                    for (var j = 1; j < coils; j += 1) {
                        offset = j % 2 === 0 ? 1 : -1;

                        c.lineTo(
                            start.x + delta.x * (j / coils) + normal.x * offset * 4,
                            start.y + delta.y * (j / coils) + normal.y * offset * 4
                        );
                    }
                }

                c.lineTo(end.x, end.y);
            }

            if (constraint.render.lineWidth) {
                c.lineWidth = constraint.render.lineWidth;
                c.strokeStyle = constraint.render.strokeStyle;
                c.stroke();
            }

            if (constraint.render.anchors) {
                c.fillStyle = constraint.render.strokeStyle;
                c.beginPath();
                c.arc(start.x, start.y, 3, 0, 2 * Math.PI);
                c.arc(end.x, end.y, 3, 0, 2 * Math.PI);
                c.closePath();
                c.fill();
            }
        }
    };

    /**
     * Description
     * @private
     * @method bodies
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodies = function(render, bodies, context) {
        var c = context,
            engine = render.engine,
            options = render.options,
            showInternalEdges = options.showInternalEdges || !options.wireframes,
            body,
            part,
            i,
            k;

        for (i = 0; i < bodies.length; i++) {
            body = bodies[i];

            if (!body.render.visible)
                continue;

            // handle compound parts
            for (k = body.parts.length > 1 ? 1 : 0; k < body.parts.length; k++) {
                part = body.parts[k];

                if (!part.render.visible)
                    continue;

                if (options.showSleeping && body.isSleeping) {
                    c.globalAlpha = 0.5 * part.render.opacity;
                } else if (part.render.opacity !== 1) {
                    c.globalAlpha = part.render.opacity;
                }

                if (part.render.sprite && part.render.sprite.texture && !options.wireframes) {
                    // part sprite
                    var sprite = part.render.sprite,
                        texture = _getTexture(render, sprite.texture);

                    c.translate(part.position.x, part.position.y);
                    c.rotate(part.angle);

                    c.drawImage(
                        texture,
                        texture.width * -sprite.xOffset * sprite.xScale,
                        texture.height * -sprite.yOffset * sprite.yScale,
                        texture.width * sprite.xScale,
                        texture.height * sprite.yScale
                    );

                    // revert translation, hopefully faster than save / restore
                    c.rotate(-part.angle);
                    c.translate(-part.position.x, -part.position.y);
                } else {
                    // part polygon
                    if (part.circleRadius) {
                        c.beginPath();
                        c.arc(part.position.x, part.position.y, part.circleRadius, 0, 2 * Math.PI);
                    } else {
                        c.beginPath();
                        c.moveTo(part.vertices[0].x, part.vertices[0].y);

                        for (var j = 1; j < part.vertices.length; j++) {
                            if (!part.vertices[j - 1].isInternal || showInternalEdges) {
                                c.lineTo(part.vertices[j].x, part.vertices[j].y);
                            } else {
                                c.moveTo(part.vertices[j].x, part.vertices[j].y);
                            }

                            if (part.vertices[j].isInternal && !showInternalEdges) {
                                c.moveTo(part.vertices[(j + 1) % part.vertices.length].x, part.vertices[(j + 1) % part.vertices.length].y);
                            }
                        }

                        c.lineTo(part.vertices[0].x, part.vertices[0].y);
                        c.closePath();
                    }

                    if (!options.wireframes) {
                        c.fillStyle = part.render.fillStyle;

                        if (part.render.lineWidth) {
                            c.lineWidth = part.render.lineWidth;
                            c.strokeStyle = part.render.strokeStyle;
                            c.stroke();
                        }

                        c.fill();
                    } else {
                        c.lineWidth = 1;
                        c.strokeStyle = '#bbb';
                        c.stroke();
                    }
                }

                c.globalAlpha = 1;
            }
        }
    };

    /**
     * Optimised method for drawing body wireframes in one pass
     * @private
     * @method bodyWireframes
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodyWireframes = function(render, bodies, context) {
        var c = context,
            showInternalEdges = render.options.showInternalEdges,
            body,
            part,
            i,
            j,
            k;

        c.beginPath();

        // render all bodies
        for (i = 0; i < bodies.length; i++) {
            body = bodies[i];

            if (!body.render.visible)
                continue;

            // handle compound parts
            for (k = body.parts.length > 1 ? 1 : 0; k < body.parts.length; k++) {
                part = body.parts[k];

                c.moveTo(part.vertices[0].x, part.vertices[0].y);

                for (j = 1; j < part.vertices.length; j++) {
                    if (!part.vertices[j - 1].isInternal || showInternalEdges) {
                        c.lineTo(part.vertices[j].x, part.vertices[j].y);
                    } else {
                        c.moveTo(part.vertices[j].x, part.vertices[j].y);
                    }

                    if (part.vertices[j].isInternal && !showInternalEdges) {
                        c.moveTo(part.vertices[(j + 1) % part.vertices.length].x, part.vertices[(j + 1) % part.vertices.length].y);
                    }
                }

                c.lineTo(part.vertices[0].x, part.vertices[0].y);
            }
        }

        c.lineWidth = 1;
        c.strokeStyle = '#bbb';
        c.stroke();
    };

    /**
     * Optimised method for drawing body convex hull wireframes in one pass
     * @private
     * @method bodyConvexHulls
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodyConvexHulls = function(render, bodies, context) {
        var c = context,
            body,
            part,
            i,
            j,
            k;

        c.beginPath();

        // render convex hulls
        for (i = 0; i < bodies.length; i++) {
            body = bodies[i];

            if (!body.render.visible || body.parts.length === 1)
                continue;

            c.moveTo(body.vertices[0].x, body.vertices[0].y);

            for (j = 1; j < body.vertices.length; j++) {
                c.lineTo(body.vertices[j].x, body.vertices[j].y);
            }

            c.lineTo(body.vertices[0].x, body.vertices[0].y);
        }

        c.lineWidth = 1;
        c.strokeStyle = 'rgba(255,255,255,0.2)';
        c.stroke();
    };

    /**
     * Renders body vertex numbers.
     * @private
     * @method vertexNumbers
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.vertexNumbers = function(render, bodies, context) {
        var c = context,
            i,
            j,
            k;

        for (i = 0; i < bodies.length; i++) {
            var parts = bodies[i].parts;
            for (k = parts.length > 1 ? 1 : 0; k < parts.length; k++) {
                var part = parts[k];
                for (j = 0; j < part.vertices.length; j++) {
                    c.fillStyle = 'rgba(255,255,255,0.2)';
                    c.fillText(i + '_' + j, part.position.x + (part.vertices[j].x - part.position.x) * 0.8, part.position.y + (part.vertices[j].y - part.position.y) * 0.8);
                }
            }
        }
    };

    /**
     * Renders mouse position.
     * @private
     * @method mousePosition
     * @param {render} render
     * @param {mouse} mouse
     * @param {RenderingContext} context
     */
    Render.mousePosition = function(render, mouse, context) {
        var c = context;
        c.fillStyle = 'rgba(255,255,255,0.8)';
        c.fillText(mouse.position.x + '  ' + mouse.position.y, mouse.position.x + 5, mouse.position.y - 5);
    };

    /**
     * Draws body bounds
     * @private
     * @method bodyBounds
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodyBounds = function(render, bodies, context) {
        var c = context,
            engine = render.engine,
            options = render.options;

        c.beginPath();

        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i];

            if (body.render.visible) {
                var parts = bodies[i].parts;
                for (var j = parts.length > 1 ? 1 : 0; j < parts.length; j++) {
                    var part = parts[j];
                    c.rect(part.bounds.min.x, part.bounds.min.y, part.bounds.max.x - part.bounds.min.x, part.bounds.max.y - part.bounds.min.y);
                }
            }
        }

        if (options.wireframes) {
            c.strokeStyle = 'rgba(255,255,255,0.08)';
        } else {
            c.strokeStyle = 'rgba(0,0,0,0.1)';
        }

        c.lineWidth = 1;
        c.stroke();
    };

    /**
     * Draws body angle indicators and axes
     * @private
     * @method bodyAxes
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodyAxes = function(render, bodies, context) {
        var c = context,
            engine = render.engine,
            options = render.options,
            part,
            i,
            j,
            k;

        c.beginPath();

        for (i = 0; i < bodies.length; i++) {
            var body = bodies[i],
                parts = body.parts;

            if (!body.render.visible)
                continue;

            if (options.showAxes) {
                // render all axes
                for (j = parts.length > 1 ? 1 : 0; j < parts.length; j++) {
                    part = parts[j];
                    for (k = 0; k < part.axes.length; k++) {
                        var axis = part.axes[k];
                        c.moveTo(part.position.x, part.position.y);
                        c.lineTo(part.position.x + axis.x * 20, part.position.y + axis.y * 20);
                    }
                }
            } else {
                for (j = parts.length > 1 ? 1 : 0; j < parts.length; j++) {
                    part = parts[j];
                    for (k = 0; k < part.axes.length; k++) {
                        // render a single axis indicator
                        c.moveTo(part.position.x, part.position.y);
                        c.lineTo((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2,
                            (part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2);
                    }
                }
            }
        }

        if (options.wireframes) {
            c.strokeStyle = 'indianred';
            c.lineWidth = 1;
        } else {
            c.strokeStyle = 'rgba(255, 255, 255, 0.4)';
            c.globalCompositeOperation = 'overlay';
            c.lineWidth = 2;
        }

        c.stroke();
        c.globalCompositeOperation = 'source-over';
    };

    /**
     * Draws body positions
     * @private
     * @method bodyPositions
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodyPositions = function(render, bodies, context) {
        var c = context,
            engine = render.engine,
            options = render.options,
            body,
            part,
            i,
            k;

        c.beginPath();

        // render current positions
        for (i = 0; i < bodies.length; i++) {
            body = bodies[i];

            if (!body.render.visible)
                continue;

            // handle compound parts
            for (k = 0; k < body.parts.length; k++) {
                part = body.parts[k];
                c.arc(part.position.x, part.position.y, 3, 0, 2 * Math.PI, false);
                c.closePath();
            }
        }

        if (options.wireframes) {
            c.fillStyle = 'indianred';
        } else {
            c.fillStyle = 'rgba(0,0,0,0.5)';
        }
        c.fill();

        c.beginPath();

        // render previous positions
        for (i = 0; i < bodies.length; i++) {
            body = bodies[i];
            if (body.render.visible) {
                c.arc(body.positionPrev.x, body.positionPrev.y, 2, 0, 2 * Math.PI, false);
                c.closePath();
            }
        }

        c.fillStyle = 'rgba(255,165,0,0.8)';
        c.fill();
    };

    /**
     * Draws body velocity
     * @private
     * @method bodyVelocity
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodyVelocity = function(render, bodies, context) {
        var c = context;

        c.beginPath();

        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i];

            if (!body.render.visible)
                continue;

            c.moveTo(body.position.x, body.position.y);
            c.lineTo(body.position.x + (body.position.x - body.positionPrev.x) * 2, body.position.y + (body.position.y - body.positionPrev.y) * 2);
        }

        c.lineWidth = 3;
        c.strokeStyle = 'cornflowerblue';
        c.stroke();
    };

    /**
     * Draws body ids
     * @private
     * @method bodyIds
     * @param {render} render
     * @param {body[]} bodies
     * @param {RenderingContext} context
     */
    Render.bodyIds = function(render, bodies, context) {
        var c = context,
            i,
            j;

        for (i = 0; i < bodies.length; i++) {
            if (!bodies[i].render.visible)
                continue;

            var parts = bodies[i].parts;
            for (j = parts.length > 1 ? 1 : 0; j < parts.length; j++) {
                var part = parts[j];
                c.font = "12px Arial";
                c.fillStyle = 'rgba(255,255,255,0.5)';
                c.fillText(part.id, part.position.x + 10, part.position.y - 10);
            }
        }
    };

    /**
     * Description
     * @private
     * @method collisions
     * @param {render} render
     * @param {pair[]} pairs
     * @param {RenderingContext} context
     */
    Render.collisions = function(render, pairs, context) {
        var c = context,
            options = render.options,
            pair,
            collision,
            corrected,
            bodyA,
            bodyB,
            i,
            j;

        c.beginPath();

        // render collision positions
        for (i = 0; i < pairs.length; i++) {
            pair = pairs[i];

            if (!pair.isActive)
                continue;

            collision = pair.collision;
            for (j = 0; j < pair.activeContacts.length; j++) {
                var contact = pair.activeContacts[j],
                    vertex = contact.vertex;
                c.rect(vertex.x - 1.5, vertex.y - 1.5, 3.5, 3.5);
            }
        }

        if (options.wireframes) {
            c.fillStyle = 'rgba(255,255,255,0.7)';
        } else {
            c.fillStyle = 'orange';
        }
        c.fill();

        c.beginPath();

