0
0
Fork 0
mirror of https://github.com/liabru/matter-js.git synced 2025-03-14 00:38:41 -04:00

Merge branch 'master' into patch-3

This commit is contained in:
Robert Kowalski 2021-07-04 07:10:21 -04:00 committed by GitHub
commit 0414cc553a
No known key found for this signature in database
GPG key ID: 4AEE18F83AFDEB23
109 changed files with 41039 additions and 14541 deletions

View file

@ -29,7 +29,6 @@
"process": false, "process": false,
"HTMLElement": false, "HTMLElement": false,
"require": false, "require": false,
"PIXI": false,
"$": false, "$": false,
"Image": false, "Image": false,
"navigator": false, "navigator": false,
@ -59,13 +58,17 @@
"Vector": false, "Vector": false,
"Vertices": false, "Vertices": false,
"Render": false, "Render": false,
"RenderPixi": false,
"Events": false, "Events": false,
"Query": false, "Query": false,
"Runner": false, "Runner": false,
"Svg": false, "Svg": false,
"Metrics": false, "Example": false,
"Example": false "__MATTER_VERSION__": false,
"__MATTER_IS_DEV__": false,
"jest": false,
"test": false,
"expect": false,
"describe": false
}, },
"extends": "eslint:recommended" "extends": "eslint:recommended"
} }

8
.gitignore vendored
View file

@ -1,14 +1,16 @@
.idea .idea
node_modules node_modules
npm-debug.log npm-debug.log
doc docs
matter-doc-theme matter-doc-theme
build/matter-dev.js build/matter-dev.js
build/matter-dev.min.js build/matter-dev.min.js
demo/js/lib/matter-dev.js demo/js/lib/matter-dev.js
demo/js/Examples.js demo/js/Examples.min.js
examples/build examples/build
test/browser/diffs test/browser/diffs
test/browser/refs test/browser/refs
test/node/diffs test/node/diffs
test/node/refs test/node/refs
__snapshots__
__compare__

View file

@ -2,10 +2,10 @@ language: node_js
sudo: false sudo: false
node_js: node_js:
- "node" - "node"
before_install: install:
- npm install -g gulp - npm ci
- mkdir travis-phantomjs script:
- wget https://s3.amazonaws.com/travis-phantomjs/phantomjs-2.0.0-ubuntu-12.04.tar.bz2 -O $PWD/travis-phantomjs/phantomjs-2.0.0-ubuntu-12.04.tar.bz2 - npm run lint
- tar -xvf $PWD/travis-phantomjs/phantomjs-2.0.0-ubuntu-12.04.tar.bz2 -C $PWD/travis-phantomjs - npm run test
- export PATH=$PWD/travis-phantomjs:$PATH - npm run build
install: npm install - npm run build-demo

View file

@ -1,3 +1,140 @@
## <small>0.17.1 (2021-04-14)</small>
* deprecate Engine.run alias replaced by Runner.run ([5817046](https://github.com/liabru/matter-js/commit/5817046))
## 0.17.0 (2021-04-11)
* add Common.setDecomp and Common.getDecomp ([313c150](https://github.com/liabru/matter-js/commit/313c150))
* add demo build config and refactor demo ([653a647](https://github.com/liabru/matter-js/commit/653a647))
* add docs for all Matter.Render options ([ec3eecc](https://github.com/liabru/matter-js/commit/ec3eecc))
* add title to all examples ([f4d72ba](https://github.com/liabru/matter-js/commit/f4d72ba))
* added Common.deprecated ([ffa3193](https://github.com/liabru/matter-js/commit/ffa3193))
* added Common.warnOnce ([6957dbf](https://github.com/liabru/matter-js/commit/6957dbf))
* added Date.now fallback to Common.now, closes #739 ([c06c107](https://github.com/liabru/matter-js/commit/c06c107)), closes [#739](https://github.com/liabru/matter-js/issues/739)
* added debug stats and performance monitoring to Matter.Render ([119881b](https://github.com/liabru/matter-js/commit/119881b))
* added doc watch script ([164456b](https://github.com/liabru/matter-js/commit/164456b))
* added docs for additional engine timing and render properties ([8017bdb](https://github.com/liabru/matter-js/commit/8017bdb))
* added Example.stats ([9915007](https://github.com/liabru/matter-js/commit/9915007))
* added lastDelta and lastElapsed to engine.timing ([6dc703f](https://github.com/liabru/matter-js/commit/6dc703f))
* build demo ([0816454](https://github.com/liabru/matter-js/commit/0816454))
* change all examples to use Composite.add instead of the alias World.add ([a3f298f](https://github.com/liabru/matter-js/commit/a3f298f))
* changed engine.broadphase to engine.grid ([b74e400](https://github.com/liabru/matter-js/commit/b74e400))
* changed Example.views to use render events ([3ac3498](https://github.com/liabru/matter-js/commit/3ac3498))
* changed world.gravity to engine.gravity ([6abb3b7](https://github.com/liabru/matter-js/commit/6abb3b7))
* deprecated Composites.car and added to car example ([cd9c5d4](https://github.com/liabru/matter-js/commit/cd9c5d4))
* deprecated Composites.newtonsCradle and added to newtonsCradle example ([9ad980b](https://github.com/liabru/matter-js/commit/9ad980b))
* deprecated Composites.softBody and added to softBody and cloth examples ([818f354](https://github.com/liabru/matter-js/commit/818f354))
* improve Render.debug ([1753bf0](https://github.com/liabru/matter-js/commit/1753bf0))
* migrate Matter.World to the equivalent Matter.Composite ([5dbec9b](https://github.com/liabru/matter-js/commit/5dbec9b))
* remove deprecated backwards compatibility engine events from Matter.Runner ([76bf80e](https://github.com/liabru/matter-js/commit/76bf80e))
* remove deprecated backwards compatibility render integration from Matter.Engine ([1aa8ed0](https://github.com/liabru/matter-js/commit/1aa8ed0))
* remove deprecated backwards compatibility render integration from Matter.Runner ([6805f85](https://github.com/liabru/matter-js/commit/6805f85))
* remove deprecated Matter.Metrics ([63a9e98](https://github.com/liabru/matter-js/commit/63a9e98))
* remove deprecated Matter.RenderPixi ([08a515b](https://github.com/liabru/matter-js/commit/08a515b))
* remove unused render shadow function ([e49834d](https://github.com/liabru/matter-js/commit/e49834d))
* run all examples in browser tests ([5734bfd](https://github.com/liabru/matter-js/commit/5734bfd))
* set render showDebug option on examples stress and stress2 ([f2ef3aa](https://github.com/liabru/matter-js/commit/f2ef3aa))
* update matter-tools ([f8d366a](https://github.com/liabru/matter-js/commit/f8d366a))
## <small>0.16.1 (2021-01-31)</small>
* add log capture and reporting in tests ([7bfd3c2](https://github.com/liabru/matter-js/commit/7bfd3c2))
* add matter-wrap as dev dependency ([ef7c4c6](https://github.com/liabru/matter-js/commit/ef7c4c6))
* catch missing plugin require in examples ([1ba1255](https://github.com/liabru/matter-js/commit/1ba1255))
* change example matter-wrap require precedence ([aa1e4e7](https://github.com/liabru/matter-js/commit/aa1e4e7))
* change perf threshold in test ([7b00354](https://github.com/liabru/matter-js/commit/7b00354))
* change test worker decomp require ([5e746b0](https://github.com/liabru/matter-js/commit/5e746b0))
* disable jest cache ([8ee0ebb](https://github.com/liabru/matter-js/commit/8ee0ebb))
* enable useful dev server features ([839f7d9](https://github.com/liabru/matter-js/commit/839f7d9))
* fix decomp require and improve warning message ([e87f64a](https://github.com/liabru/matter-js/commit/e87f64a))
* fix dev server externals ([1f2f9fe](https://github.com/liabru/matter-js/commit/1f2f9fe))
* fix named require in test ([92080ff](https://github.com/liabru/matter-js/commit/92080ff))
* improve CI speed ([1af64eb](https://github.com/liabru/matter-js/commit/1af64eb))
* improve docs for Bodies.fromVertices ([2ade78f](https://github.com/liabru/matter-js/commit/2ade78f))
* improve stack examples with exact contact ([522f4e8](https://github.com/liabru/matter-js/commit/522f4e8))
* improve test report log ([b5326f8](https://github.com/liabru/matter-js/commit/b5326f8))
## 0.16.0 (2021-01-17)
* added removeDuplicatePoints option from poly-decomp 0.3.0 to Bodies.fromVertices ([#639](https://github.com/liabru/matter-js/issues/639), [947cb97](https://github.com/liabru/matter-js/commit/947cb97), [a9694e6](https://github.com/liabru/matter-js/commit/a9694e6))
* added support for > and >= operators in plugin version ranges ([0792716](https://github.com/liabru/matter-js/commit/0792716))
* added support for example versioning in tests ([31d0ace](https://github.com/liabru/matter-js/commit/31d0ace))
* added version targets for examples ([142b7de](https://github.com/liabru/matter-js/commit/142b7de))
* added warning check on browser tests ([12377cc](https://github.com/liabru/matter-js/commit/12377cc))
* changed svg and terrain example to use fetch ([5551cd5](https://github.com/liabru/matter-js/commit/5551cd5))
* changed deprecated comments to avoid confusion ([1e73cab](https://github.com/liabru/matter-js/commit/1e73cab))
* fixed poly-decomp external require ([882e07c](https://github.com/liabru/matter-js/commit/882e07c))
* removed bower.json ([f71d4c0](https://github.com/liabru/matter-js/commit/f71d4c0))
* removed unused dev dependency run-sequence ([be592fd](https://github.com/liabru/matter-js/commit/be592fd))
* updated dev dependencies ([151eb30](https://github.com/liabru/matter-js/commit/151eb30))
* updated matter-tools ([5c66458](https://github.com/liabru/matter-js/commit/5c66458))
* updated matter-tools ([33e8fe8](https://github.com/liabru/matter-js/commit/33e8fe8))
* updated demo matter-tools ([a694ae5](https://github.com/liabru/matter-js/commit/a694ae5))
* updated demo pathseg ([9c5325b](https://github.com/liabru/matter-js/commit/9c5325b))
* updated readme ([3089b41](https://github.com/liabru/matter-js/commit/3089b41))
## 0.15.0 (2020-12-24)
* add window global, stub require and handle bad values in test tools ([497ac80](https://github.com/liabru/matter-js/commit/497ac80))
* added Body.setCentre, closes #684, closes #461, closes #679 ([2ec247b](https://github.com/liabru/matter-js/commit/2ec247b)), closes [#684](https://github.com/liabru/matter-js/issues/684) [#461](https://github.com/liabru/matter-js/issues/461) [#679](https://github.com/liabru/matter-js/issues/679)
* added browser tests ([ceb7cd5](https://github.com/liabru/matter-js/commit/ceb7cd5))
* Added build comparison tools and tests ([b7c938a](https://github.com/liabru/matter-js/commit/b7c938a))
* added check for window in Common.now ([9ef9d02](https://github.com/liabru/matter-js/commit/9ef9d02))
* added comparison output file option to test tools ([45aae25](https://github.com/liabru/matter-js/commit/45aae25))
* Added config and test files to lint ([21e4ea6](https://github.com/liabru/matter-js/commit/21e4ea6))
* added Constraint.pointAWorld and Constraint.pointBWorld ([3c32969](https://github.com/liabru/matter-js/commit/3c32969))
* added examples to dev server bundle and commit built examples ([fe80478](https://github.com/liabru/matter-js/commit/fe80478))
* added module export to examples ([f9ea799](https://github.com/liabru/matter-js/commit/f9ea799))
* added overlap metric to test tools ([3fd674d](https://github.com/liabru/matter-js/commit/3fd674d))
* added release scripts ([341c247](https://github.com/liabru/matter-js/commit/341c247))
* added tag push to release task ([060283b](https://github.com/liabru/matter-js/commit/060283b))
* added timing to engine snapshot ([e0cdbb8](https://github.com/liabru/matter-js/commit/e0cdbb8))
* Added watch content base to dev server ([f471d4e](https://github.com/liabru/matter-js/commit/f471d4e))
* added webpack build script ([046013e](https://github.com/liabru/matter-js/commit/046013e))
* changed alpha build configuration ([182c84a](https://github.com/liabru/matter-js/commit/182c84a))
* changed demo to auto populate examples with sourceLink and init ([5b0d34b](https://github.com/liabru/matter-js/commit/5b0d34b))
* changed demo to serve without sub-directory ([823bbc0](https://github.com/liabru/matter-js/commit/823bbc0))
* changed docs build config ([864452d](https://github.com/liabru/matter-js/commit/864452d))
* changed example tests to use jest ([104d319](https://github.com/liabru/matter-js/commit/104d319))
* fix decomp import in Bodies.fromVertices ([94e9614](https://github.com/liabru/matter-js/commit/94e9614))
* fix decomp require ([0af1645](https://github.com/liabru/matter-js/commit/0af1645))
* fix issues with render pixel ratio, closes #686, closes #687 ([d577477](https://github.com/liabru/matter-js/commit/d577477)), closes [#686](https://github.com/liabru/matter-js/issues/686) [#687](https://github.com/liabru/matter-js/issues/687)
* fix lint ([5a0079d](https://github.com/liabru/matter-js/commit/5a0079d))
* fix lint issues ([9ca21c1](https://github.com/liabru/matter-js/commit/9ca21c1))
* fix path to build in test worker ([fcdb4fa](https://github.com/liabru/matter-js/commit/fcdb4fa))
* fix preversion script ([c368c14](https://github.com/liabru/matter-js/commit/c368c14))
* fix terrain example module export ([4a967ec](https://github.com/liabru/matter-js/commit/4a967ec))
* Fix typo in docs ([c486635](https://github.com/liabru/matter-js/commit/c486635))
* fixed plugins in compare ([82bb415](https://github.com/liabru/matter-js/commit/82bb415))
* implemented threaded comparison testing ([285d70d](https://github.com/liabru/matter-js/commit/285d70d))
* Optimized Body's hidden class ([b3220cf](https://github.com/liabru/matter-js/commit/b3220cf))
* Optimized Events.trigger method when no event is emitted ([b17cb48](https://github.com/liabru/matter-js/commit/b17cb48))
* remove gulp ([6a28090](https://github.com/liabru/matter-js/commit/6a28090))
* remove old demo libs ([13c7eb5](https://github.com/liabru/matter-js/commit/13c7eb5))
* removed unused gulp release tasks ([e5a7311](https://github.com/liabru/matter-js/commit/e5a7311))
* removed yuidocjs dev dependency ([ee848d2](https://github.com/liabru/matter-js/commit/ee848d2))
* Set loose build version on dev server ([1fcf292](https://github.com/liabru/matter-js/commit/1fcf292))
* update build script ([90abab6](https://github.com/liabru/matter-js/commit/90abab6))
* update default render theme ([d258411](https://github.com/liabru/matter-js/commit/d258411))
* update demo and example render styles ([6dd5ec5](https://github.com/liabru/matter-js/commit/6dd5ec5))
* update dependencies ([e1e058c](https://github.com/liabru/matter-js/commit/e1e058c)) ([5f5b8a1](https://github.com/liabru/matter-js/commit/5f5b8a1))
* update examples build config and scripts ([69afb11](https://github.com/liabru/matter-js/commit/69afb11))
* update package lock ([ac3da07](https://github.com/liabru/matter-js/commit/ac3da07))
* updated build scripts ([6b698ea](https://github.com/liabru/matter-js/commit/6b698ea))
* updated ci ([288b9cd](https://github.com/liabru/matter-js/commit/288b9cd))
* updated docs ([50cf171](https://github.com/liabru/matter-js/commit/50cf171))
* updated readme ([ea5c012](https://github.com/liabru/matter-js/commit/ea5c012)) ([61b1963](https://github.com/liabru/matter-js/commit/61b1963))
<a name="0.14.2"></a> <a name="0.14.2"></a>
## <small>0.14.2 (2018-06-11)</small> ## <small>0.14.2 (2018-06-11)</small>

View file

@ -2,22 +2,51 @@
## License Agreement ## License Agreement
When providing any contributions, you must agree and be legally entitled to provide them for use and distribution in the project under the same terms as the [license](https://github.com/liabru/matter-js/blob/master/LICENSE), otherwise they can not be accepted. By providing any kind of contribution to this project, **you must agree and be legally entitled** to provide them for use and distribution as a part of this project **wholly under the same terms as in the original included [license](https://github.com/liabru/matter-js/blob/master/LICENSE)**.
## Building
To build you must first install [node.js](http://nodejs.org/) and [gulp](http://gulpjs.com/), then run
npm install
This will install the required build dependencies, then run
gulp dev
which is a task that builds the `matter-dev.js` file, spawns a development server and opens `http://localhost:8000/demo/index.html` in your browser. Any changes you make to the source will automatically rebuild `matter-dev.js` and reload your browser.
## Contributions ## Contributions
Contributions by pull request are welcome! Please ensure they follow the same style and architecture as the rest of the code. You should run `gulp test` and ensure there are no reported errors. Please do not include any changes to the files in the `build` directory. All contributors must agree to the license agreement described at the beginning of this document. Contributions by pull request or issues are welcome. Please ensure they follow the same style and architecture as the rest of the code. Use `npm run lint` and see [Testing](#Testing) below before submitting. Please **do not include** any changes to the files in the `build` directory.
If you'd like to contribute but not sure what to work on, feel free to get in touch. Before contributing please read the license agreement described at the beginning of this document.
## Building
To build you must first install [node.js](http://nodejs.org), then run
npm install
which will install the required build dependencies, then run
npm start
which will run the development server and opens `http://localhost:8000/` in your browser. Any changes you make to the source will automatically rebuild and reload the page.
## Testing
All contributions should pass when running the commands
- `npm run lint`
- `npm run test`
- `npm run test-browser`
The output of `npm run test` also includes a [comparison report](https://github.com/liabru/matter-js/pull/794), which highlights changes in results, performance and accuracy against the last release build.
## Commands
The following development commands can be run at the terminal
- **npm start**
runs development server and opens demo page
- **npm run build**
creates a release build
- **npm run build-demo**
builds the demo
- **npm run lint**
runs the linter
- **npm run test**
runs the tests and compares results
- **npm run test-browser**
runs the browser tests
- **npm run doc**
builds the documentation

View file

@ -1,313 +0,0 @@
var gulp = require('gulp');
var uglify = require('gulp-uglify');
var rename = require('gulp-rename');
var header = require('gulp-header');
var eslint = require('gulp-eslint');
var bump = require('gulp-bump');
var changelog = require('gulp-conventional-changelog');
var tag = require('gulp-tag-version');
var release = require('gulp-github-release');
var sequence = require('run-sequence');
var gutil = require('gulp-util');
var replace = require('gulp-replace');
var webserver = require('gulp-webserver');
var concat = require('gulp-concat');
var preprocess = require('gulp-preprocess');
var browserify = require('browserify');
var derequire = require('gulp-derequire');
var transform = require('vinyl-transform');
var through2 = require('through2');
var pkg = require('./package.json');
var clone = require('gulp-clone');
var livereload = require('connect-livereload');
var es = require('event-stream');
var path = require('path');
var fs = require('fs');
var watchify = require('watchify');
var extend = require('util')._extend;
var exec = require('child_process').exec;
var buildDirectory = 'build';
var server;
gulp.task('default', ['build:dev']);
gulp.task('dev', function(callback) {
sequence('watch', 'serve', callback);
});
gulp.task('release', function(callback) {
shell('git status --porcelain', function(err, stdout) {
if (stdout && stdout.trim()) {
throw new gutil.PluginError({
plugin: 'release',
message: 'cannot build release as there are uncomitted changes'
});
} else {
sequence('test', 'bump', 'reload', 'build:release', 'doc', 'changelog', callback);
}
});
});
gulp.task('release:push', function(callback) {
shell('git status --porcelain', function(err, stdout) {
if (stdout && stdout.trim()) {
throw new gutil.PluginError({
plugin: 'release',
message: 'cannot push release as it has not yet been committed'
});
} else {
sequence('tag', 'release:push:git', 'release:push:npm', callback);
}
});
});
gulp.task('release:push:github', function(callback) {
return gulp.src([
'CHANGELOG.md',
'LICENSE',
buildDirectory + '/matter.min.js',
buildDirectory + '/matter.js'
]).pipe(release({
owner: 'liabru',
repo: pkg.name,
tag: pkg.version,
name: 'Matter.js ' + pkg.version
}));
});
gulp.task('release:push:git', function(callback) {
shell('git push', callback);
});
gulp.task('release:push:npm', function(callback) {
shell('npm publish', callback);
});
gulp.task('build:dev', function() {
return build(extend(extend({}, pkg), { version: pkg.version + '-dev' }));
});
gulp.task('build:edge', function() {
return build(extend(extend({}, pkg), { version: pkg.version + '-alpha' }));
});
gulp.task('build:release', function() {
return build(extend(extend({}, pkg), { version: pkg.version }));
});
gulp.task('build:examples', function() {
var options = extend(extend({}, pkg), { version: pkg.version + '-dev' });
options.name = options.name + '-examples';
options.date = options.date || new Date().toISOString().slice(0, 10);
options.author = '@liabru';
return gulp.src('examples/**/*.js')
.pipe(concat('examples.js'))
.pipe(header(banner, { context: options }))
.pipe(gulp.dest('examples/build'));
});
gulp.task('watch', function() {
var b = browserify({
entries: ['src/module/main.js'],
standalone: 'Matter',
plugin: [watchify]
});
var bundle = function() {
gutil.log('Updated bundle build/matter-dev.js');
b.bundle()
.on('error', function(err) {
gutil.log('ERROR', err.message);
this.emit('end');
})
.pipe(through2({ objectMode: true }, function(chunk, encoding, callback) {
return callback(
null,
chunk.toString().replace(/@@VERSION@@/g, pkg.version + '-dev')
);
}))
.pipe(fs.createWriteStream('build/matter-dev.js'));
};
b.on('update', bundle);
bundle();
});
gulp.task('bump', function() {
return gulp.src(['package.json', 'bower.json'])
.pipe(bump({ type: process.argv[4] || 'minor' }))
.pipe(gulp.dest('.'));
});
gulp.task('reload', function(callback) {
delete require.cache[require.resolve('./package.json')];
pkg = require('./package.json');
callback();
});
gulp.task('tag', function() {
return gulp.src('package.json')
.pipe(tag({ prefix: '' }));
});
gulp.task('changelog', function () {
return gulp.src('CHANGELOG.md')
.pipe(changelog())
.pipe(gulp.dest('.'));
});
gulp.task('serve', function() {
serve(false);
});
gulp.task('serve:test', function() {
serve(true);
});
gulp.task('serve:stop', function() {
if (server) {
try {
server.emit('kill');
} catch (e) {} // eslint-disable-line no-empty
gutil.log('Web server stopped');
}
});
gulp.task('test', function(callback) {
// TODO: fix tests by switching to nightmare instead of phantom
// sequence('serve:test', 'lint', 'build:dev', 'test:browser', 'test:node', 'serve:stop', callback);
sequence('lint', callback);
});
gulp.task('test:browser', function(callback) {
shell('phantomjs test/browser/TestDemo.js', callback);
});
gulp.task('test:node', function(callback) {
shell('node test/node/TestDemo.js', callback);
});
gulp.task('lint', function() {
return gulp.src([
'src/**/*.js',
'demo/js/*.js',
'examples/*.js',
'test/browser/TestDemo.js',
'test/node/TestDemo.js',
'Gulpfile.js'
])
.pipe(eslint())
.pipe(eslint.format())
.pipe(eslint.failAfterError());
});
gulp.task('doc', function(callback) {
var options = {
paths: ['src'],
themedir: 'matter-doc-theme',
outdir: 'doc/build',
linkNatives: true,
project: {
name: pkg.name + ' ' + pkg.version + ' Physics Engine API Docs',
description: pkg.description,
version: pkg.version,
url: pkg.homepage
}
};
var Y = require('yuidocjs');
var json = new Y.YUIDoc(options).run();
json.project = options.project;
var builder = new Y.DocBuilder(options, json);
builder.compile(callback);
});
var serve = function(isTest) {
process.on('uncaughtException', function(err) {
if (err.errno === 'EADDRINUSE') {
gutil.log('Server already running (or port is otherwise in use)');
}
});
server = gulp.src('.')
.pipe(webserver({
host: '0.0.0.0',
livereload: {
enable: !isTest,
filter: function(filename) {
return filename.match(/build|demo/);
}
},
middleware: livereload(),
open: isTest ? false : 'http://localhost:8000/demo/index.html',
directoryListing: true
}));
};
var build = function(options) {
var isDev = options.version.indexOf('-dev') !== -1,
filename = buildDirectory + (isDev ? '/matter-dev' : '/matter'),
dest = filename + '.js',
destMin = filename + '.min.js';
options.date = options.date || new Date().toISOString().slice(0, 10);
options.author = '@liabru';
gutil.log('Building', filename, options.date);
var compiled = gulp.src(['src/module/main.js'])
.pipe(through2.obj(function(file, enc, next){
browserify(file.path, { standalone: 'Matter' })
.bundle(function(err, res){
file.contents = res;
next(null, file);
});
}))
.pipe(derequire())
.pipe(replace('@@VERSION@@', options.version));
if (!isDev) {
compiled.pipe(preprocess({ context: { DEBUG: false } }));
}
var build = compiled.pipe(clone())
.pipe(header(banner + '\n' + license + '\n\n', { context: options }))
.pipe(rename(dest))
.pipe(gulp.dest('.'));
var buildMin = compiled.pipe(clone())
.pipe(uglify({ output: { max_line_len: 1000 } }))
.pipe(header(banner, { context: options }))
.pipe(rename(destMin))
.pipe(gulp.dest('.'));
return es.merge(build, buildMin);
};
var shell = function(command, callback) {
var args = process.argv.slice(3).join(' '),
proc = exec(command + ' ' + args, function(err, stdout, stderr) {
callback(err, stdout, stderr, proc);
});
proc.stdout.on('data', function(data) {
process.stdout.write(data);
});
proc.stderr.on('data', function(data) {
process.stderr.write(data);
});
};
var license = fs.readFileSync('src/module/license.js');
var banner = [
'/**',
'* <%= context.name %> <%= context.version %> by <%= context.author %> <%= context.date %>',
'* <%= context.homepage %>',
'* License <%= context.license %>',
'*/',
''
].join('\n');

135
README.md
View file

@ -1,10 +1,10 @@
<img alt="Matter.js" src="http://brm.io/matter-js/img/matter-js.svg" width="300"> <img alt="Matter.js" src="https://brm.io/matter-js/img/matter-js.svg" width="300">
> *Matter.js* is a JavaScript 2D rigid body physics engine for the web > *Matter.js* is a JavaScript 2D rigid body physics engine for the web
[brm.io/matter-js](http://brm.io/matter-js/) [brm.io/matter-js](https://brm.io/matter-js/)
[Demos](#demos) - [Gallery](#gallery) - [Features](#features) - [Plugins](#plugins) - [Install](#install) - [Usage](#usage) - [Examples](#examples) - [Docs](#documentation) - [Wiki](https://github.com/liabru/matter-js/wiki) - [References](#references) - [License](#license) [Demos](#demos) ・ [Gallery](#gallery) ・ [Features](#features) ・ [Plugins](#plugins) ・ [Install](#install) ・ [Usage](#usage) ・ [Examples](#examples) ・ [Docs](#documentation) ・ [Wiki](https://github.com/liabru/matter-js/wiki) ・ [References](#references) ・ [License](#license)
[![Build Status](https://travis-ci.org/liabru/matter-js.png?branch=master)](https://travis-ci.org/liabru/matter-js) [![Build Status](https://travis-ci.org/liabru/matter-js.png?branch=master)](https://travis-ci.org/liabru/matter-js)
@ -14,51 +14,55 @@
<tr> <tr>
<td> <td>
<ul> <ul>
<li><a href="http://brm.io/matter-js/demo/#mixed">Mixed Shapes</a></li> <li><a href="https://brm.io/matter-js/demo/#mixed">Mixed Shapes</a></li>
<li><a href="http://brm.io/matter-js/demo/#mixedSolid">Solid Shapes</a></li> <li><a href="https://brm.io/matter-js/demo/#mixedSolid">Solid Shapes</a></li>
<li><a href="http://brm.io/matter-js/demo/#svg">Concave SVG Paths</a></li> <li><a href="https://brm.io/matter-js/demo/#svg">Concave SVG Paths</a></li>
<li><a href="http://brm.io/matter-js/demo/#terrain">Concave Terrain</a></li> <li><a href="https://brm.io/matter-js/demo/#terrain">Concave Terrain</a></li>
<li><a href="http://brm.io/matter-js/demo/#concave">Concave Bodies</a></li> <li><a href="https://brm.io/matter-js/demo/#concave">Concave Bodies</a></li>
<li><a href="http://brm.io/matter-js/demo/#compound">Compound Bodies</a></li> <li><a href="https://brm.io/matter-js/demo/#compound">Compound Bodies</a></li>
<li><a href="http://brm.io/matter-js/demo/#newtonsCradle">Newton's Cradle</a></li> <li><a href="https://brm.io/matter-js/demo/#newtonsCradle">Newton's Cradle</a></li>
<li><a href="http://brm.io/matter-js/demo/#wreckingBall">Wrecking Ball</a></li> <li><a href="https://brm.io/matter-js/demo/#wreckingBall">Wrecking Ball</a></li>
<li><a href="http://brm.io/matter-js/demo/#slingshot">Slingshot Game</a></li> <li><a href="https://brm.io/matter-js/demo/#slingshot">Slingshot Game</a></li>
<li><a href="http://brm.io/matter-js/demo/#rounded">Rounded Corners</a></li> <li><a href="https://brm.io/matter-js/demo/#rounded">Rounded Corners</a></li>
<li><a href="http://brm.io/matter-js/demo/#views">Views</a></li> <li><a href="https://brm.io/matter-js/demo/#views">Views</a></li>
<li><a href="http://brm.io/matter-js/demo/#timescale">Time Scaling</a></li> <li><a href="https://brm.io/matter-js/demo/#timescale">Time Scaling</a></li>
<li><a href="http://brm.io/matter-js/demo/#manipulation">Body Manipulation</a></li> <li><a href="https://brm.io/matter-js/demo/#manipulation">Body Manipulation</a></li>
<li><a href="http://brm.io/matter-js/demo/#compositeManipulation">Composite Manipulation</a></li> <li><a href="https://brm.io/matter-js/demo/#compositeManipulation">Composite Manipulation</a></li>
<li><a href="http://brm.io/matter-js/demo/#raycasting">Raycasting</a></li>
<li><a href="http://brm.io/matter-js/demo/#sprites">Sprites</a></li>
<li><a href="http://brm.io/matter-js/demo/#pyramid">Pyramid</a></li>
<li><a href="http://brm.io/matter-js/demo/#car">Car</a></li>
<li><a href="http://brm.io/matter-js/demo/#catapult">Catapult</a></li>
<li><a href="http://brm.io/matter-js/demo/#gravity">Reverse Gravity</a></li>
</ul> </ul>
</td> </td>
<td> <td>
<ul> <ul>
<li><a href="http://brm.io/matter-js/demo/#bridge">Bridge</a></li> <li><a href="https://brm.io/matter-js/demo/#raycasting">Raycasting</a></li>
<li><a href="http://brm.io/matter-js/demo/#avalanche">Avalanche</a></li> <li><a href="https://brm.io/matter-js/demo/#sprites">Sprites</a></li>
<li><a href="http://brm.io/matter-js/demo/#softBody">Basic Soft Bodies</a></li> <li><a href="https://brm.io/matter-js/demo/#pyramid">Pyramid</a></li>
<li><a href="http://brm.io/matter-js/demo/#cloth">Cloth</a></li> <li><a href="https://brm.io/matter-js/demo/#car">Car</a></li>
<li><a href="http://brm.io/matter-js/demo/#events">Events</a></li> <li><a href="https://brm.io/matter-js/demo/#catapult">Catapult</a></li>
<li><a href="http://brm.io/matter-js/demo/#collisionFiltering">Collision Filtering</a></li> <li><a href="https://brm.io/matter-js/demo/#gravity">Reverse Gravity</a></li>
<li><a href="http://brm.io/matter-js/demo/#chains">Chains</a></li> <li><a href="https://brm.io/matter-js/demo/#bridge">Bridge</a></li>
<li><a href="http://brm.io/matter-js/demo/#ballPool">Ball Pool</a></li> <li><a href="https://brm.io/matter-js/demo/#avalanche">Avalanche</a></li>
<li><a href="http://brm.io/matter-js/demo/#stack">Stack</a></li> <li><a href="https://brm.io/matter-js/demo/#softBody">Basic Soft Bodies</a></li>
<li><a href="http://brm.io/matter-js/demo/#circleStack">Circle Stack</a></li> <li><a href="https://brm.io/matter-js/demo/#cloth">Cloth</a></li>
<li><a href="http://brm.io/matter-js/demo/#compoundStack">Compound Stack</a></li> <li><a href="https://brm.io/matter-js/demo/#events">Events</a></li>
<li><a href="http://brm.io/matter-js/demo/#restitution">Restitution</a></li> <li><a href="https://brm.io/matter-js/demo/#collisionFiltering">Collision Filtering</a></li>
<li><a href="http://brm.io/matter-js/demo/#friction">Friction</a></li> <li><a href="https://brm.io/matter-js/demo/#chains">Chains</a></li>
<li><a href="http://brm.io/matter-js/demo/#airFriction">Air Friction</a></li> <li><a href="https://brm.io/matter-js/demo/#ballPool">Ball Pool</a></li>
<li><a href="http://brm.io/matter-js/demo/#staticFriction">Static Friction</a></li> </ul>
<li><a href="http://brm.io/matter-js/demo/#sleeping">Sleeping</a></li> </td>
<li><a href="http://brm.io/matter-js/demo/#broadphase">Grid Broadphase</a></li> <td>
<li><a href="http://brm.io/matter-js/demo/#beachBalls">Beach Balls</a></li> <ul>
<li><a href="http://brm.io/matter-js/demo/#stress">Stress 1</a></li> <li><a href="https://brm.io/matter-js/demo/#stack">Stack</a></li>
<li><a href="http://brm.io/matter-js/demo/#stress2">Stress 2</a></li> <li><a href="https://brm.io/matter-js/demo/#circleStack">Circle Stack</a></li>
<li><a href="http://brm.io/matter-js/demo/#sensors">Sensors</a></li> <li><a href="https://brm.io/matter-js/demo/#compoundStack">Compound Stack</a></li>
<li><a href="https://brm.io/matter-js/demo/#restitution">Restitution</a></li>
<li><a href="https://brm.io/matter-js/demo/#friction">Friction</a></li>
<li><a href="https://brm.io/matter-js/demo/#airFriction">Air Friction</a></li>
<li><a href="https://brm.io/matter-js/demo/#staticFriction">Static Friction</a></li>
<li><a href="https://brm.io/matter-js/demo/#sleeping">Sleeping</a></li>
<li><a href="https://brm.io/matter-js/demo/#broadphase">Grid Broadphase</a></li>
<li><a href="https://brm.io/matter-js/demo/#beachBalls">Beach Balls</a></li>
<li><a href="https://brm.io/matter-js/demo/#stress">Stress 1</a></li>
<li><a href="https://brm.io/matter-js/demo/#stress2">Stress 2</a></li>
<li><a href="https://brm.io/matter-js/demo/#sensors">Sensors</a></li>
</ul> </ul>
<br> <br>
</td> </td>
@ -69,16 +73,18 @@
See how others are using matter.js physics See how others are using matter.js physics
- [Les métamorphoses de Mr. Kalia](http://lab212.org/Les-metamorphoses-de-Mr-Kalia) by Lab212 for Google - [Patrick Heng](https://patrickheng.com/) by Patrick Heng
- [4ify](http://pauliescanlon.io/4ify-channel-4-rebrand-2/) by Supernatural for Channel 4 - [USELESS](https://useless.london/) by Nice and Serious
- [Adobe Analytics Live Stream](http://adobefirehose.mediarain.com/) by Rain for Adobe - [Secret 7](https://secret-7.com/) by Goodness
- [Blood Sweat & Tools Interactive](http://bloodsweatandtools.discovery.ca/gamebench/) by Jam3 for Discovery - [New Company](https://www.new.company/) by New Company
- [Oracle OpenWorld Experiment](http://theappslab.com/2016/10/10/how-i-attended-oracle-openworld-2016/) by Ed Jones for Oracle - [Game of The Year](https://gameoftheyear.withgoogle.com/) by Google
- [Pablo The Flamingo](http://pablotheflamingo.com/) by Nathan Gordon - [Pablo The Flamingo](https://pablotheflamingo.com/) by Nathan Gordon
- [Goblins and Grottos](http://store.steampowered.com/app/389190) by Psychic Software - [Les métamorphoses de Mr. Kalia](https://lab212.org/oeuvres/2:art/18/Les-metamorphoses-de-Mr-Kalia) by Lab212
- [masQueLaCara](https://www.instagram.com/p/BCFqCs6JNsq/) by Zach Lieberman for Art Blocks Houston - [Phaser](https://phaser.io/) by Photon Storm
- [#GIFMYLIVE](http://bonhommeparis.com/en/projects/arte-gifmylive) by Bonhomme for Arte - [Sorry I Have No Filter](https://sorryihavenofilter.com/pages/about/) by Jessica Walsh
- [Hype](http://tumult.com/hype/pro/) by Tumult - [Fuse](https://fuse.blog/) by Fuse
- [Glyphfinder](https://www.glyphfinder.com/) by überdosis
- [Isolation](https://isolation.is/postcards/my-week) by sabato studio
- [more...](https://github.com/liabru/matter-js/wiki/Gallery) - [more...](https://github.com/liabru/matter-js/wiki/Gallery)
### Features ### Features
@ -111,15 +117,14 @@ See how others are using matter.js physics
### Install ### Install
Download the [edge build (master)](https://github.com/liabru/matter-js/blob/master/build/matter.js) or get a [stable release](https://github.com/liabru/matter-js/releases) and include the script in your web page: You can install using package managers [npm](https://www.npmjs.org/package/matter-js) and [Yarn](https://yarnpkg.com/) using:
npm install matter-js
Alternatively you can download a [stable release](https://github.com/liabru/matter-js/tags) or try the latest experimental [alpha build](https://github.com/liabru/matter-js/tree/master/build) (master) and include the script in your web page:
<script src="matter.js" type="text/javascript"></script> <script src="matter.js" type="text/javascript"></script>
You can also install using the package managers [Bower](http://bower.io/search/?q=matter-js) and [NPM](https://www.npmjs.org/package/matter-js).
bower install matter-js
npm install matter-js
### Usage ### Usage
Visit the [Getting started](https://github.com/liabru/matter-js/wiki/Getting-started) wiki page for a minimal usage example which should work in both browsers and Node.js. Visit the [Getting started](https://github.com/liabru/matter-js/wiki/Getting-started) wiki page for a minimal usage example which should work in both browsers and Node.js.
@ -132,7 +137,7 @@ See the list of [tutorials](https://github.com/liabru/matter-js/wiki/Tutorials).
### Examples ### Examples
See the [examples](https://github.com/liabru/matter-js/tree/master/examples) directory which contains the source for all [demos](#demos). See the [examples](https://github.com/liabru/matter-js/tree/master/examples) directory which contains the source for all [demos](#demos).
There are even more examples on [codepen](http://codepen.io/collection/Fuagy/). There are even more examples on [codepen](https://codepen.io/collection/Fuagy/).
### Plugins ### Plugins
@ -145,17 +150,17 @@ The engine can be extended through plugins, see these resources:
### Documentation ### Documentation
See the [API Documentation](http://brm.io/matter-js/docs/) and the [wiki](https://github.com/liabru/matter-js/wiki) See the [API Documentation](https://brm.io/matter-js/docs/) and the [wiki](https://github.com/liabru/matter-js/wiki)
### Building and Contributing ### Building and Contributing
To build you must first install [node.js](http://nodejs.org/) and [gulp](http://gulpjs.com/), then run To build you must first install [node.js](https://nodejs.org/), then run
npm install npm install
This will install the required build dependencies, then run This will install the required build dependencies, then run
gulp dev npm run dev
to spawn a development server. For information on contributing see [CONTRIBUTING.md](https://github.com/liabru/matter-js/blob/master/CONTRIBUTING.md). to spawn a development server. For information on contributing see [CONTRIBUTING.md](https://github.com/liabru/matter-js/blob/master/CONTRIBUTING.md).
@ -169,7 +174,7 @@ See the wiki page on [References](https://github.com/liabru/matter-js/wiki/Refer
### License ### License
Matter.js is licensed under [The MIT License (MIT)](http://opensource.org/licenses/MIT) Matter.js is licensed under [The MIT License (MIT)](https://opensource.org/licenses/MIT)
Copyright (c) 2014 Liam Brummitt Copyright (c) 2014 Liam Brummitt
This license is also supplied with the release and source code. This license is also supplied with the release and source code.