        // render collision normals
        for (i = 0; i < pairs.length; i++) {
            pair = pairs[i];

            if (!pair.isActive)
                continue;

            collision = pair.collision;

            if (pair.activeContacts.length > 0) {
                var normalPosX = pair.activeContacts[0].vertex.x,
                    normalPosY = pair.activeContacts[0].vertex.y;

                if (pair.activeContacts.length === 2) {
                    normalPosX = (pair.activeContacts[0].vertex.x + pair.activeContacts[1].vertex.x) / 2;
                    normalPosY = (pair.activeContacts[0].vertex.y + pair.activeContacts[1].vertex.y) / 2;
                }

                if (collision.bodyB === collision.supports[0].body || collision.bodyA.isStatic === true) {
                    c.moveTo(normalPosX - collision.normal.x * 8, normalPosY - collision.normal.y * 8);
                } else {
                    c.moveTo(normalPosX + collision.normal.x * 8, normalPosY + collision.normal.y * 8);
                }

                c.lineTo(normalPosX, normalPosY);
            }
        }

        if (options.wireframes) {
            c.strokeStyle = 'rgba(255,165,0,0.7)';
        } else {
            c.strokeStyle = 'orange';
        }

        c.lineWidth = 1;
        c.stroke();
    };

    /**
     * Description
     * @private
     * @method separations
     * @param {render} render
     * @param {pair[]} pairs
     * @param {RenderingContext} context
     */
    Render.separations = function(render, pairs, context) {
        var c = context,
            options = render.options,
            pair,
            collision,
            corrected,
            bodyA,
            bodyB,
            i,
            j;

        c.beginPath();

        // render separations
        for (i = 0; i < pairs.length; i++) {
            pair = pairs[i];

            if (!pair.isActive)
                continue;

            collision = pair.collision;
            bodyA = collision.bodyA;
            bodyB = collision.bodyB;

            var k = 1;

            if (!bodyB.isStatic && !bodyA.isStatic) k = 0.5;
            if (bodyB.isStatic) k = 0;

            c.moveTo(bodyB.position.x, bodyB.position.y);
            c.lineTo(bodyB.position.x - collision.penetration.x * k, bodyB.position.y - collision.penetration.y * k);

            k = 1;

            if (!bodyB.isStatic && !bodyA.isStatic) k = 0.5;
            if (bodyA.isStatic) k = 0;

            c.moveTo(bodyA.position.x, bodyA.position.y);
            c.lineTo(bodyA.position.x + collision.penetration.x * k, bodyA.position.y + collision.penetration.y * k);
        }

        if (options.wireframes) {
            c.strokeStyle = 'rgba(255,165,0,0.5)';
        } else {
            c.strokeStyle = 'orange';
        }
        c.stroke();
    };

    /**
     * Description
     * @private
     * @method inspector
     * @param {inspector} inspector
     * @param {RenderingContext} context
     */
    Render.inspector = function(inspector, context) {
        var engine = inspector.engine,
            selected = inspector.selected,
            render = inspector.render,
            options = render.options,
            bounds;

        if (options.hasBounds) {
            var boundsWidth = render.bounds.max.x - render.bounds.min.x,
                boundsHeight = render.bounds.max.y - render.bounds.min.y,
                boundsScaleX = boundsWidth / render.options.width,
                boundsScaleY = boundsHeight / render.options.height;

            context.scale(1 / boundsScaleX, 1 / boundsScaleY);
            context.translate(-render.bounds.min.x, -render.bounds.min.y);
        }

        for (var i = 0; i < selected.length; i++) {
            var item = selected[i].data;

            context.translate(0.5, 0.5);
            context.lineWidth = 1;
            context.strokeStyle = 'rgba(255,165,0,0.9)';
            context.setLineDash([1,2]);

            switch (item.type) {

            case 'body':

                // render body selections
                bounds = item.bounds;
                context.beginPath();
                context.rect(Math.floor(bounds.min.x - 3), Math.floor(bounds.min.y - 3),
                    Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6));
                context.closePath();
                context.stroke();

                break;

            case 'constraint':

                // render constraint selections
                var point = item.pointA;
                if (item.bodyA)
                    point = item.pointB;
                context.beginPath();
                context.arc(point.x, point.y, 10, 0, 2 * Math.PI);
                context.closePath();
                context.stroke();

                break;

            }

            context.setLineDash([]);
            context.translate(-0.5, -0.5);
        }

        // render selection region
        if (inspector.selectStart !== null) {
            context.translate(0.5, 0.5);
            context.lineWidth = 1;
            context.strokeStyle = 'rgba(255,165,0,0.6)';
            context.fillStyle = 'rgba(255,165,0,0.1)';
            bounds = inspector.selectBounds;
            context.beginPath();
            context.rect(Math.floor(bounds.min.x), Math.floor(bounds.min.y),
                Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y));
            context.closePath();
            context.stroke();
            context.fill();
            context.translate(-0.5, -0.5);
        }

        if (options.hasBounds)
            context.setTransform(1, 0, 0, 1, 0, 0);
    };

    /**
     * Updates render timing.
     * @method _updateTiming
     * @private
     * @param {render} render
     * @param {number} time
     */
    var _updateTiming = function(render, time) {
        var engine = render.engine,
            timing = render.timing,
            historySize = timing.historySize,
            timestamp = engine.timing.timestamp;

        timing.delta = time - timing.lastTime || Render._goodDelta;
        timing.lastTime = time;

        timing.timestampElapsed = timestamp - timing.lastTimestamp || 0;
        timing.lastTimestamp = timestamp;

        timing.deltaHistory.unshift(timing.delta);
        timing.deltaHistory.length = Math.min(timing.deltaHistory.length, historySize);

        timing.engineDeltaHistory.unshift(engine.timing.lastDelta);
        timing.engineDeltaHistory.length = Math.min(timing.engineDeltaHistory.length, historySize);

        timing.timestampElapsedHistory.unshift(timing.timestampElapsed);
        timing.timestampElapsedHistory.length = Math.min(timing.timestampElapsedHistory.length, historySize);

        timing.engineElapsedHistory.unshift(engine.timing.lastElapsed);
        timing.engineElapsedHistory.length = Math.min(timing.engineElapsedHistory.length, historySize);

        timing.elapsedHistory.unshift(timing.lastElapsed);
        timing.elapsedHistory.length = Math.min(timing.elapsedHistory.length, historySize);
    };

    /**
     * Returns the mean value of the given numbers.
     * @method _mean
     * @private
     * @param {Number[]} values
     * @return {Number} the mean of given values
     */
    var _mean = function(values) {
        var result = 0;
        for (var i = 0; i < values.length; i += 1) {
            result += values[i];
        }
        return (result / values.length) || 0;
    };

    /**
     * @method _createCanvas
     * @private
     * @param {} width
     * @param {} height
     * @return canvas
     */
    var _createCanvas = function(width, height) {
        var canvas = document.createElement('canvas');
        canvas.width = width;
        canvas.height = height;
        canvas.oncontextmenu = function() { return false; };
        canvas.onselectstart = function() { return false; };
        return canvas;
    };

    /**
     * Gets the pixel ratio of the canvas.
     * @method _getPixelRatio
     * @private
     * @param {HTMLElement} canvas
     * @return {Number} pixel ratio
     */
    var _getPixelRatio = function(canvas) {
        var context = canvas.getContext('2d'),
            devicePixelRatio = window.devicePixelRatio || 1,
            backingStorePixelRatio = context.webkitBackingStorePixelRatio || context.mozBackingStorePixelRatio
                                      || context.msBackingStorePixelRatio || context.oBackingStorePixelRatio
                                      || context.backingStorePixelRatio || 1;

        return devicePixelRatio / backingStorePixelRatio;
    };

    /**
     * Gets the requested texture (an Image) via its path
     * @method _getTexture
     * @private
     * @param {render} render
     * @param {string} imagePath
     * @return {Image} texture
     */
    var _getTexture = function(render, imagePath) {
        var image = render.textures[imagePath];

        if (image)
            return image;

        image = render.textures[imagePath] = new Image();
        image.src = imagePath;

        return image;
    };

    /**
     * Applies the background to the canvas using CSS.
     * @method applyBackground
     * @private
     * @param {render} render
     * @param {string} background
     */
    var _applyBackground = function(render, background) {
        var cssBackground = background;

        if (/(jpg|gif|png)$/.test(background))
            cssBackground = 'url(' + background + ')';

        render.canvas.style.background = cssBackground;
        render.canvas.style.backgroundSize = "contain";
        render.currentBackground = background;
    };

    /*
    *
    *  Events Documentation
    *
    */

    /**
    * Fired before rendering
    *
    * @event beforeRender
    * @param {} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired after rendering
    *
    * @event afterRender
    * @param {} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * A back-reference to the `Matter.Render` module.
     *
     * @property controller
     * @type render
     */

    /**
     * A reference to the `Matter.Engine` instance to be used.
     *
     * @property engine
     * @type engine
     */

    /**
     * A reference to the element where the canvas is to be inserted (if `render.canvas` has not been specified)
     *
     * @property element
     * @type HTMLElement
     * @default null
     */

    /**
     * The canvas element to render to. If not specified, one will be created if `render.element` has been specified.
     *
     * @property canvas
     * @type HTMLCanvasElement
     * @default null
     */

    /**
     * A `Bounds` object that specifies the drawing view region.
     * Rendering will be automatically transformed and scaled to fit within the canvas size (`render.options.width` and `render.options.height`).
     * This allows for creating views that can pan or zoom around the scene.
     * You must also set `render.options.hasBounds` to `true` to enable bounded rendering.
     *
     * @property bounds
     * @type bounds
     */

    /**
     * The 2d rendering context from the `render.canvas` element.
     *
     * @property context
     * @type CanvasRenderingContext2D
     */

    /**
     * The sprite texture cache.
     *
     * @property textures
     * @type {}
     */

    /**
     * The mouse to render if `render.options.showMousePosition` is enabled.
     *
     * @property mouse
     * @type mouse
     * @default null
     */

    /**
     * The configuration options of the renderer.
     *
     * @property options
     * @type {}
     */

    /**
     * The target width in pixels of the `render.canvas` to be created.
     * See also the `options.pixelRatio` property to change render quality.
     *
     * @property options.width
     * @type number
     * @default 800
     */

    /**
     * The target height in pixels of the `render.canvas` to be created.
     * See also the `options.pixelRatio` property to change render quality.
     *
     * @property options.height
     * @type number
     * @default 600
     */

    /**
     * The [pixel ratio](https://developer.mozilla.org/en-US/docs/Web/API/Window/devicePixelRatio) to use when rendering.
     *
     * @property options.pixelRatio
     * @type number
     * @default 1
     */

    /**
     * A CSS background color string to use when `render.options.wireframes` is disabled.
     * This may be also set to `'transparent'` or equivalent.
     *
     * @property options.background
     * @type string
     * @default '#14151f'
     */

    /**
     * A CSS background color string to use when `render.options.wireframes` is enabled.
     * This may be also set to `'transparent'` or equivalent.
     *
     * @property options.wireframeBackground
     * @type string
     * @default '#14151f'
     */

    /**
     * A flag that specifies if `render.bounds` should be used when rendering.
     *
     * @property options.hasBounds
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable all debug information overlays together.  
     * This includes and has priority over the values of:
     *
     * - `render.options.showStats`
     * - `render.options.showPerformance`
     *
     * @property options.showDebug
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the engine stats info overlay.  
     * From left to right, the values shown are:
     *
     * - body parts total
     * - body total
     * - constraints total
     * - composites total
     * - collision pairs total
     *
     * @property options.showStats
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable performance charts.  
     * From left to right, the values shown are:
     *
     * - average render frequency (e.g. 60 fps)
     * - exact engine delta time used for last update (e.g. 16.66ms)
     * - average engine execution duration (e.g. 5.00ms)
     * - average render execution duration (e.g. 0.40ms)
     * - average effective play speed (e.g. '1.00x' is 'real-time')
     *
     * Each value is recorded over a fixed sample of past frames (60 frames).
     *
     * A chart shown below each value indicates the variance from the average over the sample.
     * The more stable or fixed the value is the flatter the chart will appear.
     *
     * @property options.showPerformance
     * @type boolean
     * @default false
     */
    
    /**
     * A flag to enable or disable rendering entirely.
     *
     * @property options.enabled
     * @type boolean
     * @default false
     */

    /**
     * A flag to toggle wireframe rendering otherwise solid fill rendering is used.
     *
     * @property options.wireframes
     * @type boolean
     * @default true
     */

    /**
     * A flag to enable or disable sleeping bodies indicators.
     *
     * @property options.showSleeping
     * @type boolean
     * @default true
     */

    /**
     * A flag to enable or disable the debug information overlay.
     *
     * @property options.showDebug
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the collision broadphase debug overlay.
     *
     * @deprecated no longer implemented
     * @property options.showBroadphase
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body bounds debug overlay.
     *
     * @property options.showBounds
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body velocity debug overlay.
     *
     * @property options.showVelocity
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body collisions debug overlay.
     *
     * @property options.showCollisions
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the collision resolver separations debug overlay.
     *
     * @property options.showSeparations
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body axes debug overlay.
     *
     * @property options.showAxes
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body positions debug overlay.
     *
     * @property options.showPositions
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body angle debug overlay.
     *
     * @property options.showAngleIndicator
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body and part ids debug overlay.
     *
     * @property options.showIds
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body vertex numbers debug overlay.
     *
     * @property options.showVertexNumbers
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body convex hulls debug overlay.
     *
     * @property options.showConvexHulls
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the body internal edges debug overlay.
     *
     * @property options.showInternalEdges
     * @type boolean
     * @default false
     */

    /**
     * A flag to enable or disable the mouse position debug overlay.
     *
     * @property options.showMousePosition
     * @type boolean
     * @default false
     */

})();


/***/ }),
/* 17 */
/***/ (function(module, exports) {

/**
* The `Matter.Contact` module contains methods for creating and manipulating collision contacts.
*
* @class Contact
*/

var Contact = {};

module.exports = Contact;

(function() {

    /**
     * Creates a new contact.
     * @method create
     * @param {vertex} vertex
     * @return {contact} A new contact
     */
    Contact.create = function(vertex) {
        return {
            vertex: vertex,
            normalImpulse: 0,
            tangentImpulse: 0
        };
    };

})();


/***/ }),
/* 18 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Engine` module contains methods for creating and manipulating engines.
* An engine is a controller that manages updating the simulation of the world.
* See `Matter.Runner` for an optional game loop utility.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Engine
*/

var Engine = {};

module.exports = Engine;

var Sleeping = __webpack_require__(7);
var Resolver = __webpack_require__(19);
var Detector = __webpack_require__(14);
var Pairs = __webpack_require__(20);
var Events = __webpack_require__(4);
var Composite = __webpack_require__(5);
var Constraint = __webpack_require__(10);
var Common = __webpack_require__(0);
var Body = __webpack_require__(6);

(function() {

    /**
     * Creates a new engine. The options parameter is an object that specifies any properties you wish to override the defaults.
     * All properties have default values, and many are pre-calculated automatically based on other properties.
     * See the properties section below for detailed information on what you can pass via the `options` object.
     * @method create
     * @param {object} [options]
     * @return {engine} engine
     */
    Engine.create = function(options) {
        options = options || {};

        var defaults = {
            positionIterations: 6,
            velocityIterations: 4,
            constraintIterations: 2,
            enableSleeping: false,
            events: [],
            plugin: {},
            gravity: {
                x: 0,
                y: 1,
                scale: 0.001
            },
            timing: {
                timestamp: 0,
                timeScale: 1,
                lastDelta: 0,
                lastElapsed: 0
            }
        };

        var engine = Common.extend(defaults, options);

        engine.world = options.world || Composite.create({ label: 'World' });
        engine.pairs = options.pairs || Pairs.create();
        engine.detector = options.detector || Detector.create();

        // for temporary back compatibility only
        engine.grid = { buckets: [] };
        engine.world.gravity = engine.gravity;
        engine.broadphase = engine.grid;
        engine.metrics = {};
        
        return engine;
    };

    /**
     * Moves the simulation forward in time by `delta` ms.
     * The `correction` argument is an optional `Number` that specifies the time correction factor to apply to the update.
     * This can help improve the accuracy of the simulation in cases where `delta` is changing between updates.
     * The value of `correction` is defined as `delta / lastDelta`, i.e. the percentage change of `delta` over the last step.
     * Therefore the value is always `1` (no correction) when `delta` constant (or when no correction is desired, which is the default).
     * See the paper on <a href="http://lonesock.net/article/verlet.html">Time Corrected Verlet</a> for more information.
     *
     * Triggers `beforeUpdate` and `afterUpdate` events.
     * Triggers `collisionStart`, `collisionActive` and `collisionEnd` events.
     * @method update
     * @param {engine} engine
     * @param {number} [delta=16.666]
     * @param {number} [correction=1]
     */
    Engine.update = function(engine, delta, correction) {
        var startTime = Common.now();

        delta = delta || 1000 / 60;
        correction = correction || 1;

        var world = engine.world,
            detector = engine.detector,
            pairs = engine.pairs,
            timing = engine.timing,
            timestamp = timing.timestamp,
            i;

        // increment timestamp
        timing.timestamp += delta * timing.timeScale;
        timing.lastDelta = delta * timing.timeScale;

        // create an event object
        var event = {
            timestamp: timing.timestamp
        };

        Events.trigger(engine, 'beforeUpdate', event);

        // get all bodies and all constraints in the world
        var allBodies = Composite.allBodies(world),
            allConstraints = Composite.allConstraints(world);

        // update the detector bodies if they have changed
        if (world.isModified) {
            Detector.setBodies(detector, allBodies);
        }

        // reset all composite modified flags
        if (world.isModified) {
            Composite.setModified(world, false, false, true);
        }

        // update sleeping if enabled
        if (engine.enableSleeping)
            Sleeping.update(allBodies, timing.timeScale);

        // apply gravity to all bodies
        Engine._bodiesApplyGravity(allBodies, engine.gravity);

        // update all body position and rotation by integration
        Engine._bodiesUpdate(allBodies, delta, timing.timeScale, correction, world.bounds);

        // update all constraints (first pass)
        Constraint.preSolveAll(allBodies);
        for (i = 0; i < engine.constraintIterations; i++) {
            Constraint.solveAll(allConstraints, timing.timeScale);
        }
        Constraint.postSolveAll(allBodies);

        // find all collisions
        detector.pairs = engine.pairs;
        var collisions = Detector.collisions(detector);

        // update collision pairs
        Pairs.update(pairs, collisions, timestamp);

        // wake up bodies involved in collisions
        if (engine.enableSleeping)
            Sleeping.afterCollisions(pairs.list, timing.timeScale);

        // trigger collision events
        if (pairs.collisionStart.length > 0)
            Events.trigger(engine, 'collisionStart', { pairs: pairs.collisionStart });

        // iteratively resolve position between collisions
        Resolver.preSolvePosition(pairs.list);
        for (i = 0; i < engine.positionIterations; i++) {
            Resolver.solvePosition(pairs.list, timing.timeScale);
        }
        Resolver.postSolvePosition(allBodies);

        // update all constraints (second pass)
        Constraint.preSolveAll(allBodies);
        for (i = 0; i < engine.constraintIterations; i++) {
            Constraint.solveAll(allConstraints, timing.timeScale);
        }
        Constraint.postSolveAll(allBodies);

        // iteratively resolve velocity between collisions
        Resolver.preSolveVelocity(pairs.list);
        for (i = 0; i < engine.velocityIterations; i++) {
            Resolver.solveVelocity(pairs.list, timing.timeScale);
        }

        // trigger collision events
        if (pairs.collisionActive.length > 0)
            Events.trigger(engine, 'collisionActive', { pairs: pairs.collisionActive });

        if (pairs.collisionEnd.length > 0)
            Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd });

        // clear force buffers
        Engine._bodiesClearForces(allBodies);

        Events.trigger(engine, 'afterUpdate', event);

        // log the time elapsed computing this update
        engine.timing.lastElapsed = Common.now() - startTime;

        return engine;
    };
    
    /**
     * Merges two engines by keeping the configuration of `engineA` but replacing the world with the one from `engineB`.
     * @method merge
     * @param {engine} engineA
     * @param {engine} engineB
     */
    Engine.merge = function(engineA, engineB) {
        Common.extend(engineA, engineB);
        
        if (engineB.world) {
            engineA.world = engineB.world;

            Engine.clear(engineA);

            var bodies = Composite.allBodies(engineA.world);

            for (var i = 0; i < bodies.length; i++) {
                var body = bodies[i];
                Sleeping.set(body, false);
                body.id = Common.nextId();
            }
        }
    };

    /**
     * Clears the engine pairs and detector.
     * @method clear
     * @param {engine} engine
     */
    Engine.clear = function(engine) {
        Pairs.clear(engine.pairs);
        Detector.clear(engine.detector);
    };

    /**
     * Zeroes the `body.force` and `body.torque` force buffers.
     * @method _bodiesClearForces
     * @private
     * @param {body[]} bodies
     */
    Engine._bodiesClearForces = function(bodies) {
        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i];

            // reset force buffers
            body.force.x = 0;
            body.force.y = 0;
            body.torque = 0;
        }
    };

    /**
     * Applys a mass dependant force to all given bodies.
     * @method _bodiesApplyGravity
     * @private
     * @param {body[]} bodies
     * @param {vector} gravity
     */
    Engine._bodiesApplyGravity = function(bodies, gravity) {
        var gravityScale = typeof gravity.scale !== 'undefined' ? gravity.scale : 0.001;

        if ((gravity.x === 0 && gravity.y === 0) || gravityScale === 0) {
            return;
        }
        
        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i];

            if (body.isStatic || body.isSleeping)
                continue;

            // apply gravity
            body.force.y += body.mass * gravity.y * gravityScale;
            body.force.x += body.mass * gravity.x * gravityScale;
        }
    };

    /**
     * Applys `Body.update` to all given `bodies`.
     * @method _bodiesUpdate
     * @private
     * @param {body[]} bodies
     * @param {number} deltaTime 
     * The amount of time elapsed between updates
     * @param {number} timeScale
     * @param {number} correction 
     * The Verlet correction factor (deltaTime / lastDeltaTime)
     * @param {bounds} worldBounds
     */
    Engine._bodiesUpdate = function(bodies, deltaTime, timeScale, correction, worldBounds) {
        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i];

            if (body.isStatic || body.isSleeping)
                continue;

            Body.update(body, deltaTime, timeScale, correction);
        }
    };

    /**
     * A deprecated alias for `Runner.run`, use `Matter.Runner.run(engine)` instead and see `Matter.Runner` for more information.
     * @deprecated use Matter.Runner.run(engine) instead
     * @method run
     * @param {engine} engine
     */

    /**
    * Fired just before an update
    *
    * @event beforeUpdate
    * @param {object} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {engine} event.source The source object of the event
    * @param {string} event.name The name of the event
    */

    /**
    * Fired after engine update and all collision events
    *
    * @event afterUpdate
    * @param {object} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {engine} event.source The source object of the event
    * @param {string} event.name The name of the event
    */

    /**
    * Fired after engine update, provides a list of all pairs that have started to collide in the current tick (if any)
    *
    * @event collisionStart
    * @param {object} event An event object
    * @param {pair[]} event.pairs List of affected pairs
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {engine} event.source The source object of the event
    * @param {string} event.name The name of the event
    */

    /**
    * Fired after engine update, provides a list of all pairs that are colliding in the current tick (if any)
    *
    * @event collisionActive
    * @param {object} event An event object
    * @param {pair[]} event.pairs List of affected pairs
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {engine} event.source The source object of the event
    * @param {string} event.name The name of the event
    */

    /**
    * Fired after engine update, provides a list of all pairs that have ended collision in the current tick (if any)
    *
    * @event collisionEnd
    * @param {object} event An event object
    * @param {pair[]} event.pairs List of affected pairs
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {engine} event.source The source object of the event
    * @param {string} event.name The name of the event
    */

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * An integer `Number` that specifies the number of position iterations to perform each update.
     * The higher the value, the higher quality the simulation will be at the expense of performance.
     *
     * @property positionIterations
     * @type number
     * @default 6
     */

    /**
     * An integer `Number` that specifies the number of velocity iterations to perform each update.
     * The higher the value, the higher quality the simulation will be at the expense of performance.
     *
     * @property velocityIterations
     * @type number
     * @default 4
     */

    /**
     * An integer `Number` that specifies the number of constraint iterations to perform each update.
     * The higher the value, the higher quality the simulation will be at the expense of performance.
     * The default value of `2` is usually very adequate.
     *
     * @property constraintIterations
     * @type number
     * @default 2
     */

    /**
     * A flag that specifies whether the engine should allow sleeping via the `Matter.Sleeping` module.
     * Sleeping can improve stability and performance, but often at the expense of accuracy.
     *
     * @property enableSleeping
     * @type boolean
     * @default false
     */

    /**
     * An `Object` containing properties regarding the timing systems of the engine. 
     *
     * @property timing
     * @type object
     */

    /**
     * A `Number` that specifies the global scaling factor of time for all bodies.
     * A value of `0` freezes the simulation.
     * A value of `0.1` gives a slow-motion effect.
     * A value of `1.2` gives a speed-up effect.
     *
     * @property timing.timeScale
     * @type number
     * @default 1
     */

    /**
     * A `Number` that specifies the current simulation-time in milliseconds starting from `0`. 
     * It is incremented on every `Engine.update` by the given `delta` argument. 
     *
     * @property timing.timestamp
     * @type number
     * @default 0
     */

    /**
     * A `Number` that represents the total execution time elapsed during the last `Engine.update` in milliseconds.
     * It is updated by timing from the start of the last `Engine.update` call until it ends.
     *
     * This value will also include the total execution time of all event handlers directly or indirectly triggered by the engine update.
     *
     * @property timing.lastElapsed
     * @type number
     * @default 0
     */

    /**
     * A `Number` that represents the `delta` value used in the last engine update.
     *
     * @property timing.lastDelta
     * @type number
     * @default 0
     */

    /**
     * A `Matter.Detector` instance.
     *
     * @property detector
     * @type detector
     * @default a Matter.Detector instance
     */

    /**
     * A `Matter.Grid` instance.
     *
     * @deprecated replaced by `engine.detector`
     * @property grid
     * @type grid
     * @default a Matter.Grid instance
     */

    /**
     * Replaced by and now alias for `engine.grid`.
     *
     * @deprecated replaced by `engine.detector`
     * @property broadphase
     * @type grid
     * @default a Matter.Grid instance
     */