139
RELEASE.md Normal file
View file

@ -0,0 +1,139 @@
## ▲.●matter.js`0.17.0`
Release notes for `0.17.0`. See the release [readme](https://github.com/liabru/matter-js/blob/0.17.0/README.md) for further information.
### Highlights
- Added performance and stats monitoring overlays to `Matter.Render`
- See the [stats demo](https://brm.io/matter-js/demo/#stats) or enable [render.options.showPerformance](https://brm.io/matter-js/docs/classes/Render.html#property_options.showPerformance) and [render.options.showStats](https://brm.io/matter-js/docs/classes/Render.html#property_options.showStats)
- Stats shown include
- render frequency (e.g. `60 fps`)
- engine delta time (e.g. `16.66ms`)
- engine execution duration (e.g. `5.00ms`)
- render execution duration (e.g.` 0.40ms`)
- effective play speed (e.g. `1.00x` is real-time)
- various other engine internal stats for debugging
- Improved [documentation](https://brm.io/matter-js/docs/) pages
- Added [Common.setDecomp](https://brm.io/matter-js/docs/classes/Common.html#method_setDecomp) and [Common.getDecomp](https://brm.io/matter-js/docs/classes/Common.html#method_getDecomp) to fix [bundler issues](https://github.com/liabru/matter-js/issues/981)
- Added docs for all [Matter.Render options](https://brm.io/matter-js/docs/classes/Render.html#properties)
- Migrated usage of `Matter.World` over to `Matter.Composite` (more info in [docs](https://brm.io/matter-js/docs/classes/World.html))
- Migrated, deprecated and removed various old functionality (see the [changelog](https://github.com/liabru/matter-js/blob/0.17.0/CHANGELOG.md) for details)
### Changes
See the release [compare page](https://github.com/liabru/matter-js/compare/0.16.1...0.17.0) and the [changelog](https://github.com/liabru/matter-js/blob/0.17.0/CHANGELOG.md) for a detailed list of changes.
### Comparison
Differences in behaviour, quality and performance against the previous release `0.16.1`. For more information see [comparison method](https://github.com/liabru/matter-js/pull/794).
```ocaml
Output comparison of 37 examples against previous release matter-js@0.16.1
Similarity 100% Performance +0.00% Overlap +0.00%
airFriction · · avalanche · · ballPool · · bridge · · broadphase · · car · ·
catapult · · chains · · circleStack · · cloth · · collisionFiltering · ·
compound · · compoundStack · · constraints · · events · · friction · ·
gyro · · manipulation · · mixed · · newtonsCradle · · pyramid · ·
ragdoll · · restitution · · rounded · · sensors · · sleeping · ·
slingshot · · softBody · · sprites · · stack · · staticFriction · ·
stats · · stress · · stress2 · · timescale · · views · ·
wreckingBall · ·
where · no change ● extrinsics changed ◆ intrinsics changed
```
### Contributors
Many thanks to the [contributors](https://github.com/liabru/matter-js/compare/0.16.1...0.17.0) of this release, [past contributors](https://github.com/liabru/matter-js/graphs/contributors) as well those involved in the [community](https://github.com/liabru/matter-js/issues) for your input and support.
---
## ▲.●matter.js`0.16.0`
Release notes for `0.16.0`. See the release [readme](https://github.com/liabru/matter-js/blob/0.16.0/README.md) for further information.
### Highlights
- Changed external require method for `poly-decomp` ([882e07c](https://github.com/liabru/matter-js/commit/882e07c))
- Improved `Bodies.fromVertices` decomposition quality using `removeDuplicatePoints` ([#639](https://github.com/liabru/matter-js/pull/639))
- Added support for `>x.x.x` and `>=x.x.x` semver ranges in plugins ([0792716](https://github.com/liabru/matter-js/commit/0792716))
- Changed demo example select background colour for Windows ([matter-tools #5](https://github.com/liabru/matter-tools/pull/5))
- Updated demo to use latest [matter-tools](https://github.com/liabru/matter-tools) ([#33e8fe8](https://github.com/liabru/matter-js/commit/33e8fe8))
- Updated SVG and terrain examples to use `fetch` ([5551cd5](https://github.com/liabru/matter-js/commit/5551cd5))
### Changes
See the release [compare page](https://github.com/liabru/matter-js/compare/0.15.0...0.16.0) and the [changelog](https://github.com/liabru/matter-js/blob/0.16.0/CHANGELOG.md) for a detailed list of changes.
### Comparison
Differences in behaviour, quality and performance against the previous release `0.15.0`. For more information see [comparison method](https://github.com/liabru/matter-js/pull/794).
```ocaml
Output comparison of 41 examples against matter-js@0.15.0 build on last run
Similarity 100% Performance +0.00% Overlap +0.00%
airFriction · · avalanche · · ballPool · · bridge · · broadphase · · car · ·
catapult · · chains · · circleStack · · cloth · · collisionFiltering · ·
compositeManipulation · · compound · · compoundStack · · concave · · constraints · ·
doublePendulum · · events · · friction · · gravity · · gyro · ·
manipulation · · mixed · · newtonsCradle · · pyramid · · ragdoll · ·
raycasting · · restitution · · rounded · · sensors · · sleeping · ·
slingshot · · softBody · · sprites · · stack · · staticFriction · ·
stress · · stress2 · · timescale · · views · · wreckingBall · ·
where · no change ● extrinsics changed ◆ intrinsics changed
```
### Contributors
Many thanks to the [contributors](https://github.com/liabru/matter-js/compare/0.15.0...0.16.0) of this release, [past contributors](https://github.com/liabru/matter-js/graphs/contributors) as well those involved in the [community](https://github.com/liabru/matter-js/issues) for your input and support.
---
## ▲.●matter.js`0.15.0`
Release notes for `0.15.0`. See the release [readme](https://github.com/liabru/matter-js/blob/0.15.0/README.md) for further information.
### Highlights
- __Optimised performance up to ~30% boost vs. `0.14.2`__ ([#528](https://github.com/liabru/matter-js/pull/528)) ([#522](https://github.com/liabru/matter-js/pull/522)) ([#553](https://github.com/liabru/matter-js/pull/553))
- Added `Body.setCentre` ([2ec247b](https://github.com/liabru/matter-js/commit/2ec247b))
- Added `Constraint.pointAWorld` and `Constraint.pointBWorld` ([3c32969](https://github.com/liabru/matter-js/commit/3c32969))
- Changed default colour scheme ([d258411](https://github.com/liabru/matter-js/commit/d258411)) ([6dd5ec5](https://github.com/liabru/matter-js/commit/6dd5ec5))
- Fixed issues with decomp require ([0af1645](https://github.com/liabru/matter-js/commit/0af1645))
- Fixed issues with render pixel ratio ([d577477](https://github.com/liabru/matter-js/commit/d577477))
### Changes
See the release [compare page](https://github.com/liabru/matter-js/compare/0.14.2...0.15.0) and the [changelog](https://github.com/liabru/matter-js/blob/0.15.0/CHANGELOG.md) for a detailed list of all changes.
### Comparison
Differences in behaviour, quality and performance against the previous release `0.14.2`. For more information see [comparison method](https://github.com/liabru/matter-js/pull/794).
```ocaml
Output comparison of 41 examples against matter-js@0.14.2 build on last run
Similarity 100% Performance +33.6% Overlap +0.00%
airFriction · · avalanche · · ballPool · · bridge · · broadphase · · car · ·
catapult · · chains · · circleStack · · cloth · · collisionFiltering · ·
compositeManipulation · · compound · · compoundStack · · concave · · constraints · ·
doublePendulum · · events · · friction · · gravity · · gyro · ·
manipulation · · mixed · · newtonsCradle · · pyramid · · ragdoll · ·
raycasting · · restitution · · rounded · · sensors · · sleeping · ·
slingshot · · softBody · · sprites · · stack · · staticFriction · ·
stress · · stress2 · · timescale · · views · · wreckingBall · ·
where · no change ● extrinsics changed ◆ intrinsics changed
```
### Contributors
Many thanks to the [contributors](https://github.com/liabru/matter-js/compare/0.14.2...0.15.0) of this release, [past contributors](https://github.com/liabru/matter-js/graphs/contributors) as well those involved in the [community](https://github.com/liabru/matter-js/issues) for your input and support.

View file

@ -1,27 +0,0 @@
{
"name": "Matter",
"version": "0.14.2",
"homepage": "https://github.com/liabru/matter-js",
"authors": [
"Liam Brummitt <liam@brm.io> (http://brm.io/)"
],
"description": "a 2D rigid body physics engine for the web",
"main": "build/matter.js",
"keywords": [
"javascript",
"canvas",
"html5",
"physics",
"physics engine",
"game engine",
"rigid body physics"
],
"license": "MIT",
"ignore": [
"**/.*",
"node_modules",
"bower_components",
"test",
"tests"
]
}

File diff suppressed because it is too large Load diff

102
build/matter.min.js vendored

File diff suppressed because one or more lines are too long

View file

@ -9,69 +9,7 @@
<meta name="apple-mobile-web-app-capable" content="yes"> <meta name="apple-mobile-web-app-capable" content="yes">
<meta name="apple-mobile-web-app-status-bar-style" content="black-translucent"> <meta name="apple-mobile-web-app-status-bar-style" content="black-translucent">
<meta name="robots" content="noindex"> <meta name="robots" content="noindex">
<title>Matter.js Demo</title> <title>Matter.js Demo</title>
<!-- libs -->
<script type="text/javascript" src="/demo/lib/decomp.js"></script>
<script type="text/javascript" src="/demo/lib/pathseg.js"></script>
<!-- Matter -->
<script src="../build/matter-dev.js"></script>
<!-- MatterTools -->
<script src="//code.jquery.com/jquery-3.1.1.js"></script>
<script src="/demo/lib/matter-tools.gui.js"></script>
<script src="/demo/lib/matter-tools.inspector.js"></script>
<script src="/demo/lib/matter-tools.demo.js"></script>
<!-- Plugins -->
<script src="/demo/lib/matter-wrap.js"></script>
<!-- Examples -->
<script src="../examples/airFriction.js"></script>
<script src="../examples/avalanche.js"></script>
<script src="../examples/ballPool.js"></script>
<script src="../examples/bridge.js"></script>
<script src="../examples/broadphase.js"></script>
<script src="../examples/car.js"></script>
<script src="../examples/catapult.js"></script>
<script src="../examples/chains.js"></script>
<script src="../examples/circleStack.js"></script>
<script src="../examples/cloth.js"></script>
<script src="../examples/collisionFiltering.js"></script>
<script src="../examples/compositeManipulation.js"></script>
<script src="../examples/compound.js"></script>
<script src="../examples/compoundStack.js"></script>
<script src="../examples/concave.js"></script>
<script src="../examples/constraints.js"></script>
<script src="../examples/doublePendulum.js"></script>
<script src="../examples/events.js"></script>
<script src="../examples/friction.js"></script>
<script src="../examples/gravity.js"></script>
<script src="../examples/gyro.js"></script>
<script src="../examples/manipulation.js"></script>
<script src="../examples/mixed.js"></script>
<script src="../examples/newtonsCradle.js"></script>
<script src="../examples/ragdoll.js"></script>
<script src="../examples/pyramid.js"></script>
<script src="../examples/raycasting.js"></script>
<script src="../examples/restitution.js"></script>
<script src="../examples/rounded.js"></script>
<script src="../examples/sensors.js"></script>
<script src="../examples/sleeping.js"></script>
<script src="../examples/slingshot.js"></script>
<script src="../examples/softBody.js"></script>
<script src="../examples/sprites.js"></script>
<script src="../examples/stack.js"></script>
<script src="../examples/staticFriction.js"></script>
<script src="../examples/stress.js"></script>
<script src="../examples/stress2.js"></script>
<script src="../examples/svg.js"></script>
<script src="../examples/terrain.js"></script>
<script src="../examples/timescale.js"></script>
<script src="../examples/views.js"></script>
<script src="../examples/wreckingBall.js"></script>
<style type="text/css"> <style type="text/css">
* { * {
@ -82,9 +20,41 @@
margin: 0; margin: 0;
padding: 0; padding: 0;
} }
.matter-btn-compare.matter-btn {
font-size: 18px;
text-align: center;
line-height: 32px;
}
.matter-js-compare-build.matter-demo {
position: absolute;
background: none;
top: 0;
left: 0;
width: 100%;
height: 100%;
border: 0;
z-index: 1;
pointer-events: none;
}
.matter-js-compare-build.matter-demo .matter-header-outer {
display: none;
}
.matter-js-compare-build.matter-demo canvas {
opacity: 0.5;
background: transparent !important;
}
</style> </style>
</head> </head>
<body> <body>
<script src="/demo/js/Demo.js"></script> <script src="./js/matter-demo.main.5a504f.min.js"></script>
<script src="./js/matter-demo.matter-tools.5e580e.min.js"></script>
<script src="./js/matter-demo.matter-wrap.b3a896.min.js"></script>
<script src="./js/matter-demo.pathseg.067c95.min.js"></script>
<script src="./js/matter-demo.poly-decomp.59954b.min.js"></script>
<script src="./js/matter-demo.e7da73.min.js"></script>
</body> </body>
</html> </html>

View file

@ -1,297 +0,0 @@
/**
* The Matter.js demo page controller and example runner.
*
* NOTE: For the actual example code, refer to the source files in `/examples/`.
*
* @class Demo
*/
(function() {
var sourceLinkRoot = 'https://github.com/liabru/matter-js/blob/master/examples';
var demo = MatterTools.Demo.create({
toolbar: {
title: 'matter-js',
url: 'https://github.com/liabru/matter-js',
reset: true,
source: true,
inspector: true,
tools: true,
fullscreen: true,
exampleSelect: true
},
tools: {
inspector: true,
gui: true
},
inline: false,
preventZoom: true,
resetOnOrientation: true,
routing: true,
startExample: 'mixed',
examples: [
{
name: 'Air Friction',
id: 'airFriction',
init: Example.airFriction,
sourceLink: sourceLinkRoot + '/airFriction.js'
},
{
name: 'Avalanche',
id: 'avalanche',
init: Example.avalanche,
sourceLink: sourceLinkRoot + '/avalanche.js'
},
{
name: 'Ball Pool',
id: 'ballPool',
init: Example.ballPool,
sourceLink: sourceLinkRoot + '/ballPool.js'
},
{
name: 'Bridge',
id: 'bridge',
init: Example.bridge,
sourceLink: sourceLinkRoot + '/bridge.js'
},
{
name: 'Broadphase',
id: 'broadphase',
init: Example.broadphase,
sourceLink: sourceLinkRoot + '/broadphase.js'
},
{
name: 'Car',
id: 'car',
init: Example.car,
sourceLink: sourceLinkRoot + '/car.js'
},
{
name: 'Catapult',
id: 'catapult',
init: Example.catapult,
sourceLink: sourceLinkRoot + '/catapult.js'
},
{
name: 'Chains',
id: 'chains',
init: Example.chains,
sourceLink: sourceLinkRoot + '/chains.js'
},
{
name: 'Circle Stack',
id: 'circleStack',
init: Example.circleStack,
sourceLink: sourceLinkRoot + '/circleStack.js'
},
{
name: 'Cloth',
id: 'cloth',
init: Example.cloth,
sourceLink: sourceLinkRoot + '/cloth.js'
},
{
name: 'Collision Filtering',
id: 'collisionFiltering',
init: Example.collisionFiltering,
sourceLink: sourceLinkRoot + '/collisionFiltering.js'
},
{
name: 'Composite Manipulation',
id: 'compositeManipulation',
init: Example.compositeManipulation,
sourceLink: sourceLinkRoot + '/compositeManipulation.js'
},
{
name: 'Compound Bodies',
id: 'compound',
init: Example.compound,
sourceLink: sourceLinkRoot + '/compound.js'
},
{
name: 'Compound Stack',
id: 'compoundStack',
init: Example.compoundStack,
sourceLink: sourceLinkRoot + '/compoundStack.js'
},
{
name: 'Concave',
id: 'concave',
init: Example.concave,
sourceLink: sourceLinkRoot + '/concave.js'
},
{
name: 'Constraints',
id: 'constraints',
init: Example.constraints,
sourceLink: sourceLinkRoot + '/constraints.js'
},
{
name: 'Double Pendulum',
id: 'doublePendulum',
init: Example.doublePendulum,
sourceLink: sourceLinkRoot + '/doublePendulum.js'
},
{
name: 'Events',
id: 'events',
init: Example.events,
sourceLink: sourceLinkRoot + '/events.js'
},
{
name: 'Friction',
id: 'friction',
init: Example.friction,
sourceLink: sourceLinkRoot + '/friction.js'
},
{
name: 'Reverse Gravity',
id: 'gravity',
init: Example.gravity,
sourceLink: sourceLinkRoot + '/gravity.js'
},
{
name: 'Gyroscope',
id: 'gyro',
init: Example.gyro,
sourceLink: sourceLinkRoot + '/gyro.js'
},
{
name: 'Manipulation',
id: 'manipulation',
init: Example.manipulation,
sourceLink: sourceLinkRoot + '/manipulation.js'
},
{
name: 'Mixed Shapes',
id: 'mixed',
init: Example.mixed,
sourceLink: sourceLinkRoot + '/mixed.js'
},
{
name: 'Newton\'s Cradle',
id: 'newtonsCradle',
init: Example.newtonsCradle,
sourceLink: sourceLinkRoot + '/newtonsCradle.js'
},
{
name: 'Ragdoll',
id: 'ragdoll',
init: Example.ragdoll,
sourceLink: sourceLinkRoot + '/ragdoll.js'
},
{
name: 'Pyramid',
id: 'pyramid',
init: Example.pyramid,
sourceLink: sourceLinkRoot + '/pyramid.js'
},
{
name: 'Raycasting',
id: 'raycasting',
init: Example.raycasting,
sourceLink: sourceLinkRoot + '/raycasting.js'
},
{
name: 'Restitution',
id: 'restitution',
init: Example.restitution,
sourceLink: sourceLinkRoot + '/restitution.js'
},
{
name: 'Rounded Corners (Chamfering)',
id: 'rounded',
init: Example.rounded,
sourceLink: sourceLinkRoot + '/rounded.js'
},
{
name: 'Sensors',
id: 'sensors',
init: Example.sensors,
sourceLink: sourceLinkRoot + '/sensors.js'
},
{
name: 'Sleeping',
id: 'sleeping',
init: Example.sleeping,
sourceLink: sourceLinkRoot + '/sleeping.js'
},
{
name: 'Slingshot',
id: 'slingshot',
init: Example.slingshot,
sourceLink: sourceLinkRoot + '/slingshot.js'
},
{
name: 'Soft Body',
id: 'softBody',
init: Example.softBody,
sourceLink: sourceLinkRoot + '/softBody.js'
},
{
name: 'Sprites',
id: 'sprites',
init: Example.sprites,
sourceLink: sourceLinkRoot + '/sprites.js'
},
{
name: 'Stack',
id: 'stack',
init: Example.stack,
sourceLink: sourceLinkRoot + '/stack.js'
},
{
name: 'Static Friction',
id: 'staticFriction',
init: Example.staticFriction,
sourceLink: sourceLinkRoot + '/staticFriction.js'
},
{
name: 'Stress',
id: 'stress',
init: Example.stress,
sourceLink: sourceLinkRoot + '/stress.js'
},
{
name: 'Stress 2',
id: 'stress2',
init: Example.stress2,
sourceLink: sourceLinkRoot + '/stress2.js'
},
{
name: 'Concave SVG Paths',
id: 'svg',
init: Example.svg,
sourceLink: sourceLinkRoot + '/svg.js'
},
{
name: 'Terrain',
id: 'terrain',
init: Example.terrain,
sourceLink: sourceLinkRoot + '/terrain.js'
},
{
name: 'Time Scaling',
id: 'timescale',
init: Example.timescale,
sourceLink: sourceLinkRoot + '/timescale.js'
},
{
name: 'Views',
id: 'views',
init: Example.views,
sourceLink: sourceLinkRoot + '/views.js'
},
{
name: 'Wrecking Ball',
id: 'wreckingBall',
init: Example.wreckingBall,
sourceLink: sourceLinkRoot + '/wreckingBall.js'
}
]
});
document.body.appendChild(demo.dom.root);
MatterTools.Demo.start(demo);
})();

6
demo/js/matter-demo.e7da73.min.js vendored Normal file

File diff suppressed because one or more lines are too long

View file

@ -0,0 +1,5 @@
/*!
* matter-demo bundle 0.17.1 by @liabru
* http://brm.io/matter-js/
* License MIT
*/!function(e){function t(t){for(var n,l,a=t[0],f=t[1],i=t[2],c=0,s=[];c<a.length;c++)l=a[c],Object.prototype.hasOwnProperty.call(o,l)&&o[l]&&s.push(o[l][0]),o[l]=0;for(n in f)Object.prototype.hasOwnProperty.call(f,n)&&(e[n]=f[n]);for(p&&p(t);s.length;)s.shift()();return u.push.apply(u,i||[]),r()}function r(){for(var e,t=0;t<u.length;t++){for(var r=u[t],n=!0,a=1;a<r.length;a++){var f=r[a];0!==o[f]&&(n=!1)}n&&(u.splice(t--,1),e=l(l.s=r[0]))}return e}var n={},o={1:0},u=[];function l(t){if(n[t])return n[t].exports;var r=n[t]={i:t,l:!1,exports:{}};return e[t].call(r.exports,r,r.exports,l),r.l=!0,r.exports}l.m=e,l.c=n,l.d=function(e,t,r){l.o(e,t)||Object.defineProperty(e,t,{enumerable:!0,get:r})},l.r=function(e){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(e,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(e,"__esModule",{value:!0})},l.t=function(e,t){if(1&t&&(e=l(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var r=Object.create(null);if(l.r(r),Object.defineProperty(r,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var n in e)l.d(r,n,function(t){return e[t]}.bind(null,n));return r},l.n=function(e){var t=e&&e.__esModule?function(){return e.default}:function(){return e};return l.d(t,"a",t),t},l.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},l.p="./js";var a=this.webpackJsonpMatterDemo=this.webpackJsonpMatterDemo||[],f=a.push.bind(a);a.push=t,a=a.slice();for(var i=0;i<a.length;i++)t(a[i]);var p=f;r()}([]);

File diff suppressed because one or more lines are too long

View file

@ -0,0 +1,12 @@
/*!
* matter-demo bundle 0.17.1 by @liabru
* http://brm.io/matter-js/
* License MIT
*/
(this.webpackJsonpMatterDemo=this.webpackJsonpMatterDemo||[]).push([[3],{OPlj:function(n,r,t){
/*!
* matter-wrap 0.2.0 by Liam Brummitt 2017-07-04
* https://github.com/liabru/matter-wrap
* License MIT
*/
var o;o=function(n){return function(n){var r={};function t(o){if(r[o])return r[o].exports;var e=r[o]={i:o,l:!1,exports:{}};return n[o].call(e.exports,e,e.exports,t),e.l=!0,e.exports}return t.m=n,t.c=r,t.i=function(n){return n},t.d=function(n,r,o){t.o(n,r)||Object.defineProperty(n,r,{configurable:!1,enumerable:!0,get:o})},t.n=function(n){var r=n&&n.__esModule?function(){return n.default}:function(){return n};return t.d(r,"a",r),r},t.o=function(n,r){return Object.prototype.hasOwnProperty.call(n,r)},t.p="/libs",t(t.s=1)}([function(r,t){r.exports=n},function(n,r,t){"use strict";var o=t(0),e={name:"matter-wrap",version:"0.1.3",for:"matter-js@^0.12.0",install:function(n){n.after("Engine.update",(function(){e.Engine.update(this)}))},Engine:{update:function(n){for(var r=n.world,t=o.Composite.allBodies(r),i=o.Composite.allComposites(r),a=0;a<t.length;a+=1){var u=t[a];u.plugin.wrap&&e.Body.wrap(u,u.plugin.wrap)}for(a=0;a<i.length;a+=1){var s=i[a];s.plugin.wrap&&e.Composite.wrap(s,s.plugin.wrap)}}},Bounds:{wrap:function(n,r){var t=null,o=null;if(void 0!==r.min.x&&void 0!==r.max.x&&(n.min.x>r.max.x?t=r.min.x-n.max.x:n.max.x<r.min.x&&(t=r.max.x-n.min.x)),void 0!==r.min.y&&void 0!==r.max.y&&(n.min.y>r.max.y?o=r.min.y-n.max.y:n.max.y<r.min.y&&(o=r.max.y-n.min.y)),null!==t||null!==o)return{x:t||0,y:o||0}}},Body:{wrap:function(n,r){var t=e.Bounds.wrap(n.bounds,r);return t&&o.Body.translate(n,t),t}},Composite:{bounds:function(n){for(var r=o.Composite.allBodies(n),t=[],e=0;e<r.length;e+=1){var i=r[e];t.push(i.bounds.min,i.bounds.max)}return o.Bounds.create(t)},wrap:function(n,r){var t=e.Bounds.wrap(e.Composite.bounds(n),r);return t&&o.Composite.translate(n,t),t}}};o.Plugin.register(e),n.exports=e}])},n.exports=o(t("lniP"))}}]);

File diff suppressed because one or more lines are too long

View file

@ -0,0 +1,6 @@
/*!
* matter-demo bundle 0.17.1 by @liabru
* http://brm.io/matter-js/
* License MIT
*/
(this.webpackJsonpMatterDemo=this.webpackJsonpMatterDemo||[]).push([[5],{Dded:function(n,r){function t(n,r,t){t=t||0;var e,u,f,o,i,h,a,l=[0,0];return e=n[1][1]-n[0][1],u=n[0][0]-n[1][0],f=e*n[0][0]+u*n[0][1],o=r[1][1]-r[0][1],i=r[0][0]-r[1][0],h=o*r[0][0]+i*r[0][1],x(a=e*i-o*u,0,t)||(l[0]=(i*f-u*h)/a,l[1]=(e*h-o*f)/a),l}function e(n,r,t,e){var u=r[0]-n[0],f=r[1]-n[1],o=e[0]-t[0],i=e[1]-t[1];if(o*f-i*u==0)return!1;var h=(u*(t[1]-n[1])+f*(n[0]-t[0]))/(o*f-i*u),a=(o*(n[1]-t[1])+i*(t[0]-n[0]))/(i*u-o*f);return h>=0&&h<=1&&a>=0&&a<=1}function u(n,r,t){return(r[0]-n[0])*(t[1]-n[1])-(t[0]-n[0])*(r[1]-n[1])}function f(n,r,t){return u(n,r,t)>0}function o(n,r,t){return u(n,r,t)>=0}function i(n,r,t){return u(n,r,t)<0}function h(n,r,t){return u(n,r,t)<=0}n.exports={decomp:function(n){var r=k(n);return r.length>0?D(n,r):[n]},quickDecomp:function n(r,t,e,u,a,l,c){l=l||100,c=c||0,a=a||25,t=void 0!==t?t:[],e=e||[],u=u||[];var m=[0,0],A=[0,0],M=[0,0],d=0,k=0,D=0,x=0,w=0,y=0,C=0,E=[],L=[],N=r,U=r;if(U.length<3)return t;if(++c>l)return console.warn("quickDecomp: max level ("+l+") reached."),t;for(var V=0;V<r.length;++V)if(p(N,V)){e.push(N[V]),d=k=Number.MAX_VALUE;for(var X=0;X<r.length;++X)f(s(N,V-1),s(N,V),s(N,X))&&h(s(N,V-1),s(N,V),s(N,X-1))&&(M=q(s(N,V-1),s(N,V),s(N,X),s(N,X-1)),i(s(N,V+1),s(N,V),M)&&(D=g(N[V],M))<k&&(k=D,A=M,y=X)),f(s(N,V+1),s(N,V),s(N,X+1))&&h(s(N,V+1),s(N,V),s(N,X))&&(M=q(s(N,V+1),s(N,V),s(N,X),s(N,X+1)),f(s(N,V-1),s(N,V),M)&&(D=g(N[V],M))<d&&(d=D,m=M,w=X));if(y===(w+1)%r.length)M[0]=(A[0]+m[0])/2,M[1]=(A[1]+m[1])/2,u.push(M),V<w?(v(E,N,V,w+1),E.push(M),L.push(M),0!==y&&v(L,N,y,N.length),v(L,N,0,V+1)):(0!==V&&v(E,N,V,N.length),v(E,N,0,w+1),E.push(M),L.push(M),v(L,N,y,V+1));else{if(y>w&&(w+=r.length),x=Number.MAX_VALUE,w<y)return t;for(X=y;X<=w;++X)o(s(N,V-1),s(N,V),s(N,X))&&h(s(N,V+1),s(N,V),s(N,X))&&(D=g(s(N,V),s(N,X)))<x&&b(N,V,X)&&(x=D,C=X%r.length);V<C?(v(E,N,V,C+1),0!==C&&v(L,N,C,U.length),v(L,N,0,V+1)):(0!==V&&v(E,N,V,U.length),v(E,N,0,C+1),v(L,N,C,V+1))}return E.length<L.length?(n(E,t,e,u,a,l,c),n(L,t,e,u,a,l,c)):(n(L,t,e,u,a,l,c),n(E,t,e,u,a,l,c)),t}return t.push(r),t},isSimple:function(n){var r,t=n;for(r=0;r<t.length-1;r++)for(var u=0;u<r-1;u++)if(e(t[r],t[r+1],t[u],t[u+1]))return!1;for(r=1;r<t.length-2;r++)if(e(t[0],t[t.length-1],t[r],t[r+1]))return!1;return!0},removeCollinearPoints:function(n,r){for(var t=0,e=n.length-1;n.length>3&&e>=0;--e)c(s(n,e-1),s(n,e),s(n,e+1),r)&&(n.splice(e%n.length,1),t++);return t},removeDuplicatePoints:function(n,r){for(var t=n.length-1;t>=1;--t)for(var e=n[t],u=t-1;u>=0;--u)w(e,n[u],r)&&n.splice(t,1)},makeCCW:function(n){for(var r=0,t=n,e=1;e<n.length;++e)(t[e][1]<t[r][1]||t[e][1]===t[r][1]&&t[e][0]>t[r][0])&&(r=e);return!f(s(n,r-1),s(n,r),s(n,r+1))&&(function(n){for(var r=[],t=n.length,e=0;e!==t;e++)r.push(n.pop());for(e=0;e!==t;e++)n[e]=r[e]}(n),!0)}};var a=[],l=[];function c(n,r,t,e){if(e){var f=a,o=l;f[0]=r[0]-n[0],f[1]=r[1]-n[1],o[0]=t[0]-r[0],o[1]=t[1]-r[1];var i=f[0]*o[0]+f[1]*o[1],h=Math.sqrt(f[0]*f[0]+f[1]*f[1]),c=Math.sqrt(o[0]*o[0]+o[1]*o[1]);return Math.acos(i/(h*c))<e}return 0===u(n,r,t)}function g(n,r){var t=r[0]-n[0],e=r[1]-n[1];return t*t+e*e}function s(n,r){var t=n.length;return n[r<0?r%t+t:r%t]}function v(n,r,t,e){for(var u=t;u<e;u++)n.push(r[u])}function p(n,r){return i(s(n,r-1),s(n,r),s(n,r+1))}var m=[],A=[];function M(n,r,e){var u,f,i=m,a=A;if(o(s(n,r+1),s(n,r),s(n,e))&&h(s(n,r-1),s(n,r),s(n,e)))return!1;f=g(s(n,r),s(n,e));for(var l=0;l!==n.length;++l)if((l+1)%n.length!==r&&l!==r&&o(s(n,r),s(n,e),s(n,l+1))&&h(s(n,r),s(n,e),s(n,l))&&(i[0]=s(n,r),i[1]=s(n,e),a[0]=s(n,l),a[1]=s(n,l+1),u=t(i,a),g(s(n,r),u)<f))return!1;return!0}function b(n,r,t){for(var u=0;u!==n.length;++u)if(u!==r&&u!==t&&(u+1)%n.length!==r&&(u+1)%n.length!==t&&e(s(n,r),s(n,t),s(n,u),s(n,u+1)))return!1;return!0}function d(n,r,t,e){var u=e||[];if(function(n){n.length=0}(u),r<t)for(var f=r;f<=t;f++)u.push(n[f]);else{for(f=0;f<=t;f++)u.push(n[f]);for(f=r;f<n.length;f++)u.push(n[f])}return u}function k(n){for(var r=[],t=[],e=[],u=[],f=Number.MAX_VALUE,o=0;o<n.length;++o)if(p(n,o))for(var i=0;i<n.length;++i)if(M(n,o,i)){t=k(d(n,o,i,u)),e=k(d(n,i,o,u));for(var h=0;h<e.length;h++)t.push(e[h]);t.length<f&&(r=t,f=t.length,r.push([s(n,o),s(n,i)]))}return r}function D(n,r){if(0===r.length)return[n];if(r instanceof Array&&r.length&&r[0]instanceof Array&&2===r[0].length&&r[0][0]instanceof Array){for(var t=[n],e=0;e<r.length;e++)for(var u=r[e],f=0;f<t.length;f++){var o=D(t[f],u);if(o){t.splice(f,1),t.push(o[0],o[1]);break}}return t}u=r,e=n.indexOf(u[0]),f=n.indexOf(u[1]);return-1!==e&&-1!==f&&[d(n,e,f),d(n,f,e)]}function q(n,r,t,e,u){u=u||0;var f=r[1]-n[1],o=n[0]-r[0],i=f*n[0]+o*n[1],h=e[1]-t[1],a=t[0]-e[0],l=h*t[0]+a*t[1],c=f*a-h*o;return x(c,0,u)?[0,0]:[(a*i-o*l)/c,(f*l-h*i)/c]}function x(n,r,t){return t=t||0,Math.abs(n-r)<=t}function w(n,r,t){return x(n[0],r[0],t)&&x(n[1],r[1],t)}}}]);