    /**
     * The root `Matter.Composite` instance that will contain all bodies, constraints and other composites to be simulated by this engine.
     *
     * @property world
     * @type composite
     * @default a Matter.Composite instance
     */

    /**
     * An object reserved for storing plugin-specific properties.
     *
     * @property plugin
     * @type {}
     */

    /**
     * The gravity to apply on all bodies in `engine.world`.
     *
     * @property gravity
     * @type object
     */

    /**
     * The gravity x component.
     *
     * @property gravity.x
     * @type object
     * @default 0
     */

    /**
     * The gravity y component.
     *
     * @property gravity.y
     * @type object
     * @default 1
     */

    /**
     * The gravity scale factor.
     *
     * @property gravity.scale
     * @type object
     * @default 0.001
     */

})();


/***/ }),
/* 19 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Resolver` module contains methods for resolving collision pairs.
*
* @class Resolver
*/

var Resolver = {};

module.exports = Resolver;

var Vertices = __webpack_require__(3);
var Bounds = __webpack_require__(1);

(function() {

    Resolver._restingThresh = 4;
    Resolver._restingThreshTangent = 6;
    Resolver._positionDampen = 0.9;
    Resolver._positionWarming = 0.8;
    Resolver._frictionNormalMultiplier = 5;

    /**
     * Prepare pairs for position solving.
     * @method preSolvePosition
     * @param {pair[]} pairs
     */
    Resolver.preSolvePosition = function(pairs) {
        var i,
            pair,
            activeCount,
            pairsLength = pairs.length;

        // find total contacts on each body
        for (i = 0; i < pairsLength; i++) {
            pair = pairs[i];
            
            if (!pair.isActive)
                continue;
            
            activeCount = pair.activeContacts.length;
            pair.collision.parentA.totalContacts += activeCount;
            pair.collision.parentB.totalContacts += activeCount;
        }
    };

    /**
     * Find a solution for pair positions.
     * @method solvePosition
     * @param {pair[]} pairs
     * @param {number} timeScale
     */
    Resolver.solvePosition = function(pairs, timeScale) {
        var i,
            pair,
            collision,
            bodyA,
            bodyB,
            normal,
            contactShare,
            positionImpulse,
            positionDampen = Resolver._positionDampen,
            pairsLength = pairs.length;

        // find impulses required to resolve penetration
        for (i = 0; i < pairsLength; i++) {
            pair = pairs[i];
            
            if (!pair.isActive || pair.isSensor)
                continue;

            collision = pair.collision;
            bodyA = collision.parentA;
            bodyB = collision.parentB;
            normal = collision.normal;

            // get current separation between body edges involved in collision
            pair.separation = 
                normal.x * (bodyB.positionImpulse.x + collision.penetration.x - bodyA.positionImpulse.x)
                + normal.y * (bodyB.positionImpulse.y + collision.penetration.y - bodyA.positionImpulse.y);
        }
        
        for (i = 0; i < pairsLength; i++) {
            pair = pairs[i];

            if (!pair.isActive || pair.isSensor)
                continue;
            
            collision = pair.collision;
            bodyA = collision.parentA;
            bodyB = collision.parentB;
            normal = collision.normal;
            positionImpulse = (pair.separation - pair.slop) * timeScale;

            if (bodyA.isStatic || bodyB.isStatic)
                positionImpulse *= 2;
            
            if (!(bodyA.isStatic || bodyA.isSleeping)) {
                contactShare = positionDampen / bodyA.totalContacts;
                bodyA.positionImpulse.x += normal.x * positionImpulse * contactShare;
                bodyA.positionImpulse.y += normal.y * positionImpulse * contactShare;
            }

            if (!(bodyB.isStatic || bodyB.isSleeping)) {
                contactShare = positionDampen / bodyB.totalContacts;
                bodyB.positionImpulse.x -= normal.x * positionImpulse * contactShare;
                bodyB.positionImpulse.y -= normal.y * positionImpulse * contactShare;
            }
        }
    };

    /**
     * Apply position resolution.
     * @method postSolvePosition
     * @param {body[]} bodies
     */
    Resolver.postSolvePosition = function(bodies) {
        var positionWarming = Resolver._positionWarming,
            bodiesLength = bodies.length,
            verticesTranslate = Vertices.translate,
            boundsUpdate = Bounds.update;

        for (var i = 0; i < bodiesLength; i++) {
            var body = bodies[i],
                positionImpulse = body.positionImpulse,
                positionImpulseX = positionImpulse.x,
                positionImpulseY = positionImpulse.y,
                velocity = body.velocity;

            // reset contact count
            body.totalContacts = 0;

            if (positionImpulseX !== 0 || positionImpulseY !== 0) {
                // update body geometry
                for (var j = 0; j < body.parts.length; j++) {
                    var part = body.parts[j];
                    verticesTranslate(part.vertices, positionImpulse);
                    boundsUpdate(part.bounds, part.vertices, velocity);
                    part.position.x += positionImpulseX;
                    part.position.y += positionImpulseY;
                }

                // move the body without changing velocity
                body.positionPrev.x += positionImpulseX;
                body.positionPrev.y += positionImpulseY;

                if (positionImpulseX * velocity.x + positionImpulseY * velocity.y < 0) {
                    // reset cached impulse if the body has velocity along it
                    positionImpulse.x = 0;
                    positionImpulse.y = 0;
                } else {
                    // warm the next iteration
                    positionImpulse.x *= positionWarming;
                    positionImpulse.y *= positionWarming;
                }
            }
        }
    };

    /**
     * Prepare pairs for velocity solving.
     * @method preSolveVelocity
     * @param {pair[]} pairs
     */
    Resolver.preSolveVelocity = function(pairs) {
        var pairsLength = pairs.length,
            i,
            j;
        
        for (i = 0; i < pairsLength; i++) {
            var pair = pairs[i];
            
            if (!pair.isActive || pair.isSensor)
                continue;
            
            var contacts = pair.activeContacts,
                contactsLength = contacts.length,
                collision = pair.collision,
                bodyA = collision.parentA,
                bodyB = collision.parentB,
                normal = collision.normal,
                tangent = collision.tangent;
    
            // resolve each contact
            for (j = 0; j < contactsLength; j++) {
                var contact = contacts[j],
                    contactVertex = contact.vertex,
                    normalImpulse = contact.normalImpulse,
                    tangentImpulse = contact.tangentImpulse;
    
                if (normalImpulse !== 0 || tangentImpulse !== 0) {
                    // total impulse from contact
                    var impulseX = normal.x * normalImpulse + tangent.x * tangentImpulse,
                        impulseY = normal.y * normalImpulse + tangent.y * tangentImpulse;
                    
                    // apply impulse from contact
                    if (!(bodyA.isStatic || bodyA.isSleeping)) {
                        bodyA.positionPrev.x += impulseX * bodyA.inverseMass;
                        bodyA.positionPrev.y += impulseY * bodyA.inverseMass;
                        bodyA.anglePrev += bodyA.inverseInertia * (
                            (contactVertex.x - bodyA.position.x) * impulseY
                            - (contactVertex.y - bodyA.position.y) * impulseX
                        );
                    }
    
                    if (!(bodyB.isStatic || bodyB.isSleeping)) {
                        bodyB.positionPrev.x -= impulseX * bodyB.inverseMass;
                        bodyB.positionPrev.y -= impulseY * bodyB.inverseMass;
                        bodyB.anglePrev -= bodyB.inverseInertia * (
                            (contactVertex.x - bodyB.position.x) * impulseY 
                            - (contactVertex.y - bodyB.position.y) * impulseX
                        );
                    }
                }
            }
        }
    };

    /**
     * Find a solution for pair velocities.
     * @method solveVelocity
     * @param {pair[]} pairs
     * @param {number} timeScale
     */
    Resolver.solveVelocity = function(pairs, timeScale) {
        var timeScaleSquared = timeScale * timeScale,
            restingThresh = Resolver._restingThresh * timeScaleSquared,
            frictionNormalMultiplier = Resolver._frictionNormalMultiplier,
            restingThreshTangent = Resolver._restingThreshTangent * timeScaleSquared,
            NumberMaxValue = Number.MAX_VALUE,
            pairsLength = pairs.length,
            tangentImpulse,
            maxFriction,
            i,
            j;

        for (i = 0; i < pairsLength; i++) {
            var pair = pairs[i];
            
            if (!pair.isActive || pair.isSensor)
                continue;
            
            var collision = pair.collision,
                bodyA = collision.parentA,
                bodyB = collision.parentB,
                bodyAVelocity = bodyA.velocity,
                bodyBVelocity = bodyB.velocity,
                normalX = collision.normal.x,
                normalY = collision.normal.y,
                tangentX = collision.tangent.x,
                tangentY = collision.tangent.y,
                contacts = pair.activeContacts,
                contactsLength = contacts.length,
                contactShare = 1 / contactsLength,
                inverseMassTotal = bodyA.inverseMass + bodyB.inverseMass,
                friction = pair.friction * pair.frictionStatic * frictionNormalMultiplier * timeScaleSquared;

            // update body velocities
            bodyAVelocity.x = bodyA.position.x - bodyA.positionPrev.x;
            bodyAVelocity.y = bodyA.position.y - bodyA.positionPrev.y;
            bodyBVelocity.x = bodyB.position.x - bodyB.positionPrev.x;
            bodyBVelocity.y = bodyB.position.y - bodyB.positionPrev.y;
            bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev;
            bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev;

            // resolve each contact
            for (j = 0; j < contactsLength; j++) {
                var contact = contacts[j],
                    contactVertex = contact.vertex;

                var offsetAX = contactVertex.x - bodyA.position.x,
                    offsetAY = contactVertex.y - bodyA.position.y,
                    offsetBX = contactVertex.x - bodyB.position.x,
                    offsetBY = contactVertex.y - bodyB.position.y;
 
                var velocityPointAX = bodyAVelocity.x - offsetAY * bodyA.angularVelocity,
                    velocityPointAY = bodyAVelocity.y + offsetAX * bodyA.angularVelocity,
                    velocityPointBX = bodyBVelocity.x - offsetBY * bodyB.angularVelocity,
                    velocityPointBY = bodyBVelocity.y + offsetBX * bodyB.angularVelocity;

                var relativeVelocityX = velocityPointAX - velocityPointBX,
                    relativeVelocityY = velocityPointAY - velocityPointBY;

                var normalVelocity = normalX * relativeVelocityX + normalY * relativeVelocityY,
                    tangentVelocity = tangentX * relativeVelocityX + tangentY * relativeVelocityY;

                // coulomb friction
                var normalOverlap = pair.separation + normalVelocity;
                var normalForce = Math.min(normalOverlap, 1);
                normalForce = normalOverlap < 0 ? 0 : normalForce;
                
                var frictionLimit = normalForce * friction;

                if (tangentVelocity > frictionLimit || -tangentVelocity > frictionLimit) {
                    maxFriction = tangentVelocity > 0 ? tangentVelocity : -tangentVelocity;
                    tangentImpulse = pair.friction * (tangentVelocity > 0 ? 1 : -1) * timeScaleSquared;
                    
                    if (tangentImpulse < -maxFriction) {
                        tangentImpulse = -maxFriction;
                    } else if (tangentImpulse > maxFriction) {
                        tangentImpulse = maxFriction;
                    }
                } else {
                    tangentImpulse = tangentVelocity;
                    maxFriction = NumberMaxValue;
                }

                // account for mass, inertia and contact offset
                var oAcN = offsetAX * normalY - offsetAY * normalX,
                    oBcN = offsetBX * normalY - offsetBY * normalX,
                    share = contactShare / (inverseMassTotal + bodyA.inverseInertia * oAcN * oAcN + bodyB.inverseInertia * oBcN * oBcN);

                // raw impulses
                var normalImpulse = (1 + pair.restitution) * normalVelocity * share;
                tangentImpulse *= share;

                // handle high velocity and resting collisions separately
                if (normalVelocity * normalVelocity > restingThresh && normalVelocity < 0) {
                    // high normal velocity so clear cached contact normal impulse
                    contact.normalImpulse = 0;
                } else {
                    // solve resting collision constraints using Erin Catto's method (GDC08)
                    // impulse constraint tends to 0
                    var contactNormalImpulse = contact.normalImpulse;
                    contact.normalImpulse += normalImpulse;
                    contact.normalImpulse = Math.min(contact.normalImpulse, 0);
                    normalImpulse = contact.normalImpulse - contactNormalImpulse;
                }

                // handle high velocity and resting collisions separately
                if (tangentVelocity * tangentVelocity > restingThreshTangent) {
                    // high tangent velocity so clear cached contact tangent impulse
                    contact.tangentImpulse = 0;
                } else {
                    // solve resting collision constraints using Erin Catto's method (GDC08)
                    // tangent impulse tends to -tangentSpeed or +tangentSpeed
                    var contactTangentImpulse = contact.tangentImpulse;
                    contact.tangentImpulse += tangentImpulse;
                    if (contact.tangentImpulse < -maxFriction) contact.tangentImpulse = -maxFriction;
                    if (contact.tangentImpulse > maxFriction) contact.tangentImpulse = maxFriction;
                    tangentImpulse = contact.tangentImpulse - contactTangentImpulse;
                }

                // total impulse from contact
                var impulseX = normalX * normalImpulse + tangentX * tangentImpulse,
                    impulseY = normalY * normalImpulse + tangentY * tangentImpulse;
                
                // apply impulse from contact
                if (!(bodyA.isStatic || bodyA.isSleeping)) {
                    bodyA.positionPrev.x += impulseX * bodyA.inverseMass;
                    bodyA.positionPrev.y += impulseY * bodyA.inverseMass;
                    bodyA.anglePrev += (offsetAX * impulseY - offsetAY * impulseX) * bodyA.inverseInertia;
                }

                if (!(bodyB.isStatic || bodyB.isSleeping)) {
                    bodyB.positionPrev.x -= impulseX * bodyB.inverseMass;
                    bodyB.positionPrev.y -= impulseY * bodyB.inverseMass;
                    bodyB.anglePrev -= (offsetBX * impulseY - offsetBY * impulseX) * bodyB.inverseInertia;
                }
            }
        }
    };

})();


/***/ }),
/* 20 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Pairs` module contains methods for creating and manipulating collision pair sets.
*
* @class Pairs
*/

var Pairs = {};

module.exports = Pairs;

var Pair = __webpack_require__(9);
var Common = __webpack_require__(0);

(function() {

    /**
     * Creates a new pairs structure.
     * @method create
     * @param {object} options
     * @return {pairs} A new pairs structure
     */
    Pairs.create = function(options) {
        return Common.extend({ 
            table: {},
            list: [],
            collisionStart: [],
            collisionActive: [],
            collisionEnd: []
        }, options);
    };

    /**
     * Updates pairs given a list of collisions.
     * @method update
     * @param {object} pairs
     * @param {collision[]} collisions
     * @param {number} timestamp
     */
    Pairs.update = function(pairs, collisions, timestamp) {
        var pairsList = pairs.list,
            pairsListLength = pairsList.length,
            pairsTable = pairs.table,
            collisionsLength = collisions.length,
            collisionStart = pairs.collisionStart,
            collisionEnd = pairs.collisionEnd,
            collisionActive = pairs.collisionActive,
            collision,
            pairIndex,
            pair,
            i;

        // clear collision state arrays, but maintain old reference
        collisionStart.length = 0;
        collisionEnd.length = 0;
        collisionActive.length = 0;

        for (i = 0; i < pairsListLength; i++) {
            pairsList[i].confirmedActive = false;
        }

        for (i = 0; i < collisionsLength; i++) {
            collision = collisions[i];
            pair = collision.pair;

            if (pair) {
                // pair already exists (but may or may not be active)
                if (pair.isActive) {
                    // pair exists and is active
                    collisionActive.push(pair);
                } else {
                    // pair exists but was inactive, so a collision has just started again
                    collisionStart.push(pair);
                }

                // update the pair
                Pair.update(pair, collision, timestamp);
                pair.confirmedActive = true;
            } else {
                // pair did not exist, create a new pair
                pair = Pair.create(collision, timestamp);
                pairsTable[pair.id] = pair;

                // push the new pair
                collisionStart.push(pair);
                pairsList.push(pair);
            }
        }

        // find pairs that are no longer active
        var removePairIndex = [];
        pairsListLength = pairsList.length;

        for (i = 0; i < pairsListLength; i++) {
            pair = pairsList[i];
            
            if (!pair.confirmedActive) {
                Pair.setActive(pair, false, timestamp);
                collisionEnd.push(pair);

                if (!pair.collision.bodyA.isSleeping && !pair.collision.bodyB.isSleeping) {
                    removePairIndex.push(i);
                }
            }
        }

        // remove inactive pairs
        for (i = 0; i < removePairIndex.length; i++) {
            pairIndex = removePairIndex[i] - i;
            pair = pairsList[pairIndex];
            pairsList.splice(pairIndex, 1);
            delete pairsTable[pair.id];
        }
    };

    /**
     * Clears the given pairs structure.
     * @method clear
     * @param {pairs} pairs
     * @return {pairs} pairs
     */
    Pairs.clear = function(pairs) {
        pairs.table = {};
        pairs.list.length = 0;
        pairs.collisionStart.length = 0;
        pairs.collisionActive.length = 0;
        pairs.collisionEnd.length = 0;
        return pairs;
    };

})();


/***/ }),
/* 21 */
/***/ (function(module, exports, __webpack_require__) {

var Matter = module.exports = __webpack_require__(22);

Matter.Axes = __webpack_require__(11);
Matter.Bodies = __webpack_require__(12);
Matter.Body = __webpack_require__(6);
Matter.Bounds = __webpack_require__(1);
Matter.Collision = __webpack_require__(8);
Matter.Common = __webpack_require__(0);
Matter.Composite = __webpack_require__(5);
Matter.Composites = __webpack_require__(23);
Matter.Constraint = __webpack_require__(10);
Matter.Contact = __webpack_require__(17);
Matter.Detector = __webpack_require__(14);
Matter.Engine = __webpack_require__(18);
Matter.Events = __webpack_require__(4);
Matter.Grid = __webpack_require__(24);
Matter.Mouse = __webpack_require__(13);
Matter.MouseConstraint = __webpack_require__(25);
Matter.Pair = __webpack_require__(9);
Matter.Pairs = __webpack_require__(20);
Matter.Plugin = __webpack_require__(15);
Matter.Query = __webpack_require__(26);
Matter.Render = __webpack_require__(16);
Matter.Resolver = __webpack_require__(19);
Matter.Runner = __webpack_require__(27);
Matter.SAT = __webpack_require__(28);
Matter.Sleeping = __webpack_require__(7);
Matter.Svg = __webpack_require__(29);
Matter.Vector = __webpack_require__(2);
Matter.Vertices = __webpack_require__(3);
Matter.World = __webpack_require__(30);

// temporary back compatibility
Matter.Engine.run = Matter.Runner.run;
Matter.Common.deprecated(Matter.Engine, 'run', 'Engine.run ➤ use Matter.Runner.run(engine) instead');


/***/ }),
/* 22 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter` module is the top level namespace. It also includes a function for installing plugins on top of the library.
*
* @class Matter
*/

var Matter = {};

module.exports = Matter;

var Plugin = __webpack_require__(15);
var Common = __webpack_require__(0);

(function() {

    /**
     * The library name.
     * @property name
     * @readOnly
     * @type {String}
     */
    Matter.name = 'matter-js';

    /**
     * The library version.
     * @property version
     * @readOnly
     * @type {String}
     */
    Matter.version =  true ? "0.18.0" : undefined;

    /**
     * A list of plugin dependencies to be installed. These are normally set and installed through `Matter.use`.
     * Alternatively you may set `Matter.uses` manually and install them by calling `Plugin.use(Matter)`.
     * @property uses
     * @type {Array}
     */
    Matter.uses = [];

    /**
     * The plugins that have been installed through `Matter.Plugin.install`. Read only.
     * @property used
     * @readOnly
     * @type {Array}
     */
    Matter.used = [];

    /**
     * Installs the given plugins on the `Matter` namespace.
     * This is a short-hand for `Plugin.use`, see it for more information.
     * Call this function once at the start of your code, with all of the plugins you wish to install as arguments.
     * Avoid calling this function multiple times unless you intend to manually control installation order.
     * @method use
     * @param ...plugin {Function} The plugin(s) to install on `base` (multi-argument).
     */
    Matter.use = function() {
        Plugin.use(Matter, Array.prototype.slice.call(arguments));
    };

    /**
     * Chains a function to excute before the original function on the given `path` relative to `Matter`.
     * See also docs for `Common.chain`.
     * @method before
     * @param {string} path The path relative to `Matter`
     * @param {function} func The function to chain before the original
     * @return {function} The chained function that replaced the original
     */
    Matter.before = function(path, func) {
        path = path.replace(/^Matter./, '');
        return Common.chainPathBefore(Matter, path, func);
    };

    /**
     * Chains a function to excute after the original function on the given `path` relative to `Matter`.
     * See also docs for `Common.chain`.
     * @method after
     * @param {string} path The path relative to `Matter`
     * @param {function} func The function to chain after the original
     * @return {function} The chained function that replaced the original
     */
    Matter.after = function(path, func) {
        path = path.replace(/^Matter./, '');
        return Common.chainPathAfter(Matter, path, func);
    };

})();


/***/ }),
/* 23 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Composites` module contains factory methods for creating composite bodies
* with commonly used configurations (such as stacks and chains).
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Composites
*/

var Composites = {};

module.exports = Composites;

var Composite = __webpack_require__(5);
var Constraint = __webpack_require__(10);
var Common = __webpack_require__(0);
var Body = __webpack_require__(6);
var Bodies = __webpack_require__(12);
var deprecated = Common.deprecated;

(function() {

    /**
     * Create a new composite containing bodies created in the callback in a grid arrangement.
     * This function uses the body's bounds to prevent overlaps.
     * @method stack
     * @param {number} xx
     * @param {number} yy
     * @param {number} columns
     * @param {number} rows
     * @param {number} columnGap
     * @param {number} rowGap
     * @param {function} callback
     * @return {composite} A new composite containing objects created in the callback
     */
    Composites.stack = function(xx, yy, columns, rows, columnGap, rowGap, callback) {
        var stack = Composite.create({ label: 'Stack' }),
            x = xx,
            y = yy,
            lastBody,
            i = 0;

        for (var row = 0; row < rows; row++) {
            var maxHeight = 0;
            
            for (var column = 0; column < columns; column++) {
                var body = callback(x, y, column, row, lastBody, i);
                    
                if (body) {
                    var bodyHeight = body.bounds.max.y - body.bounds.min.y,
                        bodyWidth = body.bounds.max.x - body.bounds.min.x; 

                    if (bodyHeight > maxHeight)
                        maxHeight = bodyHeight;
                    
                    Body.translate(body, { x: bodyWidth * 0.5, y: bodyHeight * 0.5 });

                    x = body.bounds.max.x + columnGap;

                    Composite.addBody(stack, body);
                    
                    lastBody = body;
                    i += 1;
                } else {
                    x += columnGap;
                }
            }
            
            y += maxHeight + rowGap;
            x = xx;
        }

        return stack;
    };
    
    /**
     * Chains all bodies in the given composite together using constraints.
     * @method chain
     * @param {composite} composite
     * @param {number} xOffsetA
     * @param {number} yOffsetA
     * @param {number} xOffsetB
     * @param {number} yOffsetB
     * @param {object} options
     * @return {composite} A new composite containing objects chained together with constraints
     */
    Composites.chain = function(composite, xOffsetA, yOffsetA, xOffsetB, yOffsetB, options) {
        var bodies = composite.bodies;
        
        for (var i = 1; i < bodies.length; i++) {
            var bodyA = bodies[i - 1],
                bodyB = bodies[i],
                bodyAHeight = bodyA.bounds.max.y - bodyA.bounds.min.y,
                bodyAWidth = bodyA.bounds.max.x - bodyA.bounds.min.x, 
                bodyBHeight = bodyB.bounds.max.y - bodyB.bounds.min.y,
                bodyBWidth = bodyB.bounds.max.x - bodyB.bounds.min.x;
        
            var defaults = {
                bodyA: bodyA,
                pointA: { x: bodyAWidth * xOffsetA, y: bodyAHeight * yOffsetA },
                bodyB: bodyB,
                pointB: { x: bodyBWidth * xOffsetB, y: bodyBHeight * yOffsetB }
            };
            
            var constraint = Common.extend(defaults, options);
        
            Composite.addConstraint(composite, Constraint.create(constraint));
        }

        composite.label += ' Chain';
        
        return composite;
    };

    /**
     * Connects bodies in the composite with constraints in a grid pattern, with optional cross braces.
     * @method mesh
     * @param {composite} composite
     * @param {number} columns
     * @param {number} rows
     * @param {boolean} crossBrace
     * @param {object} options
     * @return {composite} The composite containing objects meshed together with constraints
     */
    Composites.mesh = function(composite, columns, rows, crossBrace, options) {
        var bodies = composite.bodies,
            row,
            col,
            bodyA,
            bodyB,
            bodyC;
        
        for (row = 0; row < rows; row++) {
            for (col = 1; col < columns; col++) {
                bodyA = bodies[(col - 1) + (row * columns)];
                bodyB = bodies[col + (row * columns)];
                Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options)));
            }

            if (row > 0) {
                for (col = 0; col < columns; col++) {
                    bodyA = bodies[col + ((row - 1) * columns)];
                    bodyB = bodies[col + (row * columns)];
                    Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options)));

                    if (crossBrace && col > 0) {
                        bodyC = bodies[(col - 1) + ((row - 1) * columns)];
                        Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options)));
                    }

                    if (crossBrace && col < columns - 1) {
                        bodyC = bodies[(col + 1) + ((row - 1) * columns)];
                        Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options)));
                    }
                }
            }
        }

        composite.label += ' Mesh';
        
        return composite;
    };
    