View file

@ -1,604 +0,0 @@
!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.decomp=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);throw new Error("Cannot find module '"+o+"'")}var f=n[o]={exports:{}};t[o][0].call(f.exports,function(e){var n=t[o][1][e];return s(n?n:e)},f,f.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(_dereq_,module,exports){
module.exports = {
decomp: polygonDecomp,
quickDecomp: polygonQuickDecomp,
isSimple: polygonIsSimple,
removeCollinearPoints: polygonRemoveCollinearPoints,
makeCCW: polygonMakeCCW
};
/**
* Compute the intersection between two lines.
* @static
* @method lineInt
* @param {Array} l1 Line vector 1
* @param {Array} l2 Line vector 2
* @param {Number} precision Precision to use when checking if the lines are parallel
* @return {Array} The intersection point.
*/
function lineInt(l1,l2,precision){
precision = precision || 0;
var i = [0,0]; // point
var a1, b1, c1, a2, b2, c2, det; // scalars
a1 = l1[1][1] - l1[0][1];
b1 = l1[0][0] - l1[1][0];
c1 = a1 * l1[0][0] + b1 * l1[0][1];
a2 = l2[1][1] - l2[0][1];
b2 = l2[0][0] - l2[1][0];
c2 = a2 * l2[0][0] + b2 * l2[0][1];
det = a1 * b2 - a2*b1;
if (!scalar_eq(det, 0, precision)) { // lines are not parallel
i[0] = (b2 * c1 - b1 * c2) / det;
i[1] = (a1 * c2 - a2 * c1) / det;
}
return i;
}
/**
* Checks if two line segments intersects.
* @method segmentsIntersect
* @param {Array} p1 The start vertex of the first line segment.
* @param {Array} p2 The end vertex of the first line segment.
* @param {Array} q1 The start vertex of the second line segment.
* @param {Array} q2 The end vertex of the second line segment.
* @return {Boolean} True if the two line segments intersect
*/
function lineSegmentsIntersect(p1, p2, q1, q2){
var dx = p2[0] - p1[0];
var dy = p2[1] - p1[1];
var da = q2[0] - q1[0];
var db = q2[1] - q1[1];
// segments are parallel
if((da*dy - db*dx) === 0){
return false;
}
var s = (dx * (q1[1] - p1[1]) + dy * (p1[0] - q1[0])) / (da * dy - db * dx);
var t = (da * (p1[1] - q1[1]) + db * (q1[0] - p1[0])) / (db * dx - da * dy);
return (s>=0 && s<=1 && t>=0 && t<=1);
}
/**
* Get the area of a triangle spanned by the three given points. Note that the area will be negative if the points are not given in counter-clockwise order.
* @static
* @method area
* @param {Array} a
* @param {Array} b
* @param {Array} c
* @return {Number}
*/
function triangleArea(a,b,c){
return (((b[0] - a[0])*(c[1] - a[1]))-((c[0] - a[0])*(b[1] - a[1])));
}
function isLeft(a,b,c){
return triangleArea(a,b,c) > 0;
}
function isLeftOn(a,b,c) {
return triangleArea(a, b, c) >= 0;
}
function isRight(a,b,c) {
return triangleArea(a, b, c) < 0;
}
function isRightOn(a,b,c) {
return triangleArea(a, b, c) <= 0;
}
var tmpPoint1 = [],
tmpPoint2 = [];
/**
* Check if three points are collinear
* @method collinear
* @param {Array} a
* @param {Array} b
* @param {Array} c
* @param {Number} [thresholdAngle=0] Threshold angle to use when comparing the vectors. The function will return true if the angle between the resulting vectors is less than this value. Use zero for max precision.
* @return {Boolean}
*/
function collinear(a,b,c,thresholdAngle) {
if(!thresholdAngle){
return triangleArea(a, b, c) === 0;
} else {
var ab = tmpPoint1,
bc = tmpPoint2;
ab[0] = b[0]-a[0];
ab[1] = b[1]-a[1];
bc[0] = c[0]-b[0];
bc[1] = c[1]-b[1];
var dot = ab[0]*bc[0] + ab[1]*bc[1],
magA = Math.sqrt(ab[0]*ab[0] + ab[1]*ab[1]),
magB = Math.sqrt(bc[0]*bc[0] + bc[1]*bc[1]),
angle = Math.acos(dot/(magA*magB));
return angle < thresholdAngle;
}
}
function sqdist(a,b){
var dx = b[0] - a[0];
var dy = b[1] - a[1];
return dx * dx + dy * dy;
}
/**
* Get a vertex at position i. It does not matter if i is out of bounds, this function will just cycle.
* @method at
* @param {Number} i
* @return {Array}
*/
function polygonAt(polygon, i){
var s = polygon.length;
return polygon[i < 0 ? i % s + s : i % s];
}
/**
* Clear the polygon data
* @method clear
* @return {Array}
*/
function polygonClear(polygon){
polygon.length = 0;
}
/**
* Append points "from" to "to"-1 from an other polygon "poly" onto this one.
* @method append
* @param {Polygon} poly The polygon to get points from.
* @param {Number} from The vertex index in "poly".
* @param {Number} to The end vertex index in "poly". Note that this vertex is NOT included when appending.
* @return {Array}
*/
function polygonAppend(polygon, poly, from, to){
for(var i=from; i<to; i++){
polygon.push(poly[i]);
}
}
/**
* Make sure that the polygon vertices are ordered counter-clockwise.
* @method makeCCW
*/
function polygonMakeCCW(polygon){
var br = 0,
v = polygon;
// find bottom right point
for (var i = 1; i < polygon.length; ++i) {
if (v[i][1] < v[br][1] || (v[i][1] === v[br][1] && v[i][0] > v[br][0])) {
br = i;
}
}
// reverse poly if clockwise
if (!isLeft(polygonAt(polygon, br - 1), polygonAt(polygon, br), polygonAt(polygon, br + 1))) {
polygonReverse(polygon);
}
}
/**
* Reverse the vertices in the polygon
* @method reverse
*/
function polygonReverse(polygon){
var tmp = [];
var N = polygon.length;
for(var i=0; i!==N; i++){
tmp.push(polygon.pop());
}
for(var i=0; i!==N; i++){
polygon[i] = tmp[i];
}
}
/**
* Check if a point in the polygon is a reflex point
* @method isReflex
* @param {Number} i
* @return {Boolean}
*/
function polygonIsReflex(polygon, i){
return isRight(polygonAt(polygon, i - 1), polygonAt(polygon, i), polygonAt(polygon, i + 1));
}
var tmpLine1=[],
tmpLine2=[];
/**
* Check if two vertices in the polygon can see each other
* @method canSee
* @param {Number} a Vertex index 1
* @param {Number} b Vertex index 2
* @return {Boolean}
*/
function polygonCanSee(polygon, a,b) {
var p, dist, l1=tmpLine1, l2=tmpLine2;
if (isLeftOn(polygonAt(polygon, a + 1), polygonAt(polygon, a), polygonAt(polygon, b)) && isRightOn(polygonAt(polygon, a - 1), polygonAt(polygon, a), polygonAt(polygon, b))) {
return false;
}
dist = sqdist(polygonAt(polygon, a), polygonAt(polygon, b));
for (var i = 0; i !== polygon.length; ++i) { // for each edge
if ((i + 1) % polygon.length === a || i === a){ // ignore incident edges
continue;
}
if (isLeftOn(polygonAt(polygon, a), polygonAt(polygon, b), polygonAt(polygon, i + 1)) && isRightOn(polygonAt(polygon, a), polygonAt(polygon, b), polygonAt(polygon, i))) { // if diag intersects an edge
l1[0] = polygonAt(polygon, a);
l1[1] = polygonAt(polygon, b);
l2[0] = polygonAt(polygon, i);
l2[1] = polygonAt(polygon, i + 1);
p = lineInt(l1,l2);
if (sqdist(polygonAt(polygon, a), p) < dist) { // if edge is blocking visibility to b
return false;
}
}
}
return true;
}
/**
* Copy the polygon from vertex i to vertex j.
* @method copy
* @param {Number} i
* @param {Number} j
* @param {Polygon} [targetPoly] Optional target polygon to save in.
* @return {Polygon} The resulting copy.
*/
function polygonCopy(polygon, i,j,targetPoly){
var p = targetPoly || [];
polygonClear(p);
if (i < j) {
// Insert all vertices from i to j
for(var k=i; k<=j; k++){
p.push(polygon[k]);
}
} else {
// Insert vertices 0 to j
for(var k=0; k<=j; k++){
p.push(polygon[k]);
}
// Insert vertices i to end
for(var k=i; k<polygon.length; k++){
p.push(polygon[k]);
}
}
return p;
}
/**
* Decomposes the polygon into convex pieces. Returns a list of edges [[p1,p2],[p2,p3],...] that cuts the polygon.
* Note that this algorithm has complexity O(N^4) and will be very slow for polygons with many vertices.
* @method getCutEdges
* @return {Array}
*/
function polygonGetCutEdges(polygon) {
var min=[], tmp1=[], tmp2=[], tmpPoly = [];
var nDiags = Number.MAX_VALUE;
for (var i = 0; i < polygon.length; ++i) {
if (polygonIsReflex(polygon, i)) {
for (var j = 0; j < polygon.length; ++j) {
if (polygonCanSee(polygon, i, j)) {
tmp1 = polygonGetCutEdges(polygonCopy(polygon, i, j, tmpPoly));
tmp2 = polygonGetCutEdges(polygonCopy(polygon, j, i, tmpPoly));
for(var k=0; k<tmp2.length; k++){
tmp1.push(tmp2[k]);
}
if (tmp1.length < nDiags) {
min = tmp1;
nDiags = tmp1.length;
min.push([polygonAt(polygon, i), polygonAt(polygon, j)]);
}
}
}
}
}
return min;
}
/**
* Decomposes the polygon into one or more convex sub-Polygons.
* @method decomp
* @return {Array} An array or Polygon objects.
*/
function polygonDecomp(polygon){
var edges = polygonGetCutEdges(polygon);
if(edges.length > 0){
return polygonSlice(polygon, edges);
} else {
return [polygon];
}
}
/**
* Slices the polygon given one or more cut edges. If given one, this function will return two polygons (false on failure). If many, an array of polygons.
* @method slice
* @param {Array} cutEdges A list of edges, as returned by .getCutEdges()
* @return {Array}
*/
function polygonSlice(polygon, cutEdges){
if(cutEdges.length === 0){
return [polygon];
}
if(cutEdges instanceof Array && cutEdges.length && cutEdges[0] instanceof Array && cutEdges[0].length===2 && cutEdges[0][0] instanceof Array){
var polys = [polygon];
for(var i=0; i<cutEdges.length; i++){
var cutEdge = cutEdges[i];
// Cut all polys
for(var j=0; j<polys.length; j++){
var poly = polys[j];
var result = polygonSlice(poly, cutEdge);
if(result){
// Found poly! Cut and quit
polys.splice(j,1);
polys.push(result[0],result[1]);
break;
}
}
}
return polys;
} else {
// Was given one edge
var cutEdge = cutEdges;
var i = polygon.indexOf(cutEdge[0]);
var j = polygon.indexOf(cutEdge[1]);
if(i !== -1 && j !== -1){
return [polygonCopy(polygon, i,j),
polygonCopy(polygon, j,i)];
} else {
return false;
}
}
}
/**
* Checks that the line segments of this polygon do not intersect each other.
* @method isSimple
* @param {Array} path An array of vertices e.g. [[0,0],[0,1],...]
* @return {Boolean}
* @todo Should it check all segments with all others?
*/
function polygonIsSimple(polygon){
var path = polygon, i;
// Check
for(i=0; i<path.length-1; i++){
for(var j=0; j<i-1; j++){
if(lineSegmentsIntersect(path[i], path[i+1], path[j], path[j+1] )){
return false;
}
}
}
// Check the segment between the last and the first point to all others
for(i=1; i<path.length-2; i++){
if(lineSegmentsIntersect(path[0], path[path.length-1], path[i], path[i+1] )){
return false;
}
}
return true;
}
function getIntersectionPoint(p1, p2, q1, q2, delta){
delta = delta || 0;
var a1 = p2[1] - p1[1];
var b1 = p1[0] - p2[0];
var c1 = (a1 * p1[0]) + (b1 * p1[1]);
var a2 = q2[1] - q1[1];
var b2 = q1[0] - q2[0];
var c2 = (a2 * q1[0]) + (b2 * q1[1]);
var det = (a1 * b2) - (a2 * b1);
if(!scalar_eq(det,0,delta)){
return [((b2 * c1) - (b1 * c2)) / det, ((a1 * c2) - (a2 * c1)) / det];
} else {
return [0,0];
}
}
/**
* Quickly decompose the Polygon into convex sub-polygons.
* @method quickDecomp
* @param {Array} result
* @param {Array} [reflexVertices]
* @param {Array} [steinerPoints]
* @param {Number} [delta]
* @param {Number} [maxlevel]
* @param {Number} [level]
* @return {Array}
*/
function polygonQuickDecomp(polygon, result,reflexVertices,steinerPoints,delta,maxlevel,level){
maxlevel = maxlevel || 100;
level = level || 0;
delta = delta || 25;
result = typeof(result)!=="undefined" ? result : [];
reflexVertices = reflexVertices || [];
steinerPoints = steinerPoints || [];
var upperInt=[0,0], lowerInt=[0,0], p=[0,0]; // Points
var upperDist=0, lowerDist=0, d=0, closestDist=0; // scalars
var upperIndex=0, lowerIndex=0, closestIndex=0; // Integers
var lowerPoly=[], upperPoly=[]; // polygons
var poly = polygon,
v = polygon;
if(v.length < 3){
return result;
}
level++;
if(level > maxlevel){
console.warn("quickDecomp: max level ("+maxlevel+") reached.");
return result;
}
for (var i = 0; i < polygon.length; ++i) {
if (polygonIsReflex(poly, i)) {
reflexVertices.push(poly[i]);
upperDist = lowerDist = Number.MAX_VALUE;
for (var j = 0; j < polygon.length; ++j) {
if (isLeft(polygonAt(poly, i - 1), polygonAt(poly, i), polygonAt(poly, j)) && isRightOn(polygonAt(poly, i - 1), polygonAt(poly, i), polygonAt(poly, j - 1))) { // if line intersects with an edge
p = getIntersectionPoint(polygonAt(poly, i - 1), polygonAt(poly, i), polygonAt(poly, j), polygonAt(poly, j - 1)); // find the point of intersection
if (isRight(polygonAt(poly, i + 1), polygonAt(poly, i), p)) { // make sure it's inside the poly
d = sqdist(poly[i], p);
if (d < lowerDist) { // keep only the closest intersection
lowerDist = d;
lowerInt = p;
lowerIndex = j;
}
}
}
if (isLeft(polygonAt(poly, i + 1), polygonAt(poly, i), polygonAt(poly, j + 1)) && isRightOn(polygonAt(poly, i + 1), polygonAt(poly, i), polygonAt(poly, j))) {
p = getIntersectionPoint(polygonAt(poly, i + 1), polygonAt(poly, i), polygonAt(poly, j), polygonAt(poly, j + 1));
if (isLeft(polygonAt(poly, i - 1), polygonAt(poly, i), p)) {
d = sqdist(poly[i], p);
if (d < upperDist) {
upperDist = d;
upperInt = p;
upperIndex = j;
}
}
}
}
// if there are no vertices to connect to, choose a point in the middle
if (lowerIndex === (upperIndex + 1) % polygon.length) {
//console.log("Case 1: Vertex("+i+"), lowerIndex("+lowerIndex+"), upperIndex("+upperIndex+"), poly.size("+polygon.length+")");
p[0] = (lowerInt[0] + upperInt[0]) / 2;
p[1] = (lowerInt[1] + upperInt[1]) / 2;
steinerPoints.push(p);
if (i < upperIndex) {
//lowerPoly.insert(lowerPoly.end(), poly.begin() + i, poly.begin() + upperIndex + 1);
polygonAppend(lowerPoly, poly, i, upperIndex+1);
lowerPoly.push(p);
upperPoly.push(p);
if (lowerIndex !== 0){
//upperPoly.insert(upperPoly.end(), poly.begin() + lowerIndex, poly.end());
polygonAppend(upperPoly, poly,lowerIndex,poly.length);
}
//upperPoly.insert(upperPoly.end(), poly.begin(), poly.begin() + i + 1);
polygonAppend(upperPoly, poly,0,i+1);
} else {
if (i !== 0){
//lowerPoly.insert(lowerPoly.end(), poly.begin() + i, poly.end());
polygonAppend(lowerPoly, poly,i,poly.length);
}
//lowerPoly.insert(lowerPoly.end(), poly.begin(), poly.begin() + upperIndex + 1);
polygonAppend(lowerPoly, poly,0,upperIndex+1);
lowerPoly.push(p);
upperPoly.push(p);
//upperPoly.insert(upperPoly.end(), poly.begin() + lowerIndex, poly.begin() + i + 1);
polygonAppend(upperPoly, poly,lowerIndex,i+1);
}
} else {
// connect to the closest point within the triangle
//console.log("Case 2: Vertex("+i+"), closestIndex("+closestIndex+"), poly.size("+polygon.length+")\n");
if (lowerIndex > upperIndex) {
upperIndex += polygon.length;
}
closestDist = Number.MAX_VALUE;
if(upperIndex < lowerIndex){
return result;
}
for (var j = lowerIndex; j <= upperIndex; ++j) {
if (isLeftOn(polygonAt(poly, i - 1), polygonAt(poly, i), polygonAt(poly, j)) && isRightOn(polygonAt(poly, i + 1), polygonAt(poly, i), polygonAt(poly, j))) {
d = sqdist(polygonAt(poly, i), polygonAt(poly, j));
if (d < closestDist) {
closestDist = d;
closestIndex = j % polygon.length;
}
}
}
if (i < closestIndex) {
polygonAppend(lowerPoly, poly,i,closestIndex+1);
if (closestIndex !== 0){
polygonAppend(upperPoly, poly,closestIndex,v.length);
}
polygonAppend(upperPoly, poly,0,i+1);
} else {
if (i !== 0){
polygonAppend(lowerPoly, poly,i,v.length);
}
polygonAppend(lowerPoly, poly,0,closestIndex+1);
polygonAppend(upperPoly, poly,closestIndex,i+1);
}
}
// solve smallest poly first
if (lowerPoly.length < upperPoly.length) {
polygonQuickDecomp(lowerPoly,result,reflexVertices,steinerPoints,delta,maxlevel,level);
polygonQuickDecomp(upperPoly,result,reflexVertices,steinerPoints,delta,maxlevel,level);
} else {
polygonQuickDecomp(upperPoly,result,reflexVertices,steinerPoints,delta,maxlevel,level);
polygonQuickDecomp(lowerPoly,result,reflexVertices,steinerPoints,delta,maxlevel,level);
}
return result;
}
}
result.push(polygon);
return result;
}
/**
* Remove collinear points in the polygon.
* @method removeCollinearPoints
* @param {Number} [precision] The threshold angle to use when determining whether two edges are collinear. Use zero for finest precision.
* @return {Number} The number of points removed
*/
function polygonRemoveCollinearPoints(polygon, precision){
var num = 0;
for(var i=polygon.length-1; polygon.length>3 && i>=0; --i){
if(collinear(polygonAt(polygon, i-1),polygonAt(polygon, i),polygonAt(polygon, i+1),precision)){
// Remove the middle point
polygon.splice(i%polygon.length,1);
num++;
}
}
return num;
}
/**
* Check if two scalars are equal
* @static
* @method eq
* @param {Number} a
* @param {Number} b
* @param {Number} [precision]
* @return {Boolean}
*/
function scalar_eq(a,b,precision){
precision = precision || 0;
return Math.abs(a-b) < precision;
}
},{}]},{},[1])
(1)
});

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

View file

@ -1,275 +0,0 @@
/*!
* matter-wrap 0.2.0 by Liam Brummitt 2017-07-04
* https://github.com/liabru/matter-wrap
* License MIT
*/
(function webpackUniversalModuleDefinition(root, factory) {
if(typeof exports === 'object' && typeof module === 'object')
module.exports = factory(require("matter-js"));
else if(typeof define === 'function' && define.amd)
define(["matter-js"], factory);
else if(typeof exports === 'object')
exports["MatterWrap"] = factory(require("matter-js"));
else
root["MatterWrap"] = factory(root["Matter"]);
})(this, function(__WEBPACK_EXTERNAL_MODULE_0__) {
return /******/ (function(modules) { // webpackBootstrap
/******/ // The module cache
/******/ var installedModules = {};
/******/ // The require function
/******/ function __webpack_require__(moduleId) {
/******/ // Check if module is in cache
/******/ if(installedModules[moduleId])
/******/ return installedModules[moduleId].exports;
/******/ // Create a new module (and put it into the cache)
/******/ var module = installedModules[moduleId] = {
/******/ i: moduleId,
/******/ l: false,
/******/ exports: {}
/******/ };
/******/ // Execute the module function
/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/ // Flag the module as loaded
/******/ module.l = true;
/******/ // Return the exports of the module
/******/ return module.exports;
/******/ }
/******/ // expose the modules object (__webpack_modules__)
/******/ __webpack_require__.m = modules;
/******/ // expose the module cache
/******/ __webpack_require__.c = installedModules;
/******/ // identity function for calling harmony imports with the correct context
/******/ __webpack_require__.i = function(value) { return value; };
/******/ // define getter function for harmony exports
/******/ __webpack_require__.d = function(exports, name, getter) {
/******/ if(!__webpack_require__.o(exports, name)) {
/******/ Object.defineProperty(exports, name, {
/******/ configurable: false,
/******/ enumerable: true,
/******/ get: getter
/******/ });
/******/ }
/******/ };
/******/ // getDefaultExport function for compatibility with non-harmony modules
/******/ __webpack_require__.n = function(module) {
/******/ var getter = module && module.__esModule ?
/******/ function getDefault() { return module['default']; } :
/******/ function getModuleExports() { return module; };
/******/ __webpack_require__.d(getter, 'a', getter);
/******/ return getter;
/******/ };
/******/ // Object.prototype.hasOwnProperty.call
/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
/******/ // __webpack_public_path__
/******/ __webpack_require__.p = "/libs";
/******/ // Load entry module and return exports
/******/ return __webpack_require__(__webpack_require__.s = 1);
/******/ })
/************************************************************************/
/******/ ([
/* 0 */
/***/ (function(module, exports) {
module.exports = __WEBPACK_EXTERNAL_MODULE_0__;
/***/ }),
/* 1 */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
var Matter = __webpack_require__(0);
/**
* A coordinate wrapping plugin for matter.js.
* See the readme for usage and examples.
* @module MatterWrap
*/
var MatterWrap = {
// plugin meta
name: 'matter-wrap', // PLUGIN_NAME
version: '0.1.3', // PLUGIN_VERSION
for: 'matter-js@^0.12.0',
// installs the plugin where `base` is `Matter`
// you should not need to call this directly.
install: function install(base) {
base.after('Engine.update', function () {
MatterWrap.Engine.update(this);
});
},
Engine: {
/**
* Updates the engine by wrapping bodies and composites inside `engine.world`.
* This is called automatically by the plugin.
* @function MatterWrap.Engine.update
* @param {Matter.Engine} engine The engine to update.
* @returns {void} No return value.
*/
update: function update(engine) {
var world = engine.world,
bodies = Matter.Composite.allBodies(world),
composites = Matter.Composite.allComposites(world);
for (var i = 0; i < bodies.length; i += 1) {
var body = bodies[i];
if (body.plugin.wrap) {
MatterWrap.Body.wrap(body, body.plugin.wrap);
}
}
for (i = 0; i < composites.length; i += 1) {
var composite = composites[i];
if (composite.plugin.wrap) {
MatterWrap.Composite.wrap(composite, composite.plugin.wrap);
}
}
}
},
Bounds: {
/**
* Returns a translation vector that wraps the `objectBounds` inside the `bounds`.
* @function MatterWrap.Bounds.wrap
* @param {Matter.Bounds} objectBounds The bounds of the object to wrap inside the bounds.
* @param {Matter.Bounds} bounds The bounds to wrap the body inside.
* @returns {?Matter.Vector} A translation vector (only if wrapping is required).
*/
wrap: function wrap(objectBounds, bounds) {
var x = null,
y = null;
if (typeof bounds.min.x !== 'undefined' && typeof bounds.max.x !== 'undefined') {
if (objectBounds.min.x > bounds.max.x) {
x = bounds.min.x - objectBounds.max.x;
} else if (objectBounds.max.x < bounds.min.x) {
x = bounds.max.x - objectBounds.min.x;
}
}
if (typeof bounds.min.y !== 'undefined' && typeof bounds.max.y !== 'undefined') {
if (objectBounds.min.y > bounds.max.y) {
y = bounds.min.y - objectBounds.max.y;
} else if (objectBounds.max.y < bounds.min.y) {
y = bounds.max.y - objectBounds.min.y;
}
}
if (x !== null || y !== null) {
return {
x: x || 0,
y: y || 0
};
}
}
},
Body: {
/**
* Wraps the `body` position such that it always stays within the given bounds.
* Upon crossing a boundary the body will appear on the opposite side of the bounds,
* while maintaining its velocity.
* This is called automatically by the plugin.
* @function MatterWrap.Body.wrap
* @param {Matter.Body} body The body to wrap.
* @param {Matter.Bounds} bounds The bounds to wrap the body inside.
* @returns {?Matter.Vector} The translation vector that was applied (only if wrapping was required).
*/
wrap: function wrap(body, bounds) {
var translation = MatterWrap.Bounds.wrap(body.bounds, bounds);
if (translation) {
Matter.Body.translate(body, translation);
}
return translation;
}
},
Composite: {
/**
* Returns the union of the bounds of all of the composite's bodies
* (not accounting for constraints).
* @function MatterWrap.Composite.bounds
* @param {Matter.Composite} composite The composite.
* @returns {Matter.Bounds} The composite bounds.
*/
bounds: function bounds(composite) {
var bodies = Matter.Composite.allBodies(composite),
vertices = [];
for (var i = 0; i < bodies.length; i += 1) {
var body = bodies[i];
vertices.push(body.bounds.min, body.bounds.max);
}
return Matter.Bounds.create(vertices);
},
/**
* Wraps the `composite` position such that it always stays within the given bounds.
* Upon crossing a boundary the composite will appear on the opposite side of the bounds,
* while maintaining its velocity.
* This is called automatically by the plugin.
* @function MatterWrap.Composite.wrap
* @param {Matter.Composite} composite The composite to wrap.
* @param {Matter.Bounds} bounds The bounds to wrap the composite inside.
* @returns {?Matter.Vector} The translation vector that was applied (only if wrapping was required).
*/
wrap: function wrap(composite, bounds) {
var translation = MatterWrap.Bounds.wrap(MatterWrap.Composite.bounds(composite), bounds);
if (translation) {
Matter.Composite.translate(composite, translation);
}
return translation;
}
}
};
Matter.Plugin.register(MatterWrap);
module.exports = MatterWrap;
/**
* @namespace Matter.Body
* @see http://brm.io/matter-js/docs/classes/Body.html
*/
/**
* This plugin adds a new property `body.plugin.wrap` to instances of `Matter.Body`.
* This is a `Matter.Bounds` instance that specifies the wrapping region.
* @property {Matter.Bounds} body.plugin.wrap
* @memberof Matter.Body
*/
/**
* This plugin adds a new property `composite.plugin.wrap` to instances of `Matter.Composite`.
* This is a `Matter.Bounds` instance that specifies the wrapping region.
* @property {Matter.Bounds} composite.plugin.wrap
* @memberof Matter.Composite
*/
/***/ })
/******/ ]);
});

View file

@ -1,849 +0,0 @@
// SVGPathSeg API polyfill
// https://github.com/progers/pathseg
//
// This is a drop-in replacement for the SVGPathSeg and SVGPathSegList APIs that were removed from
// SVG2 (https://lists.w3.org/Archives/Public/www-svg/2015Jun/0044.html), including the latest spec
// changes which were implemented in Firefox 43 and Chrome 46.
(function() { "use strict";
if (!("SVGPathSeg" in window)) {
// Spec: http://www.w3.org/TR/SVG11/single-page.html#paths-InterfaceSVGPathSeg
window.SVGPathSeg = function(type, typeAsLetter, owningPathSegList) {
this.pathSegType = type;
this.pathSegTypeAsLetter = typeAsLetter;
this._owningPathSegList = owningPathSegList;
}
window.SVGPathSeg.prototype.classname = "SVGPathSeg";
window.SVGPathSeg.PATHSEG_UNKNOWN = 0;
window.SVGPathSeg.PATHSEG_CLOSEPATH = 1;
window.SVGPathSeg.PATHSEG_MOVETO_ABS = 2;
window.SVGPathSeg.PATHSEG_MOVETO_REL = 3;
window.SVGPathSeg.PATHSEG_LINETO_ABS = 4;
window.SVGPathSeg.PATHSEG_LINETO_REL = 5;
window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_ABS = 6;
window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_REL = 7;
window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_ABS = 8;
window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_REL = 9;
window.SVGPathSeg.PATHSEG_ARC_ABS = 10;
window.SVGPathSeg.PATHSEG_ARC_REL = 11;
window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_ABS = 12;
window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_REL = 13;
window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_ABS = 14;
window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_REL = 15;
window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_ABS = 16;
window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_REL = 17;
window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_ABS = 18;
window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_REL = 19;
// Notify owning PathSegList on any changes so they can be synchronized back to the path element.
window.SVGPathSeg.prototype._segmentChanged = function() {
if (this._owningPathSegList)
this._owningPathSegList.segmentChanged(this);
}
window.SVGPathSegClosePath = function(owningPathSegList) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CLOSEPATH, "z", owningPathSegList);
}
window.SVGPathSegClosePath.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegClosePath.prototype.toString = function() { return "[object SVGPathSegClosePath]"; }
window.SVGPathSegClosePath.prototype._asPathString = function() { return this.pathSegTypeAsLetter; }
window.SVGPathSegClosePath.prototype.clone = function() { return new window.SVGPathSegClosePath(undefined); }
window.SVGPathSegMovetoAbs = function(owningPathSegList, x, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_MOVETO_ABS, "M", owningPathSegList);
this._x = x;
this._y = y;
}
window.SVGPathSegMovetoAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegMovetoAbs.prototype.toString = function() { return "[object SVGPathSegMovetoAbs]"; }
window.SVGPathSegMovetoAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x + " " + this._y; }
window.SVGPathSegMovetoAbs.prototype.clone = function() { return new window.SVGPathSegMovetoAbs(undefined, this._x, this._y); }
Object.defineProperty(window.SVGPathSegMovetoAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegMovetoAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegMovetoRel = function(owningPathSegList, x, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_MOVETO_REL, "m", owningPathSegList);
this._x = x;
this._y = y;
}
window.SVGPathSegMovetoRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegMovetoRel.prototype.toString = function() { return "[object SVGPathSegMovetoRel]"; }
window.SVGPathSegMovetoRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x + " " + this._y; }
window.SVGPathSegMovetoRel.prototype.clone = function() { return new window.SVGPathSegMovetoRel(undefined, this._x, this._y); }
Object.defineProperty(window.SVGPathSegMovetoRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegMovetoRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegLinetoAbs = function(owningPathSegList, x, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_LINETO_ABS, "L", owningPathSegList);
this._x = x;
this._y = y;
}
window.SVGPathSegLinetoAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegLinetoAbs.prototype.toString = function() { return "[object SVGPathSegLinetoAbs]"; }
window.SVGPathSegLinetoAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x + " " + this._y; }
window.SVGPathSegLinetoAbs.prototype.clone = function() { return new window.SVGPathSegLinetoAbs(undefined, this._x, this._y); }
Object.defineProperty(window.SVGPathSegLinetoAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegLinetoAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegLinetoRel = function(owningPathSegList, x, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_LINETO_REL, "l", owningPathSegList);
this._x = x;
this._y = y;
}
window.SVGPathSegLinetoRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegLinetoRel.prototype.toString = function() { return "[object SVGPathSegLinetoRel]"; }
window.SVGPathSegLinetoRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x + " " + this._y; }
window.SVGPathSegLinetoRel.prototype.clone = function() { return new window.SVGPathSegLinetoRel(undefined, this._x, this._y); }
Object.defineProperty(window.SVGPathSegLinetoRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegLinetoRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoCubicAbs = function(owningPathSegList, x, y, x1, y1, x2, y2) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_ABS, "C", owningPathSegList);
this._x = x;
this._y = y;
this._x1 = x1;
this._y1 = y1;
this._x2 = x2;
this._y2 = y2;
}
window.SVGPathSegCurvetoCubicAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoCubicAbs.prototype.toString = function() { return "[object SVGPathSegCurvetoCubicAbs]"; }
window.SVGPathSegCurvetoCubicAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x1 + " " + this._y1 + " " + this._x2 + " " + this._y2 + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoCubicAbs.prototype.clone = function() { return new window.SVGPathSegCurvetoCubicAbs(undefined, this._x, this._y, this._x1, this._y1, this._x2, this._y2); }
Object.defineProperty(window.SVGPathSegCurvetoCubicAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicAbs.prototype, "x1", { get: function() { return this._x1; }, set: function(x1) { this._x1 = x1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicAbs.prototype, "y1", { get: function() { return this._y1; }, set: function(y1) { this._y1 = y1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicAbs.prototype, "x2", { get: function() { return this._x2; }, set: function(x2) { this._x2 = x2; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicAbs.prototype, "y2", { get: function() { return this._y2; }, set: function(y2) { this._y2 = y2; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoCubicRel = function(owningPathSegList, x, y, x1, y1, x2, y2) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_REL, "c", owningPathSegList);
this._x = x;
this._y = y;
this._x1 = x1;
this._y1 = y1;
this._x2 = x2;
this._y2 = y2;
}
window.SVGPathSegCurvetoCubicRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoCubicRel.prototype.toString = function() { return "[object SVGPathSegCurvetoCubicRel]"; }
window.SVGPathSegCurvetoCubicRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x1 + " " + this._y1 + " " + this._x2 + " " + this._y2 + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoCubicRel.prototype.clone = function() { return new window.SVGPathSegCurvetoCubicRel(undefined, this._x, this._y, this._x1, this._y1, this._x2, this._y2); }
Object.defineProperty(window.SVGPathSegCurvetoCubicRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicRel.prototype, "x1", { get: function() { return this._x1; }, set: function(x1) { this._x1 = x1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicRel.prototype, "y1", { get: function() { return this._y1; }, set: function(y1) { this._y1 = y1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicRel.prototype, "x2", { get: function() { return this._x2; }, set: function(x2) { this._x2 = x2; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicRel.prototype, "y2", { get: function() { return this._y2; }, set: function(y2) { this._y2 = y2; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoQuadraticAbs = function(owningPathSegList, x, y, x1, y1) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_ABS, "Q", owningPathSegList);
this._x = x;
this._y = y;
this._x1 = x1;
this._y1 = y1;
}
window.SVGPathSegCurvetoQuadraticAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoQuadraticAbs.prototype.toString = function() { return "[object SVGPathSegCurvetoQuadraticAbs]"; }
window.SVGPathSegCurvetoQuadraticAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x1 + " " + this._y1 + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoQuadraticAbs.prototype.clone = function() { return new window.SVGPathSegCurvetoQuadraticAbs(undefined, this._x, this._y, this._x1, this._y1); }
Object.defineProperty(window.SVGPathSegCurvetoQuadraticAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticAbs.prototype, "x1", { get: function() { return this._x1; }, set: function(x1) { this._x1 = x1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticAbs.prototype, "y1", { get: function() { return this._y1; }, set: function(y1) { this._y1 = y1; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoQuadraticRel = function(owningPathSegList, x, y, x1, y1) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_REL, "q", owningPathSegList);
this._x = x;
this._y = y;
this._x1 = x1;
this._y1 = y1;
}
window.SVGPathSegCurvetoQuadraticRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoQuadraticRel.prototype.toString = function() { return "[object SVGPathSegCurvetoQuadraticRel]"; }
window.SVGPathSegCurvetoQuadraticRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x1 + " " + this._y1 + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoQuadraticRel.prototype.clone = function() { return new window.SVGPathSegCurvetoQuadraticRel(undefined, this._x, this._y, this._x1, this._y1); }
Object.defineProperty(window.SVGPathSegCurvetoQuadraticRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticRel.prototype, "x1", { get: function() { return this._x1; }, set: function(x1) { this._x1 = x1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticRel.prototype, "y1", { get: function() { return this._y1; }, set: function(y1) { this._y1 = y1; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegArcAbs = function(owningPathSegList, x, y, r1, r2, angle, largeArcFlag, sweepFlag) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_ARC_ABS, "A", owningPathSegList);
this._x = x;
this._y = y;
this._r1 = r1;
this._r2 = r2;
this._angle = angle;
this._largeArcFlag = largeArcFlag;
this._sweepFlag = sweepFlag;
}
window.SVGPathSegArcAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegArcAbs.prototype.toString = function() { return "[object SVGPathSegArcAbs]"; }
window.SVGPathSegArcAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._r1 + " " + this._r2 + " " + this._angle + " " + (this._largeArcFlag ? "1" : "0") + " " + (this._sweepFlag ? "1" : "0") + " " + this._x + " " + this._y; }
window.SVGPathSegArcAbs.prototype.clone = function() { return new window.SVGPathSegArcAbs(undefined, this._x, this._y, this._r1, this._r2, this._angle, this._largeArcFlag, this._sweepFlag); }
Object.defineProperty(window.SVGPathSegArcAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcAbs.prototype, "r1", { get: function() { return this._r1; }, set: function(r1) { this._r1 = r1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcAbs.prototype, "r2", { get: function() { return this._r2; }, set: function(r2) { this._r2 = r2; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcAbs.prototype, "angle", { get: function() { return this._angle; }, set: function(angle) { this._angle = angle; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcAbs.prototype, "largeArcFlag", { get: function() { return this._largeArcFlag; }, set: function(largeArcFlag) { this._largeArcFlag = largeArcFlag; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcAbs.prototype, "sweepFlag", { get: function() { return this._sweepFlag; }, set: function(sweepFlag) { this._sweepFlag = sweepFlag; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegArcRel = function(owningPathSegList, x, y, r1, r2, angle, largeArcFlag, sweepFlag) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_ARC_REL, "a", owningPathSegList);
this._x = x;
this._y = y;
this._r1 = r1;
this._r2 = r2;
this._angle = angle;
this._largeArcFlag = largeArcFlag;
this._sweepFlag = sweepFlag;
}
window.SVGPathSegArcRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegArcRel.prototype.toString = function() { return "[object SVGPathSegArcRel]"; }
window.SVGPathSegArcRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._r1 + " " + this._r2 + " " + this._angle + " " + (this._largeArcFlag ? "1" : "0") + " " + (this._sweepFlag ? "1" : "0") + " " + this._x + " " + this._y; }
window.SVGPathSegArcRel.prototype.clone = function() { return new window.SVGPathSegArcRel(undefined, this._x, this._y, this._r1, this._r2, this._angle, this._largeArcFlag, this._sweepFlag); }
Object.defineProperty(window.SVGPathSegArcRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcRel.prototype, "r1", { get: function() { return this._r1; }, set: function(r1) { this._r1 = r1; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcRel.prototype, "r2", { get: function() { return this._r2; }, set: function(r2) { this._r2 = r2; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcRel.prototype, "angle", { get: function() { return this._angle; }, set: function(angle) { this._angle = angle; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcRel.prototype, "largeArcFlag", { get: function() { return this._largeArcFlag; }, set: function(largeArcFlag) { this._largeArcFlag = largeArcFlag; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegArcRel.prototype, "sweepFlag", { get: function() { return this._sweepFlag; }, set: function(sweepFlag) { this._sweepFlag = sweepFlag; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegLinetoHorizontalAbs = function(owningPathSegList, x) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_ABS, "H", owningPathSegList);
this._x = x;
}
window.SVGPathSegLinetoHorizontalAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegLinetoHorizontalAbs.prototype.toString = function() { return "[object SVGPathSegLinetoHorizontalAbs]"; }
window.SVGPathSegLinetoHorizontalAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x; }
window.SVGPathSegLinetoHorizontalAbs.prototype.clone = function() { return new window.SVGPathSegLinetoHorizontalAbs(undefined, this._x); }
Object.defineProperty(window.SVGPathSegLinetoHorizontalAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegLinetoHorizontalRel = function(owningPathSegList, x) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_REL, "h", owningPathSegList);
this._x = x;
}
window.SVGPathSegLinetoHorizontalRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegLinetoHorizontalRel.prototype.toString = function() { return "[object SVGPathSegLinetoHorizontalRel]"; }
window.SVGPathSegLinetoHorizontalRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x; }
window.SVGPathSegLinetoHorizontalRel.prototype.clone = function() { return new window.SVGPathSegLinetoHorizontalRel(undefined, this._x); }
Object.defineProperty(window.SVGPathSegLinetoHorizontalRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegLinetoVerticalAbs = function(owningPathSegList, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_ABS, "V", owningPathSegList);
this._y = y;
}
window.SVGPathSegLinetoVerticalAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegLinetoVerticalAbs.prototype.toString = function() { return "[object SVGPathSegLinetoVerticalAbs]"; }
window.SVGPathSegLinetoVerticalAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._y; }
window.SVGPathSegLinetoVerticalAbs.prototype.clone = function() { return new window.SVGPathSegLinetoVerticalAbs(undefined, this._y); }
Object.defineProperty(window.SVGPathSegLinetoVerticalAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegLinetoVerticalRel = function(owningPathSegList, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_REL, "v", owningPathSegList);
this._y = y;
}
window.SVGPathSegLinetoVerticalRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegLinetoVerticalRel.prototype.toString = function() { return "[object SVGPathSegLinetoVerticalRel]"; }
window.SVGPathSegLinetoVerticalRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._y; }
window.SVGPathSegLinetoVerticalRel.prototype.clone = function() { return new window.SVGPathSegLinetoVerticalRel(undefined, this._y); }
Object.defineProperty(window.SVGPathSegLinetoVerticalRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoCubicSmoothAbs = function(owningPathSegList, x, y, x2, y2) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_ABS, "S", owningPathSegList);
this._x = x;
this._y = y;
this._x2 = x2;
this._y2 = y2;
}
window.SVGPathSegCurvetoCubicSmoothAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoCubicSmoothAbs.prototype.toString = function() { return "[object SVGPathSegCurvetoCubicSmoothAbs]"; }
window.SVGPathSegCurvetoCubicSmoothAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x2 + " " + this._y2 + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoCubicSmoothAbs.prototype.clone = function() { return new window.SVGPathSegCurvetoCubicSmoothAbs(undefined, this._x, this._y, this._x2, this._y2); }
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothAbs.prototype, "x2", { get: function() { return this._x2; }, set: function(x2) { this._x2 = x2; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothAbs.prototype, "y2", { get: function() { return this._y2; }, set: function(y2) { this._y2 = y2; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoCubicSmoothRel = function(owningPathSegList, x, y, x2, y2) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_REL, "s", owningPathSegList);
this._x = x;
this._y = y;
this._x2 = x2;
this._y2 = y2;
}
window.SVGPathSegCurvetoCubicSmoothRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoCubicSmoothRel.prototype.toString = function() { return "[object SVGPathSegCurvetoCubicSmoothRel]"; }
window.SVGPathSegCurvetoCubicSmoothRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x2 + " " + this._y2 + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoCubicSmoothRel.prototype.clone = function() { return new window.SVGPathSegCurvetoCubicSmoothRel(undefined, this._x, this._y, this._x2, this._y2); }
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothRel.prototype, "x2", { get: function() { return this._x2; }, set: function(x2) { this._x2 = x2; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoCubicSmoothRel.prototype, "y2", { get: function() { return this._y2; }, set: function(y2) { this._y2 = y2; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoQuadraticSmoothAbs = function(owningPathSegList, x, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_ABS, "T", owningPathSegList);
this._x = x;
this._y = y;
}
window.SVGPathSegCurvetoQuadraticSmoothAbs.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoQuadraticSmoothAbs.prototype.toString = function() { return "[object SVGPathSegCurvetoQuadraticSmoothAbs]"; }
window.SVGPathSegCurvetoQuadraticSmoothAbs.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoQuadraticSmoothAbs.prototype.clone = function() { return new window.SVGPathSegCurvetoQuadraticSmoothAbs(undefined, this._x, this._y); }
Object.defineProperty(window.SVGPathSegCurvetoQuadraticSmoothAbs.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticSmoothAbs.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
window.SVGPathSegCurvetoQuadraticSmoothRel = function(owningPathSegList, x, y) {
window.SVGPathSeg.call(this, window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_REL, "t", owningPathSegList);
this._x = x;
this._y = y;
}
window.SVGPathSegCurvetoQuadraticSmoothRel.prototype = Object.create(window.SVGPathSeg.prototype);
window.SVGPathSegCurvetoQuadraticSmoothRel.prototype.toString = function() { return "[object SVGPathSegCurvetoQuadraticSmoothRel]"; }
window.SVGPathSegCurvetoQuadraticSmoothRel.prototype._asPathString = function() { return this.pathSegTypeAsLetter + " " + this._x + " " + this._y; }
window.SVGPathSegCurvetoQuadraticSmoothRel.prototype.clone = function() { return new window.SVGPathSegCurvetoQuadraticSmoothRel(undefined, this._x, this._y); }
Object.defineProperty(window.SVGPathSegCurvetoQuadraticSmoothRel.prototype, "x", { get: function() { return this._x; }, set: function(x) { this._x = x; this._segmentChanged(); }, enumerable: true });
Object.defineProperty(window.SVGPathSegCurvetoQuadraticSmoothRel.prototype, "y", { get: function() { return this._y; }, set: function(y) { this._y = y; this._segmentChanged(); }, enumerable: true });
// Add createSVGPathSeg* functions to window.SVGPathElement.
// Spec: http://www.w3.org/TR/SVG11/single-page.html#paths-Interfacewindow.SVGPathElement.
window.SVGPathElement.prototype.createSVGPathSegClosePath = function() { return new window.SVGPathSegClosePath(undefined); }
window.SVGPathElement.prototype.createSVGPathSegMovetoAbs = function(x, y) { return new window.SVGPathSegMovetoAbs(undefined, x, y); }
window.SVGPathElement.prototype.createSVGPathSegMovetoRel = function(x, y) { return new window.SVGPathSegMovetoRel(undefined, x, y); }
window.SVGPathElement.prototype.createSVGPathSegLinetoAbs = function(x, y) { return new window.SVGPathSegLinetoAbs(undefined, x, y); }
window.SVGPathElement.prototype.createSVGPathSegLinetoRel = function(x, y) { return new window.SVGPathSegLinetoRel(undefined, x, y); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoCubicAbs = function(x, y, x1, y1, x2, y2) { return new window.SVGPathSegCurvetoCubicAbs(undefined, x, y, x1, y1, x2, y2); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoCubicRel = function(x, y, x1, y1, x2, y2) { return new window.SVGPathSegCurvetoCubicRel(undefined, x, y, x1, y1, x2, y2); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoQuadraticAbs = function(x, y, x1, y1) { return new window.SVGPathSegCurvetoQuadraticAbs(undefined, x, y, x1, y1); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoQuadraticRel = function(x, y, x1, y1) { return new window.SVGPathSegCurvetoQuadraticRel(undefined, x, y, x1, y1); }
window.SVGPathElement.prototype.createSVGPathSegArcAbs = function(x, y, r1, r2, angle, largeArcFlag, sweepFlag) { return new window.SVGPathSegArcAbs(undefined, x, y, r1, r2, angle, largeArcFlag, sweepFlag); }
window.SVGPathElement.prototype.createSVGPathSegArcRel = function(x, y, r1, r2, angle, largeArcFlag, sweepFlag) { return new window.SVGPathSegArcRel(undefined, x, y, r1, r2, angle, largeArcFlag, sweepFlag); }
window.SVGPathElement.prototype.createSVGPathSegLinetoHorizontalAbs = function(x) { return new window.SVGPathSegLinetoHorizontalAbs(undefined, x); }
window.SVGPathElement.prototype.createSVGPathSegLinetoHorizontalRel = function(x) { return new window.SVGPathSegLinetoHorizontalRel(undefined, x); }
window.SVGPathElement.prototype.createSVGPathSegLinetoVerticalAbs = function(y) { return new window.SVGPathSegLinetoVerticalAbs(undefined, y); }
window.SVGPathElement.prototype.createSVGPathSegLinetoVerticalRel = function(y) { return new window.SVGPathSegLinetoVerticalRel(undefined, y); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoCubicSmoothAbs = function(x, y, x2, y2) { return new window.SVGPathSegCurvetoCubicSmoothAbs(undefined, x, y, x2, y2); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoCubicSmoothRel = function(x, y, x2, y2) { return new window.SVGPathSegCurvetoCubicSmoothRel(undefined, x, y, x2, y2); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoQuadraticSmoothAbs = function(x, y) { return new window.SVGPathSegCurvetoQuadraticSmoothAbs(undefined, x, y); }
window.SVGPathElement.prototype.createSVGPathSegCurvetoQuadraticSmoothRel = function(x, y) { return new window.SVGPathSegCurvetoQuadraticSmoothRel(undefined, x, y); }
if (!("getPathSegAtLength" in window.SVGPathElement.prototype)) {
// Add getPathSegAtLength to SVGPathElement.
// Spec: https://www.w3.org/TR/SVG11/single-page.html#paths-__svg__SVGPathElement__getPathSegAtLength
// This polyfill requires SVGPathElement.getTotalLength to implement the distance-along-a-path algorithm.
window.SVGPathElement.prototype.getPathSegAtLength = function(distance) {
if (distance === undefined || !isFinite(distance))
throw "Invalid arguments.";
var measurementElement = document.createElementNS("http://www.w3.org/2000/svg", "path");
measurementElement.setAttribute("d", this.getAttribute("d"));
var lastPathSegment = measurementElement.pathSegList.numberOfItems - 1;
// If the path is empty, return 0.
if (lastPathSegment <= 0)
return 0;
do {
measurementElement.pathSegList.removeItem(lastPathSegment);
if (distance > measurementElement.getTotalLength())
break;
lastPathSegment--;
} while (lastPathSegment > 0);
return lastPathSegment;
}
}
}
// Checking for SVGPathSegList in window checks for the case of an implementation without the
// SVGPathSegList API.
// The second check for appendItem is specific to Firefox 59+ which removed only parts of the
// SVGPathSegList API (e.g., appendItem). In this case we need to re-implement the entire API
// so the polyfill data (i.e., _list) is used throughout.
if (!("SVGPathSegList" in window) || !("appendItem" in window.SVGPathSegList.prototype)) {
// Spec: http://www.w3.org/TR/SVG11/single-page.html#paths-InterfaceSVGPathSegList
window.SVGPathSegList = function(pathElement) {
this._pathElement = pathElement;
this._list = this._parsePath(this._pathElement.getAttribute("d"));
// Use a MutationObserver to catch changes to the path's "d" attribute.
this._mutationObserverConfig = { "attributes": true, "attributeFilter": ["d"] };
this._pathElementMutationObserver = new MutationObserver(this._updateListFromPathMutations.bind(this));
this._pathElementMutationObserver.observe(this._pathElement, this._mutationObserverConfig);
}
window.SVGPathSegList.prototype.classname = "SVGPathSegList";
Object.defineProperty(window.SVGPathSegList.prototype, "numberOfItems", {
get: function() {
this._checkPathSynchronizedToList();
return this._list.length;
},
enumerable: true
});
// Add the pathSegList accessors to window.SVGPathElement.
// Spec: http://www.w3.org/TR/SVG11/single-page.html#paths-InterfaceSVGAnimatedPathData
Object.defineProperty(window.SVGPathElement.prototype, "pathSegList", {
get: function() {
if (!this._pathSegList)
this._pathSegList = new window.SVGPathSegList(this);
return this._pathSegList;
},
enumerable: true
});
// FIXME: The following are not implemented and simply return window.SVGPathElement.pathSegList.
Object.defineProperty(window.SVGPathElement.prototype, "normalizedPathSegList", { get: function() { return this.pathSegList; }, enumerable: true });
Object.defineProperty(window.SVGPathElement.prototype, "animatedPathSegList", { get: function() { return this.pathSegList; }, enumerable: true });
Object.defineProperty(window.SVGPathElement.prototype, "animatedNormalizedPathSegList", { get: function() { return this.pathSegList; }, enumerable: true });
// Process any pending mutations to the path element and update the list as needed.
// This should be the first call of all public functions and is needed because
// MutationObservers are not synchronous so we can have pending asynchronous mutations.
window.SVGPathSegList.prototype._checkPathSynchronizedToList = function() {
this._updateListFromPathMutations(this._pathElementMutationObserver.takeRecords());
}
window.SVGPathSegList.prototype._updateListFromPathMutations = function(mutationRecords) {
if (!this._pathElement)
return;
var hasPathMutations = false;
mutationRecords.forEach(function(record) {
if (record.attributeName == "d")
hasPathMutations = true;
});
if (hasPathMutations)
this._list = this._parsePath(this._pathElement.getAttribute("d"));
}
// Serialize the list and update the path's 'd' attribute.
window.SVGPathSegList.prototype._writeListToPath = function() {
this._pathElementMutationObserver.disconnect();
this._pathElement.setAttribute("d", window.SVGPathSegList._pathSegArrayAsString(this._list));
this._pathElementMutationObserver.observe(this._pathElement, this._mutationObserverConfig);
}
// When a path segment changes the list needs to be synchronized back to the path element.
window.SVGPathSegList.prototype.segmentChanged = function(pathSeg) {
this._writeListToPath();
}
window.SVGPathSegList.prototype.clear = function() {
this._checkPathSynchronizedToList();
this._list.forEach(function(pathSeg) {
pathSeg._owningPathSegList = null;
});
this._list = [];
this._writeListToPath();
}
window.SVGPathSegList.prototype.initialize = function(newItem) {
this._checkPathSynchronizedToList();
this._list = [newItem];
newItem._owningPathSegList = this;
this._writeListToPath();
return newItem;
}
window.SVGPathSegList.prototype._checkValidIndex = function(index) {
if (isNaN(index) || index < 0 || index >= this.numberOfItems)
throw "INDEX_SIZE_ERR";
}
window.SVGPathSegList.prototype.getItem = function(index) {
this._checkPathSynchronizedToList();
this._checkValidIndex(index);
return this._list[index];
}
window.SVGPathSegList.prototype.insertItemBefore = function(newItem, index) {
this._checkPathSynchronizedToList();
// Spec: If the index is greater than or equal to numberOfItems, then the new item is appended to the end of the list.
if (index > this.numberOfItems)
index = this.numberOfItems;
if (newItem._owningPathSegList) {
// SVG2 spec says to make a copy.
newItem = newItem.clone();
}
this._list.splice(index, 0, newItem);
newItem._owningPathSegList = this;
this._writeListToPath();
return newItem;
}
window.SVGPathSegList.prototype.replaceItem = function(newItem, index) {
this._checkPathSynchronizedToList();
if (newItem._owningPathSegList) {
// SVG2 spec says to make a copy.
newItem = newItem.clone();
}
this._checkValidIndex(index);
this._list[index] = newItem;
newItem._owningPathSegList = this;
this._writeListToPath();
return newItem;
}
window.SVGPathSegList.prototype.removeItem = function(index) {
this._checkPathSynchronizedToList();
this._checkValidIndex(index);
var item = this._list[index];
this._list.splice(index, 1);
this._writeListToPath();
return item;
}
window.SVGPathSegList.prototype.appendItem = function(newItem) {
this._checkPathSynchronizedToList();
if (newItem._owningPathSegList) {
// SVG2 spec says to make a copy.
newItem = newItem.clone();
}
this._list.push(newItem);
newItem._owningPathSegList = this;
// TODO: Optimize this to just append to the existing attribute.
this._writeListToPath();
return newItem;
}
window.SVGPathSegList._pathSegArrayAsString = function(pathSegArray) {
var string = "";
var first = true;
pathSegArray.forEach(function(pathSeg) {
if (first) {
first = false;
string += pathSeg._asPathString();
} else {
string += " " + pathSeg._asPathString();
}
});
return string;
}
// This closely follows SVGPathParser::parsePath from Source/core/svg/SVGPathParser.cpp.
window.SVGPathSegList.prototype._parsePath = function(string) {
if (!string || string.length == 0)
return [];
var owningPathSegList = this;
var Builder = function() {
this.pathSegList = [];
}
Builder.prototype.appendSegment = function(pathSeg) {
this.pathSegList.push(pathSeg);
}
var Source = function(string) {
this._string = string;
this._currentIndex = 0;
this._endIndex = this._string.length;
this._previousCommand = window.SVGPathSeg.PATHSEG_UNKNOWN;
this._skipOptionalSpaces();
}
Source.prototype._isCurrentSpace = function() {
var character = this._string[this._currentIndex];
return character <= " " && (character == " " || character == "\n" || character == "\t" || character == "\r" || character == "\f");
}
Source.prototype._skipOptionalSpaces = function() {
while (this._currentIndex < this._endIndex && this._isCurrentSpace())
this._currentIndex++;
return this._currentIndex < this._endIndex;
}
Source.prototype._skipOptionalSpacesOrDelimiter = function() {
if (this._currentIndex < this._endIndex && !this._isCurrentSpace() && this._string.charAt(this._currentIndex) != ",")
return false;
if (this._skipOptionalSpaces()) {
if (this._currentIndex < this._endIndex && this._string.charAt(this._currentIndex) == ",") {
this._currentIndex++;
this._skipOptionalSpaces();
}
}
return this._currentIndex < this._endIndex;
}
Source.prototype.hasMoreData = function() {
return this._currentIndex < this._endIndex;
}
Source.prototype.peekSegmentType = function() {
var lookahead = this._string[this._currentIndex];
return this._pathSegTypeFromChar(lookahead);
}
Source.prototype._pathSegTypeFromChar = function(lookahead) {
switch (lookahead) {
case "Z":
case "z":
return window.SVGPathSeg.PATHSEG_CLOSEPATH;
case "M":
return window.SVGPathSeg.PATHSEG_MOVETO_ABS;
case "m":
return window.SVGPathSeg.PATHSEG_MOVETO_REL;
case "L":
return window.SVGPathSeg.PATHSEG_LINETO_ABS;
case "l":
return window.SVGPathSeg.PATHSEG_LINETO_REL;
case "C":
return window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_ABS;
case "c":
return window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_REL;
case "Q":
return window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_ABS;
case "q":
return window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_REL;
case "A":
return window.SVGPathSeg.PATHSEG_ARC_ABS;
case "a":
return window.SVGPathSeg.PATHSEG_ARC_REL;
case "H":
return window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_ABS;
case "h":
return window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_REL;
case "V":
return window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_ABS;
case "v":
return window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_REL;
case "S":
return window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_ABS;
case "s":
return window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_REL;
case "T":
return window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_ABS;
case "t":
return window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_REL;
default:
return window.SVGPathSeg.PATHSEG_UNKNOWN;
}
}
Source.prototype._nextCommandHelper = function(lookahead, previousCommand) {
// Check for remaining coordinates in the current command.
if ((lookahead == "+" || lookahead == "-" || lookahead == "." || (lookahead >= "0" && lookahead <= "9")) && previousCommand != window.SVGPathSeg.PATHSEG_CLOSEPATH) {
if (previousCommand == window.SVGPathSeg.PATHSEG_MOVETO_ABS)
return window.SVGPathSeg.PATHSEG_LINETO_ABS;
if (previousCommand == window.SVGPathSeg.PATHSEG_MOVETO_REL)
return window.SVGPathSeg.PATHSEG_LINETO_REL;
return previousCommand;
}
return window.SVGPathSeg.PATHSEG_UNKNOWN;
}
Source.prototype.initialCommandIsMoveTo = function() {
// If the path is empty it is still valid, so return true.
if (!this.hasMoreData())
return true;
var command = this.peekSegmentType();
// Path must start with moveTo.
return command == window.SVGPathSeg.PATHSEG_MOVETO_ABS || command == window.SVGPathSeg.PATHSEG_MOVETO_REL;
}
// Parse a number from an SVG path. This very closely follows genericParseNumber(...) from Source/core/svg/SVGParserUtilities.cpp.
// Spec: http://www.w3.org/TR/SVG11/single-page.html#paths-PathDataBNF
Source.prototype._parseNumber = function() {
var exponent = 0;
var integer = 0;
var frac = 1;
var decimal = 0;
var sign = 1;
var expsign = 1;
var startIndex = this._currentIndex;
this._skipOptionalSpaces();
// Read the sign.
if (this._currentIndex < this._endIndex && this._string.charAt(this._currentIndex) == "+")
this._currentIndex++;
else if (this._currentIndex < this._endIndex && this._string.charAt(this._currentIndex) == "-") {
this._currentIndex++;
sign = -1;
}
if (this._currentIndex == this._endIndex || ((this._string.charAt(this._currentIndex) < "0" || this._string.charAt(this._currentIndex) > "9") && this._string.charAt(this._currentIndex) != "."))
// The first character of a number must be one of [0-9+-.].
return undefined;
// Read the integer part, build right-to-left.
var startIntPartIndex = this._currentIndex;
while (this._currentIndex < this._endIndex && this._string.charAt(this._currentIndex) >= "0" && this._string.charAt(this._currentIndex) <= "9")
this._currentIndex++; // Advance to first non-digit.
if (this._currentIndex != startIntPartIndex) {
var scanIntPartIndex = this._currentIndex - 1;
var multiplier = 1;
while (scanIntPartIndex >= startIntPartIndex) {
integer += multiplier * (this._string.charAt(scanIntPartIndex--) - "0");
multiplier *= 10;
}
}
// Read the decimals.
if (this._currentIndex < this._endIndex && this._string.charAt(this._currentIndex) == ".") {
this._currentIndex++;
// There must be a least one digit following the .
if (this._currentIndex >= this._endIndex || this._string.charAt(this._currentIndex) < "0" || this._string.charAt(this._currentIndex) > "9")
return undefined;
while (this._currentIndex < this._endIndex && this._string.charAt(this._currentIndex) >= "0" && this._string.charAt(this._currentIndex) <= "9") {
frac *= 10;
decimal += (this._string.charAt(this._currentIndex) - "0") / frac;
this._currentIndex += 1;
}
}
// Read the exponent part.
if (this._currentIndex != startIndex && this._currentIndex + 1 < this._endIndex && (this._string.charAt(this._currentIndex) == "e" || this._string.charAt(this._currentIndex) == "E") && (this._string.charAt(this._currentIndex + 1) != "x" && this._string.charAt(this._currentIndex + 1) != "m")) {
this._currentIndex++;
// Read the sign of the exponent.
if (this._string.charAt(this._currentIndex) == "+") {
this._currentIndex++;
} else if (this._string.charAt(this._currentIndex) == "-") {
this._currentIndex++;
expsign = -1;
}
// There must be an exponent.
if (this._currentIndex >= this._endIndex || this._string.charAt(this._currentIndex) < "0" || this._string.charAt(this._currentIndex) > "9")
return undefined;
while (this._currentIndex < this._endIndex && this._string.charAt(this._currentIndex) >= "0" && this._string.charAt(this._currentIndex) <= "9") {
exponent *= 10;
exponent += (this._string.charAt(this._currentIndex) - "0");
this._currentIndex++;
}
}
var number = integer + decimal;
number *= sign;
if (exponent)
number *= Math.pow(10, expsign * exponent);
if (startIndex == this._currentIndex)
return undefined;
this._skipOptionalSpacesOrDelimiter();
return number;
}
Source.prototype._parseArcFlag = function() {
if (this._currentIndex >= this._endIndex)
return undefined;
var flag = false;
var flagChar = this._string.charAt(this._currentIndex++);
if (flagChar == "0")
flag = false;
else if (flagChar == "1")
flag = true;
else
return undefined;
this._skipOptionalSpacesOrDelimiter();
return flag;
}
Source.prototype.parseSegment = function() {
var lookahead = this._string[this._currentIndex];
var command = this._pathSegTypeFromChar(lookahead);
if (command == window.SVGPathSeg.PATHSEG_UNKNOWN) {
// Possibly an implicit command. Not allowed if this is the first command.
if (this._previousCommand == window.SVGPathSeg.PATHSEG_UNKNOWN)
return null;
command = this._nextCommandHelper(lookahead, this._previousCommand);
if (command == window.SVGPathSeg.PATHSEG_UNKNOWN)
return null;
} else {
this._currentIndex++;
}
this._previousCommand = command;
switch (command) {
case window.SVGPathSeg.PATHSEG_MOVETO_REL:
return new window.SVGPathSegMovetoRel(owningPathSegList, this._parseNumber(), this._parseNumber());
case window.SVGPathSeg.PATHSEG_MOVETO_ABS:
return new window.SVGPathSegMovetoAbs(owningPathSegList, this._parseNumber(), this._parseNumber());
case window.SVGPathSeg.PATHSEG_LINETO_REL:
return new window.SVGPathSegLinetoRel(owningPathSegList, this._parseNumber(), this._parseNumber());
case window.SVGPathSeg.PATHSEG_LINETO_ABS:
return new window.SVGPathSegLinetoAbs(owningPathSegList, this._parseNumber(), this._parseNumber());
case window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_REL:
return new window.SVGPathSegLinetoHorizontalRel(owningPathSegList, this._parseNumber());
case window.SVGPathSeg.PATHSEG_LINETO_HORIZONTAL_ABS:
return new window.SVGPathSegLinetoHorizontalAbs(owningPathSegList, this._parseNumber());
case window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_REL:
return new window.SVGPathSegLinetoVerticalRel(owningPathSegList, this._parseNumber());
case window.SVGPathSeg.PATHSEG_LINETO_VERTICAL_ABS:
return new window.SVGPathSegLinetoVerticalAbs(owningPathSegList, this._parseNumber());
case window.SVGPathSeg.PATHSEG_CLOSEPATH:
this._skipOptionalSpaces();
return new window.SVGPathSegClosePath(owningPathSegList);
case window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_REL:
var points = {x1: this._parseNumber(), y1: this._parseNumber(), x2: this._parseNumber(), y2: this._parseNumber(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegCurvetoCubicRel(owningPathSegList, points.x, points.y, points.x1, points.y1, points.x2, points.y2);
case window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_ABS:
var points = {x1: this._parseNumber(), y1: this._parseNumber(), x2: this._parseNumber(), y2: this._parseNumber(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegCurvetoCubicAbs(owningPathSegList, points.x, points.y, points.x1, points.y1, points.x2, points.y2);
case window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_REL:
var points = {x2: this._parseNumber(), y2: this._parseNumber(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegCurvetoCubicSmoothRel(owningPathSegList, points.x, points.y, points.x2, points.y2);
case window.SVGPathSeg.PATHSEG_CURVETO_CUBIC_SMOOTH_ABS:
var points = {x2: this._parseNumber(), y2: this._parseNumber(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegCurvetoCubicSmoothAbs(owningPathSegList, points.x, points.y, points.x2, points.y2);
case window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_REL:
var points = {x1: this._parseNumber(), y1: this._parseNumber(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegCurvetoQuadraticRel(owningPathSegList, points.x, points.y, points.x1, points.y1);
case window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_ABS:
var points = {x1: this._parseNumber(), y1: this._parseNumber(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegCurvetoQuadraticAbs(owningPathSegList, points.x, points.y, points.x1, points.y1);
case window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_REL:
return new window.SVGPathSegCurvetoQuadraticSmoothRel(owningPathSegList, this._parseNumber(), this._parseNumber());
case window.SVGPathSeg.PATHSEG_CURVETO_QUADRATIC_SMOOTH_ABS:
return new window.SVGPathSegCurvetoQuadraticSmoothAbs(owningPathSegList, this._parseNumber(), this._parseNumber());
case window.SVGPathSeg.PATHSEG_ARC_REL:
var points = {x1: this._parseNumber(), y1: this._parseNumber(), arcAngle: this._parseNumber(), arcLarge: this._parseArcFlag(), arcSweep: this._parseArcFlag(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegArcRel(owningPathSegList, points.x, points.y, points.x1, points.y1, points.arcAngle, points.arcLarge, points.arcSweep);
case window.SVGPathSeg.PATHSEG_ARC_ABS:
var points = {x1: this._parseNumber(), y1: this._parseNumber(), arcAngle: this._parseNumber(), arcLarge: this._parseArcFlag(), arcSweep: this._parseArcFlag(), x: this._parseNumber(), y: this._parseNumber()};
return new window.SVGPathSegArcAbs(owningPathSegList, points.x, points.y, points.x1, points.y1, points.arcAngle, points.arcLarge, points.arcSweep);
default:
throw "Unknown path seg type."
}
}
var builder = new Builder();
var source = new Source(string);
if (!source.initialCommandIsMoveTo())
return [];
while (source.hasMoreData()) {
var pathSeg = source.parseSegment();
if (!pathSeg)
return [];
builder.appendSegment(pathSeg);
}
return builder.pathSegList;
}
}
}());