    /**
     * Create a new composite containing bodies created in the callback in a pyramid arrangement.
     * This function uses the body's bounds to prevent overlaps.
     * @method pyramid
     * @param {number} xx
     * @param {number} yy
     * @param {number} columns
     * @param {number} rows
     * @param {number} columnGap
     * @param {number} rowGap
     * @param {function} callback
     * @return {composite} A new composite containing objects created in the callback
     */
    Composites.pyramid = function(xx, yy, columns, rows, columnGap, rowGap, callback) {
        return Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row, lastBody, i) {
            var actualRows = Math.min(rows, Math.ceil(columns / 2)),
                lastBodyWidth = lastBody ? lastBody.bounds.max.x - lastBody.bounds.min.x : 0;
            
            if (row > actualRows)
                return;
            
            // reverse row order
            row = actualRows - row;
            
            var start = row,
                end = columns - 1 - row;

            if (column < start || column > end)
                return;
            
            // retroactively fix the first body's position, since width was unknown
            if (i === 1) {
                Body.translate(lastBody, { x: (column + (columns % 2 === 1 ? 1 : -1)) * lastBodyWidth, y: 0 });
            }

            var xOffset = lastBody ? column * lastBodyWidth : 0;
            
            return callback(xx + xOffset + column * columnGap, y, column, row, lastBody, i);
        });
    };

    /**
     * This has now moved to the [newtonsCradle example](https://github.com/liabru/matter-js/blob/master/examples/newtonsCradle.js), follow that instead as this function is deprecated here.
     * @deprecated moved to newtonsCradle example
     * @method newtonsCradle
     * @param {number} xx
     * @param {number} yy
     * @param {number} number
     * @param {number} size
     * @param {number} length
     * @return {composite} A new composite newtonsCradle body
     */
    Composites.newtonsCradle = function(xx, yy, number, size, length) {
        var newtonsCradle = Composite.create({ label: 'Newtons Cradle' });

        for (var i = 0; i < number; i++) {
            var separation = 1.9,
                circle = Bodies.circle(xx + i * (size * separation), yy + length, size, 
                    { inertia: Infinity, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 1 }),
                constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle });

            Composite.addBody(newtonsCradle, circle);
            Composite.addConstraint(newtonsCradle, constraint);
        }

        return newtonsCradle;
    };

    deprecated(Composites, 'newtonsCradle', 'Composites.newtonsCradle ➤ moved to newtonsCradle example');
    
    /**
     * This has now moved to the [car example](https://github.com/liabru/matter-js/blob/master/examples/car.js), follow that instead as this function is deprecated here.
     * @deprecated moved to car example
     * @method car
     * @param {number} xx
     * @param {number} yy
     * @param {number} width
     * @param {number} height
     * @param {number} wheelSize
     * @return {composite} A new composite car body
     */
    Composites.car = function(xx, yy, width, height, wheelSize) {
        var group = Body.nextGroup(true),
            wheelBase = 20,
            wheelAOffset = -width * 0.5 + wheelBase,
            wheelBOffset = width * 0.5 - wheelBase,
            wheelYOffset = 0;
    
        var car = Composite.create({ label: 'Car' }),
            body = Bodies.rectangle(xx, yy, width, height, { 
                collisionFilter: {
                    group: group
                },
                chamfer: {
                    radius: height * 0.5
                },
                density: 0.0002
            });
    
        var wheelA = Bodies.circle(xx + wheelAOffset, yy + wheelYOffset, wheelSize, { 
            collisionFilter: {
                group: group
            },
            friction: 0.8
        });
                    
        var wheelB = Bodies.circle(xx + wheelBOffset, yy + wheelYOffset, wheelSize, { 
            collisionFilter: {
                group: group
            },
            friction: 0.8
        });
                    
        var axelA = Constraint.create({
            bodyB: body,
            pointB: { x: wheelAOffset, y: wheelYOffset },
            bodyA: wheelA,
            stiffness: 1,
            length: 0
        });
                        
        var axelB = Constraint.create({
            bodyB: body,
            pointB: { x: wheelBOffset, y: wheelYOffset },
            bodyA: wheelB,
            stiffness: 1,
            length: 0
        });
        
        Composite.addBody(car, body);
        Composite.addBody(car, wheelA);
        Composite.addBody(car, wheelB);
        Composite.addConstraint(car, axelA);
        Composite.addConstraint(car, axelB);

        return car;
    };

    deprecated(Composites, 'car', 'Composites.car ➤ moved to car example');

    /**
     * This has now moved to the [softBody example](https://github.com/liabru/matter-js/blob/master/examples/softBody.js)
     * and the [cloth example](https://github.com/liabru/matter-js/blob/master/examples/cloth.js), follow those instead as this function is deprecated here.
     * @deprecated moved to softBody and cloth examples
     * @method softBody
     * @param {number} xx
     * @param {number} yy
     * @param {number} columns
     * @param {number} rows
     * @param {number} columnGap
     * @param {number} rowGap
     * @param {boolean} crossBrace
     * @param {number} particleRadius
     * @param {} particleOptions
     * @param {} constraintOptions
     * @return {composite} A new composite softBody
     */
    Composites.softBody = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) {
        particleOptions = Common.extend({ inertia: Infinity }, particleOptions);
        constraintOptions = Common.extend({ stiffness: 0.2, render: { type: 'line', anchors: false } }, constraintOptions);

        var softBody = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y) {
            return Bodies.circle(x, y, particleRadius, particleOptions);
        });

        Composites.mesh(softBody, columns, rows, crossBrace, constraintOptions);

        softBody.label = 'Soft Body';

        return softBody;
    };

    deprecated(Composites, 'softBody', 'Composites.softBody ➤ moved to softBody and cloth examples');
})();


/***/ }),
/* 24 */
/***/ (function(module, exports, __webpack_require__) {

/**
* This module has now been replaced by `Matter.Detector`.
*
* All usage should be migrated to `Matter.Detector` or another alternative.
* For back-compatibility purposes this module will remain for a short term and then later removed in a future release.
*
* The `Matter.Grid` module contains methods for creating and manipulating collision broadphase grid structures.
*
* @class Grid
* @deprecated
*/

var Grid = {};

module.exports = Grid;

var Pair = __webpack_require__(9);
var Common = __webpack_require__(0);
var deprecated = Common.deprecated;

(function() {

    /**
     * Creates a new grid.
     * @deprecated replaced by Matter.Detector
     * @method create
     * @param {} options
     * @return {grid} A new grid
     */
    Grid.create = function(options) {
        var defaults = {
            buckets: {},
            pairs: {},
            pairsList: [],
            bucketWidth: 48,
            bucketHeight: 48
        };

        return Common.extend(defaults, options);
    };

    /**
     * The width of a single grid bucket.
     *
     * @property bucketWidth
     * @type number
     * @default 48
     */

    /**
     * The height of a single grid bucket.
     *
     * @property bucketHeight
     * @type number
     * @default 48
     */

    /**
     * Updates the grid.
     * @deprecated replaced by Matter.Detector
     * @method update
     * @param {grid} grid
     * @param {body[]} bodies
     * @param {engine} engine
     * @param {boolean} forceUpdate
     */
    Grid.update = function(grid, bodies, engine, forceUpdate) {
        var i, col, row,
            world = engine.world,
            buckets = grid.buckets,
            bucket,
            bucketId,
            gridChanged = false;

        for (i = 0; i < bodies.length; i++) {
            var body = bodies[i];

            if (body.isSleeping && !forceUpdate)
                continue;

            // temporary back compatibility bounds check
            if (world.bounds && (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x
                || body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y))
                continue;

            var newRegion = Grid._getRegion(grid, body);

            // if the body has changed grid region
            if (!body.region || newRegion.id !== body.region.id || forceUpdate) {

                if (!body.region || forceUpdate)
                    body.region = newRegion;

                var union = Grid._regionUnion(newRegion, body.region);

                // update grid buckets affected by region change
                // iterate over the union of both regions
                for (col = union.startCol; col <= union.endCol; col++) {
                    for (row = union.startRow; row <= union.endRow; row++) {
                        bucketId = Grid._getBucketId(col, row);
                        bucket = buckets[bucketId];

                        var isInsideNewRegion = (col >= newRegion.startCol && col <= newRegion.endCol
                                                && row >= newRegion.startRow && row <= newRegion.endRow);

                        var isInsideOldRegion = (col >= body.region.startCol && col <= body.region.endCol
                                                && row >= body.region.startRow && row <= body.region.endRow);

                        // remove from old region buckets
                        if (!isInsideNewRegion && isInsideOldRegion) {
                            if (isInsideOldRegion) {
                                if (bucket)
                                    Grid._bucketRemoveBody(grid, bucket, body);
                            }
                        }

                        // add to new region buckets
                        if (body.region === newRegion || (isInsideNewRegion && !isInsideOldRegion) || forceUpdate) {
                            if (!bucket)
                                bucket = Grid._createBucket(buckets, bucketId);
                            Grid._bucketAddBody(grid, bucket, body);
                        }
                    }
                }

                // set the new region
                body.region = newRegion;

                // flag changes so we can update pairs
                gridChanged = true;
            }
        }

        // update pairs list only if pairs changed (i.e. a body changed region)
        if (gridChanged)
            grid.pairsList = Grid._createActivePairsList(grid);
    };

    deprecated(Grid, 'update', 'Grid.update ➤ replaced by Matter.Detector');

    /**
     * Clears the grid.
     * @deprecated replaced by Matter.Detector
     * @method clear
     * @param {grid} grid
     */
    Grid.clear = function(grid) {
        grid.buckets = {};
        grid.pairs = {};
        grid.pairsList = [];
    };

    deprecated(Grid, 'clear', 'Grid.clear ➤ replaced by Matter.Detector');

    /**
     * Finds the union of two regions.
     * @method _regionUnion
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} regionA
     * @param {} regionB
     * @return {} region
     */
    Grid._regionUnion = function(regionA, regionB) {
        var startCol = Math.min(regionA.startCol, regionB.startCol),
            endCol = Math.max(regionA.endCol, regionB.endCol),
            startRow = Math.min(regionA.startRow, regionB.startRow),
            endRow = Math.max(regionA.endRow, regionB.endRow);

        return Grid._createRegion(startCol, endCol, startRow, endRow);
    };

    /**
     * Gets the region a given body falls in for a given grid.
     * @method _getRegion
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} grid
     * @param {} body
     * @return {} region
     */
    Grid._getRegion = function(grid, body) {
        var bounds = body.bounds,
            startCol = Math.floor(bounds.min.x / grid.bucketWidth),
            endCol = Math.floor(bounds.max.x / grid.bucketWidth),
            startRow = Math.floor(bounds.min.y / grid.bucketHeight),
            endRow = Math.floor(bounds.max.y / grid.bucketHeight);

        return Grid._createRegion(startCol, endCol, startRow, endRow);
    };

    /**
     * Creates a region.
     * @method _createRegion
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} startCol
     * @param {} endCol
     * @param {} startRow
     * @param {} endRow
     * @return {} region
     */
    Grid._createRegion = function(startCol, endCol, startRow, endRow) {
        return { 
            id: startCol + ',' + endCol + ',' + startRow + ',' + endRow,
            startCol: startCol, 
            endCol: endCol, 
            startRow: startRow, 
            endRow: endRow 
        };
    };

    /**
     * Gets the bucket id at the given position.
     * @method _getBucketId
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} column
     * @param {} row
     * @return {string} bucket id
     */
    Grid._getBucketId = function(column, row) {
        return 'C' + column + 'R' + row;
    };

    /**
     * Creates a bucket.
     * @method _createBucket
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} buckets
     * @param {} bucketId
     * @return {} bucket
     */
    Grid._createBucket = function(buckets, bucketId) {
        var bucket = buckets[bucketId] = [];
        return bucket;
    };

    /**
     * Adds a body to a bucket.
     * @method _bucketAddBody
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} grid
     * @param {} bucket
     * @param {} body
     */
    Grid._bucketAddBody = function(grid, bucket, body) {
        var gridPairs = grid.pairs,
            pairId = Pair.id,
            bucketLength = bucket.length,
            i;

        // add new pairs
        for (i = 0; i < bucketLength; i++) {
            var bodyB = bucket[i];

            if (body.id === bodyB.id || (body.isStatic && bodyB.isStatic))
                continue;

            // keep track of the number of buckets the pair exists in
            // important for Grid.update to work
            var id = pairId(body, bodyB),
                pair = gridPairs[id];

            if (pair) {
                pair[2] += 1;
            } else {
                gridPairs[id] = [body, bodyB, 1];
            }
        }

        // add to bodies (after pairs, otherwise pairs with self)
        bucket.push(body);
    };

    /**
     * Removes a body from a bucket.
     * @method _bucketRemoveBody
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} grid
     * @param {} bucket
     * @param {} body
     */
    Grid._bucketRemoveBody = function(grid, bucket, body) {
        var gridPairs = grid.pairs,
            pairId = Pair.id,
            i;

        // remove from bucket
        bucket.splice(Common.indexOf(bucket, body), 1);

        var bucketLength = bucket.length;

        // update pair counts
        for (i = 0; i < bucketLength; i++) {
            // keep track of the number of buckets the pair exists in
            // important for _createActivePairsList to work
            var pair = gridPairs[pairId(body, bucket[i])];

            if (pair)
                pair[2] -= 1;
        }
    };