173
demo/src/Compare.js Normal file
View file

@ -0,0 +1,173 @@
/**
* A Matter.js version comparison testbed based on MatterTools.
*
* Tool to interactively compare engine results of
* development version against the previous release.
*
* USAGE: [host]?compare[=frames]#[example]
* e.g. http://localhost:8000/?compare=120#mixed
*
* @module Compare
*/
var MatterTools = require('matter-tools');
var MatterDev = require('MatterDev');
var MatterBuild = require('MatterBuild');
var compare = function(examples, isDev) {
// create primary demo for dev build
var demo = MatterTools.Demo.create({
toolbar: {
title: 'matter-js ・ ' + (isDev ? 'dev' : '') + ' ・ comparing to ' + MatterBuild.version,
url: 'https://github.com/liabru/matter-js',
reset: true,
source: true,
inspector: false,
tools: false,
fullscreen: true,
exampleSelect: true
},
// tools disabled to keep sync between instances
tools: {
inspector: false,
gui: false
},
inline: false,
preventZoom: true,
resetOnOrientation: true,
routing: true,
startExample: false,
examples: examples
});
// create secondary demo for release build
var demoBuild = MatterTools.Demo.create({
toolbar: {
title: 'matter-js-compare-build',
reset: false,
source: false,
inspector: false,
tools: false,
fullscreen: false,
exampleSelect: false
},
// tools disabled to keep sync between instances
tools: {
inspector: false,
gui: false
},
inline: false,
preventZoom: true,
resetOnOrientation: true,
routing: false,
startExample: false,
examples: examples.map(function(example) {
return Matter.Common.extend({}, example);
})
});
/**
* NOTE: For the actual example code, refer to the source files in `/examples/`.
* The code below is tooling for Matter.js maintainers to compare versions of Matter.
*/
// build version should not run itself
MatterBuild.Runner.run = function() {};
MatterBuild.Render.run = function() {};
// maintain original references to patched methods
MatterDev.Runner._tick = MatterDev.Runner.tick;
MatterDev.Render._world = MatterDev.Render.world;
MatterBuild.Mouse._setElement = MatterBuild.Mouse.setElement;
// patch MatterTools to control both demo versions simultaneously
MatterTools.Demo._setExample = MatterTools.Demo.setExample;
MatterTools.Demo.setExample = function(_demo, example) {
MatterBuild.Common._nextId = MatterBuild.Common._seed = 0;
MatterDev.Common._nextId = MatterDev.Common._seed = 0;
MatterBuild.Plugin._registry = MatterDev.Plugin._registry;
MatterBuild.use.apply(null, MatterDev.used);
window.Matter = MatterDev;
MatterTools.Demo._setExample(
demo, demo.examples.find(function(e) { return e.name === example.name; })
);
var maxTicks = parseFloat(window.location.search.split('=')[1]);
var ticks = 0;
MatterDev.Runner.tick = function(runner, engine, time) {
if (ticks === -1) {
return;
}
if (ticks >= maxTicks) {
console.info(
'Demo.Compare: ran ' + ticks + ' ticks, timestamp is now '
+ engine.timing.timestamp.toFixed(2)
);
ticks = -1;
return;
}
ticks += 1;
var demoBuildInstance = demoBuild.example.instance;
runner.isFixed = demoBuildInstance.runner.isFixed = true;
runner.delta = demoBuildInstance.runner.delta = 1000 / 60;
window.Matter = MatterBuild;
MatterBuild.Runner.tick(demoBuildInstance.runner, demoBuildInstance.engine, time);
window.Matter = MatterDev;
return MatterDev.Runner._tick(runner, engine, time);
};
MatterDev.Render.world = function(render) {
window.Matter = MatterBuild;
MatterBuild.Render.world(demoBuild.example.instance.render);
window.Matter = MatterDev;
return MatterDev.Render._world(render);
};
MatterBuild.Mouse.setElement = function(mouse) {
return MatterBuild.Mouse._setElement(mouse, demo.example.instance.render.canvas);
};
window.Matter = MatterBuild;
MatterTools.Demo._setExample(
demoBuild, demoBuild.examples.find(function(e) { return e.name === example.name; })
);
window.Matter = MatterDev;
};
// reset both engine versions simultaneously
MatterTools.Demo._reset = MatterTools.Demo.reset;
MatterTools.Demo.reset = function(_demo) {
MatterBuild.Common._nextId = MatterBuild.Common._seed = 0;
MatterDev.Common._nextId = MatterDev.Common._seed = 0;
window.Matter = MatterBuild;
MatterTools.Demo._reset(demoBuild);
window.Matter = MatterDev;
MatterTools.Demo._reset(demo);
};
document.body.appendChild(demo.dom.root);
document.body.appendChild(demoBuild.dom.root);
MatterTools.Demo.start(demo);
document.title = 'Matter.js Compare' + (isDev ? ' ・ Dev' : '');
console.info(
'Demo.Compare: matter-js@' + MatterDev.version +
' with matter-js@' + MatterBuild.version
);
};
module.exports = { compare: compare };

65
demo/src/Demo.js Normal file
View file

@ -0,0 +1,65 @@
/**
* A Matter.js demo and development testbed based on MatterTools.
*
* For a simpler, minimal Matter.js example see:
* https://github.com/liabru/matter-js/wiki/Getting-started
*
* The source for examples can be found at `/examples/`.
*
* @module Demo
*/
var MatterTools = require('matter-tools');
var demo = function(examples, isDev) {
var demo = MatterTools.Demo.create({
toolbar: {
title: 'matter-js' + (isDev ? ' ・ dev' : ''),
url: 'https://github.com/liabru/matter-js',
reset: true,
source: true,
inspector: true,
tools: true,
fullscreen: true,
exampleSelect: true
},
tools: {
inspector: true,
gui: true
},
inline: false,
preventZoom: true,
resetOnOrientation: true,
routing: true,
startExample: 'mixed',
examples: examples
});
window.MatterDemoInstance = demo;
document.body.appendChild(demo.dom.root);
document.title = 'Matter.js Demo' + (isDev ? ' ・ Dev' : '');
if (isDev) {
var buttonSource = demo.dom.buttonSource;
var buttonCompare = buttonSource.cloneNode(true);
buttonCompare.textContent = '⎄';
buttonCompare.title = 'Compare';
buttonCompare.href = '?compare';
buttonCompare.target = '';
buttonCompare.className = 'matter-btn matter-btn-compare';
buttonCompare.addEventListener('click', function(event) {
window.location = '?compare#' + demo.example.id;
event.preventDefault();
});
buttonSource.parentNode.insertBefore(buttonCompare, buttonSource.nextSibling);
Matter.before('Render.create', function(renderOptions) {
renderOptions.options.showDebug = true;
});
}
MatterTools.Demo.start(demo);
};
module.exports = { demo: demo };

55
demo/src/index.ejs Normal file
View file

@ -0,0 +1,55 @@
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="utf-8">
<meta http-equiv="X-UA-Compatible" content="IE=edge,chrome=1">
<meta name="viewport" content="width=device-width,initial-scale=1.0,minimum-scale=1.0,maximum-scale=1.0,user-scalable=no,minimal-ui">
<meta name="theme-color" content="#000000">
<meta name="msapplication-navbutton-color" content="#000000">
<meta name="apple-mobile-web-app-capable" content="yes">
<meta name="apple-mobile-web-app-status-bar-style" content="black-translucent">
<meta name="robots" content="noindex">
<title>Matter.js Demo</title>
<style type="text/css">
* {
box-sizing: border-box;
}
body {
margin: 0;
padding: 0;
}
.matter-btn-compare.matter-btn {
font-size: 18px;
text-align: center;
line-height: 32px;
}
.matter-js-compare-build.matter-demo {
position: absolute;
background: none;
top: 0;
left: 0;
width: 100%;
height: 100%;
border: 0;
z-index: 1;
pointer-events: none;
}
.matter-js-compare-build.matter-demo .matter-header-outer {
display: none;
}
.matter-js-compare-build.matter-demo canvas {
opacity: 0.5;
background: transparent !important;
}
</style>
</head>
<body><% for (var chunk in htmlWebpackPlugin.files.js) { %>
<script src="<%= htmlWebpackPlugin.files.js[chunk] %>"></script><% } %>
</body>
</html>

39
demo/src/index.js Normal file
View file

@ -0,0 +1,39 @@
/**
* Initialise and start the browser demo / compare tool.
*
* For a simpler, minimal Matter.js example see:
* https://github.com/liabru/matter-js/wiki/Getting-started
*
* The source for examples can be found at `/examples/`.
*
* @module Index
*/
var Matter = require('matter-js');
var Examples = require('../../examples/index');
var compare = require('./Compare').compare;
var demo = require('./Demo').demo;
// browser globals
window.pathseg = require('pathseg');
window.MatterTools = require('matter-tools');
window.Matter = Matter;
// prepare examples
var examples = Matter.Common.keys(Examples).map(function(id){
return {
id: id,
sourceLink: 'https://github.com/liabru/matter-js/blob/master/examples/' + id + '.js',
name: Examples[id].title,
init: Examples[id]
};
});
// start the requested tool
var isCompare = window.location.search.indexOf('compare') >= 0;
var isDev = __MATTER_IS_DEV__;
if (isCompare) {
compare(examples, isDev);
} else {
demo(examples, isDev);
}

View file

@ -6,7 +6,7 @@ Example.airFriction = function() {
Runner = Matter.Runner, Runner = Matter.Runner,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -31,7 +31,7 @@ Example.airFriction = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// falling blocks // falling blocks
Bodies.rectangle(200, 100, 60, 60, { frictionAir: 0.001 }), Bodies.rectangle(200, 100, 60, 60, { frictionAir: 0.001 }),
Bodies.rectangle(400, 100, 60, 60, { frictionAir: 0.05 }), Bodies.rectangle(400, 100, 60, 60, { frictionAir: 0.05 }),
@ -56,7 +56,7 @@ Example.airFriction = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -78,4 +78,11 @@ Example.airFriction = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.airFriction.title = 'Air Friction';
Example.airFriction.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.airFriction;
}

View file

@ -1,10 +1,18 @@
var Example = Example || {}; var Example = Example || {};
Matter.use(
'matter-wrap'
);
Example.avalanche = function() { Example.avalanche = function() {
try {
if (typeof MatterWrap !== 'undefined') {
// either use by name from plugin registry (Browser global)
Matter.use('matter-wrap');
} else {
// or require and use the plugin directly (Node.js, Webpack etc.)
Matter.use(require('matter-wrap'));
}
} catch (e) {
// could not require the plugin or install needed
}
var Engine = Matter.Engine, var Engine = Matter.Engine,
Render = Matter.Render, Render = Matter.Render,
Runner = Matter.Runner, Runner = Matter.Runner,
@ -13,7 +21,6 @@ Example.avalanche = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -41,13 +48,13 @@ Example.avalanche = function() {
var stack = Composites.stack(20, 20, 20, 5, 0, 0, function(x, y) { var stack = Composites.stack(20, 20, 20, 5, 0, 0, function(x, y) {
return Bodies.circle(x, y, Common.random(10, 20), { friction: 0.00001, restitution: 0.5, density: 0.001 }); return Bodies.circle(x, y, Common.random(10, 20), { friction: 0.00001, restitution: 0.5, density: 0.001 });
}); });
Composite.add(world, stack);
World.add(world, stack); Composite.add(world, [
Bodies.rectangle(200, 150, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }),
World.add(world, [ Bodies.rectangle(500, 350, 700, 20, { isStatic: true, angle: -Math.PI * 0.06, render: { fillStyle: '#060a19' } }),
Bodies.rectangle(200, 150, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), Bodies.rectangle(340, 580, 700, 20, { isStatic: true, angle: Math.PI * 0.04, render: { fillStyle: '#060a19' } })
Bodies.rectangle(500, 350, 700, 20, { isStatic: true, angle: -Math.PI * 0.06 }),
Bodies.rectangle(340, 580, 700, 20, { isStatic: true, angle: Math.PI * 0.04 })
]); ]);
// add mouse control // add mouse control
@ -62,7 +69,7 @@ Example.avalanche = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -89,4 +96,11 @@ Example.avalanche = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.avalanche.title = 'Avalanche';
Example.avalanche.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.avalanche;
}

View file

@ -1,10 +1,18 @@
var Example = Example || {}; var Example = Example || {};
Matter.use(
'matter-wrap'
);
Example.ballPool = function() { Example.ballPool = function() {
try {
if (typeof MatterWrap !== 'undefined') {
// either use by name from plugin registry (Browser global)
Matter.use('matter-wrap');
} else {
// or require and use the plugin directly (Node.js, Webpack etc.)
Matter.use(require('matter-wrap'));
}
} catch (e) {
// could not require the plugin or install needed
}
var Engine = Matter.Engine, var Engine = Matter.Engine,
Render = Matter.Render, Render = Matter.Render,
Runner = Matter.Runner, Runner = Matter.Runner,
@ -13,7 +21,6 @@ Example.ballPool = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -38,15 +45,15 @@ Example.ballPool = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
Bodies.rectangle(400, 600, 1200, 50.5, { isStatic: true }) Bodies.rectangle(400, 600, 1200, 50.5, { isStatic: true, render: { fillStyle: '#060a19' } })
]); ]);
var stack = Composites.stack(100, 0, 10, 8, 10, 10, function(x, y) { var stack = Composites.stack(100, 0, 10, 8, 10, 10, function(x, y) {
return Bodies.circle(x, y, Common.random(15, 30), { restitution: 0.6, friction: 0.1 }); return Bodies.circle(x, y, Common.random(15, 30), { restitution: 0.6, friction: 0.1 });
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
Bodies.polygon(200, 460, 3, 60), Bodies.polygon(200, 460, 3, 60),
Bodies.polygon(400, 460, 5, 60), Bodies.polygon(400, 460, 5, 60),
@ -65,7 +72,7 @@ Example.ballPool = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -97,4 +104,11 @@ Example.ballPool = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.ballPool.title = 'Ball Pool';
Example.ballPool.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.ballPool;
}

View file

@ -10,7 +10,7 @@ Example.bridge = function() {
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -44,7 +44,7 @@ Example.bridge = function() {
density: 0.005, density: 0.005,
frictionAir: 0.05, frictionAir: 0.05,
render: { render: {
fillStyle: '#575375' fillStyle: '#060a19'
} }
}); });
}); });
@ -61,7 +61,7 @@ Example.bridge = function() {
return Bodies.rectangle(x, y, 50, 50, Common.random(20, 40)); return Bodies.rectangle(x, y, 50, 50, Common.random(20, 40));
}); });
World.add(world, [ Composite.add(world, [
bridge, bridge,
stack, stack,
Bodies.rectangle(30, 490, 220, 380, { Bodies.rectangle(30, 490, 220, 380, {
@ -100,7 +100,7 @@ Example.bridge = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -122,4 +122,11 @@ Example.bridge = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.bridge.title = 'Bridge';
Example.bridge.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.bridge;
}

View file

@ -8,7 +8,7 @@ Example.broadphase = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -34,7 +34,7 @@ Example.broadphase = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -57,7 +57,7 @@ Example.broadphase = function() {
} }
}); });
World.add(world, stack); Composite.add(world, stack);
// add mouse control // add mouse control
var mouse = Mouse.create(render.canvas), var mouse = Mouse.create(render.canvas),
@ -71,7 +71,7 @@ Example.broadphase = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -93,4 +93,11 @@ Example.broadphase = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.broadphase.title = 'Broadphase';
Example.broadphase.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.broadphase;
}

View file

@ -7,7 +7,7 @@ Example.car = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -33,7 +33,7 @@ Example.car = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -41,16 +41,17 @@ Example.car = function() {
Bodies.rectangle(0, 300, 50, 600, { isStatic: true }) Bodies.rectangle(0, 300, 50, 600, { isStatic: true })
]); ]);
// see car function defined later in this file
var scale = 0.9; var scale = 0.9;
World.add(world, Composites.car(150, 100, 150 * scale, 30 * scale, 30 * scale)); Composite.add(world, Example.car.car(150, 100, 150 * scale, 30 * scale, 30 * scale));
scale = 0.8; scale = 0.8;
World.add(world, Composites.car(350, 300, 150 * scale, 30 * scale, 30 * scale)); Composite.add(world, Example.car.car(350, 300, 150 * scale, 30 * scale, 30 * scale));
World.add(world, [ Composite.add(world, [
Bodies.rectangle(200, 150, 400, 20, { isStatic: true, angle: Math.PI * 0.06 }), Bodies.rectangle(200, 150, 400, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' }}),
Bodies.rectangle(500, 350, 650, 20, { isStatic: true, angle: -Math.PI * 0.06 }), Bodies.rectangle(500, 350, 650, 20, { isStatic: true, angle: -Math.PI * 0.06, render: { fillStyle: '#060a19' }}),
Bodies.rectangle(300, 560, 600, 20, { isStatic: true, angle: Math.PI * 0.04 }) Bodies.rectangle(300, 560, 600, 20, { isStatic: true, angle: Math.PI * 0.04, render: { fillStyle: '#060a19' }})
]); ]);
// add mouse control // add mouse control
@ -65,7 +66,7 @@ Example.car = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -87,4 +88,83 @@ Example.car = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.car.title = 'Car';
Example.car.for = '>=0.14.2';
/**
* Creates a composite with simple car setup of bodies and constraints.
* @method car
* @param {number} xx
* @param {number} yy
* @param {number} width
* @param {number} height
* @param {number} wheelSize
* @return {composite} A new composite car body
*/
Example.car.car = function(xx, yy, width, height, wheelSize) {
var Body = Matter.Body,
Bodies = Matter.Bodies,
Composite = Matter.Composite,
Constraint = Matter.Constraint;
var group = Body.nextGroup(true),
wheelBase = 20,
wheelAOffset = -width * 0.5 + wheelBase,
wheelBOffset = width * 0.5 - wheelBase,
wheelYOffset = 0;
var car = Composite.create({ label: 'Car' }),
body = Bodies.rectangle(xx, yy, width, height, {
collisionFilter: {
group: group
},
chamfer: {
radius: height * 0.5
},
density: 0.0002
});
var wheelA = Bodies.circle(xx + wheelAOffset, yy + wheelYOffset, wheelSize, {
collisionFilter: {
group: group
},
friction: 0.8
});
var wheelB = Bodies.circle(xx + wheelBOffset, yy + wheelYOffset, wheelSize, {
collisionFilter: {
group: group
},
friction: 0.8
});
var axelA = Constraint.create({
bodyB: body,
pointB: { x: wheelAOffset, y: wheelYOffset },
bodyA: wheelA,
stiffness: 1,
length: 0
});
var axelB = Constraint.create({
bodyB: body,
pointB: { x: wheelBOffset, y: wheelYOffset },
bodyA: wheelB,
stiffness: 1,
length: 0
});
Composite.addBody(car, body);
Composite.addBody(car, wheelA);
Composite.addBody(car, wheelB);
Composite.addConstraint(car, axelA);
Composite.addConstraint(car, axelB);
return car;
};
if (typeof module !== 'undefined') {
module.exports = Example.car;
}

View file

@ -8,7 +8,7 @@ Example.catapult = function() {
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies, Bodies = Matter.Bodies,
Body = Matter.Body, Body = Matter.Body,
Vector = Matter.Vector; Vector = Matter.Vector;
@ -45,12 +45,12 @@ Example.catapult = function() {
var catapult = Bodies.rectangle(400, 520, 320, 20, { collisionFilter: { group: group } }); var catapult = Bodies.rectangle(400, 520, 320, 20, { collisionFilter: { group: group } });
World.add(world, [ Composite.add(world, [
stack, stack,
catapult, catapult,
Bodies.rectangle(400, 600, 800, 50.5, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50.5, { isStatic: true, render: { fillStyle: '#060a19' } }),
Bodies.rectangle(250, 555, 20, 50, { isStatic: true }), Bodies.rectangle(250, 555, 20, 50, { isStatic: true, render: { fillStyle: '#060a19' } }),
Bodies.rectangle(400, 535, 20, 80, { isStatic: true, collisionFilter: { group: group } }), Bodies.rectangle(400, 535, 20, 80, { isStatic: true, collisionFilter: { group: group }, render: { fillStyle: '#060a19' } }),
Bodies.circle(560, 100, 50, { density: 0.005 }), Bodies.circle(560, 100, 50, { density: 0.005 }),
Constraint.create({ Constraint.create({
bodyA: catapult, bodyA: catapult,
@ -72,7 +72,7 @@ Example.catapult = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -94,4 +94,11 @@ Example.catapult = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.catapult.title = 'Catapult';
Example.catapult.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.catapult;
}

View file

@ -10,7 +10,6 @@ Example.chains = function() {
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -79,7 +78,7 @@ Example.chains = function() {
stiffness: 0.5 stiffness: 0.5
})); }));
World.add(world, [ Composite.add(world, [
ropeA, ropeA,
ropeB, ropeB,
ropeC, ropeC,
@ -98,7 +97,7 @@ Example.chains = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -120,4 +119,11 @@ Example.chains = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.chains.title = 'Chains';
Example.chains.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.chains;
}

View file

@ -7,7 +7,7 @@ Example.circleStack = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -32,11 +32,11 @@ Example.circleStack = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var stack = Composites.stack(100, 185, 10, 10, 20, 0, function(x, y) { var stack = Composites.stack(100, 600 - 21 - 20 * 20, 10, 10, 20, 0, function(x, y) {
return Bodies.circle(x, y, 20); return Bodies.circle(x, y, 20);
}); });
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -57,7 +57,7 @@ Example.circleStack = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -79,4 +79,11 @@ Example.circleStack = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.circleStack.title = 'Circle Stack';
Example.circleStack.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.circleStack;
}