    /**
     * Generates a list of the active pairs in the grid.
     * @method _createActivePairsList
     * @deprecated replaced by Matter.Detector
     * @private
     * @param {} grid
     * @return [] pairs
     */
    Grid._createActivePairsList = function(grid) {
        var pair,
            gridPairs = grid.pairs,
            pairKeys = Common.keys(gridPairs),
            pairKeysLength = pairKeys.length,
            pairs = [],
            k;

        // iterate over grid.pairs
        for (k = 0; k < pairKeysLength; k++) {
            pair = gridPairs[pairKeys[k]];

            // if pair exists in at least one bucket
            // it is a pair that needs further collision testing so push it
            if (pair[2] > 0) {
                pairs.push(pair);
            } else {
                delete gridPairs[pairKeys[k]];
            }
        }

        return pairs;
    };
    
})();


/***/ }),
/* 25 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.MouseConstraint` module contains methods for creating mouse constraints.
* Mouse constraints are used for allowing user interaction, providing the ability to move bodies via the mouse or touch.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class MouseConstraint
*/

var MouseConstraint = {};

module.exports = MouseConstraint;

var Vertices = __webpack_require__(3);
var Sleeping = __webpack_require__(7);
var Mouse = __webpack_require__(13);
var Events = __webpack_require__(4);
var Detector = __webpack_require__(14);
var Constraint = __webpack_require__(10);
var Composite = __webpack_require__(5);
var Common = __webpack_require__(0);
var Bounds = __webpack_require__(1);

(function() {

    /**
     * Creates a new mouse constraint.
     * All properties have default values, and many are pre-calculated automatically based on other properties.
     * See the properties section below for detailed information on what you can pass via the `options` object.
     * @method create
     * @param {engine} engine
     * @param {} options
     * @return {MouseConstraint} A new MouseConstraint
     */
    MouseConstraint.create = function(engine, options) {
        var mouse = (engine ? engine.mouse : null) || (options ? options.mouse : null);

        if (!mouse) {
            if (engine && engine.render && engine.render.canvas) {
                mouse = Mouse.create(engine.render.canvas);
            } else if (options && options.element) {
                mouse = Mouse.create(options.element);
            } else {
                mouse = Mouse.create();
                Common.warn('MouseConstraint.create: options.mouse was undefined, options.element was undefined, may not function as expected');
            }
        }

        var constraint = Constraint.create({ 
            label: 'Mouse Constraint',
            pointA: mouse.position,
            pointB: { x: 0, y: 0 },
            length: 0.01, 
            stiffness: 0.1,
            angularStiffness: 1,
            render: {
                strokeStyle: '#90EE90',
                lineWidth: 3
            }
        });

        var defaults = {
            type: 'mouseConstraint',
            mouse: mouse,
            element: null,
            body: null,
            constraint: constraint,
            collisionFilter: {
                category: 0x0001,
                mask: 0xFFFFFFFF,
                group: 0
            }
        };

        var mouseConstraint = Common.extend(defaults, options);

        Events.on(engine, 'beforeUpdate', function() {
            var allBodies = Composite.allBodies(engine.world);
            MouseConstraint.update(mouseConstraint, allBodies);
            MouseConstraint._triggerEvents(mouseConstraint);
        });

        return mouseConstraint;
    };

    /**
     * Updates the given mouse constraint.
     * @private
     * @method update
     * @param {MouseConstraint} mouseConstraint
     * @param {body[]} bodies
     */
    MouseConstraint.update = function(mouseConstraint, bodies) {
        var mouse = mouseConstraint.mouse,
            constraint = mouseConstraint.constraint,
            body = mouseConstraint.body;

        if (mouse.button === 0) {
            if (!constraint.bodyB) {
                for (var i = 0; i < bodies.length; i++) {
                    body = bodies[i];
                    if (Bounds.contains(body.bounds, mouse.position) 
                            && Detector.canCollide(body.collisionFilter, mouseConstraint.collisionFilter)) {
                        for (var j = body.parts.length > 1 ? 1 : 0; j < body.parts.length; j++) {
                            var part = body.parts[j];
                            if (Vertices.contains(part.vertices, mouse.position)) {
                                constraint.pointA = mouse.position;
                                constraint.bodyB = mouseConstraint.body = body;
                                constraint.pointB = { x: mouse.position.x - body.position.x, y: mouse.position.y - body.position.y };
                                constraint.angleB = body.angle;

                                Sleeping.set(body, false);
                                Events.trigger(mouseConstraint, 'startdrag', { mouse: mouse, body: body });

                                break;
                            }
                        }
                    }
                }
            } else {
                Sleeping.set(constraint.bodyB, false);
                constraint.pointA = mouse.position;
            }
        } else {
            constraint.bodyB = mouseConstraint.body = null;
            constraint.pointB = null;

            if (body)
                Events.trigger(mouseConstraint, 'enddrag', { mouse: mouse, body: body });
        }
    };

    /**
     * Triggers mouse constraint events.
     * @method _triggerEvents
     * @private
     * @param {mouse} mouseConstraint
     */
    MouseConstraint._triggerEvents = function(mouseConstraint) {
        var mouse = mouseConstraint.mouse,
            mouseEvents = mouse.sourceEvents;

        if (mouseEvents.mousemove)
            Events.trigger(mouseConstraint, 'mousemove', { mouse: mouse });

        if (mouseEvents.mousedown)
            Events.trigger(mouseConstraint, 'mousedown', { mouse: mouse });

        if (mouseEvents.mouseup)
            Events.trigger(mouseConstraint, 'mouseup', { mouse: mouse });

        // reset the mouse state ready for the next step
        Mouse.clearSourceEvents(mouse);
    };

    /*
    *
    *  Events Documentation
    *
    */

    /**
    * Fired when the mouse has moved (or a touch moves) during the last step
    *
    * @event mousemove
    * @param {} event An event object
    * @param {mouse} event.mouse The engine's mouse instance
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when the mouse is down (or a touch has started) during the last step
    *
    * @event mousedown
    * @param {} event An event object
    * @param {mouse} event.mouse The engine's mouse instance
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when the mouse is up (or a touch has ended) during the last step
    *
    * @event mouseup
    * @param {} event An event object
    * @param {mouse} event.mouse The engine's mouse instance
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when the user starts dragging a body
    *
    * @event startdrag
    * @param {} event An event object
    * @param {mouse} event.mouse The engine's mouse instance
    * @param {body} event.body The body being dragged
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired when the user ends dragging a body
    *
    * @event enddrag
    * @param {} event An event object
    * @param {mouse} event.mouse The engine's mouse instance
    * @param {body} event.body The body that has stopped being dragged
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * A `String` denoting the type of object.
     *
     * @property type
     * @type string
     * @default "constraint"
     * @readOnly
     */

    /**
     * The `Mouse` instance in use. If not supplied in `MouseConstraint.create`, one will be created.
     *
     * @property mouse
     * @type mouse
     * @default mouse
     */

    /**
     * The `Body` that is currently being moved by the user, or `null` if no body.
     *
     * @property body
     * @type body
     * @default null
     */

    /**
     * The `Constraint` object that is used to move the body during interaction.
     *
     * @property constraint
     * @type constraint
     */

    /**
     * An `Object` that specifies the collision filter properties.
     * The collision filter allows the user to define which types of body this mouse constraint can interact with.
     * See `body.collisionFilter` for more information.
     *
     * @property collisionFilter
     * @type object
     */

})();


/***/ }),
/* 26 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Query` module contains methods for performing collision queries.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Query
*/

var Query = {};

module.exports = Query;

var Vector = __webpack_require__(2);
var Collision = __webpack_require__(8);
var Bounds = __webpack_require__(1);
var Bodies = __webpack_require__(12);
var Vertices = __webpack_require__(3);

(function() {

    /**
     * Returns a list of collisions between `body` and `bodies`.
     * @method collides
     * @param {body} body
     * @param {body[]} bodies
     * @return {collision[]} Collisions
     */
    Query.collides = function(body, bodies) {
        var collisions = [],
            bodiesLength = bodies.length,
            bounds = body.bounds,
            collides = Collision.collides,
            overlaps = Bounds.overlaps;

        for (var i = 0; i < bodiesLength; i++) {
            var bodyA = bodies[i],
                partsALength = bodyA.parts.length,
                partsAStart = partsALength === 1 ? 0 : 1;
            
            if (overlaps(bodyA.bounds, bounds)) {
                for (var j = partsAStart; j < partsALength; j++) {
                    var part = bodyA.parts[j];

                    if (overlaps(part.bounds, bounds)) {
                        var collision = collides(part, body);

                        if (collision) {
                            collisions.push(collision);
                            break;
                        }
                    }
                }
            }
        }

        return collisions;
    };

    /**
     * Casts a ray segment against a set of bodies and returns all collisions, ray width is optional. Intersection points are not provided.
     * @method ray
     * @param {body[]} bodies
     * @param {vector} startPoint
     * @param {vector} endPoint
     * @param {number} [rayWidth]
     * @return {collision[]} Collisions
     */
    Query.ray = function(bodies, startPoint, endPoint, rayWidth) {
        rayWidth = rayWidth || 1e-100;

        var rayAngle = Vector.angle(startPoint, endPoint),
            rayLength = Vector.magnitude(Vector.sub(startPoint, endPoint)),
            rayX = (endPoint.x + startPoint.x) * 0.5,
            rayY = (endPoint.y + startPoint.y) * 0.5,
            ray = Bodies.rectangle(rayX, rayY, rayLength, rayWidth, { angle: rayAngle }),
            collisions = Query.collides(ray, bodies);

        for (var i = 0; i < collisions.length; i += 1) {
            var collision = collisions[i];
            collision.body = collision.bodyB = collision.bodyA;            
        }

        return collisions;
    };

    /**
     * Returns all bodies whose bounds are inside (or outside if set) the given set of bounds, from the given set of bodies.
     * @method region
     * @param {body[]} bodies
     * @param {bounds} bounds
     * @param {bool} [outside=false]
     * @return {body[]} The bodies matching the query
     */
    Query.region = function(bodies, bounds, outside) {
        var result = [];

        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i],
                overlaps = Bounds.overlaps(body.bounds, bounds);
            if ((overlaps && !outside) || (!overlaps && outside))
                result.push(body);
        }

        return result;
    };

    /**
     * Returns all bodies whose vertices contain the given point, from the given set of bodies.
     * @method point
     * @param {body[]} bodies
     * @param {vector} point
     * @return {body[]} The bodies matching the query
     */
    Query.point = function(bodies, point) {
        var result = [];

        for (var i = 0; i < bodies.length; i++) {
            var body = bodies[i];
            
            if (Bounds.contains(body.bounds, point)) {
                for (var j = body.parts.length === 1 ? 0 : 1; j < body.parts.length; j++) {
                    var part = body.parts[j];

                    if (Bounds.contains(part.bounds, point)
                        && Vertices.contains(part.vertices, point)) {
                        result.push(body);
                        break;
                    }
                }
            }
        }

        return result;
    };

})();


/***/ }),
/* 27 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Runner` module is an optional utility which provides a game loop, 
* that handles continuously updating a `Matter.Engine` for you within a browser.
* It is intended for development and debugging purposes, but may also be suitable for simple games.
* If you are using your own game loop instead, then you do not need the `Matter.Runner` module.
* Instead just call `Engine.update(engine, delta)` in your own loop.
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Runner
*/

var Runner = {};

module.exports = Runner;

var Events = __webpack_require__(4);
var Engine = __webpack_require__(18);
var Common = __webpack_require__(0);

(function() {

    var _requestAnimationFrame,
        _cancelAnimationFrame;

    if (typeof window !== 'undefined') {
        _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame
                                      || window.mozRequestAnimationFrame || window.msRequestAnimationFrame;
   
        _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame 
                                      || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame;
    }

    if (!_requestAnimationFrame) {
        var _frameTimeout;

        _requestAnimationFrame = function(callback){ 
            _frameTimeout = setTimeout(function() { 
                callback(Common.now()); 
            }, 1000 / 60);
        };

        _cancelAnimationFrame = function() {
            clearTimeout(_frameTimeout);
        };
    }

    /**
     * Creates a new Runner. The options parameter is an object that specifies any properties you wish to override the defaults.
     * @method create
     * @param {} options
     */
    Runner.create = function(options) {
        var defaults = {
            fps: 60,
            correction: 1,
            deltaSampleSize: 60,
            counterTimestamp: 0,
            frameCounter: 0,
            deltaHistory: [],
            timePrev: null,
            timeScalePrev: 1,
            frameRequestId: null,
            isFixed: false,
            enabled: true
        };

        var runner = Common.extend(defaults, options);

        runner.delta = runner.delta || 1000 / runner.fps;
        runner.deltaMin = runner.deltaMin || 1000 / runner.fps;
        runner.deltaMax = runner.deltaMax || 1000 / (runner.fps * 0.5);
        runner.fps = 1000 / runner.delta;

        return runner;
    };

    /**
     * Continuously ticks a `Matter.Engine` by calling `Runner.tick` on the `requestAnimationFrame` event.
     * @method run
     * @param {engine} engine
     */
    Runner.run = function(runner, engine) {
        // create runner if engine is first argument
        if (typeof runner.positionIterations !== 'undefined') {
            engine = runner;
            runner = Runner.create();
        }