View file

@ -8,7 +8,7 @@ Example.cloth = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -31,20 +31,17 @@ Example.cloth = function() {
var runner = Runner.create(); var runner = Runner.create();
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // see cloth function defined later in this file
var group = Body.nextGroup(true), var cloth = Example.cloth.cloth(200, 200, 20, 12, 5, 5, false, 8);
particleOptions = { friction: 0.00001, collisionFilter: { group: group }, render: { visible: false }},
constraintOptions = { stiffness: 0.06 },
cloth = Composites.softBody(200, 200, 20, 12, 5, 5, false, 8, particleOptions, constraintOptions);
for (var i = 0; i < 20; i++) { for (var i = 0; i < 20; i++) {
cloth.bodies[i].isStatic = true; cloth.bodies[i].isStatic = true;
} }
World.add(world, [ Composite.add(world, [
cloth, cloth,
Bodies.circle(300, 500, 80, { isStatic: true }), Bodies.circle(300, 500, 80, { isStatic: true, render: { fillStyle: '#060a19' }}),
Bodies.rectangle(500, 480, 80, 80, { isStatic: true }), Bodies.rectangle(500, 480, 80, 80, { isStatic: true, render: { fillStyle: '#060a19' }}),
Bodies.rectangle(400, 609, 800, 50, { isStatic: true }) Bodies.rectangle(400, 609, 800, 50, { isStatic: true })
]); ]);
@ -60,7 +57,7 @@ Example.cloth = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -82,4 +79,47 @@ Example.cloth = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.cloth.title = 'Cloth';
Example.cloth.for = '>=0.14.2';
/**
* Creates a simple cloth like object.
* @method cloth
* @param {number} xx
* @param {number} yy
* @param {number} columns
* @param {number} rows
* @param {number} columnGap
* @param {number} rowGap
* @param {boolean} crossBrace
* @param {number} particleRadius
* @param {} particleOptions
* @param {} constraintOptions
* @return {composite} A new composite cloth
*/
Example.cloth.cloth = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) {
var Body = Matter.Body,
Bodies = Matter.Bodies,
Common = Matter.Common,
Composites = Matter.Composites;
var group = Body.nextGroup(true);
particleOptions = Common.extend({ inertia: Infinity, friction: 0.00001, collisionFilter: { group: group }, render: { visible: false }}, particleOptions);
constraintOptions = Common.extend({ stiffness: 0.06, render: { type: 'line', anchors: false } }, constraintOptions);
var cloth = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y) {
return Bodies.circle(x, y, particleRadius, particleOptions);
});
Composites.mesh(cloth, columns, rows, crossBrace, constraintOptions);
cloth.label = 'Cloth Body';
return cloth;
};
if (typeof module !== 'undefined') {
module.exports = Example.cloth;
}

View file

@ -9,7 +9,6 @@ Example.collisionFiltering = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -23,8 +22,7 @@ Example.collisionFiltering = function() {
options: { options: {
width: 800, width: 800,
height: 600, height: 600,
wireframes: false, wireframes: false
background: '#111'
} }
}); });
@ -40,12 +38,12 @@ Example.collisionFiltering = function() {
greenCategory = 0x0004, greenCategory = 0x0004,
blueCategory = 0x0008; blueCategory = 0x0008;
var redColor = '#C44D58', var colorA = '#f55a3c',
blueColor = '#4ECDC4', colorB = '#063e7b',
greenColor = '#C7F464'; colorC = '#f5d259';
// add floor // add floor
World.add(world, Bodies.rectangle(400, 600, 900, 50, { Composite.add(world, Bodies.rectangle(400, 600, 900, 50, {
isStatic: true, isStatic: true,
render: { render: {
fillStyle: 'transparent', fillStyle: 'transparent',
@ -54,17 +52,17 @@ Example.collisionFiltering = function() {
})); }));
// create a stack with varying body categories (but these bodies can all collide with each other) // create a stack with varying body categories (but these bodies can all collide with each other)
World.add(world, Composite.add(world,
Composites.stack(275, 100, 5, 9, 10, 10, function(x, y, column, row) { Composites.stack(275, 100, 5, 9, 10, 10, function(x, y, column, row) {
var category = redCategory, var category = redCategory,
color = redColor; color = colorA;
if (row > 5) { if (row > 5) {
category = blueCategory; category = blueCategory;
color = blueColor; color = colorB;
} else if (row > 2) { } else if (row > 2) {
category = greenCategory; category = greenCategory;
color = greenColor; color = colorC;
} }
return Bodies.circle(x, y, 20, { return Bodies.circle(x, y, 20, {
@ -81,37 +79,37 @@ Example.collisionFiltering = function() {
); );
// this body will only collide with the walls and the green bodies // this body will only collide with the walls and the green bodies
World.add(world, Composite.add(world,
Bodies.circle(310, 40, 30, { Bodies.circle(310, 40, 30, {
collisionFilter: { collisionFilter: {
mask: defaultCategory | greenCategory mask: defaultCategory | greenCategory
}, },
render: { render: {
fillStyle: greenColor fillStyle: colorC
} }
}) })
); );
// this body will only collide with the walls and the red bodies // this body will only collide with the walls and the red bodies
World.add(world, Composite.add(world,
Bodies.circle(400, 40, 30, { Bodies.circle(400, 40, 30, {
collisionFilter: { collisionFilter: {
mask: defaultCategory | redCategory mask: defaultCategory | redCategory
}, },
render: { render: {
fillStyle: redColor fillStyle: colorA
} }
}) })
); );
// this body will only collide with the walls and the blue bodies // this body will only collide with the walls and the blue bodies
World.add(world, Composite.add(world,
Bodies.circle(480, 40, 30, { Bodies.circle(480, 40, 30, {
collisionFilter: { collisionFilter: {
mask: defaultCategory | blueCategory mask: defaultCategory | blueCategory
}, },
render: { render: {
fillStyle: blueColor fillStyle: colorB
} }
}) })
); );
@ -128,7 +126,7 @@ Example.collisionFiltering = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -153,4 +151,11 @@ Example.collisionFiltering = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.collisionFiltering.title = 'Collision Filtering';
Example.collisionFiltering.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.collisionFiltering;
}

View file

@ -9,7 +9,6 @@ Example.compositeManipulation = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -34,7 +33,7 @@ Example.compositeManipulation = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -46,9 +45,9 @@ Example.compositeManipulation = function() {
return Bodies.rectangle(x, y, 40, 40); return Bodies.rectangle(x, y, 40, 40);
}); });
World.add(world, stack); Composite.add(world, stack);
world.gravity.y = 0; engine.gravity.y = 0;
Events.on(engine, 'afterUpdate', function(event) { Events.on(engine, 'afterUpdate', function(event) {
var time = engine.timing.timestamp; var time = engine.timing.timestamp;
@ -83,7 +82,7 @@ Example.compositeManipulation = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -105,4 +104,11 @@ Example.compositeManipulation = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.compositeManipulation.title = 'Composite Manipulation';
Example.compositeManipulation.for = '>0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.compositeManipulation;
}

View file

@ -6,9 +6,9 @@ Example.compound = function() {
Runner = Matter.Runner, Runner = Matter.Runner,
Body = Matter.Body, Body = Matter.Body,
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
Composite = Matter.Composite,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -63,7 +63,7 @@ Example.compound = function() {
pointB: { x: 0, y: 0 } pointB: { x: 0, y: 0 }
}); });
World.add(world, [ Composite.add(world, [
compoundBodyA, compoundBodyA,
compoundBodyB, compoundBodyB,
constraint, constraint,
@ -82,7 +82,7 @@ Example.compound = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -104,4 +104,11 @@ Example.compound = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.compound.title = 'Compound Bodies';
Example.compound.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.compound;
}

View file

@ -8,7 +8,7 @@ Example.compoundStack = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -35,7 +35,7 @@ Example.compoundStack = function() {
// add bodies // add bodies
var size = 50; var size = 50;
var stack = Composites.stack(100, 280, 12, 6, 0, 0, function(x, y) { var stack = Composites.stack(100, 600 - 17 - size * 6, 12, 6, 0, 0, function(x, y) {
var partA = Bodies.rectangle(x, y, size, size / 5), var partA = Bodies.rectangle(x, y, size, size / 5),
partB = Bodies.rectangle(x, y, size / 5, size, { render: partA.render }); partB = Bodies.rectangle(x, y, size / 5, size, { render: partA.render });
@ -44,7 +44,7 @@ Example.compoundStack = function() {
}); });
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
@ -65,7 +65,7 @@ Example.compoundStack = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -87,4 +87,11 @@ Example.compoundStack = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.compoundStack.title = 'Compound Stack';
Example.compoundStack.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.compoundStack;
}

View file

@ -8,10 +8,13 @@ Example.concave = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Vertices = Matter.Vertices, Vertices = Matter.Vertices,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// provide concave decomposition support library
Common.setDecomp(require('poly-decomp'));
// create engine // create engine
var engine = Engine.create(), var engine = Engine.create(),
world = engine.world; world = engine.world;
@ -33,7 +36,7 @@ Example.concave = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -47,7 +50,7 @@ Example.concave = function() {
horseShoe = Vertices.fromPath('35 7 19 17 14 38 14 58 25 79 45 85 65 84 65 66 46 67 34 59 30 44 33 29 45 23 66 23 66 7 53 7'); horseShoe = Vertices.fromPath('35 7 19 17 14 38 14 58 25 79 45 85 65 84 65 66 46 67 34 59 30 44 33 29 45 23 66 23 66 7 53 7');
var stack = Composites.stack(50, 50, 6, 4, 10, 10, function(x, y) { var stack = Composites.stack(50, 50, 6, 4, 10, 10, function(x, y) {
var color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); var color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']);
return Bodies.fromVertices(x, y, Common.choose([arrow, chevron, star, horseShoe]), { return Bodies.fromVertices(x, y, Common.choose([arrow, chevron, star, horseShoe]), {
render: { render: {
fillStyle: color, fillStyle: color,
@ -57,7 +60,7 @@ Example.concave = function() {
}, true); }, true);
}); });
World.add(world, stack); Composite.add(world, stack);
// add mouse control // add mouse control
var mouse = Mouse.create(render.canvas), var mouse = Mouse.create(render.canvas),
@ -71,7 +74,7 @@ Example.concave = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -93,4 +96,11 @@ Example.concave = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.concave.title = 'Concave';
Example.concave.for = '>0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.concave;
}

View file

@ -9,7 +9,7 @@ Example.constraints = function() {
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -42,7 +42,7 @@ Example.constraints = function() {
pointB: { x: -10, y: -10 } pointB: { x: -10, y: -10 }
}); });
World.add(world, [body, constraint]); Composite.add(world, [body, constraint]);
// add soft global constraint // add soft global constraint
var body = Bodies.polygon(280, 100, 3, 30); var body = Bodies.polygon(280, 100, 3, 30);
@ -54,7 +54,7 @@ Example.constraints = function() {
stiffness: 0.001 stiffness: 0.001
}); });
World.add(world, [body, constraint]); Composite.add(world, [body, constraint]);
// add damped soft global constraint // add damped soft global constraint
var body = Bodies.polygon(400, 100, 4, 30); var body = Bodies.polygon(400, 100, 4, 30);
@ -67,7 +67,7 @@ Example.constraints = function() {
damping: 0.05 damping: 0.05
}); });
World.add(world, [body, constraint]); Composite.add(world, [body, constraint]);
// add revolute constraint // add revolute constraint
var body = Bodies.rectangle(600, 200, 200, 20); var body = Bodies.rectangle(600, 200, 200, 20);
@ -79,7 +79,7 @@ Example.constraints = function() {
length: 0 length: 0
}); });
World.add(world, [body, ball, constraint]); Composite.add(world, [body, ball, constraint]);
// add revolute multi-body constraint // add revolute multi-body constraint
var body = Bodies.rectangle(500, 400, 100, 20, { collisionFilter: { group: -1 } }); var body = Bodies.rectangle(500, 400, 100, 20, { collisionFilter: { group: -1 } });
@ -90,7 +90,7 @@ Example.constraints = function() {
bodyB: ball bodyB: ball
}); });
World.add(world, [body, ball, constraint]); Composite.add(world, [body, ball, constraint]);
// add stiff multi-body constraint // add stiff multi-body constraint
var bodyA = Bodies.polygon(100, 400, 6, 20); var bodyA = Bodies.polygon(100, 400, 6, 20);
@ -103,7 +103,7 @@ Example.constraints = function() {
pointB: { x: -10, y: -10 } pointB: { x: -10, y: -10 }
}); });
World.add(world, [bodyA, bodyB, constraint]); Composite.add(world, [bodyA, bodyB, constraint]);
// add soft global constraint // add soft global constraint
var bodyA = Bodies.polygon(300, 400, 4, 20); var bodyA = Bodies.polygon(300, 400, 4, 20);
@ -117,7 +117,7 @@ Example.constraints = function() {
stiffness: 0.001 stiffness: 0.001
}); });
World.add(world, [bodyA, bodyB, constraint]); Composite.add(world, [bodyA, bodyB, constraint]);
// add damped soft global constraint // add damped soft global constraint
var bodyA = Bodies.polygon(500, 400, 6, 30); var bodyA = Bodies.polygon(500, 400, 6, 30);
@ -132,9 +132,9 @@ Example.constraints = function() {
damping: 0.1 damping: 0.1
}); });
World.add(world, [bodyA, bodyB, constraint]); Composite.add(world, [bodyA, bodyB, constraint]);
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -155,7 +155,7 @@ Example.constraints = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -177,4 +177,11 @@ Example.constraints = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.constraints.title = 'Constraints';
Example.constraints.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.constraints;
}

View file

@ -11,7 +11,6 @@ Example.doublePendulum = function() {
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies, Bodies = Matter.Bodies,
Vector = Matter.Vector; Vector = Matter.Vector;
@ -26,8 +25,7 @@ Example.doublePendulum = function() {
options: { options: {
width: 800, width: 800,
height: 600, height: 600,
wireframes: false, wireframes: false
background: '#0f0f13'
} }
}); });
@ -54,10 +52,7 @@ Example.doublePendulum = function() {
}); });
}); });
pendulum.bodies[0].render.strokeStyle = '#4a485b'; engine.gravity.scale = 0.002;
pendulum.bodies[1].render.strokeStyle = '#4a485b';
world.gravity.scale = 0.002;
Composites.chain(pendulum, 0.45, 0, -0.45, 0, { Composites.chain(pendulum, 0.45, 0, -0.45, 0, {
stiffness: 0.9, stiffness: 0.9,
@ -86,7 +81,7 @@ Example.doublePendulum = function() {
y: lowerArm.position.y y: lowerArm.position.y
}); });
World.add(world, pendulum); Composite.add(world, pendulum);
var trail = []; var trail = [];
@ -128,7 +123,7 @@ Example.doublePendulum = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -150,4 +145,11 @@ Example.doublePendulum = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.doublePendulum.title = 'Double Pendulum';
Example.doublePendulum.for = '>0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.doublePendulum;
}

View file

@ -11,7 +11,6 @@ Example.events = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -37,7 +36,7 @@ Example.events = function() {
// an example of using composite events on the world // an example of using composite events on the world
Events.on(world, 'afterAdd', function(event) { Events.on(world, 'afterAdd', function(event) {
console.log('added to world:', event.object); // do something with event.object
}); });
// an example of using beforeUpdate event on an engine // an example of using beforeUpdate event on an engine
@ -89,7 +88,7 @@ Example.events = function() {
var bodyStyle = { fillStyle: '#222' }; var bodyStyle = { fillStyle: '#222' };
// scene code // scene code
World.add(world, [ Composite.add(world, [
Bodies.rectangle(400, 0, 800, 50, { isStatic: true, render: bodyStyle }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true, render: bodyStyle }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true, render: bodyStyle }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true, render: bodyStyle }),
Bodies.rectangle(800, 300, 50, 600, { isStatic: true, render: bodyStyle }), Bodies.rectangle(800, 300, 50, 600, { isStatic: true, render: bodyStyle }),
@ -100,7 +99,7 @@ Example.events = function() {
return Bodies.circle(x, y, 15, { restitution: 1, render: bodyStyle }); return Bodies.circle(x, y, 15, { restitution: 1, render: bodyStyle });
}); });
World.add(world, stack); Composite.add(world, stack);
var shakeScene = function(engine) { var shakeScene = function(engine) {
var bodies = Composite.allBodies(engine.world); var bodies = Composite.allBodies(engine.world);
@ -131,7 +130,7 @@ Example.events = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -176,4 +175,11 @@ Example.events = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.events.title = 'Events';
Example.events.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.events;
}

View file

@ -6,7 +6,7 @@ Example.friction = function() {
Runner = Matter.Runner, Runner = Matter.Runner,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -31,7 +31,7 @@ Example.friction = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -39,18 +39,18 @@ Example.friction = function() {
Bodies.rectangle(0, 300, 50, 600, { isStatic: true }) Bodies.rectangle(0, 300, 50, 600, { isStatic: true })
]); ]);
World.add(world, [ Composite.add(world, [
Bodies.rectangle(300, 180, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), Bodies.rectangle(300, 180, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }),
Bodies.rectangle(300, 70, 40, 40, { friction: 0.001 }) Bodies.rectangle(300, 70, 40, 40, { friction: 0.001 })
]); ]);
World.add(world, [ Composite.add(world, [
Bodies.rectangle(300, 350, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), Bodies.rectangle(300, 350, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }),
Bodies.rectangle(300, 250, 40, 40, { friction: 0.0005 }) Bodies.rectangle(300, 250, 40, 40, { friction: 0.0005 })
]); ]);
World.add(world, [ Composite.add(world, [
Bodies.rectangle(300, 520, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), Bodies.rectangle(300, 520, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }),
Bodies.rectangle(300, 430, 40, 40, { friction: 0 }) Bodies.rectangle(300, 430, 40, 40, { friction: 0 })
]); ]);
@ -66,7 +66,7 @@ Example.friction = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -88,4 +88,11 @@ Example.friction = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.friction.title = 'Friction';
Example.friction.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.friction;
}

View file

@ -8,7 +8,7 @@ Example.gravity = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -34,14 +34,14 @@ Example.gravity = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50.5, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50.5, { isStatic: true }),
Bodies.rectangle(800, 300, 50, 600, { isStatic: true }), Bodies.rectangle(800, 300, 50, 600, { isStatic: true }),
Bodies.rectangle(0, 300, 50, 600, { isStatic: true }) Bodies.rectangle(0, 300, 50, 600, { isStatic: true })
]); ]);
engine.world.gravity.y = -1; engine.gravity.y = -1;
var stack = Composites.stack(50, 120, 11, 5, 0, 0, function(x, y) { var stack = Composites.stack(50, 120, 11, 5, 0, 0, function(x, y) {
switch (Math.round(Common.random(0, 1))) { switch (Math.round(Common.random(0, 1))) {
@ -58,7 +58,7 @@ Example.gravity = function() {
} }
}); });
World.add(world, stack); Composite.add(world, stack);
// add mouse control // add mouse control
var mouse = Mouse.create(render.canvas), var mouse = Mouse.create(render.canvas),
@ -72,7 +72,7 @@ Example.gravity = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -94,4 +94,11 @@ Example.gravity = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.gravity.title = 'Reverse Gravity';
Example.gravity.for = '>0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.gravity;
}

View file

@ -8,7 +8,7 @@ Example.gyro = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -59,7 +59,7 @@ Example.gyro = function() {
} }
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -68,26 +68,28 @@ Example.gyro = function() {
]); ]);
// add gyro control // add gyro control
var updateGravity = function(event) { if (typeof window !== 'undefined') {
var orientation = typeof window.orientation !== 'undefined' ? window.orientation : 0, var updateGravity = function(event) {
gravity = engine.world.gravity; var orientation = typeof window.orientation !== 'undefined' ? window.orientation : 0,
gravity = engine.gravity;
if (orientation === 0) { if (orientation === 0) {
gravity.x = Common.clamp(event.gamma, -90, 90) / 90; gravity.x = Common.clamp(event.gamma, -90, 90) / 90;
gravity.y = Common.clamp(event.beta, -90, 90) / 90; gravity.y = Common.clamp(event.beta, -90, 90) / 90;
} else if (orientation === 180) { } else if (orientation === 180) {
gravity.x = Common.clamp(event.gamma, -90, 90) / 90; gravity.x = Common.clamp(event.gamma, -90, 90) / 90;
gravity.y = Common.clamp(-event.beta, -90, 90) / 90; gravity.y = Common.clamp(-event.beta, -90, 90) / 90;
} else if (orientation === 90) { } else if (orientation === 90) {
gravity.x = Common.clamp(event.beta, -90, 90) / 90; gravity.x = Common.clamp(event.beta, -90, 90) / 90;
gravity.y = Common.clamp(-event.gamma, -90, 90) / 90; gravity.y = Common.clamp(-event.gamma, -90, 90) / 90;
} else if (orientation === -90) { } else if (orientation === -90) {
gravity.x = Common.clamp(-event.beta, -90, 90) / 90; gravity.x = Common.clamp(-event.beta, -90, 90) / 90;
gravity.y = Common.clamp(event.gamma, -90, 90) / 90; gravity.y = Common.clamp(event.gamma, -90, 90) / 90;
} }
}; };
window.addEventListener('deviceorientation', updateGravity); window.addEventListener('deviceorientation', updateGravity);
}
// add mouse control // add mouse control
var mouse = Mouse.create(render.canvas), var mouse = Mouse.create(render.canvas),
@ -101,7 +103,7 @@ Example.gyro = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -121,7 +123,16 @@ Example.gyro = function() {
stop: function() { stop: function() {
Matter.Render.stop(render); Matter.Render.stop(render);
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
window.removeEventListener('deviceorientation', updateGravity); if (typeof window !== 'undefined') {
window.removeEventListener('deviceorientation', updateGravity);
}
} }
}; };
}; };
Example.gyro.title = 'Gyroscope';
Example.gyro.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.gyro;
}

47
examples/index.js Normal file
View file

@ -0,0 +1,47 @@
module.exports = {
airFriction: require('./airFriction.js'),
avalanche: require('./avalanche.js'),
ballPool: require('./ballPool.js'),
bridge: require('./bridge.js'),
broadphase: require('./broadphase.js'),
car: require('./car.js'),
catapult: require('./catapult.js'),
chains: require('./chains.js'),
circleStack: require('./circleStack.js'),
cloth: require('./cloth.js'),
collisionFiltering: require('./collisionFiltering.js'),
compositeManipulation: require('./compositeManipulation.js'),
compound: require('./compound.js'),
compoundStack: require('./compoundStack.js'),
concave: require('./concave.js'),
constraints: require('./constraints.js'),
doublePendulum: require('./doublePendulum.js'),
events: require('./events.js'),
friction: require('./friction.js'),
gravity: require('./gravity.js'),
gyro: require('./gyro.js'),
manipulation: require('./manipulation.js'),
mixed: require('./mixed.js'),
newtonsCradle: require('./newtonsCradle.js'),
ragdoll: require('./ragdoll.js'),
pyramid: require('./pyramid.js'),
raycasting: require('./raycasting.js'),
restitution: require('./restitution.js'),
rounded: require('./rounded.js'),
sensors: require('./sensors.js'),
sleeping: require('./sleeping.js'),
slingshot: require('./slingshot.js'),
softBody: require('./softBody.js'),
sprites: require('./sprites.js'),
stack: require('./stack.js'),
staticFriction: require('./staticFriction.js'),
stats: require('./stats.js'),
stress: require('./stress.js'),
stress2: require('./stress2.js'),
stress3: require('./stress3.js'),
svg: require('./svg.js'),
terrain: require('./terrain.js'),
timescale: require('./timescale.js'),
views: require('./views.js'),
wreckingBall: require('./wreckingBall.js')
};

View file

@ -8,7 +8,7 @@ Example.manipulation = function() {
Events = Matter.Events, Events = Matter.Events,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -35,23 +35,23 @@ Example.manipulation = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var bodyA = Bodies.rectangle(100, 200, 50, 50, { isStatic: true }), var bodyA = Bodies.rectangle(100, 200, 50, 50, { isStatic: true, render: { fillStyle: '#060a19' } }),
bodyB = Bodies.rectangle(200, 200, 50, 50), bodyB = Bodies.rectangle(200, 200, 50, 50),
bodyC = Bodies.rectangle(300, 200, 50, 50), bodyC = Bodies.rectangle(300, 200, 50, 50),
bodyD = Bodies.rectangle(400, 200, 50, 50), bodyD = Bodies.rectangle(400, 200, 50, 50),
bodyE = Bodies.rectangle(550, 200, 50, 50), bodyE = Bodies.rectangle(550, 200, 50, 50),
bodyF = Bodies.rectangle(700, 200, 50, 50), bodyF = Bodies.rectangle(700, 200, 50, 50),
bodyG = Bodies.circle(400, 100, 25), bodyG = Bodies.circle(400, 100, 25, { render: { fillStyle: '#060a19' } }),
partA = Bodies.rectangle(600, 200, 120, 50), partA = Bodies.rectangle(600, 200, 120, 50, { render: { fillStyle: '#060a19' } }),
partB = Bodies.rectangle(660, 200, 50, 190), partB = Bodies.rectangle(660, 200, 50, 190, { render: { fillStyle: '#060a19' } }),
compound = Body.create({ compound = Body.create({
parts: [partA, partB], parts: [partA, partB],
isStatic: true isStatic: true
}); });
World.add(world, [bodyA, bodyB, bodyC, bodyD, bodyE, bodyF, bodyG, compound]); Composite.add(world, [bodyA, bodyB, bodyC, bodyD, bodyE, bodyF, bodyG, compound]);
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -116,7 +116,7 @@ Example.manipulation = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -138,4 +138,11 @@ Example.manipulation = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.manipulation.title = 'Manipulation';
Example.manipulation.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.manipulation;
}

View file

@ -8,7 +8,7 @@ Example.mixed = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -59,9 +59,9 @@ Example.mixed = function() {
} }
}); });
World.add(world, stack); Composite.add(world, stack);
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -81,7 +81,7 @@ Example.mixed = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -103,4 +103,11 @@ Example.mixed = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.mixed.title = 'Mixed Shapes';
Example.mixed.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.mixed;
}

View file

@ -8,7 +8,7 @@ Example.newtonsCradle = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World; Composite = Matter.Composite;
// create engine // create engine
var engine = Engine.create(), var engine = Engine.create(),
@ -31,13 +31,13 @@ Example.newtonsCradle = function() {
var runner = Runner.create(); var runner = Runner.create();
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // see newtonsCradle function defined later in this file
var cradle = Composites.newtonsCradle(280, 100, 5, 30, 200); var cradle = Example.newtonsCradle.newtonsCradle(280, 100, 5, 30, 200);
World.add(world, cradle); Composite.add(world, cradle);
Body.translate(cradle.bodies[0], { x: -180, y: -100 }); Body.translate(cradle.bodies[0], { x: -180, y: -100 });
cradle = Composites.newtonsCradle(280, 380, 7, 20, 140); cradle = Example.newtonsCradle.newtonsCradle(280, 380, 7, 20, 140);
World.add(world, cradle); Composite.add(world, cradle);
Body.translate(cradle.bodies[0], { x: -140, y: -100 }); Body.translate(cradle.bodies[0], { x: -140, y: -100 });
// add mouse control // add mouse control
@ -52,7 +52,7 @@ Example.newtonsCradle = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -74,4 +74,41 @@ Example.newtonsCradle = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.newtonsCradle.title = 'Newton\'s Cradle';
Example.newtonsCradle.for = '>=0.14.2';
/**
* Creates a composite with a Newton's Cradle setup of bodies and constraints.
* @method newtonsCradle
* @param {number} xx
* @param {number} yy
* @param {number} number
* @param {number} size
* @param {number} length
* @return {composite} A new composite newtonsCradle body
*/
Example.newtonsCradle.newtonsCradle = function(xx, yy, number, size, length) {
var Composite = Matter.Composite,
Constraint = Matter.Constraint,
Bodies = Matter.Bodies;
var newtonsCradle = Composite.create({ label: 'Newtons Cradle' });
for (var i = 0; i < number; i++) {
var separation = 1.9,
circle = Bodies.circle(xx + i * (size * separation), yy + length, size,
{ inertia: Infinity, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 1 }),
constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle });
Composite.addBody(newtonsCradle, circle);
Composite.addConstraint(newtonsCradle, constraint);
}
return newtonsCradle;
};
if (typeof module !== 'undefined') {
module.exports = Example.newtonsCradle;
}

View file

@ -7,7 +7,7 @@ Example.pyramid = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -32,11 +32,11 @@ Example.pyramid = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var stack = Composites.pyramid(100, 258, 15, 10, 0, 0, function(x, y) { var stack = Composites.pyramid(100, 605 - 25 - 16 * 20, 15, 10, 0, 0, function(x, y) {
return Bodies.rectangle(x, y, 40, 40); return Bodies.rectangle(x, y, 40, 40);
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
@ -57,7 +57,7 @@ Example.pyramid = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -79,4 +79,11 @@ Example.pyramid = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.pyramid.title = 'Pyramid';
Example.pyramid.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.pyramid;
}

View file

@ -12,7 +12,6 @@ Example.ragdoll = function() {
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies, Bodies = Matter.Bodies,
Vector = Matter.Vector; Vector = Matter.Vector;
@ -27,8 +26,7 @@ Example.ragdoll = function() {
options: { options: {
width: 800, width: 800,
height: 600, height: 600,
showAngleIndicator: true, showAngleIndicator: true
background: '#0f0f13'
} }
}); });
@ -45,7 +43,9 @@ Example.ragdoll = function() {
return Bodies.rectangle(x - 50, y + column * 50, 100, 1000, { return Bodies.rectangle(x - 50, y + column * 50, 100, 1000, {
isStatic: true, isStatic: true,
render: { render: {
fillStyle: '#222' fillStyle: '#060a19',
strokeStyle: '#ffffff',
lineWidth: 1
} }
}); });
}); });
@ -55,7 +55,7 @@ Example.ragdoll = function() {
var sides = Math.round(Common.random(1, 8)), var sides = Math.round(Common.random(1, 8)),
options = { options = {
render: { render: {
fillStyle: Common.choose(['#006BA6', '#0496FF', '#D81159', '#8F2D56']) fillStyle: Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1'])
} }
}; };
@ -79,7 +79,7 @@ Example.ragdoll = function() {
Composite.add(ragdolls, ragdoll); Composite.add(ragdolls, ragdoll);
} }
World.add(world, [stack, obstacles, ragdolls]); Composite.add(world, [stack, obstacles, ragdolls]);
var timeScaleTarget = 1, var timeScaleTarget = 1,
counter = 0; counter = 0;
@ -172,7 +172,7 @@ Example.ragdoll = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -495,4 +495,11 @@ Example.ragdoll.ragdoll = function(x, y, scale, options) {
}); });
return person; return person;
}; };
Example.ragdoll.title = 'Ragdoll';
Example.ragdoll.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.ragdoll;
}

View file

@ -11,7 +11,6 @@ Example.raycasting = function() {
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
Events = Matter.Events, Events = Matter.Events,
World = Matter.World,
Vertices = Matter.Vertices, Vertices = Matter.Vertices,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
@ -53,10 +52,13 @@ Example.raycasting = function() {
} }
}); });
// for testing raycasting on concave bodies
Common.setDecomp(require('poly-decomp'));
var star = Vertices.fromPath('50 0 63 38 100 38 69 59 82 100 50 75 18 100 31 59 0 38 37 38'), var star = Vertices.fromPath('50 0 63 38 100 38 69 59 82 100 50 75 18 100 31 59 0 38 37 38'),
concave = Bodies.fromVertices(200, 200, star); concave = Bodies.fromVertices(200, 200, star);
World.add(world, [ Composite.add(world, [
stack, stack,
concave, concave,
// walls // walls
@ -111,7 +113,7 @@ Example.raycasting = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -133,4 +135,11 @@ Example.raycasting = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.raycasting.title = 'Raycasting';
Example.raycasting.for = '>0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.raycasting;
}

View file

@ -6,7 +6,7 @@ Example.restitution = function() {
Runner = Matter.Runner, Runner = Matter.Runner,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -36,7 +36,7 @@ Example.restitution = function() {
var rest = 0.9, var rest = 0.9,
space = 600 / 5; space = 600 / 5;
World.add(world, [ Composite.add(world, [
Bodies.rectangle(100 + space * 0, 150, 50, 50, { restitution: rest }), Bodies.rectangle(100 + space * 0, 150, 50, 50, { restitution: rest }),
Bodies.rectangle(100 + space * 1, 150, 50, 50, { restitution: rest, angle: -Math.PI * 0.15 }), Bodies.rectangle(100 + space * 1, 150, 50, 50, { restitution: rest, angle: -Math.PI * 0.15 }),
Bodies.rectangle(100 + space * 2, 150, 50, 50, { restitution: rest, angle: -Math.PI * 0.25 }), Bodies.rectangle(100 + space * 2, 150, 50, 50, { restitution: rest, angle: -Math.PI * 0.25 }),
@ -61,7 +61,7 @@ Example.restitution = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -83,4 +83,11 @@ Example.restitution = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.restitution.title = 'Restitution';
Example.restitution.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.restitution;
}

View file

@ -6,7 +6,7 @@ Example.rounded = function() {
Runner = Matter.Runner, Runner = Matter.Runner,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -31,7 +31,7 @@ Example.rounded = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -39,7 +39,7 @@ Example.rounded = function() {
Bodies.rectangle(0, 300, 50, 600, { isStatic: true }) Bodies.rectangle(0, 300, 50, 600, { isStatic: true })
]); ]);
World.add(world, [ Composite.add(world, [
Bodies.rectangle(200, 200, 100, 100, { Bodies.rectangle(200, 200, 100, 100, {
chamfer: { radius: 20 } chamfer: { radius: 20 }
}), }),
@ -85,7 +85,7 @@ Example.rounded = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -107,4 +107,11 @@ Example.rounded = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.rounded.title = 'Rounded Corners (Chamfering)';
Example.rounded.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.rounded;
}

View file

@ -7,7 +7,7 @@ Example.sensors = function() {
Events = Matter.Events, Events = Matter.Events,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -21,8 +21,7 @@ Example.sensors = function() {
options: { options: {
width: 800, width: 800,
height: 600, height: 600,
wireframes: false, wireframes: false
background: '#111'
} }
}); });
@ -33,34 +32,34 @@ Example.sensors = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var redColor = '#C44D58', var colorA = '#f55a3c',
greenColor = '#C7F464'; colorB = '#f5d259';
var collider = Bodies.rectangle(400, 300, 500, 50, { var collider = Bodies.rectangle(400, 300, 500, 50, {
isSensor: true, isSensor: true,
isStatic: true, isStatic: true,
render: { render: {
strokeStyle: redColor, strokeStyle: colorA,
fillStyle: 'transparent', fillStyle: 'transparent',
lineWidth: 1 lineWidth: 1
} }
}); });
World.add(world, [ Composite.add(world, [
collider, collider,
Bodies.rectangle(400, 620, 800, 50, { Bodies.rectangle(400, 600, 800, 50, {
isStatic: true, isStatic: true,
render: { render: {
fillStyle: 'transparent', fillStyle: '#060a19',
lineWidth: 1 lineWidth: 0
} }
}) })
]); ]);
World.add(world, Composite.add(world,
Bodies.circle(400, 40, 30, { Bodies.circle(400, 40, 30, {
render: { render: {
strokeStyle: greenColor, strokeStyle: colorB,
fillStyle: 'transparent', fillStyle: 'transparent',
lineWidth: 1 lineWidth: 1
} }
@ -74,9 +73,9 @@ Example.sensors = function() {
var pair = pairs[i]; var pair = pairs[i];
if (pair.bodyA === collider) { if (pair.bodyA === collider) {
pair.bodyB.render.strokeStyle = redColor; pair.bodyB.render.strokeStyle = colorA;
} else if (pair.bodyB === collider) { } else if (pair.bodyB === collider) {
pair.bodyA.render.strokeStyle = redColor; pair.bodyA.render.strokeStyle = colorA;
} }
} }
}); });
@ -88,9 +87,9 @@ Example.sensors = function() {
var pair = pairs[i]; var pair = pairs[i];
if (pair.bodyA === collider) { if (pair.bodyA === collider) {
pair.bodyB.render.strokeStyle = greenColor; pair.bodyB.render.strokeStyle = colorB;
} else if (pair.bodyB === collider) { } else if (pair.bodyB === collider) {
pair.bodyA.render.strokeStyle = greenColor; pair.bodyA.render.strokeStyle = colorB;
} }
} }
}); });
@ -107,7 +106,7 @@ Example.sensors = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -129,4 +128,11 @@ Example.sensors = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.sensors.title = 'Sensors';
Example.sensors.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.sensors;
}

View file

@ -9,7 +9,7 @@ Example.sleeping = function() {
Events = Matter.Events, Events = Matter.Events,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -36,7 +36,7 @@ Example.sleeping = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -59,7 +59,7 @@ Example.sleeping = function() {
} }
}); });
World.add(world, stack); Composite.add(world, stack);
for (var i = 0; i < stack.bodies.length; i++) { for (var i = 0; i < stack.bodies.length; i++) {
Events.on(stack.bodies[i], 'sleepStart sleepEnd', function(event) { Events.on(stack.bodies[i], 'sleepStart sleepEnd', function(event) {
@ -80,7 +80,7 @@ Example.sleeping = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -102,4 +102,11 @@ Example.sleeping = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.sleeping.title = 'Sleeping';
Example.sleeping.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.sleeping;
}

View file

@ -9,7 +9,7 @@ Example.slingshot = function() {
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -34,7 +34,7 @@ Example.slingshot = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var ground = Bodies.rectangle(395, 600, 815, 50, { isStatic: true }), var ground = Bodies.rectangle(395, 600, 815, 50, { isStatic: true, render: { fillStyle: '#060a19' } }),
rockOptions = { density: 0.004 }, rockOptions = { density: 0.004 },
rock = Bodies.polygon(170, 450, 8, 20, rockOptions), rock = Bodies.polygon(170, 450, 8, 20, rockOptions),
anchor = { x: 170, y: 450 }, anchor = { x: 170, y: 450 },
@ -48,18 +48,18 @@ Example.slingshot = function() {
return Bodies.rectangle(x, y, 25, 40); return Bodies.rectangle(x, y, 25, 40);
}); });
var ground2 = Bodies.rectangle(610, 250, 200, 20, { isStatic: true }); var ground2 = Bodies.rectangle(610, 250, 200, 20, { isStatic: true, render: { fillStyle: '#060a19' } });
var pyramid2 = Composites.pyramid(550, 0, 5, 10, 0, 0, function(x, y) { var pyramid2 = Composites.pyramid(550, 0, 5, 10, 0, 0, function(x, y) {
return Bodies.rectangle(x, y, 25, 40); return Bodies.rectangle(x, y, 25, 40);
}); });
World.add(engine.world, [ground, pyramid, ground2, pyramid2, rock, elastic]); Composite.add(engine.world, [ground, pyramid, ground2, pyramid2, rock, elastic]);
Events.on(engine, 'afterUpdate', function() { Events.on(engine, 'afterUpdate', function() {
if (mouseConstraint.mouse.button === -1 && (rock.position.x > 190 || rock.position.y < 430)) { if (mouseConstraint.mouse.button === -1 && (rock.position.x > 190 || rock.position.y < 430)) {
rock = Bodies.polygon(170, 450, 7, 20, rockOptions); rock = Bodies.polygon(170, 450, 7, 20, rockOptions);
World.add(engine.world, rock); Composite.add(engine.world, rock);
elastic.bodyB = rock; elastic.bodyB = rock;
} }
}); });
@ -76,7 +76,7 @@ Example.slingshot = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -98,4 +98,11 @@ Example.slingshot = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.slingshot.title = 'Slingshot';
Example.slingshot.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.slingshot;
}

View file

@ -7,7 +7,7 @@ Example.softBody = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -38,10 +38,11 @@ Example.softBody = function() {
render: { visible: true } render: { visible: true }
}; };
World.add(world, [ Composite.add(world, [
Composites.softBody(250, 100, 5, 5, 0, 0, true, 18, particleOptions), // see softBody function defined later in this file
Composites.softBody(400, 300, 8, 3, 0, 0, true, 15, particleOptions), Example.softBody.softBody(250, 100, 5, 5, 0, 0, true, 18, particleOptions),
Composites.softBody(250, 400, 4, 4, 0, 0, true, 15, particleOptions), Example.softBody.softBody(400, 300, 8, 3, 0, 0, true, 15, particleOptions),
Example.softBody.softBody(250, 400, 4, 4, 0, 0, true, 15, particleOptions),
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -61,7 +62,7 @@ Example.softBody = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -83,4 +84,45 @@ Example.softBody = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.softBody.title = 'Soft Body';
Example.softBody.for = '>=0.14.2';
/**
* Creates a simple soft body like object.
* @method softBody
* @param {number} xx
* @param {number} yy
* @param {number} columns
* @param {number} rows
* @param {number} columnGap
* @param {number} rowGap
* @param {boolean} crossBrace
* @param {number} particleRadius
* @param {} particleOptions
* @param {} constraintOptions
* @return {composite} A new composite softBody
*/
Example.softBody.softBody = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) {
var Common = Matter.Common,
Composites = Matter.Composites,
Bodies = Matter.Bodies;
particleOptions = Common.extend({ inertia: Infinity }, particleOptions);
constraintOptions = Common.extend({ stiffness: 0.2, render: { type: 'line', anchors: false } }, constraintOptions);
var softBody = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y) {
return Bodies.circle(x, y, particleRadius, particleOptions);
});
Composites.mesh(softBody, columns, rows, crossBrace, constraintOptions);
softBody.label = 'Soft Body';
return softBody;
};
if (typeof module !== 'undefined') {
module.exports = Example.softBody;
}

View file

@ -8,7 +8,7 @@ Example.sprites = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -22,7 +22,6 @@ Example.sprites = function() {
options: { options: {
width: 800, width: 800,
height: 600, height: 600,
background: '#0f0f13',
showAngleIndicator: false, showAngleIndicator: false,
wireframes: false wireframes: false
} }
@ -43,7 +42,7 @@ Example.sprites = function() {
world.bodies = []; world.bodies = [];
// these static walls will not be rendered in this sprites example, see options // these static walls will not be rendered in this sprites example, see options
World.add(world, [ Composite.add(world, [
Bodies.rectangle(400, -offset, 800.5 + 2 * offset, 50.5, options), Bodies.rectangle(400, -offset, 800.5 + 2 * offset, 50.5, options),
Bodies.rectangle(400, 600 + offset, 800.5 + 2 * offset, 50.5, options), Bodies.rectangle(400, 600 + offset, 800.5 + 2 * offset, 50.5, options),
Bodies.rectangle(800 + offset, 300, 50.5, 600.5 + 2 * offset, options), Bodies.rectangle(800 + offset, 300, 50.5, 600.5 + 2 * offset, options),
@ -75,7 +74,7 @@ Example.sprites = function() {
} }
}); });
World.add(world, stack); Composite.add(world, stack);
// add mouse control // add mouse control
var mouse = Mouse.create(render.canvas), var mouse = Mouse.create(render.canvas),
@ -89,7 +88,7 @@ Example.sprites = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -111,4 +110,11 @@ Example.sprites = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.sprites.title = 'Sprites';
Example.sprites.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.sprites;
}

View file

@ -7,7 +7,7 @@ Example.stack = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -32,11 +32,11 @@ Example.stack = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var stack = Composites.stack(200, 380, 10, 5, 0, 0, function(x, y) { var stack = Composites.stack(200, 606 - 25.25 - 5 * 40, 10, 5, 0, 0, function(x, y) {
return Bodies.rectangle(x, y, 40, 40); return Bodies.rectangle(x, y, 40, 40);
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
@ -57,7 +57,7 @@ Example.stack = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -79,4 +79,11 @@ Example.stack = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.stack.title = 'Stack';
Example.stack.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.stack;
}

View file

@ -9,7 +9,7 @@ Example.staticFriction = function() {
Events = Matter.Events, Events = Matter.Events,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -34,7 +34,7 @@ Example.staticFriction = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var body = Bodies.rectangle(400, 500, 200, 60, { isStatic: true, chamfer: 10 }), var body = Bodies.rectangle(400, 500, 200, 60, { isStatic: true, chamfer: 10, render: { fillStyle: '#060a19' } }),
size = 50, size = 50,
counter = -1; counter = -1;
@ -46,7 +46,7 @@ Example.staticFriction = function() {
}); });
}); });
World.add(world, [ Composite.add(world, [
body, body,
stack, stack,
// walls // walls
@ -82,7 +82,7 @@ Example.staticFriction = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -104,4 +104,11 @@ Example.staticFriction = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.staticFriction.title = 'Static Friction';
Example.staticFriction.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.staticFriction;
}

91
examples/stats.js Normal file
View file

@ -0,0 +1,91 @@
var Example = Example || {};
Example.stats = function() {
var Engine = Matter.Engine,
Render = Matter.Render,
Runner = Matter.Runner,
Common = Matter.Common,
Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies;
// create engine
var engine = Engine.create(),
world = engine.world;
// create renderer
var render = Render.create({
element: document.body,
engine: engine,
options: {
width: 800,
height: 600,
// show stats and performance monitors
showStats: true,
showPerformance: true
}
});
Render.run(render);
// create runner
var runner = Runner.create();
Runner.run(runner, engine);
// scene code
var stack = Composites.stack(70, 30, 13, 9, 5, 5, function(x, y) {
return Bodies.circle(x, y, 10 + Common.random() * 20);
});
World.add(world, [
stack,
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
Bodies.rectangle(800, 300, 50, 600, { isStatic: true }),
Bodies.rectangle(0, 300, 50, 600, { isStatic: true })
]);
// add mouse control
var mouse = Mouse.create(render.canvas),
mouseConstraint = MouseConstraint.create(engine, {
mouse: mouse,
constraint: {
stiffness: 0.2,
render: {
visible: false
}
}
});
World.add(world, mouseConstraint);
// keep the mouse in sync with rendering
render.mouse = mouse;
// fit the render viewport to the scene
Render.lookAt(render, {
min: { x: 0, y: 0 },
max: { x: 800, y: 600 }
});
// context for MatterTools.Demo
return {
engine: engine,
runner: runner,
render: render,
canvas: render.canvas,
stop: function() {
Matter.Render.stop(render);
Matter.Runner.stop(runner);
}
};
};
Example.stats.title = 'Stats & Performance';
Example.stats.for = '>=0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.stats;
}

View file

@ -7,7 +7,7 @@ Example.stress = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -20,7 +20,9 @@ Example.stress = function() {
engine: engine, engine: engine,
options: { options: {
width: 800, width: 800,
height: 600 height: 600,
showStats: true,
showPerformance: true
} }
}); });
@ -31,11 +33,11 @@ Example.stress = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// scene code // scene code
var stack = Composites.stack(90, 50, 18, 15, 0, 0, function(x, y) { var stack = Composites.stack(90, 600 - 25 - 15 * 35, 18, 15, 0, 0, function(x, y) {
return Bodies.rectangle(x, y, 35, 35); return Bodies.rectangle(x, y, 35, 35);
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -55,7 +57,7 @@ Example.stress = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -77,4 +79,11 @@ Example.stress = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.stress.title = 'Stress';
Example.stress.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.stress;
}

View file

@ -7,7 +7,7 @@ Example.stress2 = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -20,7 +20,9 @@ Example.stress2 = function() {
engine: engine, engine: engine,
options: { options: {
width: 800, width: 800,
height: 600 height: 600,
showStats: true,
showPerformance: true
} }
}); });
@ -31,11 +33,11 @@ Example.stress2 = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// scene code // scene code
var stack = Composites.stack(100, 120, 25, 18, 0, 0, function(x, y) { var stack = Composites.stack(100, 600 - 25 - 18 * 25, 25, 18, 0, 0, function(x, y) {
return Bodies.rectangle(x, y, 25, 25); return Bodies.rectangle(x, y, 25, 25);
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
@ -55,7 +57,7 @@ Example.stress2 = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -77,4 +79,11 @@ Example.stress2 = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.stress2.title = 'Stress 2';
Example.stress2.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.stress2;
}

107
examples/stress3.js Normal file
View file

@ -0,0 +1,107 @@
var Example = Example || {};
Example.stress3 = function() {
var Engine = Matter.Engine,
Render = Matter.Render,
Runner = Matter.Runner,
Composites = Matter.Composites,
Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse,
Composite = Matter.Composite,
Bodies = Matter.Bodies;
// create engine
var engine = Engine.create(),
world = engine.world;
// create renderer
var render = Render.create({
element: document.body,
engine: engine,
options: {
width: 800,
height: 600,
showStats: true,
showPerformance: true
}
});
Render.run(render);
// create runner
var runner = Runner.create({
isFixed: true
});
Runner.run(runner, engine);
// add bodies
var scale = 0.3;
var stack = Composites.stack(40, 40, 38, 18, 0, 0, function(x, y) {
var sides = Math.round(Common.random(1, 8));
switch (Math.round(Common.random(0, 1))) {
case 0:
if (Common.random() < 0.8) {
return Bodies.rectangle(x, y, Common.random(25, 50) * scale, Common.random(25, 50) * scale);
} else {
return Bodies.rectangle(x, y, Common.random(80, 120) * scale, Common.random(25, 30) * scale);
}
case 1:
return Bodies.polygon(x, y, sides, Common.random(25, 50) * scale);
}
});
Composite.add(world, stack);
Composite.add(world, [
// walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
Bodies.rectangle(800, 300, 50, 600, { isStatic: true }),
Bodies.rectangle(0, 300, 50, 600, { isStatic: true })
]);
// add mouse control
var mouse = Mouse.create(render.canvas),
mouseConstraint = MouseConstraint.create(engine, {
mouse: mouse,
constraint: {
stiffness: 0.2,
render: {
visible: false
}
}
});
Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering
render.mouse = mouse;
// fit the render viewport to the scene
Render.lookAt(render, {
min: { x: 0, y: 0 },
max: { x: 800, y: 600 }
});
// context for MatterTools.Demo
return {
engine: engine,
runner: runner,
render: render,
canvas: render.canvas,
stop: function() {
Matter.Render.stop(render);
Matter.Runner.stop(runner);
}
};
};
Example.stress3.title = 'Stress 3';
Example.stress3.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.stress3;
}

View file

@ -7,11 +7,14 @@ Example.svg = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Vertices = Matter.Vertices, Vertices = Matter.Vertices,
Svg = Matter.Svg, Svg = Matter.Svg,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// provide concave decomposition support library
Common.setDecomp(require('poly-decomp'));
// create engine // create engine
var engine = Engine.create(), var engine = Engine.create(),
world = engine.world; world = engine.world;
@ -33,25 +36,30 @@ Example.svg = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var svgs = [ if (typeof fetch !== 'undefined') {
'iconmonstr-check-mark-8-icon', var select = function(root, selector) {
'iconmonstr-paperclip-2-icon', return Array.prototype.slice.call(root.querySelectorAll(selector));
'iconmonstr-puzzle-icon', };
'iconmonstr-user-icon'
];
for (var i = 0; i < svgs.length; i += 1) { var loadSvg = function(url) {
(function(i) { return fetch(url)
$.get('./svg/' + svgs[i] + '.svg').done(function(data) { .then(function(response) { return response.text(); })
var vertexSets = [], .then(function(raw) { return (new window.DOMParser()).parseFromString(raw, 'image/svg+xml'); });
color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); };
$(data).find('path').each(function(i, path) { ([
var points = Svg.pathToVertices(path, 30); './svg/iconmonstr-check-mark-8-icon.svg',
vertexSets.push(Vertices.scale(points, 0.4, 0.4)); './svg/iconmonstr-paperclip-2-icon.svg',
}); './svg/iconmonstr-puzzle-icon.svg',
'./svg/iconmonstr-user-icon.svg'
]).forEach(function(path, i) {
loadSvg(path).then(function(root) {
var color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']);
World.add(world, Bodies.fromVertices(100 + i * 150, 200 + i * 50, vertexSets, { var vertexSets = select(root, 'path')
.map(function(path) { return Vertices.scale(Svg.pathToVertices(path, 30), 0.4, 0.4); });
Composite.add(world, Bodies.fromVertices(100 + i * 150, 200 + i * 50, vertexSets, {
render: { render: {
fillStyle: color, fillStyle: color,
strokeStyle: color, strokeStyle: color,
@ -59,27 +67,27 @@ Example.svg = function() {
} }
}, true)); }, true));
}); });
})(i);
}
$.get('./svg/svg.svg').done(function(data) {
var vertexSets = [],
color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']);
$(data).find('path').each(function(i, path) {
vertexSets.push(Svg.pathToVertices(path, 30));
}); });
World.add(world, Bodies.fromVertices(400, 80, vertexSets, { loadSvg('./svg/svg.svg').then(function(root) {
render: { var color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']);
fillStyle: color,
strokeStyle: color, var vertexSets = select(root, 'path')
lineWidth: 1 .map(function(path) { return Svg.pathToVertices(path, 30); });
}
}, true));
});
World.add(world, [ Composite.add(world, Bodies.fromVertices(400, 80, vertexSets, {
render: {
fillStyle: color,
strokeStyle: color,
lineWidth: 1
}
}, true));
});
} else {
Common.warn('Fetch is not available. Could not load SVG.');
}
Composite.add(world, [
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
Bodies.rectangle(800, 300, 50, 600, { isStatic: true }), Bodies.rectangle(800, 300, 50, 600, { isStatic: true }),
@ -98,7 +106,7 @@ Example.svg = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -120,4 +128,11 @@ Example.svg = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.svg.title = 'Concave SVG Paths';
Example.svg.for = '>0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.svg;
}

View file

@ -8,11 +8,14 @@ Example.terrain = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Query = Matter.Query, Query = Matter.Query,
Svg = Matter.Svg, Svg = Matter.Svg,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// provide concave decomposition support library
Common.setDecomp(require('poly-decomp'));
// create engine // create engine
var engine = Engine.create(), var engine = Engine.create(),
world = engine.world; world = engine.world;
@ -34,38 +37,49 @@ Example.terrain = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
var terrain; if (typeof fetch !== 'undefined') {
var select = function(root, selector) {
$.get('./svg/terrain.svg').done(function(data) { return Array.prototype.slice.call(root.querySelectorAll(selector));
var vertexSets = [];
$(data).find('path').each(function(i, path) {
vertexSets.push(Svg.pathToVertices(path, 30));
});
terrain = Bodies.fromVertices(400, 350, vertexSets, {
isStatic: true,
render: {
fillStyle: '#2e2b44',
strokeStyle: '#2e2b44',
lineWidth: 1
}
}, true);
World.add(world, terrain);
var bodyOptions = {
frictionAir: 0,
friction: 0.0001,
restitution: 0.6
}; };
World.add(world, Composites.stack(80, 100, 20, 20, 10, 10, function(x, y) { var loadSvg = function(url) {
if (Query.point([terrain], { x: x, y: y }).length === 0) { return fetch(url)
return Bodies.polygon(x, y, 5, 12, bodyOptions); .then(function(response) { return response.text(); })
} .then(function(raw) { return (new window.DOMParser()).parseFromString(raw, 'image/svg+xml'); });
})); };
});
loadSvg('./svg/terrain.svg')
.then(function(root) {
var paths = select(root, 'path');
var vertexSets = paths.map(function(path) { return Svg.pathToVertices(path, 30); });
var terrain = Bodies.fromVertices(400, 350, vertexSets, {
isStatic: true,
render: {
fillStyle: '#060a19',
strokeStyle: '#060a19',
lineWidth: 1
}
}, true);
Composite.add(world, terrain);
var bodyOptions = {
frictionAir: 0,
friction: 0.0001,
restitution: 0.6
};
Composite.add(world, Composites.stack(80, 100, 20, 20, 10, 10, function(x, y) {
if (Query.point([terrain], { x: x, y: y }).length === 0) {
return Bodies.polygon(x, y, 5, 12, bodyOptions);
}
}));
});
} else {
Common.warn('Fetch is not available. Could not load SVG.');
}
// add mouse control // add mouse control
var mouse = Mouse.create(render.canvas), var mouse = Mouse.create(render.canvas),
@ -79,7 +93,7 @@ Example.terrain = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -101,4 +115,11 @@ Example.terrain = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.terrain.title = 'Terrain';
Example.terrain.for = '>0.16.1';
if (typeof module !== 'undefined') {
module.exports = Example.terrain;
}

View file

@ -11,7 +11,6 @@ Example.timescale = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
// create engine // create engine
@ -36,7 +35,7 @@ Example.timescale = function() {
Runner.run(runner, engine); Runner.run(runner, engine);
// add bodies // add bodies
World.add(world, [ Composite.add(world, [
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
Bodies.rectangle(400, 600, 800, 50, { isStatic: true }), Bodies.rectangle(400, 600, 800, 50, { isStatic: true }),
Bodies.rectangle(800, 300, 50, 600, { isStatic: true }), Bodies.rectangle(800, 300, 50, 600, { isStatic: true }),
@ -95,12 +94,12 @@ Example.timescale = function() {
}; };
// add some small bouncy circles... remember Swordfish? // add some small bouncy circles... remember Swordfish?
World.add(world, Composites.stack(20, 100, 15, 3, 20, 40, function(x, y) { Composite.add(world, Composites.stack(20, 100, 15, 3, 20, 40, function(x, y) {
return Bodies.circle(x, y, Common.random(10, 20), bodyOptions); return Bodies.circle(x, y, Common.random(10, 20), bodyOptions);
})); }));
// add some larger random bouncy objects // add some larger random bouncy objects
World.add(world, Composites.stack(50, 50, 8, 3, 0, 0, function(x, y) { Composite.add(world, Composites.stack(50, 50, 8, 3, 0, 0, function(x, y) {
switch (Math.round(Common.random(0, 1))) { switch (Math.round(Common.random(0, 1))) {
case 0: case 0:
@ -127,7 +126,7 @@ Example.timescale = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -149,4 +148,11 @@ Example.timescale = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.timescale.title = 'Time Scaling';
Example.timescale.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.timescale;
}

View file

@ -9,7 +9,7 @@ Example.views = function() {
Common = Matter.Common, Common = Matter.Common,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Vector = Matter.Vector, Vector = Matter.Vector,
Bounds = Matter.Bounds, Bounds = Matter.Bounds,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
@ -48,13 +48,13 @@ Example.views = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
// add bodies // add bodies
var stack = Composites.stack(20, 20, 15, 4, 0, 0, function(x, y) { var stack = Composites.stack(20, 20, 10, 4, 0, 0, function(x, y) {
switch (Math.round(Common.random(0, 1))) { switch (Math.round(Common.random(0, 1))) {
case 0: case 0:
@ -70,7 +70,7 @@ Example.views = function() {
} }
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
@ -85,11 +85,11 @@ Example.views = function() {
y: render.options.height * 0.5 y: render.options.height * 0.5
}; };
// make the world bounds a little bigger than the render bounds // create limits for the viewport
world.bounds.min.x = -300; var extents = {
world.bounds.min.y = -300; min: { x: -300, y: -300 },
world.bounds.max.x = 1100; max: { x: 1100, y: 900 }
world.bounds.max.y = 900; };
// keep track of current bounds scale (view zoom) // keep track of current bounds scale (view zoom)
var boundsScaleTarget = 1, var boundsScaleTarget = 1,
@ -98,8 +98,8 @@ Example.views = function() {
y: 1 y: 1
}; };
// use the engine tick event to control our view // use a render event to control our view
Events.on(engine, 'beforeTick', function() { Events.on(render, 'beforeRender', function() {
var world = engine.world, var world = engine.world,
mouse = mouseConstraint.mouse, mouse = mouseConstraint.mouse,
translate; translate;
@ -148,18 +148,18 @@ Example.views = function() {
translate = Vector.mult(direction, speed); translate = Vector.mult(direction, speed);
// prevent the view moving outside the world bounds // prevent the view moving outside the extents
if (render.bounds.min.x + translate.x < world.bounds.min.x) if (render.bounds.min.x + translate.x < extents.min.x)
translate.x = world.bounds.min.x - render.bounds.min.x; translate.x = extents.min.x - render.bounds.min.x;
if (render.bounds.max.x + translate.x > world.bounds.max.x) if (render.bounds.max.x + translate.x > extents.max.x)
translate.x = world.bounds.max.x - render.bounds.max.x; translate.x = extents.max.x - render.bounds.max.x;
if (render.bounds.min.y + translate.y < world.bounds.min.y) if (render.bounds.min.y + translate.y < extents.min.y)
translate.y = world.bounds.min.y - render.bounds.min.y; translate.y = extents.min.y - render.bounds.min.y;
if (render.bounds.max.y + translate.y > world.bounds.max.y) if (render.bounds.max.y + translate.y > extents.max.y)
translate.y = world.bounds.max.y - render.bounds.max.y; translate.y = extents.max.y - render.bounds.max.y;
// move the view // move the view
Bounds.translate(render.bounds, translate); Bounds.translate(render.bounds, translate);
@ -180,4 +180,11 @@ Example.views = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.views.title = 'Views';
Example.views.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.views;
}

View file

@ -7,7 +7,7 @@ Example.wreckingBall = function() {
Composites = Matter.Composites, Composites = Matter.Composites,
MouseConstraint = Matter.MouseConstraint, MouseConstraint = Matter.MouseConstraint,
Mouse = Matter.Mouse, Mouse = Matter.Mouse,
World = Matter.World, Composite = Matter.Composite,
Constraint = Matter.Constraint, Constraint = Matter.Constraint,
Bodies = Matter.Bodies; Bodies = Matter.Bodies;
@ -34,13 +34,13 @@ Example.wreckingBall = function() {
// add bodies // add bodies
var rows = 10, var rows = 10,
yy = 600 - 21 - 40 * rows; yy = 600 - 25 - 40 * rows;
var stack = Composites.stack(400, yy, 5, rows, 0, 0, function(x, y) { var stack = Composites.stack(400, yy, 5, rows, 0, 0, function(x, y) {
return Bodies.rectangle(x, y, 40, 40); return Bodies.rectangle(x, y, 40, 40);
}); });
World.add(world, [ Composite.add(world, [
stack, stack,
// walls // walls
Bodies.rectangle(400, 0, 800, 50, { isStatic: true }), Bodies.rectangle(400, 0, 800, 50, { isStatic: true }),
@ -51,8 +51,8 @@ Example.wreckingBall = function() {
var ball = Bodies.circle(100, 400, 50, { density: 0.04, frictionAir: 0.005}); var ball = Bodies.circle(100, 400, 50, { density: 0.04, frictionAir: 0.005});
World.add(world, ball); Composite.add(world, ball);
World.add(world, Constraint.create({ Composite.add(world, Constraint.create({
pointA: { x: 300, y: 100 }, pointA: { x: 300, y: 100 },
bodyB: ball bodyB: ball
})); }));
@ -69,7 +69,7 @@ Example.wreckingBall = function() {
} }
}); });
World.add(world, mouseConstraint); Composite.add(world, mouseConstraint);
// keep the mouse in sync with rendering // keep the mouse in sync with rendering
render.mouse = mouse; render.mouse = mouse;
@ -91,4 +91,11 @@ Example.wreckingBall = function() {
Matter.Runner.stop(runner); Matter.Runner.stop(runner);
} }
}; };
}; };
Example.wreckingBall.title = 'Wrecking Ball';
Example.wreckingBall.for = '>=0.14.2';
if (typeof module !== 'undefined') {
module.exports = Example.wreckingBall;
}

30427
package-lock.json generated Normal file

File diff suppressed because it is too large Load diff

View file

@ -1,6 +1,6 @@
{ {
"name": "matter-js", "name": "matter-js",
"version": "0.14.2", "version": "0.17.1",
"license": "MIT", "license": "MIT",
"homepage": "http://brm.io/matter-js/", "homepage": "http://brm.io/matter-js/",
"author": "Liam Brummitt <liam@brm.io> (http://brm.io/)", "author": "Liam Brummitt <liam@brm.io> (http://brm.io/)",
@ -20,40 +20,46 @@
"rigid body physics" "rigid body physics"
], ],
"devDependencies": { "devDependencies": {
"browserify": "^14.0.0", "conventional-changelog-cli": "^2.1.1",
"cheerio": "^0.22.0", "eslint": "^6.8.0",
"connect-livereload": "^0.6.0", "html-webpack-plugin": "^4.5.1",
"event-stream": "^3.3.2", "jest": "^25.1.0",
"fast-json-patch": "^1.1.4", "jest-worker": "^24.9.0",
"gulp": "^3.9.0", "json-stringify-pretty-compact": "^2.0.0",
"gulp-bump": "^2.6.1", "matter-tools": "^0.14.0",
"gulp-clone": "^1.0.0", "matter-wrap": "^0.2.0",
"gulp-concat": "^2.6.0", "mock-require": "^3.0.3",
"gulp-conventional-changelog": "^1.1.0", "pathseg": "^1.2.0",
"gulp-derequire": "^2.1.0", "poly-decomp": "^0.3.0",
"gulp-eslint": "^3.0.1", "puppeteer-core": "^5.5.0",
"gulp-github-release": "^1.2.1", "terser-webpack-plugin": "^4.2.3",
"gulp-header": "^1.7.1", "webpack": "^4.46.0",
"gulp-preprocess": "^2.0.0", "webpack-bundle-analyzer": "^4.4.0",
"gulp-rename": "^1.2.2", "webpack-cli": "^3.3.11",
"gulp-replace": "^0.5.4", "webpack-dev-server": "^3.11.1"
"gulp-tag-version": "^1.3.0",
"gulp-uglify": "^2.0.1",
"gulp-util": "^3.0.8",
"gulp-webdriver": "^2.0.3",
"gulp-webserver": "^0.9.1",
"mkdirp": "^0.5.1",
"rimraf": "^2.4.2",
"run-sequence": "^1.1.4",
"through2": "^2.0.3",
"vinyl-transform": "^1.0.0",
"watchify": "^3.9.0",
"yuidocjs": "^0.10.2"
}, },
"scripts": { "scripts": {
"test": "gulp build:dev && gulp lint" "start": "npm run dev",
"dev": "npm run serve -- --open",
"serve": "webpack-dev-server --no-cache --mode development --config webpack.demo.config.js",
"watch": "nodemon --watch webpack.demo.config.js --exec \"npm run serve\"",
"build": "webpack --mode=production --no-hot --no-watch & webpack --mode=production --no-hot --no-watch --env.MINIMIZE",
"build-alpha": "webpack --mode=production --env.ALPHA & webpack --mode=production --env.MINIMIZE --env.ALPHA",
"build-demo": "rm -rf ./demo/js && webpack --no-hot --no-watch --config webpack.demo.config.js --mode=production && webpack --no-hot --no-watch --config webpack.demo.config.js --mode=production --env.MINIMIZE",
"lint": "eslint 'src/**/*.js' 'demo/src/**/*.js' 'examples/*.js' 'webpack.*.js'",
"doc": "yuidoc --config yuidoc.json --project-version $npm_package_version",
"doc-watch": "nodemon --delay 3 --watch 'matter-doc-theme' --watch src -e 'js,html,css,handlebars' --exec 'npm run doc'",
"test": "npm run test-node",
"test-all": "jest --no-cache",
"test-save": "SAVE=true npm run test-node",
"test-watch": "npm run test-node -- --watch",
"test-node": "jest --no-cache ./test/Examples.spec.js",
"test-browser": "jest --no-cache ./test/Browser.spec.js",
"changelog": "conventional-changelog -i CHANGELOG.md -s -r",
"release": "npm version --no-git-tag-version",
"preversion": "git checkout master && npm run lint && SAVE=true npm run test-all",
"version": "git checkout -b release/$npm_package_version && npm run build"
}, },
"dependencies": {},
"files": [ "files": [
"src", "src",
"build", "build",

View file

@ -49,7 +49,6 @@ var Axes = require('../geometry/Axes');
force: { x: 0, y: 0 }, force: { x: 0, y: 0 },
torque: 0, torque: 0,
positionImpulse: { x: 0, y: 0 }, positionImpulse: { x: 0, y: 0 },
previousPositionImpulse: { x: 0, y: 0 },
constraintImpulse: { x: 0, y: 0, angle: 0 }, constraintImpulse: { x: 0, y: 0, angle: 0 },
totalContacts: 0, totalContacts: 0,
speed: 0, speed: 0,
@ -76,13 +75,15 @@ var Axes = require('../geometry/Axes');
render: { render: {
visible: true, visible: true,
opacity: 1, opacity: 1,
strokeStyle: null,
fillStyle: null,
lineWidth: null,
sprite: { sprite: {
xScale: 1, xScale: 1,
yScale: 1, yScale: 1,
xOffset: 0, xOffset: 0,
yOffset: 0 yOffset: 0
}, }
lineWidth: 0
}, },
events: null, events: null,
bounds: null, bounds: null,
@ -166,10 +167,12 @@ var Axes = require('../geometry/Axes');
}); });
// render properties // render properties
var defaultFillStyle = (body.isStatic ? '#2e2b44' : Common.choose(['#006BA6', '#0496FF', '#FFBC42', '#D81159', '#8F2D56'])), var defaultFillStyle = (body.isStatic ? '#14151f' : Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1'])),
defaultStrokeStyle = '#000'; defaultStrokeStyle = body.isStatic ? '#555' : '#ccc',
defaultLineWidth = body.isStatic && body.render.fillStyle === null ? 1 : 0;
body.render.fillStyle = body.render.fillStyle || defaultFillStyle; body.render.fillStyle = body.render.fillStyle || defaultFillStyle;
body.render.strokeStyle = body.render.strokeStyle || defaultStrokeStyle; body.render.strokeStyle = body.render.strokeStyle || defaultStrokeStyle;
body.render.lineWidth = body.render.lineWidth || defaultLineWidth;
body.render.sprite.xOffset += -(body.bounds.min.x - body.position.x) / (body.bounds.max.x - body.bounds.min.x); body.render.sprite.xOffset += -(body.bounds.min.x - body.position.x) / (body.bounds.max.x - body.bounds.min.x);
body.render.sprite.yOffset += -(body.bounds.min.y - body.position.y) / (body.bounds.max.y - body.bounds.min.y); body.render.sprite.yOffset += -(body.bounds.min.y - body.position.y) / (body.bounds.max.y - body.bounds.min.y);
}; };
@ -192,8 +195,7 @@ var Axes = require('../geometry/Axes');
} }
for (property in settings) { for (property in settings) {
if (!Object.prototype.hasOwnProperty.call(settings, property))
if (!settings.hasOwnProperty(property))
continue; continue;
value = settings[property]; value = settings[property];
@ -1162,7 +1164,7 @@ var Axes = require('../geometry/Axes');
* @default 1 * @default 1
*/ */
/** /**
* A `Number` that defines the offset in the x-axis for the sprite (normalised by texture width). * A `Number` that defines the offset in the x-axis for the sprite (normalised by texture width).
* *
* @property render.sprite.xOffset * @property render.sprite.xOffset
@ -1170,7 +1172,7 @@ var Axes = require('../geometry/Axes');
* @default 0 * @default 0
*/ */
/** /**
* A `Number` that defines the offset in the y-axis for the sprite (normalised by texture height). * A `Number` that defines the offset in the y-axis for the sprite (normalised by texture height).
* *
* @property render.sprite.yOffset * @property render.sprite.yOffset

View file

@ -1,8 +1,10 @@
/** /**
* The `Matter.Composite` module contains methods for creating and manipulating composite bodies. * A composite is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite` objects.
* A composite body is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`, therefore composites form a tree structure. *
* It is important to use the functions in this module to modify composites, rather than directly modifying their properties. * They are a container that can represent complex objects made of multiple parts, even if they are not physically connected.
* Note that the `Matter.World` object is also a type of `Matter.Composite` and as such all composite methods here can also operate on a `Matter.World`. * A composite could contain anything from a single body all the way up to a whole world.
*
* When making any changes to composites, use the included functions rather than changing their properties directly.
* *
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
* *
@ -67,11 +69,11 @@ var Body = require('./Body');
}; };
/** /**
* Generic add function. Adds one or many body(s), constraint(s) or a composite(s) to the given composite. * Generic single or multi-add function. Adds a single or an array of body(s), constraint(s) or composite(s) to the given composite.
* Triggers `beforeAdd` and `afterAdd` events on the `composite`. * Triggers `beforeAdd` and `afterAdd` events on the `composite`.
* @method add * @method add
* @param {composite} composite * @param {composite} composite
* @param {} object * @param {object|array} object A single or an array of body(s), constraint(s) or composite(s)
* @return {composite} The original composite with the objects added * @return {composite} The original composite with the objects added
*/ */
Composite.add = function(composite, object) { Composite.add = function(composite, object) {
@ -117,7 +119,7 @@ var Body = require('./Body');
* Triggers `beforeRemove` and `afterRemove` events on the `composite`. * Triggers `beforeRemove` and `afterRemove` events on the `composite`.
* @method remove * @method remove
* @param {composite} composite * @param {composite} composite
* @param {} object * @param {object|array} object
* @param {boolean} [deep=false] * @param {boolean} [deep=false]
* @return {composite} The original composite with the objects removed * @return {composite} The original composite with the objects removed
*/ */
@ -440,8 +442,8 @@ var Body = require('./Body');
*/ */
Composite.rebase = function(composite) { Composite.rebase = function(composite) {
var objects = Composite.allBodies(composite) var objects = Composite.allBodies(composite)
.concat(Composite.allConstraints(composite)) .concat(Composite.allConstraints(composite))
.concat(Composite.allComposites(composite)); .concat(Composite.allComposites(composite));
for (var i = 0; i < objects.length; i++) { for (var i = 0; i < objects.length; i++) {
objects[i].id = Common.nextId(); objects[i].id = Common.nextId();

View file

@ -1,14 +1,15 @@
/** /**
* The `Matter.World` module contains methods for creating and manipulating the world composite. * This module has now been replaced by `Matter.Composite`.
* A `Matter.World` is a `Matter.Composite` body, which is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`.
* A `Matter.World` has a few additional properties including `gravity` and `bounds`.
* It is important to use the functions in the `Matter.Composite` module to modify the world composite, rather than directly modifying its properties.
* There are also a few methods here that alias those in `Matter.Composite` for easier readability.
* *
* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * All usage should be migrated to the equivalent functions found on `Matter.Composite`.
* For example `World.add(world, body)` now becomes `Composite.add(world, body)`.
*
* The property `world.gravity` has been moved to `engine.gravity`.
*
* For back-compatibility purposes this module will remain as a direct alias to `Matter.Composite` in the short term during migration.
* Eventually this alias module will be marked as deprecated and then later removed in a future release.
* *
* @class World * @class World
* @extends Composite
*/ */
var World = {}; var World = {};
@ -16,132 +17,19 @@ var World = {};
module.exports = World; module.exports = World;
var Composite = require('./Composite'); var Composite = require('./Composite');
var Constraint = require('../constraint/Constraint');
var Common = require('../core/Common'); var Common = require('../core/Common');
(function() { (function() {
/** /**
* Creates a new world composite. The options parameter is an object that specifies any properties you wish to override the defaults. * See above, aliases for back compatibility only
* See the properties section below for detailed information on what you can pass via the `options` object.
* @method create
* @constructor
* @param {} options
* @return {world} A new world
*/ */
World.create = function(options) { World.create = Composite.create;
var composite = Composite.create(); World.add = Composite.add;
World.remove = Composite.remove;
var defaults = { World.clear = Composite.clear;
label: 'World', World.addComposite = Composite.addComposite;
gravity: { World.addBody = Composite.addBody;
x: 0, World.addConstraint = Composite.addConstraint;
y: 1,
scale: 0.001
},
bounds: {
min: { x: -Infinity, y: -Infinity },
max: { x: Infinity, y: Infinity }
}
};
return Common.extend(composite, defaults, options);
};
/*
*
* Properties Documentation
*
*/
/**
* The gravity to apply on the world.
*
* @property gravity
* @type object
*/
/**
* The gravity x component.
*
* @property gravity.x
* @type object
* @default 0
*/
/**
* The gravity y component.
*
* @property gravity.y
* @type object
* @default 1
*/
/**
* The gravity scale factor.
*
* @property gravity.scale
* @type object
* @default 0.001
*/
/**
* A `Bounds` object that defines the world bounds for collision detection.
*
* @property bounds
* @type bounds
* @default { min: { x: -Infinity, y: -Infinity }, max: { x: Infinity, y: Infinity } }
*/
// World is a Composite body
// see src/module/Outro.js for these aliases:
/**
* An alias for Composite.add
* @method add
* @param {world} world
* @param {} object
* @return {composite} The original world with the objects added
*/
/**
* An alias for Composite.remove
* @method remove
* @param {world} world
* @param {} object
* @param {boolean} [deep=false]
* @return {composite} The original world with the objects removed
*/
/**
* An alias for Composite.clear
* @method clear
* @param {world} world
* @param {boolean} keepStatic
*/
/**
* An alias for Composite.addComposite
* @method addComposite
* @param {world} world
* @param {composite} composite
* @return {world} The original world with the objects from composite added
*/
/**
* An alias for Composite.addBody
* @method addBody
* @param {world} world
* @param {body} body
* @return {world} The original world with the body added
*/
/**
* An alias for Composite.addConstraint
* @method addConstraint
* @param {world} world
* @param {constraint} constraint
* @return {world} The original world with the constraint added
*/
})(); })();

38
src/collision/Contact.js Normal file
View file

@ -0,0 +1,38 @@
/**
* The `Matter.Contact` module contains methods for creating and manipulating collision contacts.
*
* @class Contact
*/
var Contact = {};
module.exports = Contact;
(function() {
/**
* Creates a new contact.
* @method create
* @param {vertex} vertex
* @return {contact} A new contact
*/
Contact.create = function(vertex) {
return {
id: Contact.id(vertex),
vertex: vertex,
normalImpulse: 0,
tangentImpulse: 0
};
};
/**
* Generates a contact id.
* @method id
* @param {vertex} vertex
* @return {string} Unique contactID
*/
Contact.id = function(vertex) {
return vertex.body.id + '_' + vertex.index;
};
})();

View file

@ -27,10 +27,6 @@ var Bounds = require('../geometry/Bounds');
var collisions = [], var collisions = [],
pairsTable = engine.pairs.table; pairsTable = engine.pairs.table;
// @if DEBUG
var metrics = engine.metrics;
// @endif
for (var i = 0; i < broadphasePairs.length; i++) { for (var i = 0; i < broadphasePairs.length; i++) {
var bodyA = broadphasePairs[i][0], var bodyA = broadphasePairs[i][0],
bodyB = broadphasePairs[i][1]; bodyB = broadphasePairs[i][1];
@ -41,10 +37,6 @@ var Bounds = require('../geometry/Bounds');
if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter))
continue; continue;
// @if DEBUG
metrics.midphaseTests += 1;
// @endif
// mid phase // mid phase
if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) {
for (var j = bodyA.parts.length > 1 ? 1 : 0; j < bodyA.parts.length; j++) { for (var j = bodyA.parts.length > 1 ? 1 : 0; j < bodyA.parts.length; j++) {
@ -68,17 +60,8 @@ var Bounds = require('../geometry/Bounds');
// narrow phase // narrow phase
var collision = SAT.collides(partA, partB, previousCollision); var collision = SAT.collides(partA, partB, previousCollision);
// @if DEBUG
metrics.narrowphaseTests += 1;
if (collision.reused)
metrics.narrowReuseCount += 1;
// @endif
if (collision.collided) { if (collision.collided) {
collisions.push(collision); collisions.push(collision);
// @if DEBUG
metrics.narrowDetections += 1;
// @endif
} }
} }
} }

View file

@ -9,7 +9,6 @@ var Grid = {};
module.exports = Grid; module.exports = Grid;
var Pair = require('./Pair'); var Pair = require('./Pair');
var Detector = require('./Detector');
var Common = require('../core/Common'); var Common = require('../core/Common');
(function() { (function() {
@ -22,8 +21,6 @@ var Common = require('../core/Common');
*/ */
Grid.create = function(options) { Grid.create = function(options) {
var defaults = { var defaults = {
controller: Grid,
detector: Detector.collisions,
buckets: {}, buckets: {},
pairs: {}, pairs: {},
pairsList: [], pairsList: [],
@ -66,20 +63,15 @@ var Common = require('../core/Common');
bucketId, bucketId,
gridChanged = false; gridChanged = false;
// @if DEBUG
var metrics = engine.metrics;
metrics.broadphaseTests = 0;
// @endif
for (i = 0; i < bodies.length; i++) { for (i = 0; i < bodies.length; i++) {
var body = bodies[i]; var body = bodies[i];
if (body.isSleeping && !forceUpdate) if (body.isSleeping && !forceUpdate)
continue; continue;
// don't update out of world bodies // temporary back compatibility bounds check
if (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x if (world.bounds && (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x
|| body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y) || body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y))
continue; continue;
var newRegion = Grid._getRegion(grid, body); var newRegion = Grid._getRegion(grid, body);
@ -87,10 +79,6 @@ var Common = require('../core/Common');
// if the body has changed grid region // if the body has changed grid region
if (!body.region || newRegion.id !== body.region.id || forceUpdate) { if (!body.region || newRegion.id !== body.region.id || forceUpdate) {
// @if DEBUG
metrics.broadphaseTests += 1;
// @endif
if (!body.region || forceUpdate) if (!body.region || forceUpdate)
body.region = newRegion; body.region = newRegion;

View file

@ -8,6 +8,8 @@ var Pair = {};
module.exports = Pair; module.exports = Pair;
var Contact = require('./Contact');
(function() { (function() {
/** /**
@ -19,12 +21,15 @@ module.exports = Pair;
*/ */
Pair.create = function(collision, timestamp) { Pair.create = function(collision, timestamp) {
var bodyA = collision.bodyA, var bodyA = collision.bodyA,
bodyB = collision.bodyB; bodyB = collision.bodyB,
parentA = collision.parentA,
parentB = collision.parentB;
var pair = { var pair = {
id: Pair.id(bodyA, bodyB), id: Pair.id(bodyA, bodyB),
bodyA: bodyA, bodyA: bodyA,
bodyB: bodyB, bodyB: bodyB,
contacts: {},
activeContacts: [], activeContacts: [],
separation: 0, separation: 0,
isActive: true, isActive: true,
@ -32,12 +37,11 @@ module.exports = Pair;
isSensor: bodyA.isSensor || bodyB.isSensor, isSensor: bodyA.isSensor || bodyB.isSensor,
timeCreated: timestamp, timeCreated: timestamp,
timeUpdated: timestamp, timeUpdated: timestamp,
collision: null, inverseMass: parentA.inverseMass + parentB.inverseMass,
inverseMass: 0, friction: Math.min(parentA.friction, parentB.friction),
friction: 0, frictionStatic: Math.max(parentA.frictionStatic, parentB.frictionStatic),
frictionStatic: 0, restitution: Math.max(parentA.restitution, parentB.restitution),
restitution: 0, slop: Math.max(parentA.slop, parentB.slop)
slop: 0
}; };
Pair.update(pair, collision, timestamp); Pair.update(pair, collision, timestamp);
@ -53,28 +57,31 @@ module.exports = Pair;
* @param {number} timestamp * @param {number} timestamp
*/ */
Pair.update = function(pair, collision, timestamp) { Pair.update = function(pair, collision, timestamp) {
var contacts = pair.contacts,
supports = collision.supports,
activeContacts = pair.activeContacts,
parentA = collision.parentA,
parentB = collision.parentB;
pair.collision = collision; pair.collision = collision;
pair.inverseMass = parentA.inverseMass + parentB.inverseMass;
pair.friction = Math.min(parentA.friction, parentB.friction);
pair.frictionStatic = Math.max(parentA.frictionStatic, parentB.frictionStatic);
pair.restitution = Math.max(parentA.restitution, parentB.restitution);
pair.slop = Math.max(parentA.slop, parentB.slop);
activeContacts.length = 0;
if (collision.collided) { if (collision.collided) {
var supports = collision.supports,
activeContacts = pair.activeContacts,
parentA = collision.parentA,
parentB = collision.parentB;
pair.inverseMass = parentA.inverseMass + parentB.inverseMass;
pair.friction = Math.min(parentA.friction, parentB.friction);
pair.frictionStatic = Math.max(parentA.frictionStatic, parentB.frictionStatic);
pair.restitution = Math.max(parentA.restitution, parentB.restitution);
pair.slop = Math.max(parentA.slop, parentB.slop);
for (var i = 0; i < supports.length; i++) { for (var i = 0; i < supports.length; i++) {
activeContacts[i] = supports[i].contact; var support = supports[i],
} contactId = Contact.id(support),
contact = contacts[contactId];
// optimise array size if (contact) {
var supportCount = supports.length; activeContacts.push(contact);
if (supportCount < activeContacts.length) { } else {
activeContacts.length = supportCount; activeContacts.push(contacts[contactId] = Contact.create(support));
}
} }
pair.separation = collision.depth; pair.separation = collision.depth;
@ -117,4 +124,4 @@ module.exports = Pair;
} }
}; };
})(); })();