        (function render(time){
            runner.frameRequestId = _requestAnimationFrame(render);

            if (time && runner.enabled) {
                Runner.tick(runner, engine, time);
            }
        })();

        return runner;
    };

    /**
     * A game loop utility that updates the engine and renderer by one step (a 'tick').
     * Features delta smoothing, time correction and fixed or dynamic timing.
     * Consider just `Engine.update(engine, delta)` if you're using your own loop.
     * @method tick
     * @param {runner} runner
     * @param {engine} engine
     * @param {number} time
     */
    Runner.tick = function(runner, engine, time) {
        var timing = engine.timing,
            correction = 1,
            delta;

        // create an event object
        var event = {
            timestamp: timing.timestamp
        };

        Events.trigger(runner, 'beforeTick', event);

        if (runner.isFixed) {
            // fixed timestep
            delta = runner.delta;
        } else {
            // dynamic timestep based on wall clock between calls
            delta = (time - runner.timePrev) || runner.delta;
            runner.timePrev = time;

            // optimistically filter delta over a few frames, to improve stability
            runner.deltaHistory.push(delta);
            runner.deltaHistory = runner.deltaHistory.slice(-runner.deltaSampleSize);
            delta = Math.min.apply(null, runner.deltaHistory);
            
            // limit delta
            delta = delta < runner.deltaMin ? runner.deltaMin : delta;
            delta = delta > runner.deltaMax ? runner.deltaMax : delta;

            // correction for delta
            correction = delta / runner.delta;

            // update engine timing object
            runner.delta = delta;
        }

        // time correction for time scaling
        if (runner.timeScalePrev !== 0)
            correction *= timing.timeScale / runner.timeScalePrev;

        if (timing.timeScale === 0)
            correction = 0;

        runner.timeScalePrev = timing.timeScale;
        runner.correction = correction;

        // fps counter
        runner.frameCounter += 1;
        if (time - runner.counterTimestamp >= 1000) {
            runner.fps = runner.frameCounter * ((time - runner.counterTimestamp) / 1000);
            runner.counterTimestamp = time;
            runner.frameCounter = 0;
        }

        Events.trigger(runner, 'tick', event);

        // update
        Events.trigger(runner, 'beforeUpdate', event);
        Engine.update(engine, delta, correction);
        Events.trigger(runner, 'afterUpdate', event);

        Events.trigger(runner, 'afterTick', event);
    };

    /**
     * Ends execution of `Runner.run` on the given `runner`, by canceling the animation frame request event loop.
     * If you wish to only temporarily pause the engine, see `engine.enabled` instead.
     * @method stop
     * @param {runner} runner
     */
    Runner.stop = function(runner) {
        _cancelAnimationFrame(runner.frameRequestId);
    };

    /**
     * Alias for `Runner.run`.
     * @method start
     * @param {runner} runner
     * @param {engine} engine
     */
    Runner.start = function(runner, engine) {
        Runner.run(runner, engine);
    };

    /*
    *
    *  Events Documentation
    *
    */

    /**
    * Fired at the start of a tick, before any updates to the engine or timing
    *
    * @event beforeTick
    * @param {} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired after engine timing updated, but just before update
    *
    * @event tick
    * @param {} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired at the end of a tick, after engine update and after rendering
    *
    * @event afterTick
    * @param {} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired before update
    *
    * @event beforeUpdate
    * @param {} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /**
    * Fired after update
    *
    * @event afterUpdate
    * @param {} event An event object
    * @param {number} event.timestamp The engine.timing.timestamp of the event
    * @param {} event.source The source object of the event
    * @param {} event.name The name of the event
    */

    /*
    *
    *  Properties Documentation
    *
    */

    /**
     * A flag that specifies whether the runner is running or not.
     *
     * @property enabled
     * @type boolean
     * @default true
     */

    /**
     * A `Boolean` that specifies if the runner should use a fixed timestep (otherwise it is variable).
     * If timing is fixed, then the apparent simulation speed will change depending on the frame rate (but behaviour will be deterministic).
     * If the timing is variable, then the apparent simulation speed will be constant (approximately, but at the cost of determininism).
     *
     * @property isFixed
     * @type boolean
     * @default false
     */

    /**
     * A `Number` that specifies the time step between updates in milliseconds.
     * If `engine.timing.isFixed` is set to `true`, then `delta` is fixed.
     * If it is `false`, then `delta` can dynamically change to maintain the correct apparent simulation speed.
     *
     * @property delta
     * @type number
     * @default 1000 / 60
     */

})();


/***/ }),
/* 28 */
/***/ (function(module, exports, __webpack_require__) {

/**
* This module has now been replaced by `Matter.Collision`.
*
* All usage should be migrated to `Matter.Collision`.
* For back-compatibility purposes this module will remain for a short term and then later removed in a future release.
*
* The `Matter.SAT` module contains methods for detecting collisions using the Separating Axis Theorem.
*
* @class SAT
* @deprecated
*/

var SAT = {};

module.exports = SAT;

var Collision = __webpack_require__(8);
var Common = __webpack_require__(0);
var deprecated = Common.deprecated;

(function() {

    /**
     * Detect collision between two bodies using the Separating Axis Theorem.
     * @deprecated replaced by Collision.collides
     * @method collides
     * @param {body} bodyA
     * @param {body} bodyB
     * @return {collision} collision
     */
    SAT.collides = function(bodyA, bodyB) {
        return Collision.collides(bodyA, bodyB);
    };

    deprecated(SAT, 'collides', 'SAT.collides ➤ replaced by Collision.collides');

})();


/***/ }),
/* 29 */
/***/ (function(module, exports, __webpack_require__) {

/**
* The `Matter.Svg` module contains methods for converting SVG images into an array of vector points.
*
* To use this module you also need the SVGPathSeg polyfill: https://github.com/progers/pathseg
*
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
*
* @class Svg
*/

var Svg = {};

module.exports = Svg;

var Bounds = __webpack_require__(1);
var Common = __webpack_require__(0);

(function() {

    /**
     * Converts an SVG path into an array of vector points.
     * If the input path forms a concave shape, you must decompose the result into convex parts before use.
     * See `Bodies.fromVertices` which provides support for this.
     * Note that this function is not guaranteed to support complex paths (such as those with holes).
     * You must load the `pathseg.js` polyfill on newer browsers.
     * @method pathToVertices
     * @param {SVGPathElement} path
     * @param {Number} [sampleLength=15]
     * @return {Vector[]} points
     */
    Svg.pathToVertices = function(path, sampleLength) {
        if (typeof window !== 'undefined' && !('SVGPathSeg' in window)) {
            Common.warn('Svg.pathToVertices: SVGPathSeg not defined, a polyfill is required.');
        }

        // https://github.com/wout/svg.topoly.js/blob/master/svg.topoly.js
        var i, il, total, point, segment, segments, 
            segmentsQueue, lastSegment, 
            lastPoint, segmentIndex, points = [],
            lx, ly, length = 0, x = 0, y = 0;

        sampleLength = sampleLength || 15;

        var addPoint = function(px, py, pathSegType) {
            // all odd-numbered path types are relative except PATHSEG_CLOSEPATH (1)
            var isRelative = pathSegType % 2 === 1 && pathSegType > 1;

            // when the last point doesn't equal the current point add the current point
            if (!lastPoint || px != lastPoint.x || py != lastPoint.y) {
                if (lastPoint && isRelative) {
                    lx = lastPoint.x;
                    ly = lastPoint.y;
                } else {
                    lx = 0;
                    ly = 0;
                }

                var point = {
                    x: lx + px,
                    y: ly + py
                };

                // set last point
                if (isRelative || !lastPoint) {
                    lastPoint = point;
                }

                points.push(point);

                x = lx + px;
                y = ly + py;
            }
        };

        var addSegmentPoint = function(segment) {
            var segType = segment.pathSegTypeAsLetter.toUpperCase();

            // skip path ends
            if (segType === 'Z') 
                return;

            // map segment to x and y
            switch (segType) {

            case 'M':
            case 'L':
            case 'T':
            case 'C':
            case 'S':
            case 'Q':
                x = segment.x;
                y = segment.y;
                break;
            case 'H':
                x = segment.x;
                break;
            case 'V':
                y = segment.y;
                break;
            }

            addPoint(x, y, segment.pathSegType);
        };

        // ensure path is absolute
        Svg._svgPathToAbsolute(path);

        // get total length
        total = path.getTotalLength();

        // queue segments
        segments = [];
        for (i = 0; i < path.pathSegList.numberOfItems; i += 1)
            segments.push(path.pathSegList.getItem(i));

        segmentsQueue = segments.concat();

        // sample through path
        while (length < total) {
            // get segment at position
            segmentIndex = path.getPathSegAtLength(length);
            segment = segments[segmentIndex];

            // new segment
            if (segment != lastSegment) {
                while (segmentsQueue.length && segmentsQueue[0] != segment)
                    addSegmentPoint(segmentsQueue.shift());

                lastSegment = segment;
            }

            // add points in between when curving
            // TODO: adaptive sampling
            switch (segment.pathSegTypeAsLetter.toUpperCase()) {

            case 'C':
            case 'T':
            case 'S':
            case 'Q':
            case 'A':
                point = path.getPointAtLength(length);
                addPoint(point.x, point.y, 0);
                break;

            }

            // increment by sample value
            length += sampleLength;
        }

        // add remaining segments not passed by sampling
        for (i = 0, il = segmentsQueue.length; i < il; ++i)
            addSegmentPoint(segmentsQueue[i]);

        return points;
    };

    Svg._svgPathToAbsolute = function(path) {
        // http://phrogz.net/convert-svg-path-to-all-absolute-commands
        // Copyright (c) Gavin Kistner
        // http://phrogz.net/js/_ReuseLicense.txt
        // Modifications: tidy formatting and naming
        var x0, y0, x1, y1, x2, y2, segs = path.pathSegList,
            x = 0, y = 0, len = segs.numberOfItems;

        for (var i = 0; i < len; ++i) {
            var seg = segs.getItem(i),
                segType = seg.pathSegTypeAsLetter;

            if (/[MLHVCSQTA]/.test(segType)) {
                if ('x' in seg) x = seg.x;
                if ('y' in seg) y = seg.y;
            } else {
                if ('x1' in seg) x1 = x + seg.x1;
                if ('x2' in seg) x2 = x + seg.x2;
                if ('y1' in seg) y1 = y + seg.y1;
                if ('y2' in seg) y2 = y + seg.y2;
                if ('x' in seg) x += seg.x;
                if ('y' in seg) y += seg.y;

                switch (segType) {

                case 'm':
                    segs.replaceItem(path.createSVGPathSegMovetoAbs(x, y), i);
                    break;
                case 'l':
                    segs.replaceItem(path.createSVGPathSegLinetoAbs(x, y), i);
                    break;
                case 'h':
                    segs.replaceItem(path.createSVGPathSegLinetoHorizontalAbs(x), i);
                    break;
                case 'v':
                    segs.replaceItem(path.createSVGPathSegLinetoVerticalAbs(y), i);
                    break;
                case 'c':
                    segs.replaceItem(path.createSVGPathSegCurvetoCubicAbs(x, y, x1, y1, x2, y2), i);
                    break;
                case 's':
                    segs.replaceItem(path.createSVGPathSegCurvetoCubicSmoothAbs(x, y, x2, y2), i);
                    break;
                case 'q':
                    segs.replaceItem(path.createSVGPathSegCurvetoQuadraticAbs(x, y, x1, y1), i);
                    break;
                case 't':
                    segs.replaceItem(path.createSVGPathSegCurvetoQuadraticSmoothAbs(x, y), i);
                    break;
                case 'a':
                    segs.replaceItem(path.createSVGPathSegArcAbs(x, y, seg.r1, seg.r2, seg.angle, seg.largeArcFlag, seg.sweepFlag), i);
                    break;
                case 'z':
                case 'Z':
                    x = x0;
                    y = y0;
                    break;

                }
            }

            if (segType == 'M' || segType == 'm') {
                x0 = x;
                y0 = y;
            }
        }
    };

})();

/***/ }),
/* 30 */
/***/ (function(module, exports, __webpack_require__) {

/**
* This module has now been replaced by `Matter.Composite`.
*
* All usage should be migrated to the equivalent functions found on `Matter.Composite`.
* For example `World.add(world, body)` now becomes `Composite.add(world, body)`.
*
* The property `world.gravity` has been moved to `engine.gravity`.
*
* For back-compatibility purposes this module will remain as a direct alias to `Matter.Composite` in the short term during migration.
* Eventually this alias module will be marked as deprecated and then later removed in a future release.
*
* @class World
*/

var World = {};

module.exports = World;

var Composite = __webpack_require__(5);
var Common = __webpack_require__(0);

(function() {

    /**
     * See above, aliases for back compatibility only
     */
    World.create = Composite.create;
    World.add = Composite.add;
    World.remove = Composite.remove;
    World.clear = Composite.clear;
    World.addComposite = Composite.addComposite;
    World.addBody = Composite.addBody;
    World.addConstraint = Composite.addConstraint;

})();


/***/ })
/******/ ]);
});