View file

@ -48,33 +48,23 @@ var Bounds = require('../geometry/Bounds');
* Find a solution for pair positions. * Find a solution for pair positions.
* @method solvePosition * @method solvePosition
* @param {pair[]} pairs * @param {pair[]} pairs
* @param {body[]} bodies
* @param {number} timeScale * @param {number} timeScale
*/ */
Resolver.solvePosition = function(pairs, bodies, timeScale) { Resolver.solvePosition = function(pairs, timeScale) {
var i, var i,
normalX,
normalY,
pair, pair,
collision, collision,
bodyA, bodyA,
bodyB, bodyB,
normal, normal,
separation, bodyBtoA,
penetration,
positionImpulseA,
positionImpulseB,
contactShare, contactShare,
bodyBtoAX,
bodyBtoAY,
positionImpulse, positionImpulse,
impulseCoefficient = timeScale * Resolver._positionDampen; contactCount = {},
tempA = Vector._temp[0],
for (i = 0; i < bodies.length; i++) { tempB = Vector._temp[1],
var body = bodies[i]; tempC = Vector._temp[2],
body.previousPositionImpulse.x = body.positionImpulse.x; tempD = Vector._temp[3];
body.previousPositionImpulse.y = body.positionImpulse.y;
}
// find impulses required to resolve penetration // find impulses required to resolve penetration
for (i = 0; i < pairs.length; i++) { for (i = 0; i < pairs.length; i++) {
@ -88,35 +78,39 @@ var Bounds = require('../geometry/Bounds');
bodyB = collision.parentB; bodyB = collision.parentB;
normal = collision.normal; normal = collision.normal;
positionImpulseA = bodyA.previousPositionImpulse; // get current separation between body edges involved in collision
positionImpulseB = bodyB.previousPositionImpulse; bodyBtoA = Vector.sub(Vector.add(bodyB.positionImpulse, bodyB.position, tempA),
Vector.add(bodyA.positionImpulse,
Vector.sub(bodyB.position, collision.penetration, tempB), tempC), tempD);
penetration = collision.penetration; pair.separation = Vector.dot(normal, bodyBtoA);
}
for (i = 0; i < pairs.length; i++) {
pair = pairs[i];
bodyBtoAX = positionImpulseB.x - positionImpulseA.x + penetration.x; if (!pair.isActive || pair.isSensor)
bodyBtoAY = positionImpulseB.y - positionImpulseA.y + penetration.y; continue;
normalX = normal.x; collision = pair.collision;
normalY = normal.y; bodyA = collision.parentA;
bodyB = collision.parentB;
separation = normalX * bodyBtoAX + normalY * bodyBtoAY; normal = collision.normal;
pair.separation = separation; positionImpulse = (pair.separation - pair.slop) * timeScale;
positionImpulse = (separation - pair.slop) * impulseCoefficient;
if (bodyA.isStatic || bodyB.isStatic) if (bodyA.isStatic || bodyB.isStatic)
positionImpulse *= 2; positionImpulse *= 2;
if (!(bodyA.isStatic || bodyA.isSleeping)) { if (!(bodyA.isStatic || bodyA.isSleeping)) {
contactShare = positionImpulse / bodyA.totalContacts; contactShare = Resolver._positionDampen / bodyA.totalContacts;
bodyA.positionImpulse.x += normalX * contactShare; bodyA.positionImpulse.x += normal.x * positionImpulse * contactShare;
bodyA.positionImpulse.y += normalY * contactShare; bodyA.positionImpulse.y += normal.y * positionImpulse * contactShare;
} }
if (!(bodyB.isStatic || bodyB.isSleeping)) { if (!(bodyB.isStatic || bodyB.isSleeping)) {
contactShare = positionImpulse / bodyB.totalContacts; contactShare = Resolver._positionDampen / bodyB.totalContacts;
bodyB.positionImpulse.x -= normalX * contactShare; bodyB.positionImpulse.x -= normal.x * positionImpulse * contactShare;
bodyB.positionImpulse.y -= normalY * contactShare; bodyB.positionImpulse.y -= normal.y * positionImpulse * contactShare;
} }
} }
}; };
@ -347,4 +341,4 @@ var Bounds = require('../geometry/Bounds');
} }
}; };
})(); })();

View file

@ -300,6 +300,32 @@ var Common = require('../core/Common');
} }
}; };
/**
* Returns the world-space position of `constraint.pointA`, accounting for `constraint.bodyA`.
* @method pointAWorld
* @param {constraint} constraint
* @returns {vector} the world-space position
*/
Constraint.pointAWorld = function(constraint) {
return {
x: (constraint.bodyA ? constraint.bodyA.position.x : 0) + constraint.pointA.x,
y: (constraint.bodyA ? constraint.bodyA.position.y : 0) + constraint.pointA.y
};
};
/**
* Returns the world-space position of `constraint.pointB`, accounting for `constraint.bodyB`.
* @method pointBWorld
* @param {constraint} constraint
* @returns {vector} the world-space position
*/
Constraint.pointBWorld = function(constraint) {
return {
x: (constraint.bodyB ? constraint.bodyB.position.x : 0) + constraint.pointB.x,
y: (constraint.bodyB ? constraint.bodyB.position.y : 0) + constraint.pointB.y
};
};
/* /*
* *
* Properties Documentation * Properties Documentation

View file

@ -13,7 +13,9 @@ module.exports = Common;
Common._nextId = 0; Common._nextId = 0;
Common._seed = 0; Common._seed = 0;
Common._nowStartTime = +(new Date()); Common._nowStartTime = +(new Date());
Common._warnedOnce = {};
Common._decomp = null;
/** /**
* Extends the object in the first argument using the object in the second argument. * Extends the object in the first argument using the object in the second argument.
* @method extend * @method extend
@ -252,12 +254,12 @@ module.exports = Common;
/** /**
* Returns the current timestamp since the time origin (e.g. from page load). * Returns the current timestamp since the time origin (e.g. from page load).
* The result will be high-resolution including decimal places if available. * The result is in milliseconds and will use high-resolution timing if available.
* @method now * @method now
* @return {number} the current timestamp * @return {number} the current timestamp in milliseconds
*/ */
Common.now = function() { Common.now = function() {
if (window.performance) { if (typeof window !== 'undefined' && window.performance) {
if (window.performance.now) { if (window.performance.now) {
return window.performance.now(); return window.performance.now();
} else if (window.performance.webkitNow) { } else if (window.performance.webkitNow) {
@ -265,6 +267,10 @@ module.exports = Common;
} }
} }
if (Date.now) {
return Date.now();
}
return (new Date()) - Common._nowStartTime; return (new Date()) - Common._nowStartTime;
}; };
@ -358,6 +364,35 @@ module.exports = Common;
} }
}; };
/**
* Uses `Common.warn` to log the given message one time only.
* @method warnOnce
* @param ...objs {} The objects to log.
*/
Common.warnOnce = function() {
var message = Array.prototype.slice.call(arguments).join(' ');
if (!Common._warnedOnce[message]) {
Common.warn(message);
Common._warnedOnce[message] = true;
}
};
/**
* Shows a deprecated console warning when the function on the given object is called.
* The target function will be replaced with a new function that first shows the warning
* and then calls the original function.
* @method deprecated
* @param {object} obj The object or module
* @param {string} name The property name of the function on obj
* @param {string} warning The one-time message to show if the function is called
*/
Common.deprecated = function(obj, prop, warning) {
obj[prop] = Common.chain(function() {
Common.warnOnce('🔅 deprecated 🔅', warning);
}, obj[prop]);
};
/** /**
* Returns the next unique sequential ID. * Returns the next unique sequential ID.
* @method nextId * @method nextId
@ -537,17 +572,40 @@ module.exports = Common;
}; };
/** /**
* Used to require external libraries outside of the bundle. * Provide the [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module to enable
* It first looks for the `globalName` on the environment's global namespace. * concave vertex decomposition support when using `Bodies.fromVertices` e.g. `Common.setDecomp(require('poly-decomp'))`.
* If the global is not found, it will fall back to using the standard `require` using the `moduleName`. * @method setDecomp
* @private * @param {} decomp The [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module.
* @method _requireGlobal
* @param {string} globalName The global module name
* @param {string} moduleName The fallback CommonJS module name
* @return {} The loaded module
*/ */
Common._requireGlobal = function(globalName, moduleName) { Common.setDecomp = function(decomp) {
var obj = (typeof window !== 'undefined' ? window[globalName] : typeof global !== 'undefined' ? global[globalName] : null); Common._decomp = decomp;
return obj || require(moduleName); };
/**
* Returns the [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module provided through `Common.setDecomp`,
* otherwise returns the global `decomp` if set.
* @method getDecomp
* @return {} The [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module if provided.
*/
Common.getDecomp = function() {
// get user provided decomp if set
var decomp = Common._decomp;
try {
// otherwise from window global
if (!decomp && typeof window !== 'undefined') {
decomp = window.decomp;
}
// otherwise from node global
if (!decomp && typeof global !== 'undefined') {
decomp = global.decomp;
}
} catch (e) {
// decomp not available
decomp = null;
}
return decomp;
}; };
})(); })();

View file

@ -12,12 +12,10 @@ var Engine = {};
module.exports = Engine; module.exports = Engine;
var World = require('../body/World');
var Sleeping = require('./Sleeping'); var Sleeping = require('./Sleeping');
var Resolver = require('../collision/Resolver'); var Resolver = require('../collision/Resolver');
var Render = require('../render/Render'); var Detector = require('../collision/Detector');
var Pairs = require('../collision/Pairs'); var Pairs = require('../collision/Pairs');
var Metrics = require('./Metrics');
var Grid = require('../collision/Grid'); var Grid = require('../collision/Grid');
var Events = require('./Events'); var Events = require('./Events');
var Composite = require('../body/Composite'); var Composite = require('../body/Composite');
@ -35,16 +33,9 @@ var Body = require('../body/Body');
* @param {object} [options] * @param {object} [options]
* @return {engine} engine * @return {engine} engine
*/ */
Engine.create = function(element, options) { Engine.create = function(options) {
// options may be passed as the first (and only) argument
options = Common.isElement(element) ? options : element;
element = Common.isElement(element) ? element : null;
options = options || {}; options = options || {};
if (element || options.render) {
Common.warn('Engine.create: engine.render is deprecated (see docs)');
}
var defaults = { var defaults = {
positionIterations: 6, positionIterations: 6,
velocityIterations: 4, velocityIterations: 4,
@ -52,46 +43,31 @@ var Body = require('../body/Body');
enableSleeping: false, enableSleeping: false,
events: [], events: [],
plugin: {}, plugin: {},
grid: null,
gravity: {
x: 0,
y: 1,
scale: 0.001
},
timing: { timing: {
timestamp: 0, timestamp: 0,
timeScale: 1 timeScale: 1,
}, lastDelta: 0,
broadphase: { lastElapsed: 0
controller: Grid
} }
}; };
var engine = Common.extend(defaults, options); var engine = Common.extend(defaults, options);
// @deprecated engine.world = options.world || Composite.create({ label: 'World' });
if (element || engine.render) { engine.grid = Grid.create(options.grid || options.broadphase);
var renderDefaults = {
element: element,
controller: Render
};
engine.render = Common.extend(renderDefaults, engine.render);
}
// @deprecated
if (engine.render && engine.render.controller) {
engine.render = engine.render.controller.create(engine.render);
}
// @deprecated
if (engine.render) {
engine.render.engine = engine;
}
engine.world = options.world || World.create(engine.world);
engine.pairs = Pairs.create(); engine.pairs = Pairs.create();
engine.broadphase = engine.broadphase.controller.create(engine.broadphase);
engine.metrics = engine.metrics || { extended: false };
// @if DEBUG
engine.metrics = Metrics.create(engine.metrics);
// @endif
// temporary back compatibility
engine.world.gravity = engine.gravity;
engine.broadphase = engine.grid;
engine.metrics = {};
return engine; return engine;
}; };
@ -111,17 +87,20 @@ var Body = require('../body/Body');
* @param {number} [correction=1] * @param {number} [correction=1]
*/ */
Engine.update = function(engine, delta, correction) { Engine.update = function(engine, delta, correction) {
var startTime = Common.now();
delta = delta || 1000 / 60; delta = delta || 1000 / 60;
correction = correction || 1; correction = correction || 1;
var world = engine.world, var world = engine.world,
timing = engine.timing, timing = engine.timing,
broadphase = engine.broadphase, grid = engine.grid,
broadphasePairs = [], gridPairs = [],
i; i;
// increment timestamp // increment timestamp
timing.timestamp += delta * timing.timeScale; timing.timestamp += delta * timing.timeScale;
timing.lastDelta = delta * timing.timeScale;
// create an event object // create an event object
var event = { var event = {
@ -134,17 +113,12 @@ var Body = require('../body/Body');
var allBodies = Composite.allBodies(world), var allBodies = Composite.allBodies(world),
allConstraints = Composite.allConstraints(world); allConstraints = Composite.allConstraints(world);
// @if DEBUG
// reset metrics logging
Metrics.reset(engine.metrics);
// @endif
// if sleeping enabled, call the sleeping controller // if sleeping enabled, call the sleeping controller
if (engine.enableSleeping) if (engine.enableSleeping)
Sleeping.update(allBodies, timing.timeScale); Sleeping.update(allBodies, timing.timeScale);
// applies gravity to all bodies // applies gravity to all bodies
Engine._bodiesApplyGravity(allBodies, world.gravity); Engine._bodiesApplyGravity(allBodies, engine.gravity);
// update all body position and rotation by integration // update all body position and rotation by integration
Engine._bodiesUpdate(allBodies, delta, timing.timeScale, correction, world.bounds); Engine._bodiesUpdate(allBodies, delta, timing.timeScale, correction, world.bounds);
@ -157,18 +131,14 @@ var Body = require('../body/Body');
Constraint.postSolveAll(allBodies); Constraint.postSolveAll(allBodies);
// broadphase pass: find potential collision pairs // broadphase pass: find potential collision pairs
if (broadphase.controller) {
// if world is dirty, we must flush the whole grid
if (world.isModified)
broadphase.controller.clear(broadphase);
// update the grid buckets based on current bodies // if world is dirty, we must flush the whole grid
broadphase.controller.update(broadphase, allBodies, engine, world.isModified); if (world.isModified)
broadphasePairs = broadphase.pairsList; Grid.clear(grid);
} else {
// if no broadphase set, we just pass all bodies // update the grid buckets based on current bodies
broadphasePairs = allBodies; Grid.update(grid, allBodies, engine, world.isModified);
} gridPairs = grid.pairsList;
// clear all composite modified flags // clear all composite modified flags
if (world.isModified) { if (world.isModified) {
@ -176,7 +146,7 @@ var Body = require('../body/Body');
} }
// narrowphase pass: find actual collisions, then create or update collision pairs // narrowphase pass: find actual collisions, then create or update collision pairs
var collisions = broadphase.detector(broadphasePairs, engine); var collisions = Detector.collisions(gridPairs, engine);
// update collision pairs // update collision pairs
var pairs = engine.pairs, var pairs = engine.pairs,
@ -195,7 +165,7 @@ var Body = require('../body/Body');
// iteratively resolve position between collisions // iteratively resolve position between collisions
Resolver.preSolvePosition(pairs.list); Resolver.preSolvePosition(pairs.list);
for (i = 0; i < engine.positionIterations; i++) { for (i = 0; i < engine.positionIterations; i++) {
Resolver.solvePosition(pairs.list, allBodies, timing.timeScale); Resolver.solvePosition(pairs.list, timing.timeScale);
} }
Resolver.postSolvePosition(allBodies); Resolver.postSolvePosition(allBodies);
@ -219,16 +189,14 @@ var Body = require('../body/Body');
if (pairs.collisionEnd.length > 0) if (pairs.collisionEnd.length > 0)
Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd }); Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd });
// @if DEBUG
// update metrics log
Metrics.update(engine.metrics, engine);
// @endif
// clear force buffers // clear force buffers
Engine._bodiesClearForces(allBodies); Engine._bodiesClearForces(allBodies);
Events.trigger(engine, 'afterUpdate', event); Events.trigger(engine, 'afterUpdate', event);
// log the time elapsed computing this update
engine.timing.lastElapsed = Common.now() - startTime;
return engine; return engine;
}; };
@ -262,16 +230,12 @@ var Body = require('../body/Body');
* @param {engine} engine * @param {engine} engine
*/ */
Engine.clear = function(engine) { Engine.clear = function(engine) {
var world = engine.world; var world = engine.world,
bodies = Composite.allBodies(world);
Pairs.clear(engine.pairs);
var broadphase = engine.broadphase; Pairs.clear(engine.pairs);
if (broadphase.controller) { Grid.clear(engine.grid);
var bodies = Composite.allBodies(world); Grid.update(engine.grid, bodies, engine, true);
broadphase.controller.clear(broadphase);
broadphase.controller.update(broadphase, bodies, engine, true);
}
}; };
/** /**
@ -341,7 +305,8 @@ var Body = require('../body/Body');
}; };
/** /**
* An alias for `Runner.run`, see `Matter.Runner` for more information. * A deprecated alias for `Runner.run`, use `Matter.Runner.run(engine)` instead and see `Matter.Runner` for more information.
* @deprecated use Matter.Runner.run(engine) instead
* @method run * @method run
* @param {engine} engine * @param {engine} engine
*/ */
@ -470,32 +435,47 @@ var Body = require('../body/Body');
*/ */
/** /**
* An instance of a `Render` controller. The default value is a `Matter.Render` instance created by `Engine.create`. * A `Number` that represents the total execution time elapsed during the last `Engine.update` in milliseconds.
* One may also develop a custom renderer module based on `Matter.Render` and pass an instance of it to `Engine.create` via `options.render`. * It is updated by timing from the start of the last `Engine.update` call until it ends.
* *
* A minimal custom renderer object must define at least three functions: `create`, `clear` and `world` (see `Matter.Render`). * This value will also include the total execution time of all event handlers directly or indirectly triggered by the engine update.
* It is also possible to instead pass the _module_ reference via `options.render.controller` and `Engine.create` will instantiate one for you.
* *
* @property render * @property timing.lastElapsed
* @type render * @type number
* @deprecated see Demo.js for an example of creating a renderer * @default 0
* @default a Matter.Render instance
*/ */
/** /**
* An instance of a broadphase controller. The default value is a `Matter.Grid` instance created by `Engine.create`. * A `Number` that represents the `delta` value used in the last engine update.
* *
* @property timing.lastDelta
* @type number
* @default 0
*/
/**
* A `Matter.Grid` instance.
*
* @property grid
* @type grid
* @default a Matter.Grid instance
*/
/**
* Replaced by and now alias for `engine.grid`.
*
* @deprecated use `engine.grid`
* @property broadphase * @property broadphase
* @type grid * @type grid
* @default a Matter.Grid instance * @default a Matter.Grid instance
*/ */
/** /**
* A `World` composite object that will contain all simulated bodies and constraints. * The root `Matter.Composite` instance that will contain all bodies, constraints and other composites to be simulated by this engine.
* *
* @property world * @property world
* @type world * @type composite
* @default a Matter.World instance * @default a Matter.Composite instance
*/ */
/** /**
@ -505,4 +485,35 @@ var Body = require('../body/Body');
* @type {} * @type {}
*/ */
/**
* The gravity to apply on all bodies in `engine.world`.
*
* @property gravity
* @type object
*/
/**
* The gravity x component.
*
* @property gravity.x
* @type object
* @default 0
*/
/**
* The gravity y component.
*
* @property gravity.y
* @type object
* @default 1
*/
/**
* The gravity scale factor.
*
* @property gravity.scale
* @type object
* @default 0.001
*/
})(); })();

View file

@ -27,7 +27,7 @@ var Common = require('./Common');
* @readOnly * @readOnly
* @type {String} * @type {String}
*/ */
Matter.version = '@@VERSION@@'; Matter.version = typeof __MATTER_VERSION__ !== 'undefined' ? __MATTER_VERSION__ : '*';
/** /**
* A list of plugin dependencies to be installed. These are normally set and installed through `Matter.use`. * A list of plugin dependencies to be installed. These are normally set and installed through `Matter.use`.

View file

@ -1,93 +0,0 @@
// @if DEBUG
/**
* _Internal Class_, not generally used outside of the engine's internals.
*
*/
var Metrics = {};
module.exports = Metrics;
var Composite = require('../body/Composite');
var Common = require('./Common');
(function() {
/**
* Creates a new metrics.
* @method create
* @private
* @return {metrics} A new metrics
*/
Metrics.create = function(options) {
var defaults = {
extended: false,
narrowDetections: 0,
narrowphaseTests: 0,
narrowReuse: 0,
narrowReuseCount: 0,
midphaseTests: 0,
broadphaseTests: 0,
narrowEff: 0.0001,
midEff: 0.0001,
broadEff: 0.0001,
collisions: 0,
buckets: 0,
bodies: 0,
pairs: 0
};
return Common.extend(defaults, false, options);
};
/**
* Resets metrics.
* @method reset
* @private
* @param {metrics} metrics
*/
Metrics.reset = function(metrics) {
if (metrics.extended) {
metrics.narrowDetections = 0;
metrics.narrowphaseTests = 0;
metrics.narrowReuse = 0;
metrics.narrowReuseCount = 0;
metrics.midphaseTests = 0;
metrics.broadphaseTests = 0;
metrics.narrowEff = 0;
metrics.midEff = 0;
metrics.broadEff = 0;
metrics.collisions = 0;
metrics.buckets = 0;
metrics.pairs = 0;
metrics.bodies = 0;
}
};
/**
* Updates metrics.
* @method update
* @private
* @param {metrics} metrics
* @param {engine} engine
*/
Metrics.update = function(metrics, engine) {
if (metrics.extended) {
var world = engine.world,
bodies = Composite.allBodies(world);
metrics.collisions = metrics.narrowDetections;
metrics.pairs = engine.pairs.list.length;
metrics.bodies = bodies.length;
metrics.midEff = (metrics.narrowDetections / (metrics.midphaseTests || 1)).toFixed(2);
metrics.narrowEff = (metrics.narrowDetections / (metrics.narrowphaseTests || 1)).toFixed(2);
metrics.broadEff = (1 - (metrics.broadphaseTests / (bodies.length || 1))).toFixed(2);
metrics.narrowReuse = (metrics.narrowReuseCount / (metrics.narrowphaseTests || 1)).toFixed(2);
//var broadphase = engine.broadphase[engine.broadphase.current];
//if (broadphase.instance)
// metrics.buckets = Common.keys(broadphase.instance.buckets).length;
}
};
})();
// @endif

View file

@ -266,6 +266,8 @@ var Common = require('./Common');
* Only the following range types are supported: * Only the following range types are supported:
* - Tilde ranges e.g. `~1.2.3` * - Tilde ranges e.g. `~1.2.3`
* - Caret ranges e.g. `^1.2.3` * - Caret ranges e.g. `^1.2.3`
* - Greater than ranges e.g. `>1.2.3`
* - Greater than or equal ranges e.g. `>=1.2.3`
* - Exact version e.g. `1.2.3` * - Exact version e.g. `1.2.3`
* - Any version `*` * - Any version `*`
* @method versionParse * @method versionParse
@ -273,29 +275,28 @@ var Common = require('./Common');
* @return {object} The version range parsed into its components. * @return {object} The version range parsed into its components.
*/ */
Plugin.versionParse = function(range) { Plugin.versionParse = function(range) {
var pattern = /^\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?$/; var pattern = /^(\*)|(\^|~|>=|>)?\s*((\d+)\.(\d+)\.(\d+))(-[0-9A-Za-z-]+)?$/;
if (!pattern.test(range)) { if (!pattern.test(range)) {
Common.warn('Plugin.versionParse:', range, 'is not a valid version or range.'); Common.warn('Plugin.versionParse:', range, 'is not a valid version or range.');
} }
var identifiers = range.split('-'); var parts = pattern.exec(range);
range = identifiers[0]; var major = Number(parts[4]);
var minor = Number(parts[5]);
var isRange = isNaN(Number(range[0])), var patch = Number(parts[6]);
version = isRange ? range.substr(1) : range,
parts = Common.map(version.split('.'), function(part) {
return Number(part);
});
return { return {
isRange: isRange, isRange: Boolean(parts[1] || parts[2]),
version: version, version: parts[3],
range: range, range: range,
operator: isRange ? range[0] : '', operator: parts[1] || parts[2] || '',
parts: parts, major: major,
prerelease: identifiers[1], minor: minor,
number: parts[0] * 1e8 + parts[1] * 1e4 + parts[2] patch: patch,
parts: [major, minor, patch],
prerelease: parts[7],
number: major * 1e8 + minor * 1e4 + patch
}; };
}; };
@ -311,30 +312,36 @@ var Common = require('./Common');
Plugin.versionSatisfies = function(version, range) { Plugin.versionSatisfies = function(version, range) {
range = range || '*'; range = range || '*';
var rangeParsed = Plugin.versionParse(range), var r = Plugin.versionParse(range),
rangeParts = rangeParsed.parts, v = Plugin.versionParse(version);
versionParsed = Plugin.versionParse(version),
versionParts = versionParsed.parts;
if (rangeParsed.isRange) { if (r.isRange) {
if (rangeParsed.operator === '*' || version === '*') { if (r.operator === '*' || version === '*') {
return true; return true;
} }
if (rangeParsed.operator === '~') { if (r.operator === '>') {
return versionParts[0] === rangeParts[0] && versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; return v.number > r.number;
} }
if (rangeParsed.operator === '^') { if (r.operator === '>=') {
if (rangeParts[0] > 0) { return v.number >= r.number;
return versionParts[0] === rangeParts[0] && versionParsed.number >= rangeParsed.number; }
if (r.operator === '~') {
return v.major === r.major && v.minor === r.minor && v.patch >= r.patch;
}
if (r.operator === '^') {
if (r.major > 0) {
return v.major === r.major && v.number >= r.number;
} }
if (rangeParts[1] > 0) { if (r.minor > 0) {
return versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; return v.minor === r.minor && v.patch >= r.patch;
} }
return versionParts[2] === rangeParts[2]; return v.patch === r.patch;
} }
} }

View file

@ -101,7 +101,6 @@ var Common = require('./Common');
/** /**
* A game loop utility that updates the engine and renderer by one step (a 'tick'). * A game loop utility that updates the engine and renderer by one step (a 'tick').
* Features delta smoothing, time correction and fixed or dynamic timing. * Features delta smoothing, time correction and fixed or dynamic timing.
* Triggers `beforeTick`, `tick` and `afterTick` events on the engine.
* Consider just `Engine.update(engine, delta)` if you're using your own loop. * Consider just `Engine.update(engine, delta)` if you're using your own loop.
* @method tick * @method tick
* @param {runner} runner * @param {runner} runner
@ -119,7 +118,6 @@ var Common = require('./Common');
}; };
Events.trigger(runner, 'beforeTick', event); Events.trigger(runner, 'beforeTick', event);
Events.trigger(engine, 'beforeTick', event); // @deprecated
if (runner.isFixed) { if (runner.isFixed) {
// fixed timestep // fixed timestep
@ -164,35 +162,13 @@ var Common = require('./Common');
} }
Events.trigger(runner, 'tick', event); Events.trigger(runner, 'tick', event);
Events.trigger(engine, 'tick', event); // @deprecated
// if world has been modified, clear the render scene graph
if (engine.world.isModified
&& engine.render
&& engine.render.controller
&& engine.render.controller.clear) {
engine.render.controller.clear(engine.render); // @deprecated
}
// update // update
Events.trigger(runner, 'beforeUpdate', event); Events.trigger(runner, 'beforeUpdate', event);
Engine.update(engine, delta, correction); Engine.update(engine, delta, correction);
Events.trigger(runner, 'afterUpdate', event); Events.trigger(runner, 'afterUpdate', event);
// render
// @deprecated
if (engine.render && engine.render.controller) {
Events.trigger(runner, 'beforeRender', event);
Events.trigger(engine, 'beforeRender', event); // @deprecated
engine.render.controller.world(engine.render);
Events.trigger(runner, 'afterRender', event);
Events.trigger(engine, 'afterRender', event); // @deprecated
}
Events.trigger(runner, 'afterTick', event); Events.trigger(runner, 'afterTick', event);
Events.trigger(engine, 'afterTick', event); // @deprecated
}; };
/** /**
@ -271,28 +247,6 @@ var Common = require('./Common');
* @param {} event.name The name of the event * @param {} event.name The name of the event
*/ */
/**
* Fired before rendering
*
* @event beforeRender
* @param {} event An event object
* @param {number} event.timestamp The engine.timing.timestamp of the event
* @param {} event.source The source object of the event
* @param {} event.name The name of the event
* @deprecated
*/
/**
* Fired after rendering
*
* @event afterRender
* @param {} event An event object
* @param {number} event.timestamp The engine.timing.timestamp of the event
* @param {} event.source The source object of the event
* @param {} event.name The name of the event
* @deprecated
*/
/* /*
* *
* Properties Documentation * Properties Documentation

View file

@ -18,7 +18,6 @@ var Common = require('../core/Common');
var Body = require('../body/Body'); var Body = require('../body/Body');
var Bounds = require('../geometry/Bounds'); var Bounds = require('../geometry/Bounds');
var Vector = require('../geometry/Vector'); var Vector = require('../geometry/Vector');
var decomp;
(function() { (function() {
@ -46,7 +45,7 @@ var decomp;
if (options.chamfer) { if (options.chamfer) {
var chamfer = options.chamfer; var chamfer = options.chamfer;
rectangle.vertices = Vertices.chamfer(rectangle.vertices, chamfer.radius, rectangle.vertices = Vertices.chamfer(rectangle.vertices, chamfer.radius,
chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); chamfer.quality, chamfer.qualityMin, chamfer.qualityMax);
delete options.chamfer; delete options.chamfer;
} }
@ -92,7 +91,7 @@ var decomp;
if (options.chamfer) { if (options.chamfer) {
var chamfer = options.chamfer; var chamfer = options.chamfer;
trapezoid.vertices = Vertices.chamfer(trapezoid.vertices, chamfer.radius, trapezoid.vertices = Vertices.chamfer(trapezoid.vertices, chamfer.radius,
chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); chamfer.quality, chamfer.qualityMin, chamfer.qualityMax);
delete options.chamfer; delete options.chamfer;
} }
@ -169,7 +168,7 @@ var decomp;
if (options.chamfer) { if (options.chamfer) {
var chamfer = options.chamfer; var chamfer = options.chamfer;
polygon.vertices = Vertices.chamfer(polygon.vertices, chamfer.radius, polygon.vertices = Vertices.chamfer(polygon.vertices, chamfer.radius,
chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); chamfer.quality, chamfer.qualityMin, chamfer.qualityMax);
delete options.chamfer; delete options.chamfer;
} }
@ -177,33 +176,46 @@ var decomp;
}; };
/** /**
* Creates a body using the supplied vertices (or an array containing multiple sets of vertices). * Utility to create a compound body based on set(s) of vertices.
* If the vertices are convex, they will pass through as supplied. *
* Otherwise if the vertices are concave, they will be decomposed if [poly-decomp.js](https://github.com/schteppe/poly-decomp.js) is available. * _Note:_ To optionally enable automatic concave vertices decomposition the [poly-decomp](https://github.com/schteppe/poly-decomp.js)
* Note that this process is not guaranteed to support complex sets of vertices (e.g. those with holes may fail). * package must be first installed and provided see `Common.setDecomp`, otherwise the convex hull of each vertex set will be used.
* By default the decomposition will discard collinear edges (to improve performance). *
* It can also optionally discard any parts that have an area less than `minimumArea`. * The resulting vertices are reorientated about their centre of mass,
* If the vertices can not be decomposed, the result will fall back to using the convex hull. * and offset such that `body.position` corresponds to this point.
* The options parameter is an object that specifies any `Matter.Body` properties you wish to override the defaults. *
* The resulting offset may be found if needed by subtracting `body.bounds` from the original input bounds.
* To later move the centre of mass see `Body.setCentre`.
*
* Note that automatic conconcave decomposition results are not always optimal.
* For best results, simplify the input vertices as much as possible first.
* By default this function applies some addtional simplification to help.
*
* Some outputs may also require further manual processing afterwards to be robust.
* In particular some parts may need to be overlapped to avoid collision gaps.
* Thin parts and sharp points should be avoided or removed where possible.
*
* The options parameter object specifies any `Matter.Body` properties you wish to override the defaults.
*
* See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object.
* @method fromVertices * @method fromVertices
* @param {number} x * @param {number} x
* @param {number} y * @param {number} y
* @param [[vector]] vertexSets * @param {array} vertexSets One or more arrays of vertex points e.g. `[[{ x: 0, y: 0 }...], ...]`.
* @param {object} [options] * @param {object} [options] The body options.
* @param {bool} [flagInternal=false] * @param {bool} [flagInternal=false] Optionally marks internal edges with `isInternal`.
* @param {number} [removeCollinear=0.01] * @param {number} [removeCollinear=0.01] Threshold when simplifying vertices along the same edge.
* @param {number} [minimumArea=10] * @param {number} [minimumArea=10] Threshold when removing small parts.
* @param {number} [removeDuplicatePoints=0.01] Threshold when simplifying nearby vertices.
* @return {body} * @return {body}
*/ */
Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea) { Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea, removeDuplicatePoints) {
if (!decomp) { var decomp = Common.getDecomp(),
decomp = Common._requireGlobal('decomp', 'poly-decomp'); canDecomp,
} body,
var body,
parts, parts,
isConvex, isConvex,
isConcave,
vertices, vertices,
i, i,
j, j,
@ -211,16 +223,16 @@ var decomp;
v, v,
z; z;
// check decomp is as expected
canDecomp = Boolean(decomp && decomp.quickDecomp);
options = options || {}; options = options || {};
parts = []; parts = [];
flagInternal = typeof flagInternal !== 'undefined' ? flagInternal : false; flagInternal = typeof flagInternal !== 'undefined' ? flagInternal : false;
removeCollinear = typeof removeCollinear !== 'undefined' ? removeCollinear : 0.01; removeCollinear = typeof removeCollinear !== 'undefined' ? removeCollinear : 0.01;
minimumArea = typeof minimumArea !== 'undefined' ? minimumArea : 10; minimumArea = typeof minimumArea !== 'undefined' ? minimumArea : 10;
removeDuplicatePoints = typeof removeDuplicatePoints !== 'undefined' ? removeDuplicatePoints : 0.01;
if (!decomp) {
Common.warn('Bodies.fromVertices: poly-decomp.js required. Could not decompose vertices. Fallback to convex hull.');
}
// ensure vertexSets is an array of arrays // ensure vertexSets is an array of arrays
if (!Common.isArray(vertexSets[0])) { if (!Common.isArray(vertexSets[0])) {
@ -230,8 +242,15 @@ var decomp;
for (v = 0; v < vertexSets.length; v += 1) { for (v = 0; v < vertexSets.length; v += 1) {
vertices = vertexSets[v]; vertices = vertexSets[v];
isConvex = Vertices.isConvex(vertices); isConvex = Vertices.isConvex(vertices);
isConcave = !isConvex;
if (isConvex || !decomp) { if (isConcave && !canDecomp) {
Common.warnOnce(
'Bodies.fromVertices: Install the \'poly-decomp\' library and use Common.setDecomp or provide \'decomp\' as a global to decompose concave vertices.'
);
}
if (isConvex || !canDecomp) {
if (isConvex) { if (isConvex) {
vertices = Vertices.clockwiseSort(vertices); vertices = Vertices.clockwiseSort(vertices);
} else { } else {
@ -253,6 +272,8 @@ var decomp;
decomp.makeCCW(concave); decomp.makeCCW(concave);
if (removeCollinear !== false) if (removeCollinear !== false)
decomp.removeCollinearPoints(concave, removeCollinear); decomp.removeCollinearPoints(concave, removeCollinear);
if (removeDuplicatePoints !== false && decomp.removeDuplicatePoints)
decomp.removeDuplicatePoints(concave, removeDuplicatePoints);
// use the quick decomposition algorithm (Bayazit) // use the quick decomposition algorithm (Bayazit)
var decomposed = decomp.quickDecomp(concave); var decomposed = decomp.quickDecomp(concave);
@ -324,6 +345,8 @@ var decomp;
if (parts.length > 1) { if (parts.length > 1) {
// create the parent body to be returned, that contains generated compound parts // create the parent body to be returned, that contains generated compound parts
body = Body.create(Common.extend({ parts: parts.slice(0) }, options)); body = Body.create(Common.extend({ parts: parts.slice(0) }, options));
// offset such that body.position is at the centre off mass
Body.setPosition(body, { x: x, y: y }); Body.setPosition(body, { x: x, y: y });
return body; return body;

View file

@ -16,6 +16,7 @@ var Constraint = require('../constraint/Constraint');
var Common = require('../core/Common'); var Common = require('../core/Common');
var Body = require('../body/Body'); var Body = require('../body/Body');
var Bodies = require('./Bodies'); var Bodies = require('./Bodies');
var deprecated = Common.deprecated;
(function() { (function() {
@ -202,7 +203,8 @@ var Bodies = require('./Bodies');
}; };
/** /**
* Creates a composite with a Newton's Cradle setup of bodies and constraints. * This has now moved to the [newtonsCradle example](https://github.com/liabru/matter-js/blob/master/examples/newtonsCradle.js), follow that instead as this function is deprecated here.
* @deprecated moved to newtonsCradle example
* @method newtonsCradle * @method newtonsCradle
* @param {number} xx * @param {number} xx
* @param {number} yy * @param {number} yy
@ -217,7 +219,7 @@ var Bodies = require('./Bodies');
for (var i = 0; i < number; i++) { for (var i = 0; i < number; i++) {
var separation = 1.9, var separation = 1.9,
circle = Bodies.circle(xx + i * (size * separation), yy + length, size, circle = Bodies.circle(xx + i * (size * separation), yy + length, size,
{ inertia: Infinity, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 1 }), { inertia: Infinity, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 1 }),
constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle }); constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle });
Composite.addBody(newtonsCradle, circle); Composite.addBody(newtonsCradle, circle);
@ -226,9 +228,12 @@ var Bodies = require('./Bodies');
return newtonsCradle; return newtonsCradle;
}; };
deprecated(Composites, 'newtonsCradle', 'Composites.newtonsCradle ➤ moved to newtonsCradle example');
/** /**
* Creates a composite with simple car setup of bodies and constraints. * This has now moved to the [car example](https://github.com/liabru/matter-js/blob/master/examples/car.js), follow that instead as this function is deprecated here.
* @deprecated moved to car example
* @method car * @method car
* @param {number} xx * @param {number} xx
* @param {number} yy * @param {number} yy
@ -294,8 +299,12 @@ var Bodies = require('./Bodies');
return car; return car;
}; };
deprecated(Composites, 'car', 'Composites.car ➤ moved to car example');
/** /**
* Creates a simple soft body like object. * This has now moved to the [softBody example](https://github.com/liabru/matter-js/blob/master/examples/softBody.js)
* and the [cloth example](https://github.com/liabru/matter-js/blob/master/examples/cloth.js), follow those instead as this function is deprecated here.
* @deprecated moved to softBody and cloth examples
* @method softBody * @method softBody
* @param {number} xx * @param {number} xx
* @param {number} yy * @param {number} yy
@ -324,4 +333,5 @@ var Bodies = require('./Bodies');
return softBody; return softBody;
}; };
deprecated(Composites, 'softBody', 'Composites.softBody ➤ moved to softBody and cloth examples');
})(); })();

View file

@ -44,16 +44,9 @@ var Common = require('../core/Common');
y: point.y, y: point.y,
index: i, index: i,
body: body, body: body,
isInternal: false, isInternal: false
contact: null
}; };
vertex.contact = {
vertex: vertex,
normalImpulse: 0,
tangentImpulse: 0
};
vertices.push(vertex); vertices.push(vertex);
} }
@ -70,7 +63,7 @@ var Common = require('../core/Common');
* @return {vertices} vertices * @return {vertices} vertices
*/ */
Vertices.fromPath = function(path, body) { Vertices.fromPath = function(path, body) {
var pathPattern = /L?\s*([\-\d\.e]+)[\s,]*([\-\d\.e]+)*/ig, var pathPattern = /L?\s*([-\d.e]+)[\s,]*([-\d.e]+)*/ig,
points = []; points = [];
path.replace(pathPattern, function(match, x, y) { path.replace(pathPattern, function(match, x, y) {

View file

@ -1,50 +1,34 @@
var Matter = module.exports = require('../core/Matter'); var Matter = module.exports = require('../core/Matter');
Matter.Axes = require('../geometry/Axes');
Matter.Bodies = require('../factory/Bodies');
Matter.Body = require('../body/Body'); Matter.Body = require('../body/Body');
Matter.Composite = require('../body/Composite'); Matter.Bounds = require('../geometry/Bounds');
Matter.World = require('../body/World');
Matter.Detector = require('../collision/Detector');
Matter.Grid = require('../collision/Grid');
Matter.Pairs = require('../collision/Pairs');
Matter.Pair = require('../collision/Pair');
Matter.Query = require('../collision/Query');
Matter.Resolver = require('../collision/Resolver');
Matter.SAT = require('../collision/SAT');
Matter.Constraint = require('../constraint/Constraint');
Matter.MouseConstraint = require('../constraint/MouseConstraint');
Matter.Common = require('../core/Common'); Matter.Common = require('../core/Common');
Matter.Composite = require('../body/Composite');
Matter.Composites = require('../factory/Composites');
Matter.Constraint = require('../constraint/Constraint');
Matter.Contact = require('../collision/Contact');
Matter.Detector = require('../collision/Detector');
Matter.Engine = require('../core/Engine'); Matter.Engine = require('../core/Engine');
Matter.Events = require('../core/Events'); Matter.Events = require('../core/Events');
Matter.Grid = require('../collision/Grid');
Matter.Mouse = require('../core/Mouse'); Matter.Mouse = require('../core/Mouse');
Matter.Runner = require('../core/Runner'); Matter.MouseConstraint = require('../constraint/MouseConstraint');
Matter.Sleeping = require('../core/Sleeping'); Matter.Pair = require('../collision/Pair');
Matter.Pairs = require('../collision/Pairs');
Matter.Plugin = require('../core/Plugin'); Matter.Plugin = require('../core/Plugin');
Matter.Query = require('../collision/Query');
// @if DEBUG Matter.Render = require('../render/Render');
Matter.Metrics = require('../core/Metrics'); Matter.Resolver = require('../collision/Resolver');
// @endif Matter.Runner = require('../core/Runner');
Matter.SAT = require('../collision/SAT');
Matter.Bodies = require('../factory/Bodies'); Matter.Sleeping = require('../core/Sleeping');
Matter.Composites = require('../factory/Composites');
Matter.Axes = require('../geometry/Axes');
Matter.Bounds = require('../geometry/Bounds');
Matter.Svg = require('../geometry/Svg'); Matter.Svg = require('../geometry/Svg');
Matter.Vector = require('../geometry/Vector'); Matter.Vector = require('../geometry/Vector');
Matter.Vertices = require('../geometry/Vertices'); Matter.Vertices = require('../geometry/Vertices');
Matter.World = require('../body/World');
Matter.Render = require('../render/Render'); // temporary back compatibility
Matter.RenderPixi = require('../render/RenderPixi');
// aliases
Matter.World.add = Matter.Composite.add;
Matter.World.remove = Matter.Composite.remove;
Matter.World.addComposite = Matter.Composite.addComposite;
Matter.World.addBody = Matter.Composite.addBody;
Matter.World.addConstraint = Matter.Composite.addConstraint;
Matter.World.clear = Matter.Composite.clear;
Matter.Engine.run = Matter.Runner.run; Matter.Engine.run = Matter.Runner.run;
Matter.Common.deprecated(Matter.Engine, 'run', 'Engine.run ➤ use Matter.Runner.run(engine) instead');

View file

@ -1,5 +1,5 @@
/** /**
* The `Matter.Render` module is a simple HTML5 canvas based renderer for visualising instances of `Matter.Engine`. * The `Matter.Render` module is a simple canvas based renderer for visualising instances of `Matter.Engine`.
* It is intended for development and debugging purposes, but may also be suitable for simple games. * It is intended for development and debugging purposes, but may also be suitable for simple games.
* It includes a number of drawing options including wireframe, vector with support for sprites and viewports. * It includes a number of drawing options including wireframe, vector with support for sprites and viewports.
* *
@ -14,7 +14,6 @@ var Common = require('../core/Common');
var Composite = require('../body/Composite'); var Composite = require('../body/Composite');
var Bounds = require('../geometry/Bounds'); var Bounds = require('../geometry/Bounds');
var Events = require('../core/Events'); var Events = require('../core/Events');
var Grid = require('../collision/Grid');
var Vector = require('../geometry/Vector'); var Vector = require('../geometry/Vector');
var Mouse = require('../core/Mouse'); var Mouse = require('../core/Mouse');
@ -32,6 +31,9 @@ var Mouse = require('../core/Mouse');
|| window.webkitCancelAnimationFrame || window.msCancelAnimationFrame; || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame;
} }
Render._goodFps = 30;
Render._goodDelta = 1000 / 60;
/** /**
* Creates a new renderer. The options parameter is an object that specifies any properties you wish to override the defaults. * Creates a new renderer. The options parameter is an object that specifies any properties you wish to override the defaults.
* All properties have default values, and many are pre-calculated automatically based on other properties. * All properties have default values, and many are pre-calculated automatically based on other properties.
@ -48,17 +50,32 @@ var Mouse = require('../core/Mouse');
canvas: null, canvas: null,
mouse: null, mouse: null,
frameRequestId: null, frameRequestId: null,
timing: {
historySize: 60,
delta: 0,
deltaHistory: [],
lastTime: 0,
lastTimestamp: 0,
lastElapsed: 0,
timestampElapsed: 0,
timestampElapsedHistory: [],
engineDeltaHistory: [],
engineElapsedHistory: [],
elapsedHistory: []
},
options: { options: {
width: 800, width: 800,
height: 600, height: 600,
pixelRatio: 1, pixelRatio: 1,
background: '#18181d', background: '#14151f',
wireframeBackground: '#0f0f13', wireframeBackground: '#14151f',
hasBounds: !!options.bounds, hasBounds: !!options.bounds,
enabled: true, enabled: true,
wireframes: true, wireframes: true,
showSleeping: true, showSleeping: true,
showDebug: false, showDebug: false,
showStats: false,
showPerformance: false,
showBroadphase: false, showBroadphase: false,
showBounds: false, showBounds: false,
showVelocity: false, showVelocity: false,
@ -68,7 +85,6 @@ var Mouse = require('../core/Mouse');
showPositions: false, showPositions: false,
showAngleIndicator: false, showAngleIndicator: false,
showIds: false, showIds: false,
showShadows: false,
showVertexNumbers: false, showVertexNumbers: false,
showConvexHulls: false, showConvexHulls: false,
showInternalEdges: false, showInternalEdges: false,
@ -121,7 +137,18 @@ var Mouse = require('../core/Mouse');
Render.run = function(render) { Render.run = function(render) {
(function loop(time){ (function loop(time){
render.frameRequestId = _requestAnimationFrame(loop); render.frameRequestId = _requestAnimationFrame(loop);
Render.world(render);
_updateTiming(render, time);
Render.world(render, time);
if (render.options.showStats || render.options.showDebug) {
Render.stats(render, render.context, time);
}
if (render.options.showPerformance || render.options.showDebug) {
Render.performance(render, render.context, time);
}
})(); })();
}; };
@ -289,13 +316,16 @@ var Mouse = require('../core/Mouse');
* @method world * @method world
* @param {render} render * @param {render} render
*/ */
Render.world = function(render) { Render.world = function(render, time) {
var engine = render.engine, var startTime = Common.now(),
engine = render.engine,
world = engine.world, world = engine.world,
canvas = render.canvas, canvas = render.canvas,
context = render.context, context = render.context,
options = render.options, options = render.options,
allBodies = Composite.allBodies(world), timing = render.timing;
var allBodies = Composite.allBodies(world),
allConstraints = Composite.allConstraints(world), allConstraints = Composite.allConstraints(world),
background = options.wireframes ? options.wireframeBackground : options.background, background = options.wireframes ? options.wireframeBackground : options.background,
bodies = [], bodies = [],
@ -406,11 +436,8 @@ var Mouse = require('../core/Mouse');
Render.constraints(constraints, context); Render.constraints(constraints, context);
if (options.showBroadphase && engine.broadphase.controller === Grid) if (options.showBroadphase)
Render.grid(render, engine.broadphase, context); Render.grid(render, engine.grid, context);
if (options.showDebug)
Render.debug(render, context);
if (options.hasBounds) { if (options.hasBounds) {
// revert view transforms // revert view transforms
@ -418,72 +445,182 @@ var Mouse = require('../core/Mouse');
} }
Events.trigger(render, 'afterRender', event); Events.trigger(render, 'afterRender', event);
// log the time elapsed computing this update
timing.lastElapsed = Common.now() - startTime;
}; };
/** /**
* Description * Renders statistics about the engine and world useful for debugging.
* @private * @private
* @method debug * @method stats
* @param {render} render
* @param {RenderingContext} context
* @param {Number} time
*/
Render.stats = function(render, context, time) {
var engine = render.engine,
world = engine.world,
bodies = Composite.allBodies(world),
parts = 0,
width = 55,
height = 44,
x = 0,
y = 0;
// count parts
for (var i = 0; i < bodies.length; i += 1) {
parts += bodies[i].parts.length;
}
// sections
var sections = {
'Part': parts,
'Body': bodies.length,
'Cons': Composite.allConstraints(world).length,
'Comp': Composite.allComposites(world).length,
'Pair': engine.pairs.list.length
};
// background
context.fillStyle = '#0e0f19';
context.fillRect(x, y, width * 5.5, height);
context.font = '12px Arial';
context.textBaseline = 'top';
context.textAlign = 'right';
// sections
for (var key in sections) {
var section = sections[key];
// label
context.fillStyle = '#aaa';
context.fillText(key, x + width, y + 8);
// value
context.fillStyle = '#eee';
context.fillText(section, x + width, y + 26);
x += width;
}
};
/**
* Renders engine and render performance information.
* @private
* @method performance
* @param {render} render * @param {render} render
* @param {RenderingContext} context * @param {RenderingContext} context
*/ */
Render.debug = function(render, context) { Render.performance = function(render, context) {
var c = context, var engine = render.engine,
engine = render.engine, timing = render.timing,
world = engine.world, deltaHistory = timing.deltaHistory,
metrics = engine.metrics, elapsedHistory = timing.elapsedHistory,
options = render.options, timestampElapsedHistory = timing.timestampElapsedHistory,
bodies = Composite.allBodies(world), engineDeltaHistory = timing.engineDeltaHistory,
space = " "; engineElapsedHistory = timing.engineElapsedHistory,
lastEngineDelta = engine.timing.lastDelta;
var deltaMean = _mean(deltaHistory),
elapsedMean = _mean(elapsedHistory),
engineDeltaMean = _mean(engineDeltaHistory),
engineElapsedMean = _mean(engineElapsedHistory),
timestampElapsedMean = _mean(timestampElapsedHistory),
rateMean = (timestampElapsedMean / deltaMean) || 0,
fps = (1000 / deltaMean) || 0;
if (engine.timing.timestamp - (render.debugTimestamp || 0) >= 500) { var graphHeight = 4,
var text = ""; gap = 12,
width = 60,
height = 34,
x = 10,
y = 69;
if (metrics.timing) { // background
text += "fps: " + Math.round(metrics.timing.fps) + space; context.fillStyle = '#0e0f19';
} context.fillRect(0, 50, gap * 4 + width * 5 + 22, height);
// @if DEBUG // show FPS
if (metrics.extended) { Render.status(
if (metrics.timing) { context, x, y, width, graphHeight, deltaHistory.length,
text += "delta: " + metrics.timing.delta.toFixed(3) + space; Math.round(fps) + ' fps',
text += "correction: " + metrics.timing.correction.toFixed(3) + space; fps / Render._goodFps,
} function(i) { return (deltaHistory[i] / deltaMean) - 1; }
);
text += "bodies: " + bodies.length + space; // show engine delta
Render.status(
context, x + gap + width, y, width, graphHeight, engineDeltaHistory.length,
lastEngineDelta.toFixed(2) + ' dt',
Render._goodDelta / lastEngineDelta,
function(i) { return (engineDeltaHistory[i] / engineDeltaMean) - 1; }
);
if (engine.broadphase.controller === Grid) // show engine update time
text += "buckets: " + metrics.buckets + space; Render.status(
context, x + (gap + width) * 2, y, width, graphHeight, engineElapsedHistory.length,
engineElapsedMean.toFixed(2) + ' ut',
1 - (engineElapsedMean / Render._goodFps),
function(i) { return (engineElapsedHistory[i] / engineElapsedMean) - 1; }
);
text += "\n"; // show render time
Render.status(
context, x + (gap + width) * 3, y, width, graphHeight, elapsedHistory.length,
elapsedMean.toFixed(2) + ' rt',
1 - (elapsedMean / Render._goodFps),
function(i) { return (elapsedHistory[i] / elapsedMean) - 1; }
);
text += "collisions: " + metrics.collisions + space; // show effective speed
text += "pairs: " + engine.pairs.list.length + space; Render.status(
text += "broad: " + metrics.broadEff + space; context, x + (gap + width) * 4, y, width, graphHeight, timestampElapsedHistory.length,
text += "mid: " + metrics.midEff + space; rateMean.toFixed(2) + ' x',
text += "narrow: " + metrics.narrowEff + space; rateMean * rateMean * rateMean,
} function(i) { return (((timestampElapsedHistory[i] / deltaHistory[i]) / rateMean) || 0) - 1; }
// @endif );
};
render.debugString = text; /**
render.debugTimestamp = engine.timing.timestamp; * Renders a label, indicator and a chart.
* @private
* @method status
* @param {RenderingContext} context
* @param {number} x
* @param {number} y
* @param {number} width
* @param {number} height
* @param {number} count
* @param {string} label
* @param {string} indicator
* @param {function} plotY
*/
Render.status = function(context, x, y, width, height, count, label, indicator, plotY) {
// background
context.strokeStyle = '#888';
context.fillStyle = '#444';
context.lineWidth = 1;
context.fillRect(x, y + 7, width, 1);
// chart
context.beginPath();
context.moveTo(x, y + 7 - height * Common.clamp(0.4 * plotY(0), -2, 2));
for (var i = 0; i < width; i += 1) {
context.lineTo(x + i, y + 7 - (i < count ? height * Common.clamp(0.4 * plotY(i), -2, 2) : 0));
} }
context.stroke();
if (render.debugString) { // indicator
c.font = "12px Arial"; context.fillStyle = 'hsl(' + Common.clamp(25 + 95 * indicator, 0, 120) + ',100%,60%)';
context.fillRect(x, y - 7, 4, 4);
if (options.wireframes) { // label
c.fillStyle = 'rgba(255,255,255,0.5)'; context.font = '12px Arial';
} else { context.textBaseline = 'middle';
c.fillStyle = 'rgba(0,0,0,0.5)'; context.textAlign = 'right';
} context.fillStyle = '#eee';
context.fillText(label, x + width, y - 5);
var split = render.debugString.split('\n');
for (var i = 0; i < split.length; i++) {
c.fillText(split[i], 50, 50 + i * 18);
}
}
}; };
/** /**
@ -563,55 +700,6 @@ var Mouse = require('../core/Mouse');
} }
}; };
/**
* Description
* @private
* @method bodyShadows
* @param {render} render
* @param {body[]} bodies
* @param {RenderingContext} context
*/
Render.bodyShadows = function(render, bodies, context) {
var c = context,
engine = render.engine;
for (var i = 0; i < bodies.length; i++) {
var body = bodies[i];
if (!body.render.visible)
continue;
if (body.circleRadius) {
c.beginPath();
c.arc(body.position.x, body.position.y, body.circleRadius, 0, 2 * Math.PI);
c.closePath();
} else {
c.beginPath();
c.moveTo(body.vertices[0].x, body.vertices[0].y);
for (var j = 1; j < body.vertices.length; j++) {
c.lineTo(body.vertices[j].x, body.vertices[j].y);
}
c.closePath();
}
var distanceX = body.position.x - render.options.width * 0.5,
distanceY = body.position.y - render.options.height * 0.2,
distance = Math.abs(distanceX) + Math.abs(distanceY);
c.shadowColor = 'rgba(0,0,0,0.15)';
c.shadowOffsetX = 0.05 * distanceX;
c.shadowOffsetY = 0.05 * distanceY;
c.shadowBlur = 1 + 12 * Math.min(1, distance / 1000);
c.fill();
c.shadowColor = null;
c.shadowOffsetX = null;
c.shadowOffsetY = null;
c.shadowBlur = null;
}
};
/** /**
* Description * Description
* @private * @private
@ -927,7 +1015,7 @@ var Mouse = require('../core/Mouse');
// render a single axis indicator // render a single axis indicator
c.moveTo(part.position.x, part.position.y); c.moveTo(part.position.x, part.position.y);
c.lineTo((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2, c.lineTo((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2,
(part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2); (part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2);
} }
} }
} }
@ -1227,9 +1315,9 @@ var Mouse = require('../core/Mouse');
var region = bucketId.split(/C|R/); var region = bucketId.split(/C|R/);
c.rect(0.5 + parseInt(region[1], 10) * grid.bucketWidth, c.rect(0.5 + parseInt(region[1], 10) * grid.bucketWidth,
0.5 + parseInt(region[2], 10) * grid.bucketHeight, 0.5 + parseInt(region[2], 10) * grid.bucketHeight,
grid.bucketWidth, grid.bucketWidth,
grid.bucketHeight); grid.bucketHeight);
} }
c.lineWidth = 1; c.lineWidth = 1;
@ -1276,7 +1364,7 @@ var Mouse = require('../core/Mouse');
bounds = item.bounds; bounds = item.bounds;
context.beginPath(); context.beginPath();
context.rect(Math.floor(bounds.min.x - 3), Math.floor(bounds.min.y - 3), context.rect(Math.floor(bounds.min.x - 3), Math.floor(bounds.min.y - 3),
Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6)); Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6));
context.closePath(); context.closePath();
context.stroke(); context.stroke();
@ -1310,7 +1398,7 @@ var Mouse = require('../core/Mouse');
bounds = inspector.selectBounds; bounds = inspector.selectBounds;
context.beginPath(); context.beginPath();
context.rect(Math.floor(bounds.min.x), Math.floor(bounds.min.y), context.rect(Math.floor(bounds.min.x), Math.floor(bounds.min.y),
Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y)); Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y));
context.closePath(); context.closePath();
context.stroke(); context.stroke();
context.fill(); context.fill();
@ -1322,7 +1410,56 @@ var Mouse = require('../core/Mouse');
}; };
/** /**
* Description * Updates render timing.
* @method _updateTiming
* @private
* @param {render} render
* @param {number} time
*/
var _updateTiming = function(render, time) {
var engine = render.engine,
timing = render.timing,
historySize = timing.historySize,
timestamp = engine.timing.timestamp;
timing.delta = time - timing.lastTime || Render._goodDelta;
timing.lastTime = time;
timing.timestampElapsed = timestamp - timing.lastTimestamp || 0;
timing.lastTimestamp = timestamp;
timing.deltaHistory.unshift(timing.delta);
timing.deltaHistory.length = Math.min(timing.deltaHistory.length, historySize);
timing.engineDeltaHistory.unshift(engine.timing.lastDelta);
timing.engineDeltaHistory.length = Math.min(timing.engineDeltaHistory.length, historySize);
timing.timestampElapsedHistory.unshift(timing.timestampElapsed);
timing.timestampElapsedHistory.length = Math.min(timing.timestampElapsedHistory.length, historySize);
timing.engineElapsedHistory.unshift(engine.timing.lastElapsed);
timing.engineElapsedHistory.length = Math.min(timing.engineElapsedHistory.length, historySize);
timing.elapsedHistory.unshift(timing.lastElapsed);
timing.elapsedHistory.length = Math.min(timing.elapsedHistory.length, historySize);
};
/**
* Returns the mean value of the given numbers.
* @method _mean
* @private
* @param {Number[]} values
* @return {Number} the mean of given values
*/
var _mean = function(values) {
var result = 0;
for (var i = 0; i < values.length; i += 1) {
result += values[i];
}
return (result / values.length) || 0;
};
/**
* @method _createCanvas * @method _createCanvas
* @private * @private
* @param {} width * @param {} width
@ -1455,37 +1592,6 @@ var Mouse = require('../core/Mouse');
* @default null * @default null
*/ */
/**
* The configuration options of the renderer.
*
* @property options
* @type {}
*/
/**
* The target width in pixels of the `render.canvas` to be created.
*
* @property options.width
* @type number
* @default 800
*/
/**
* The target height in pixels of the `render.canvas` to be created.
*
* @property options.height
* @type number
* @default 600
*/
/**
* A flag that specifies if `render.bounds` should be used when rendering.
*
* @property options.hasBounds
* @type boolean
* @default false
*/
/** /**
* A `Bounds` object that specifies the drawing view region. * A `Bounds` object that specifies the drawing view region.
* Rendering will be automatically transformed and scaled to fit within the canvas size (`render.options.width` and `render.options.height`). * Rendering will be automatically transformed and scaled to fit within the canvas size (`render.options.width` and `render.options.height`).
@ -1510,4 +1616,254 @@ var Mouse = require('../core/Mouse');
* @type {} * @type {}
*/ */
/**
* The mouse to render if `render.options.showMousePosition` is enabled.
*
* @property mouse
* @type mouse
* @default null
*/
/**
* The configuration options of the renderer.
*
* @property options
* @type {}
*/
/**
* The target width in pixels of the `render.canvas` to be created.
* See also the `options.pixelRatio` property to change render quality.
*
* @property options.width
* @type number
* @default 800
*/
/**
* The target height in pixels of the `render.canvas` to be created.
* See also the `options.pixelRatio` property to change render quality.
*
* @property options.height
* @type number
* @default 600
*/
/**
* The [pixel ratio](https://developer.mozilla.org/en-US/docs/Web/API/Window/devicePixelRatio) to use when rendering.
*
* @property options.pixelRatio
* @type number
* @default 1
*/
/**
* A CSS background color string to use when `render.options.wireframes` is disabled.
* This may be also set to `'transparent'` or equivalent.
*
* @property options.background
* @type string
* @default '#14151f'
*/
/**
* A CSS background color string to use when `render.options.wireframes` is enabled.
* This may be also set to `'transparent'` or equivalent.
*
* @property options.wireframeBackground
* @type string
* @default '#14151f'
*/
/**
* A flag that specifies if `render.bounds` should be used when rendering.
*
* @property options.hasBounds
* @type boolean
* @default false
*/
/**
* A flag to enable or disable all debug information overlays together.
* This includes and has priority over the values of:
*
* - `render.options.showStats`
* - `render.options.showPerformance`
*
* @property options.showDebug
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the engine stats info overlay.
* From left to right, the values shown are:
*
* - body parts total
* - body total
* - constraints total
* - composites total
* - collision pairs total
*
* @property options.showStats
* @type boolean
* @default false
*/
/**
* A flag to enable or disable performance charts.
* From left to right, the values shown are:
*
* - average render frequency (e.g. 60 fps)
* - exact engine delta time used for last update (e.g. 16.66ms)
* - average engine execution duration (e.g. 5.00ms)
* - average render execution duration (e.g. 0.40ms)
* - average effective play speed (e.g. '1.00x' is 'real-time')
*
* Each value is recorded over a fixed sample of past frames (60 frames).
*
* A chart shown below each value indicates the variance from the average over the sample.
* The more stable or fixed the value is the flatter the chart will appear.
*
* @property options.showPerformance
* @type boolean
* @default false
*/
/**
* A flag to enable or disable rendering entirely.
*
* @property options.enabled
* @type boolean
* @default false
*/
/**
* A flag to toggle wireframe rendering otherwise solid fill rendering is used.
*
* @property options.wireframes
* @type boolean
* @default true
*/
/**
* A flag to enable or disable sleeping bodies indicators.
*
* @property options.showSleeping
* @type boolean
* @default true
*/
/**
* A flag to enable or disable the debug information overlay.
*
* @property options.showDebug
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the collision broadphase debug overlay.
*
* @property options.showBroadphase
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body bounds debug overlay.
*
* @property options.showBounds
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body velocity debug overlay.
*
* @property options.showVelocity
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body collisions debug overlay.
*
* @property options.showCollisions
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the collision resolver separations debug overlay.
*
* @property options.showSeparations
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body axes debug overlay.
*
* @property options.showAxes
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body positions debug overlay.
*
* @property options.showPositions
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body angle debug overlay.
*
* @property options.showAngleIndicator
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body and part ids debug overlay.
*
* @property options.showIds
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body vertex numbers debug overlay.
*
* @property options.showVertexNumbers
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body convex hulls debug overlay.
*
* @property options.showConvexHulls
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the body internal edges debug overlay.
*
* @property options.showInternalEdges
* @type boolean
* @default false
*/
/**
* A flag to enable or disable the mouse position debug overlay.
*
* @property options.showMousePosition
* @type boolean
* @default false
*/
})(); })();

View file

@ -1,515 +0,0 @@
/**
* The `Matter.RenderPixi` module is an example renderer using pixi.js.
* See also `Matter.Render` for a canvas based renderer.
*
* @class RenderPixi
* @deprecated the Matter.RenderPixi module will soon be removed from the Matter.js core.
* It will likely be moved to its own repository (but maintenance will be limited).
*/
var RenderPixi = {};
module.exports = RenderPixi;
var Bounds = require('../geometry/Bounds');
var Composite = require('../body/Composite');
var Common = require('../core/Common');
var Events = require('../core/Events');
var Vector = require('../geometry/Vector');
(function() {
var _requestAnimationFrame,
_cancelAnimationFrame;
if (typeof window !== 'undefined') {
_requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame
|| window.mozRequestAnimationFrame || window.msRequestAnimationFrame
|| function(callback){ window.setTimeout(function() { callback(Common.now()); }, 1000 / 60); };
_cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame
|| window.webkitCancelAnimationFrame || window.msCancelAnimationFrame;
}
/**
* Creates a new Pixi.js WebGL renderer
* @method create
* @param {object} options
* @return {RenderPixi} A new renderer
* @deprecated
*/
RenderPixi.create = function(options) {
Common.warn('RenderPixi.create: Matter.RenderPixi is deprecated (see docs)');
var defaults = {
controller: RenderPixi,
engine: null,
element: null,
frameRequestId: null,
canvas: null,
renderer: null,
container: null,
spriteContainer: null,
pixiOptions: null,
options: {
width: 800,
height: 600,
background: '#fafafa',
wireframeBackground: '#222',
hasBounds: false,
enabled: true,
wireframes: true,
showSleeping: true,
showDebug: false,
showBroadphase: false,
showBounds: false,
showVelocity: false,
showCollisions: false,
showAxes: false,
showPositions: false,
showAngleIndicator: false,
showIds: false,
showShadows: false
}
};
var render = Common.extend(defaults, options),
transparent = !render.options.wireframes && render.options.background === 'transparent';
// init pixi
render.pixiOptions = render.pixiOptions || {
view: render.canvas,
transparent: transparent,
antialias: true,
backgroundColor: options.background
};
render.mouse = options.mouse;
render.engine = options.engine;
render.renderer = render.renderer || new PIXI.WebGLRenderer(render.options.width, render.options.height, render.pixiOptions);
render.container = render.container || new PIXI.Container();
render.spriteContainer = render.spriteContainer || new PIXI.Container();
render.canvas = render.canvas || render.renderer.view;
render.bounds = render.bounds || {
min: {
x: 0,
y: 0
},
max: {
x: render.options.width,
y: render.options.height
}
};
// event listeners
Events.on(render.engine, 'beforeUpdate', function() {
RenderPixi.clear(render);
});
// caches
render.textures = {};
render.sprites = {};
render.primitives = {};
// use a sprite batch for performance
render.container.addChild(render.spriteContainer);
// insert canvas
if (Common.isElement(render.element)) {
render.element.appendChild(render.canvas);
} else {
Common.warn('No "render.element" passed, "render.canvas" was not inserted into document.');
}
// prevent menus on canvas
render.canvas.oncontextmenu = function() { return false; };
render.canvas.onselectstart = function() { return false; };
return render;
};
/**
* Continuously updates the render canvas on the `requestAnimationFrame` event.
* @method run
* @param {render} render
* @deprecated
*/
RenderPixi.run = function(render) {
(function loop(time){
render.frameRequestId = _requestAnimationFrame(loop);
RenderPixi.world(render);
})();
};
/**
* Ends execution of `Render.run` on the given `render`, by canceling the animation frame request event loop.
* @method stop
* @param {render} render
* @deprecated
*/
RenderPixi.stop = function(render) {
_cancelAnimationFrame(render.frameRequestId);
};
/**
* Clears the scene graph
* @method clear
* @param {RenderPixi} render
* @deprecated
*/
RenderPixi.clear = function(render) {
var container = render.container,
spriteContainer = render.spriteContainer;
// clear stage container
while (container.children[0]) {
container.removeChild(container.children[0]);
}
// clear sprite batch
while (spriteContainer.children[0]) {
spriteContainer.removeChild(spriteContainer.children[0]);
}
var bgSprite = render.sprites['bg-0'];
// clear caches
render.textures = {};
render.sprites = {};
render.primitives = {};
// set background sprite
render.sprites['bg-0'] = bgSprite;
if (bgSprite)
container.addChildAt(bgSprite, 0);
// add sprite batch back into container
render.container.addChild(render.spriteContainer);
// reset background state
render.currentBackground = null;
// reset bounds transforms
container.scale.set(1, 1);
container.position.set(0, 0);
};
/**
* Sets the background of the canvas
* @method setBackground
* @param {RenderPixi} render
* @param {string} background
* @deprecated
*/
RenderPixi.setBackground = function(render, background) {
if (render.currentBackground !== background) {
var isColor = background.indexOf && background.indexOf('#') !== -1,
bgSprite = render.sprites['bg-0'];
if (isColor) {
// if solid background color
var color = Common.colorToNumber(background);
render.renderer.backgroundColor = color;
// remove background sprite if existing
if (bgSprite)
render.container.removeChild(bgSprite);
} else {
// initialise background sprite if needed
if (!bgSprite) {
var texture = _getTexture(render, background);
bgSprite = render.sprites['bg-0'] = new PIXI.Sprite(texture);
bgSprite.position.x = 0;
bgSprite.position.y = 0;
render.container.addChildAt(bgSprite, 0);
}
}
render.currentBackground = background;
}
};
/**
* Description
* @method world
* @param {engine} engine
* @deprecated
*/
RenderPixi.world = function(render) {
var engine = render.engine,
world = engine.world,
renderer = render.renderer,
container = render.container,
options = render.options,
bodies = Composite.allBodies(world),
allConstraints = Composite.allConstraints(world),
constraints = [],
i;
if (options.wireframes) {
RenderPixi.setBackground(render, options.wireframeBackground);
} else {
RenderPixi.setBackground(render, options.background);
}
// handle bounds
var boundsWidth = render.bounds.max.x - render.bounds.min.x,
boundsHeight = render.bounds.max.y - render.bounds.min.y,
boundsScaleX = boundsWidth / render.options.width,
boundsScaleY = boundsHeight / render.options.height;
if (options.hasBounds) {
// Hide bodies that are not in view
for (i = 0; i < bodies.length; i++) {
var body = bodies[i];
body.render.sprite.visible = Bounds.overlaps(body.bounds, render.bounds);
}
// filter out constraints that are not in view
for (i = 0; i < allConstraints.length; i++) {
var constraint = allConstraints[i],
bodyA = constraint.bodyA,
bodyB = constraint.bodyB,
pointAWorld = constraint.pointA,
pointBWorld = constraint.pointB;
if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA);
if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB);
if (!pointAWorld || !pointBWorld)
continue;
if (Bounds.contains(render.bounds, pointAWorld) || Bounds.contains(render.bounds, pointBWorld))
constraints.push(constraint);
}
// transform the view
container.scale.set(1 / boundsScaleX, 1 / boundsScaleY);
container.position.set(-render.bounds.min.x * (1 / boundsScaleX), -render.bounds.min.y * (1 / boundsScaleY));
} else {
constraints = allConstraints;
}
for (i = 0; i < bodies.length; i++)
RenderPixi.body(render, bodies[i]);
for (i = 0; i < constraints.length; i++)
RenderPixi.constraint(render, constraints[i]);
renderer.render(container);
};
/**
* Description
* @method constraint
* @param {engine} engine
* @param {constraint} constraint
* @deprecated
*/
RenderPixi.constraint = function(render, constraint) {
var engine = render.engine,
bodyA = constraint.bodyA,
bodyB = constraint.bodyB,
pointA = constraint.pointA,
pointB = constraint.pointB,
container = render.container,
constraintRender = constraint.render,
primitiveId = 'c-' + constraint.id,
primitive = render.primitives[primitiveId];
// initialise constraint primitive if not existing
if (!primitive)
primitive = render.primitives[primitiveId] = new PIXI.Graphics();
// don't render if constraint does not have two end points
if (!constraintRender.visible || !constraint.pointA || !constraint.pointB) {
primitive.clear();
return;
}
// add to scene graph if not already there
if (Common.indexOf(container.children, primitive) === -1)
container.addChild(primitive);
// render the constraint on every update, since they can change dynamically
primitive.clear();
primitive.beginFill(0, 0);
primitive.lineStyle(constraintRender.lineWidth, Common.colorToNumber(constraintRender.strokeStyle), 1);
if (bodyA) {
primitive.moveTo(bodyA.position.x + pointA.x, bodyA.position.y + pointA.y);
} else {
primitive.moveTo(pointA.x, pointA.y);
}
if (bodyB) {
primitive.lineTo(bodyB.position.x + pointB.x, bodyB.position.y + pointB.y);
} else {
primitive.lineTo(pointB.x, pointB.y);
}
primitive.endFill();
};
/**
* Description
* @method body
* @param {engine} engine
* @param {body} body
* @deprecated
*/
RenderPixi.body = function(render, body) {
var engine = render.engine,
bodyRender = body.render;
if (!bodyRender.visible)
return;
if (bodyRender.sprite && bodyRender.sprite.texture) {
var spriteId = 'b-' + body.id,
sprite = render.sprites[spriteId],
spriteContainer = render.spriteContainer;
// initialise body sprite if not existing
if (!sprite)
sprite = render.sprites[spriteId] = _createBodySprite(render, body);
// add to scene graph if not already there
if (Common.indexOf(spriteContainer.children, sprite) === -1)
spriteContainer.addChild(sprite);
// update body sprite
sprite.position.x = body.position.x;
sprite.position.y = body.position.y;
sprite.rotation = body.angle;
sprite.scale.x = bodyRender.sprite.xScale || 1;
sprite.scale.y = bodyRender.sprite.yScale || 1;
} else {
var primitiveId = 'b-' + body.id,
primitive = render.primitives[primitiveId],
container = render.container;
// initialise body primitive if not existing
if (!primitive) {
primitive = render.primitives[primitiveId] = _createBodyPrimitive(render, body);
primitive.initialAngle = body.angle;
}
// add to scene graph if not already there
if (Common.indexOf(container.children, primitive) === -1)
container.addChild(primitive);
// update body primitive
primitive.position.x = body.position.x;
primitive.position.y = body.position.y;
primitive.rotation = body.angle - primitive.initialAngle;
}
};
/**
* Creates a body sprite
* @method _createBodySprite
* @private
* @param {RenderPixi} render
* @param {body} body
* @return {PIXI.Sprite} sprite
* @deprecated
*/
var _createBodySprite = function(render, body) {
var bodyRender = body.render,
texturePath = bodyRender.sprite.texture,
texture = _getTexture(render, texturePath),
sprite = new PIXI.Sprite(texture);
sprite.anchor.x = body.render.sprite.xOffset;
sprite.anchor.y = body.render.sprite.yOffset;
return sprite;
};
/**
* Creates a body primitive
* @method _createBodyPrimitive
* @private
* @param {RenderPixi} render
* @param {body} body
* @return {PIXI.Graphics} graphics
* @deprecated
*/
var _createBodyPrimitive = function(render, body) {
var bodyRender = body.render,
options = render.options,
primitive = new PIXI.Graphics(),
fillStyle = Common.colorToNumber(bodyRender.fillStyle),
strokeStyle = Common.colorToNumber(bodyRender.strokeStyle),
strokeStyleIndicator = Common.colorToNumber(bodyRender.strokeStyle),
strokeStyleWireframe = Common.colorToNumber('#bbb'),
strokeStyleWireframeIndicator = Common.colorToNumber('#CD5C5C'),
part;
primitive.clear();
// handle compound parts
for (var k = body.parts.length > 1 ? 1 : 0; k < body.parts.length; k++) {
part = body.parts[k];
if (!options.wireframes) {
primitive.beginFill(fillStyle, 1);
primitive.lineStyle(bodyRender.lineWidth, strokeStyle, 1);
} else {
primitive.beginFill(0, 0);
primitive.lineStyle(1, strokeStyleWireframe, 1);
}
primitive.moveTo(part.vertices[0].x - body.position.x, part.vertices[0].y - body.position.y);
for (var j = 1; j < part.vertices.length; j++) {
primitive.lineTo(part.vertices[j].x - body.position.x, part.vertices[j].y - body.position.y);
}
primitive.lineTo(part.vertices[0].x - body.position.x, part.vertices[0].y - body.position.y);
primitive.endFill();
// angle indicator
if (options.showAngleIndicator || options.showAxes) {
primitive.beginFill(0, 0);
if (options.wireframes) {
primitive.lineStyle(1, strokeStyleWireframeIndicator, 1);
} else {
primitive.lineStyle(1, strokeStyleIndicator);
}
primitive.moveTo(part.position.x - body.position.x, part.position.y - body.position.y);
primitive.lineTo(((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2 - body.position.x),
((part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2 - body.position.y));
primitive.endFill();
}
}
return primitive;
};
/**
* Gets the requested texture (a PIXI.Texture) via its path
* @method _getTexture
* @private
* @param {RenderPixi} render
* @param {string} imagePath
* @return {PIXI.Texture} texture
* @deprecated
*/
var _getTexture = function(render, imagePath) {
var texture = render.textures[imagePath];
if (!texture)
texture = render.textures[imagePath] = PIXI.Texture.fromImage(imagePath);
return texture;
};
})();

114
test/Browser.spec.js Normal file
View file

@ -0,0 +1,114 @@
/* eslint-env es6 */
"use strict";
jest.setTimeout(120 * 1000);
const puppeteer = require('puppeteer-core');
const Example = require('../examples/index');
const fs = require('fs');
const examples = Object.keys(Example);
const browserPath = '/Applications/Google\ Chrome.app/Contents/MacOS/Google\ Chrome';
const demoPagePath = 'http://localhost:8000/';
const totalUpdates = 5;
if (!fs.existsSync(browserPath)) {
// Skip if browser is missing
console.warn('Could not find browser. Browser tests skipped.');
describe.skip('Browser integration tests');
} else {
describe('Browser integration tests', () => {
let results;
// Set up the environment and run examples
beforeAll(async () => results = await runExamplesBrowser(totalUpdates));
it('all examples run without throwing error or warning', () => {
if (results.error) {
console.error(results.error);
expect(Boolean(results.error)).toBe(false);
}
if (results.warns) {
console.error(results.warns);
expect(results.warns.size).toBe(0);
}
if (!results.error && !results.warns) {
for (const example of examples) {
expect(results[example].id).toBe(example);
expect(results[example].timestamp).toBeGreaterThan(0);
}
}
});
});
}
const runExamplesBrowser = async updates => {
// Set up browser environment
const browser = await puppeteer.launch({ executablePath: browserPath });
const page = await browser.newPage();
const results = {};
let example;
// Load local demo page and catch errors
let pageError;
let pageWarns;
const onPageError = error => pageError = error;
const onPageConsole = async message => {
const type = message.type();
if (example && type === 'error' || type === 'warning') {
const log = `[${example}] ${message.type()} ${message.text()}`;
pageWarns = pageWarns || new Set();
pageWarns.add(log);
}
}
page.addListener('pageerror', onPageError);
page.addListener('console', onPageConsole);
await page.goto(demoPagePath).catch(onPageError);
// For every example
for (example of examples) {
// Bail on error
if (pageError) {
break;
}
// In the demo page context
results[example] = await page.evaluate(async (example, updates) => {
const demo = window.MatterDemoInstance;
// Set the current example
MatterTools.Demo.setExampleById(demo, example);
const instance = demo.example.instance;
let ticks = 0;
// Wait while running
await new Promise((resolve) => {
Matter.Events.on(instance.runner, 'tick', () => {
// Stop after enough updates
if (ticks >= updates) {
Matter.Runner.stop(instance.runner);
resolve();
}
ticks += 1;
});
});
// Return results
return {
id: demo.example.id,
timestamp: instance.engine.timing.timestamp
};
}, example, updates);
}
// Tear down
await browser.close();
results.error = pageError;
results.warns = pageWarns;
return results;
};

Some files were not shown because too many files have changed in this diff Show more